--- /dev/null
+meta.foundation-version {
+ font-family: "/5.1.0/"; }
+
+meta.foundation-mq-small {
+ font-family: "/only screen and (max-width: 40em)/";
+ width: 0em; }
+
+meta.foundation-mq-medium {
+ font-family: "/only screen and (min-width:40.063em)/";
+ width: 40.063em; }
+
+meta.foundation-mq-large {
+ font-family: "/only screen and (min-width:64.063em)/";
+ width: 64.063em; }
+
+meta.foundation-mq-xlarge {
+ font-family: "/only screen and (min-width:90.063em)/";
+ width: 90.063em; }
+
+meta.foundation-mq-xxlarge {
+ font-family: "/only screen and (min-width:120.063em)/";
+ width: 120.063em; }
+
+meta.foundation-data-attribute-namespace {
+ font-family: false; }
+
+html, body {
+ height: 100%; }
+
+*, *:before, *:after {
+ -moz-box-sizing: border-box;
+ -webkit-box-sizing: border-box;
+ box-sizing: border-box; }
+
+html, body {
+ font-size: 100%; }
+
+body {
+ background: white;
+ color: #222222;
+ padding: 0;
+ margin: 0;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif;
+ font-weight: normal;
+ font-style: normal;
+ line-height: 1;
+ position: relative;
+ cursor: default; }
+
+a:hover {
+ cursor: pointer; }
+
+img, object, embed {
+ max-width: 100%;
+ height: auto; }
+
+object, embed {
+ height: 100%; }
+
+img {
+ -ms-interpolation-mode: bicubic; }
+
+#map_canvas img, #map_canvas embed, #map_canvas object, .map_canvas img, .map_canvas embed, .map_canvas object {
+ max-width: none !important; }
+
+.left {
+ float: left !important; }
+
+.right {
+ float: right !important; }
+
+.clearfix {
+ *zoom: 1; }
+ .clearfix:before, .clearfix:after {
+ content: " ";
+ display: table; }
+ .clearfix:after {
+ clear: both; }
+
+.hide {
+ display: none; }
+
+.antialiased {
+ -webkit-font-smoothing: antialiased;
+ -moz-osx-font-smoothing: grayscale; }
+
+img {
+ display: inline-block;
+ vertical-align: middle; }
+
+textarea {
+ height: auto;
+ min-height: 50px; }
+
+select {
+ width: 100%; }
+
+.row {
+ width: 100%;
+ margin-left: auto;
+ margin-right: auto;
+ margin-top: 0;
+ margin-bottom: 0;
+ max-width: 62.5rem;
+ *zoom: 1; }
+ .row:before, .row:after {
+ content: " ";
+ display: table; }
+ .row:after {
+ clear: both; }
+ .row.collapse > .column, .row.collapse > .columns {
+ padding-left: 0;
+ padding-right: 0;
+ float: left; }
+ .row.collapse .row {
+ margin-left: 0;
+ margin-right: 0; }
+ .row .row {
+ width: auto;
+ margin-left: -0.9375rem;
+ margin-right: -0.9375rem;
+ margin-top: 0;
+ margin-bottom: 0;
+ max-width: none;
+ *zoom: 1; }
+ .row .row:before, .row .row:after {
+ content: " ";
+ display: table; }
+ .row .row:after {
+ clear: both; }
+ .row .row.collapse {
+ width: auto;
+ margin: 0;
+ max-width: none;
+ *zoom: 1; }
+ .row .row.collapse:before, .row .row.collapse:after {
+ content: " ";
+ display: table; }
+ .row .row.collapse:after {
+ clear: both; }
+
+.column, .columns {
+ padding-left: 0.9375rem;
+ padding-right: 0.9375rem;
+ width: 100%;
+ float: left; }
+
+@media only screen {
+ .column.small-centered, .columns.small-centered {
+ margin-left: auto;
+ margin-right: auto;
+ float: none; }
+ .column.small-uncentered, .columns.small-uncentered {
+ margin-left: 0;
+ margin-right: 0;
+ float: left; }
+ .column.small-uncentered.opposite, .columns.small-uncentered.opposite {
+ float: right; }
+ .small-push-0 {
+ left: 0%;
+ right: auto; }
+ .small-pull-0 {
+ right: 0%;
+ left: auto; }
+ .small-push-1 {
+ left: 8.33333%;
+ right: auto; }
+ .small-pull-1 {
+ right: 8.33333%;
+ left: auto; }
+ .small-push-2 {
+ left: 16.66667%;
+ right: auto; }
+ .small-pull-2 {
+ right: 16.66667%;
+ left: auto; }
+ .small-push-3 {
+ left: 25%;
+ right: auto; }
+ .small-pull-3 {
+ right: 25%;
+ left: auto; }
+ .small-push-4 {
+ left: 33.33333%;
+ right: auto; }
+ .small-pull-4 {
+ right: 33.33333%;
+ left: auto; }
+ .small-push-5 {
+ left: 41.66667%;
+ right: auto; }
+ .small-pull-5 {
+ right: 41.66667%;
+ left: auto; }
+ .small-push-6 {
+ left: 50%;
+ right: auto; }
+ .small-pull-6 {
+ right: 50%;
+ left: auto; }
+ .small-push-7 {
+ left: 58.33333%;
+ right: auto; }
+ .small-pull-7 {
+ right: 58.33333%;
+ left: auto; }
+ .small-push-8 {
+ left: 66.66667%;
+ right: auto; }
+ .small-pull-8 {
+ right: 66.66667%;
+ left: auto; }
+ .small-push-9 {
+ left: 75%;
+ right: auto; }
+ .small-pull-9 {
+ right: 75%;
+ left: auto; }
+ .small-push-10 {
+ left: 83.33333%;
+ right: auto; }
+ .small-pull-10 {
+ right: 83.33333%;
+ left: auto; }
+ .small-push-11 {
+ left: 91.66667%;
+ right: auto; }
+ .small-pull-11 {
+ right: 91.66667%;
+ left: auto; }
+ .column, .columns {
+ position: relative;
+ padding-left: 0.9375rem;
+ padding-right: 0.9375rem;
+ float: left; }
+ .small-1 {
+ width: 8.33333%; }
+ .small-2 {
+ width: 16.66667%; }
+ .small-3 {
+ width: 25%; }
+ .small-4 {
+ width: 33.33333%; }
+ .small-5 {
+ width: 41.66667%; }
+ .small-6 {
+ width: 50%; }
+ .small-7 {
+ width: 58.33333%; }
+ .small-8 {
+ width: 66.66667%; }
+ .small-9 {
+ width: 75%; }
+ .small-10 {
+ width: 83.33333%; }
+ .small-11 {
+ width: 91.66667%; }
+ .small-12 {
+ width: 100%; }
+ [class*="column"] + [class*="column"]:last-child {
+ float: right; }
+ [class*="column"] + [class*="column"].end {
+ float: left; }
+ .small-offset-0 {
+ margin-left: 0% !important; }
+ .small-offset-1 {
+ margin-left: 8.33333% !important; }
+ .small-offset-2 {
+ margin-left: 16.66667% !important; }
+ .small-offset-3 {
+ margin-left: 25% !important; }
+ .small-offset-4 {
+ margin-left: 33.33333% !important; }
+ .small-offset-5 {
+ margin-left: 41.66667% !important; }
+ .small-offset-6 {
+ margin-left: 50% !important; }
+ .small-offset-7 {
+ margin-left: 58.33333% !important; }
+ .small-offset-8 {
+ margin-left: 66.66667% !important; }
+ .small-offset-9 {
+ margin-left: 75% !important; }
+ .small-offset-10 {
+ margin-left: 83.33333% !important; }
+ .small-offset-11 {
+ margin-left: 91.66667% !important; }
+ .small-reset-order, .small-reset-order {
+ margin-left: 0;
+ margin-right: 0;
+ left: auto;
+ right: auto;
+ float: left; } }
+
+@media only screen and (min-width:40.063em) {
+ .column.medium-centered, .columns.medium-centered {
+ margin-left: auto;
+ margin-right: auto;
+ float: none; }
+ .column.medium-uncentered, .columns.medium-uncentered {
+ margin-left: 0;
+ margin-right: 0;
+ float: left; }
+ .column.medium-uncentered.opposite, .columns.medium-uncentered.opposite {
+ float: right; }
+ .medium-push-0 {
+ left: 0%;
+ right: auto; }
+ .medium-pull-0 {
+ right: 0%;
+ left: auto; }
+ .medium-push-1 {
+ left: 8.33333%;
+ right: auto; }
+ .medium-pull-1 {
+ right: 8.33333%;
+ left: auto; }
+ .medium-push-2 {
+ left: 16.66667%;
+ right: auto; }
+ .medium-pull-2 {
+ right: 16.66667%;
+ left: auto; }
+ .medium-push-3 {
+ left: 25%;
+ right: auto; }
+ .medium-pull-3 {
+ right: 25%;
+ left: auto; }
+ .medium-push-4 {
+ left: 33.33333%;
+ right: auto; }
+ .medium-pull-4 {
+ right: 33.33333%;
+ left: auto; }
+ .medium-push-5 {
+ left: 41.66667%;
+ right: auto; }
+ .medium-pull-5 {
+ right: 41.66667%;
+ left: auto; }
+ .medium-push-6 {
+ left: 50%;
+ right: auto; }
+ .medium-pull-6 {
+ right: 50%;
+ left: auto; }
+ .medium-push-7 {
+ left: 58.33333%;
+ right: auto; }
+ .medium-pull-7 {
+ right: 58.33333%;
+ left: auto; }
+ .medium-push-8 {
+ left: 66.66667%;
+ right: auto; }
+ .medium-pull-8 {
+ right: 66.66667%;
+ left: auto; }
+ .medium-push-9 {
+ left: 75%;
+ right: auto; }
+ .medium-pull-9 {
+ right: 75%;
+ left: auto; }
+ .medium-push-10 {
+ left: 83.33333%;
+ right: auto; }
+ .medium-pull-10 {
+ right: 83.33333%;
+ left: auto; }
+ .medium-push-11 {
+ left: 91.66667%;
+ right: auto; }
+ .medium-pull-11 {
+ right: 91.66667%;
+ left: auto; }
+ .column, .columns {
+ position: relative;
+ padding-left: 0.9375rem;
+ padding-right: 0.9375rem;
+ float: left; }
+ .medium-1 {
+ width: 8.33333%; }
+ .medium-2 {
+ width: 16.66667%; }
+ .medium-3 {
+ width: 25%; }
+ .medium-4 {
+ width: 33.33333%; }
+ .medium-5 {
+ width: 41.66667%; }
+ .medium-6 {
+ width: 50%; }
+ .medium-7 {
+ width: 58.33333%; }
+ .medium-8 {
+ width: 66.66667%; }
+ .medium-9 {
+ width: 75%; }
+ .medium-10 {
+ width: 83.33333%; }
+ .medium-11 {
+ width: 91.66667%; }
+ .medium-12 {
+ width: 100%; }
+ [class*="column"] + [class*="column"]:last-child {
+ float: right; }
+ [class*="column"] + [class*="column"].end {
+ float: left; }
+ .medium-offset-0 {
+ margin-left: 0% !important; }
+ .medium-offset-1 {
+ margin-left: 8.33333% !important; }
+ .medium-offset-2 {
+ margin-left: 16.66667% !important; }
+ .medium-offset-3 {
+ margin-left: 25% !important; }
+ .medium-offset-4 {
+ margin-left: 33.33333% !important; }
+ .medium-offset-5 {
+ margin-left: 41.66667% !important; }
+ .medium-offset-6 {
+ margin-left: 50% !important; }
+ .medium-offset-7 {
+ margin-left: 58.33333% !important; }
+ .medium-offset-8 {
+ margin-left: 66.66667% !important; }
+ .medium-offset-9 {
+ margin-left: 75% !important; }
+ .medium-offset-10 {
+ margin-left: 83.33333% !important; }
+ .medium-offset-11 {
+ margin-left: 91.66667% !important; }
+ .medium-reset-order, .medium-reset-order {
+ margin-left: 0;
+ margin-right: 0;
+ left: auto;
+ right: auto;
+ float: left; }
+ .push-0 {
+ left: 0%;
+ right: auto; }
+ .pull-0 {
+ right: 0%;
+ left: auto; }
+ .push-1 {
+ left: 8.33333%;
+ right: auto; }
+ .pull-1 {
+ right: 8.33333%;
+ left: auto; }
+ .push-2 {
+ left: 16.66667%;
+ right: auto; }
+ .pull-2 {
+ right: 16.66667%;
+ left: auto; }
+ .push-3 {
+ left: 25%;
+ right: auto; }
+ .pull-3 {
+ right: 25%;
+ left: auto; }
+ .push-4 {
+ left: 33.33333%;
+ right: auto; }
+ .pull-4 {
+ right: 33.33333%;
+ left: auto; }
+ .push-5 {
+ left: 41.66667%;
+ right: auto; }
+ .pull-5 {
+ right: 41.66667%;
+ left: auto; }
+ .push-6 {
+ left: 50%;
+ right: auto; }
+ .pull-6 {
+ right: 50%;
+ left: auto; }
+ .push-7 {
+ left: 58.33333%;
+ right: auto; }
+ .pull-7 {
+ right: 58.33333%;
+ left: auto; }
+ .push-8 {
+ left: 66.66667%;
+ right: auto; }
+ .pull-8 {
+ right: 66.66667%;
+ left: auto; }
+ .push-9 {
+ left: 75%;
+ right: auto; }
+ .pull-9 {
+ right: 75%;
+ left: auto; }
+ .push-10 {
+ left: 83.33333%;
+ right: auto; }
+ .pull-10 {
+ right: 83.33333%;
+ left: auto; }
+ .push-11 {
+ left: 91.66667%;
+ right: auto; }
+ .pull-11 {
+ right: 91.66667%;
+ left: auto; } }
+
+@media only screen and (min-width:64.063em) {
+ .column.large-centered, .columns.large-centered {
+ margin-left: auto;
+ margin-right: auto;
+ float: none; }
+ .column.large-uncentered, .columns.large-uncentered {
+ margin-left: 0;
+ margin-right: 0;
+ float: left; }
+ .column.large-uncentered.opposite, .columns.large-uncentered.opposite {
+ float: right; }
+ .large-push-0 {
+ left: 0%;
+ right: auto; }
+ .large-pull-0 {
+ right: 0%;
+ left: auto; }
+ .large-push-1 {
+ left: 8.33333%;
+ right: auto; }
+ .large-pull-1 {
+ right: 8.33333%;
+ left: auto; }
+ .large-push-2 {
+ left: 16.66667%;
+ right: auto; }
+ .large-pull-2 {
+ right: 16.66667%;
+ left: auto; }
+ .large-push-3 {
+ left: 25%;
+ right: auto; }
+ .large-pull-3 {
+ right: 25%;
+ left: auto; }
+ .large-push-4 {
+ left: 33.33333%;
+ right: auto; }
+ .large-pull-4 {
+ right: 33.33333%;
+ left: auto; }
+ .large-push-5 {
+ left: 41.66667%;
+ right: auto; }
+ .large-pull-5 {
+ right: 41.66667%;
+ left: auto; }
+ .large-push-6 {
+ left: 50%;
+ right: auto; }
+ .large-pull-6 {
+ right: 50%;
+ left: auto; }
+ .large-push-7 {
+ left: 58.33333%;
+ right: auto; }
+ .large-pull-7 {
+ right: 58.33333%;
+ left: auto; }
+ .large-push-8 {
+ left: 66.66667%;
+ right: auto; }
+ .large-pull-8 {
+ right: 66.66667%;
+ left: auto; }
+ .large-push-9 {
+ left: 75%;
+ right: auto; }
+ .large-pull-9 {
+ right: 75%;
+ left: auto; }
+ .large-push-10 {
+ left: 83.33333%;
+ right: auto; }
+ .large-pull-10 {
+ right: 83.33333%;
+ left: auto; }
+ .large-push-11 {
+ left: 91.66667%;
+ right: auto; }
+ .large-pull-11 {
+ right: 91.66667%;
+ left: auto; }
+ .column, .columns {
+ position: relative;
+ padding-left: 0.9375rem;
+ padding-right: 0.9375rem;
+ float: left; }
+ .large-1 {
+ width: 8.33333%; }
+ .large-2 {
+ width: 16.66667%; }
+ .large-3 {
+ width: 25%; }
+ .large-4 {
+ width: 33.33333%; }
+ .large-5 {
+ width: 41.66667%; }
+ .large-6 {
+ width: 50%; }
+ .large-7 {
+ width: 58.33333%; }
+ .large-8 {
+ width: 66.66667%; }
+ .large-9 {
+ width: 75%; }
+ .large-10 {
+ width: 83.33333%; }
+ .large-11 {
+ width: 91.66667%; }
+ .large-12 {
+ width: 100%; }
+ [class*="column"] + [class*="column"]:last-child {
+ float: right; }
+ [class*="column"] + [class*="column"].end {
+ float: left; }
+ .large-offset-0 {
+ margin-left: 0% !important; }
+ .large-offset-1 {
+ margin-left: 8.33333% !important; }
+ .large-offset-2 {
+ margin-left: 16.66667% !important; }
+ .large-offset-3 {
+ margin-left: 25% !important; }
+ .large-offset-4 {
+ margin-left: 33.33333% !important; }
+ .large-offset-5 {
+ margin-left: 41.66667% !important; }
+ .large-offset-6 {
+ margin-left: 50% !important; }
+ .large-offset-7 {
+ margin-left: 58.33333% !important; }
+ .large-offset-8 {
+ margin-left: 66.66667% !important; }
+ .large-offset-9 {
+ margin-left: 75% !important; }
+ .large-offset-10 {
+ margin-left: 83.33333% !important; }
+ .large-offset-11 {
+ margin-left: 91.66667% !important; }
+ .large-reset-order, .large-reset-order {
+ margin-left: 0;
+ margin-right: 0;
+ left: auto;
+ right: auto;
+ float: left; }
+ .push-0 {
+ left: 0%;
+ right: auto; }
+ .pull-0 {
+ right: 0%;
+ left: auto; }
+ .push-1 {
+ left: 8.33333%;
+ right: auto; }
+ .pull-1 {
+ right: 8.33333%;
+ left: auto; }
+ .push-2 {
+ left: 16.66667%;
+ right: auto; }
+ .pull-2 {
+ right: 16.66667%;
+ left: auto; }
+ .push-3 {
+ left: 25%;
+ right: auto; }
+ .pull-3 {
+ right: 25%;
+ left: auto; }
+ .push-4 {
+ left: 33.33333%;
+ right: auto; }
+ .pull-4 {
+ right: 33.33333%;
+ left: auto; }
+ .push-5 {
+ left: 41.66667%;
+ right: auto; }
+ .pull-5 {
+ right: 41.66667%;
+ left: auto; }
+ .push-6 {
+ left: 50%;
+ right: auto; }
+ .pull-6 {
+ right: 50%;
+ left: auto; }
+ .push-7 {
+ left: 58.33333%;
+ right: auto; }
+ .pull-7 {
+ right: 58.33333%;
+ left: auto; }
+ .push-8 {
+ left: 66.66667%;
+ right: auto; }
+ .pull-8 {
+ right: 66.66667%;
+ left: auto; }
+ .push-9 {
+ left: 75%;
+ right: auto; }
+ .pull-9 {
+ right: 75%;
+ left: auto; }
+ .push-10 {
+ left: 83.33333%;
+ right: auto; }
+ .pull-10 {
+ right: 83.33333%;
+ left: auto; }
+ .push-11 {
+ left: 91.66667%;
+ right: auto; }
+ .pull-11 {
+ right: 91.66667%;
+ left: auto; } }
+
+.accordion {
+ *zoom: 1;
+ margin-bottom: 0; }
+ .accordion:before, .accordion:after {
+ content: " ";
+ display: table; }
+ .accordion:after {
+ clear: both; }
+ .accordion dd {
+ display: block;
+ margin-bottom: 0 !important; }
+ .accordion dd.active a {
+ background: #e8e8e8; }
+ .accordion dd > a {
+ background: #efefef;
+ color: #222222;
+ padding: 1rem;
+ display: block;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif;
+ font-size: 1rem; }
+ .accordion dd > a:hover {
+ background: #e3e3e3; }
+ .accordion .content {
+ display: none;
+ padding: 0.9375rem; }
+ .accordion .content.active {
+ display: block;
+ background: white; }
+
+.alert-box {
+ border-style: solid;
+ border-width: 1px;
+ display: block;
+ font-weight: normal;
+ margin-bottom: 1.25rem;
+ position: relative;
+ padding: 0.875rem 1.5rem 0.875rem 0.875rem;
+ font-size: 0.8125rem;
+ background-color: #008cba;
+ border-color: #007ba0;
+ color: white; }
+ .alert-box .close {
+ font-size: 1.375rem;
+ padding: 9px 6px 4px;
+ line-height: 0;
+ position: absolute;
+ top: 50%;
+ margin-top: -0.6875rem;
+ right: 0.25rem;
+ color: #333333;
+ opacity: 0.3; }
+ .alert-box .close:hover, .alert-box .close:focus {
+ opacity: 0.5; }
+ .alert-box.radius {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+ .alert-box.round {
+ -webkit-border-radius: 1000px;
+ border-radius: 1000px; }
+ .alert-box.success {
+ background-color: #43ac6a;
+ border-color: #3a945b;
+ color: white; }
+ .alert-box.alert {
+ background-color: #f04124;
+ border-color: #de2b0f;
+ color: white; }
+ .alert-box.secondary {
+ background-color: #e7e7e7;
+ border-color: #c7c7c7;
+ color: #4f4f4f; }
+ .alert-box.warning {
+ background-color: #f08a24;
+ border-color: #de770f;
+ color: white; }
+ .alert-box.info {
+ background-color: #a0d3e8;
+ border-color: #74bfdd;
+ color: #4f4f4f; }
+
+[class*="block-grid-"] {
+ display: block;
+ padding: 0;
+ margin: 0 -0.625rem;
+ *zoom: 1; }
+ [class*="block-grid-"]:before, [class*="block-grid-"]:after {
+ content: " ";
+ display: table; }
+ [class*="block-grid-"]:after {
+ clear: both; }
+ [class*="block-grid-"] > li {
+ display: block;
+ height: auto;
+ float: left;
+ padding: 0 0.625rem 1.25rem; }
+
+@media only screen {
+ .small-block-grid-1 > li {
+ width: 100%;
+ list-style: none; }
+ .small-block-grid-1 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-1 > li:nth-of-type(1n+1) {
+ clear: both; }
+ .small-block-grid-2 > li {
+ width: 50%;
+ list-style: none; }
+ .small-block-grid-2 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-2 > li:nth-of-type(2n+1) {
+ clear: both; }
+ .small-block-grid-3 > li {
+ width: 33.33333%;
+ list-style: none; }
+ .small-block-grid-3 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-3 > li:nth-of-type(3n+1) {
+ clear: both; }
+ .small-block-grid-4 > li {
+ width: 25%;
+ list-style: none; }
+ .small-block-grid-4 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-4 > li:nth-of-type(4n+1) {
+ clear: both; }
+ .small-block-grid-5 > li {
+ width: 20%;
+ list-style: none; }
+ .small-block-grid-5 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-5 > li:nth-of-type(5n+1) {
+ clear: both; }
+ .small-block-grid-6 > li {
+ width: 16.66667%;
+ list-style: none; }
+ .small-block-grid-6 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-6 > li:nth-of-type(6n+1) {
+ clear: both; }
+ .small-block-grid-7 > li {
+ width: 14.28571%;
+ list-style: none; }
+ .small-block-grid-7 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-7 > li:nth-of-type(7n+1) {
+ clear: both; }
+ .small-block-grid-8 > li {
+ width: 12.5%;
+ list-style: none; }
+ .small-block-grid-8 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-8 > li:nth-of-type(8n+1) {
+ clear: both; }
+ .small-block-grid-9 > li {
+ width: 11.11111%;
+ list-style: none; }
+ .small-block-grid-9 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-9 > li:nth-of-type(9n+1) {
+ clear: both; }
+ .small-block-grid-10 > li {
+ width: 10%;
+ list-style: none; }
+ .small-block-grid-10 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-10 > li:nth-of-type(10n+1) {
+ clear: both; }
+ .small-block-grid-11 > li {
+ width: 9.09091%;
+ list-style: none; }
+ .small-block-grid-11 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-11 > li:nth-of-type(11n+1) {
+ clear: both; }
+ .small-block-grid-12 > li {
+ width: 8.33333%;
+ list-style: none; }
+ .small-block-grid-12 > li:nth-of-type(n) {
+ clear: none; }
+ .small-block-grid-12 > li:nth-of-type(12n+1) {
+ clear: both; } }
+
+@media only screen and (min-width:40.063em) {
+ .medium-block-grid-1 > li {
+ width: 100%;
+ list-style: none; }
+ .medium-block-grid-1 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-1 > li:nth-of-type(1n+1) {
+ clear: both; }
+ .medium-block-grid-2 > li {
+ width: 50%;
+ list-style: none; }
+ .medium-block-grid-2 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-2 > li:nth-of-type(2n+1) {
+ clear: both; }
+ .medium-block-grid-3 > li {
+ width: 33.33333%;
+ list-style: none; }
+ .medium-block-grid-3 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-3 > li:nth-of-type(3n+1) {
+ clear: both; }
+ .medium-block-grid-4 > li {
+ width: 25%;
+ list-style: none; }
+ .medium-block-grid-4 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-4 > li:nth-of-type(4n+1) {
+ clear: both; }
+ .medium-block-grid-5 > li {
+ width: 20%;
+ list-style: none; }
+ .medium-block-grid-5 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-5 > li:nth-of-type(5n+1) {
+ clear: both; }
+ .medium-block-grid-6 > li {
+ width: 16.66667%;
+ list-style: none; }
+ .medium-block-grid-6 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-6 > li:nth-of-type(6n+1) {
+ clear: both; }
+ .medium-block-grid-7 > li {
+ width: 14.28571%;
+ list-style: none; }
+ .medium-block-grid-7 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-7 > li:nth-of-type(7n+1) {
+ clear: both; }
+ .medium-block-grid-8 > li {
+ width: 12.5%;
+ list-style: none; }
+ .medium-block-grid-8 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-8 > li:nth-of-type(8n+1) {
+ clear: both; }
+ .medium-block-grid-9 > li {
+ width: 11.11111%;
+ list-style: none; }
+ .medium-block-grid-9 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-9 > li:nth-of-type(9n+1) {
+ clear: both; }
+ .medium-block-grid-10 > li {
+ width: 10%;
+ list-style: none; }
+ .medium-block-grid-10 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-10 > li:nth-of-type(10n+1) {
+ clear: both; }
+ .medium-block-grid-11 > li {
+ width: 9.09091%;
+ list-style: none; }
+ .medium-block-grid-11 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-11 > li:nth-of-type(11n+1) {
+ clear: both; }
+ .medium-block-grid-12 > li {
+ width: 8.33333%;
+ list-style: none; }
+ .medium-block-grid-12 > li:nth-of-type(n) {
+ clear: none; }
+ .medium-block-grid-12 > li:nth-of-type(12n+1) {
+ clear: both; } }
+
+@media only screen and (min-width:64.063em) {
+ .large-block-grid-1 > li {
+ width: 100%;
+ list-style: none; }
+ .large-block-grid-1 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-1 > li:nth-of-type(1n+1) {
+ clear: both; }
+ .large-block-grid-2 > li {
+ width: 50%;
+ list-style: none; }
+ .large-block-grid-2 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-2 > li:nth-of-type(2n+1) {
+ clear: both; }
+ .large-block-grid-3 > li {
+ width: 33.33333%;
+ list-style: none; }
+ .large-block-grid-3 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-3 > li:nth-of-type(3n+1) {
+ clear: both; }
+ .large-block-grid-4 > li {
+ width: 25%;
+ list-style: none; }
+ .large-block-grid-4 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-4 > li:nth-of-type(4n+1) {
+ clear: both; }
+ .large-block-grid-5 > li {
+ width: 20%;
+ list-style: none; }
+ .large-block-grid-5 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-5 > li:nth-of-type(5n+1) {
+ clear: both; }
+ .large-block-grid-6 > li {
+ width: 16.66667%;
+ list-style: none; }
+ .large-block-grid-6 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-6 > li:nth-of-type(6n+1) {
+ clear: both; }
+ .large-block-grid-7 > li {
+ width: 14.28571%;
+ list-style: none; }
+ .large-block-grid-7 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-7 > li:nth-of-type(7n+1) {
+ clear: both; }
+ .large-block-grid-8 > li {
+ width: 12.5%;
+ list-style: none; }
+ .large-block-grid-8 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-8 > li:nth-of-type(8n+1) {
+ clear: both; }
+ .large-block-grid-9 > li {
+ width: 11.11111%;
+ list-style: none; }
+ .large-block-grid-9 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-9 > li:nth-of-type(9n+1) {
+ clear: both; }
+ .large-block-grid-10 > li {
+ width: 10%;
+ list-style: none; }
+ .large-block-grid-10 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-10 > li:nth-of-type(10n+1) {
+ clear: both; }
+ .large-block-grid-11 > li {
+ width: 9.09091%;
+ list-style: none; }
+ .large-block-grid-11 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-11 > li:nth-of-type(11n+1) {
+ clear: both; }
+ .large-block-grid-12 > li {
+ width: 8.33333%;
+ list-style: none; }
+ .large-block-grid-12 > li:nth-of-type(n) {
+ clear: none; }
+ .large-block-grid-12 > li:nth-of-type(12n+1) {
+ clear: both; } }
+
+.breadcrumbs {
+ display: block;
+ padding: 0.5625rem 0.875rem 0.5625rem;
+ overflow: hidden;
+ margin-left: 0;
+ list-style: none;
+ border-style: solid;
+ border-width: 1px;
+ background-color: #f4f4f4;
+ border-color: gainsboro;
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+ .breadcrumbs > * {
+ margin: 0;
+ float: left;
+ font-size: 0.6875rem;
+ text-transform: uppercase; }
+ .breadcrumbs > *:hover a, .breadcrumbs > *:focus a {
+ text-decoration: underline; }
+ .breadcrumbs > * a, .breadcrumbs > * span {
+ text-transform: uppercase;
+ color: #008cba; }
+ .breadcrumbs > *.current {
+ cursor: default;
+ color: #333333; }
+ .breadcrumbs > *.current a {
+ cursor: default;
+ color: #333333; }
+ .breadcrumbs > *.current:hover, .breadcrumbs > *.current:hover a, .breadcrumbs > *.current:focus, .breadcrumbs > *.current:focus a {
+ text-decoration: none; }
+ .breadcrumbs > *.unavailable {
+ color: #999999; }
+ .breadcrumbs > *.unavailable a {
+ color: #999999; }
+ .breadcrumbs > *.unavailable:hover, .breadcrumbs > *.unavailable:hover a, .breadcrumbs > *.unavailable:focus, .breadcrumbs > *.unavailable a:focus {
+ text-decoration: none;
+ color: #999999;
+ cursor: default; }
+ .breadcrumbs > *:before {
+ content: "/";
+ color: #aaaaaa;
+ margin: 0 0.75rem;
+ position: relative;
+ top: 1px; }
+ .breadcrumbs > *:first-child:before {
+ content: " ";
+ margin: 0; }
+
+button, .button {
+ border-style: solid;
+ border-width: 0px;
+ cursor: pointer;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif;
+ font-weight: normal;
+ line-height: normal;
+ margin: 0 0 1.25rem;
+ position: relative;
+ text-decoration: none;
+ text-align: center;
+ display: inline-block;
+ padding-top: 1rem;
+ padding-right: 2rem;
+ padding-bottom: 1.0625rem;
+ padding-left: 2rem;
+ font-size: 1rem;
+ /* @else { font-size: $padding - rem-calc(2); } */
+ background-color: #008cba;
+ border-color: #007295;
+ color: white;
+ -webkit-transition: background-color 300ms ease-out;
+ -moz-transition: background-color 300ms ease-out;
+ transition: background-color 300ms ease-out;
+ padding-top: 1.0625rem;
+ padding-bottom: 1rem;
+ -webkit-appearance: none;
+ border: none;
+ font-weight: normal !important; }
+ button:hover, button:focus, .button:hover, .button:focus {
+ background-color: #007295; }
+ button:hover, button:focus, .button:hover, .button:focus {
+ color: white; }
+ button.secondary, .button.secondary {
+ background-color: #e7e7e7;
+ border-color: #b9b9b9;
+ color: #333333; }
+ button.secondary:hover, button.secondary:focus, .button.secondary:hover, .button.secondary:focus {
+ background-color: #b9b9b9; }
+ button.secondary:hover, button.secondary:focus, .button.secondary:hover, .button.secondary:focus {
+ color: #333333; }
+ button.success, .button.success {
+ background-color: #43ac6a;
+ border-color: #368a54;
+ color: white; }
+ button.success:hover, button.success:focus, .button.success:hover, .button.success:focus {
+ background-color: #368a54; }
+ button.success:hover, button.success:focus, .button.success:hover, .button.success:focus {
+ color: white; }
+ button.alert, .button.alert {
+ background-color: #f04124;
+ border-color: #cf280e;
+ color: white; }
+ button.alert:hover, button.alert:focus, .button.alert:hover, .button.alert:focus {
+ background-color: #cf280e; }
+ button.alert:hover, button.alert:focus, .button.alert:hover, .button.alert:focus {
+ color: white; }
+ button.large, .button.large {
+ padding-top: 1.125rem;
+ padding-right: 2.25rem;
+ padding-bottom: 1.1875rem;
+ padding-left: 2.25rem;
+ font-size: 1.25rem;
+ /* @else { font-size: $padding - rem-calc(2); } */ }
+ button.small, .button.small {
+ padding-top: 0.875rem;
+ padding-right: 1.75rem;
+ padding-bottom: 0.9375rem;
+ padding-left: 1.75rem;
+ font-size: 0.8125rem;
+ /* @else { font-size: $padding - rem-calc(2); } */ }
+ button.tiny, .button.tiny {
+ padding-top: 0.625rem;
+ padding-right: 1.25rem;
+ padding-bottom: 0.6875rem;
+ padding-left: 1.25rem;
+ font-size: 0.6875rem;
+ /* @else { font-size: $padding - rem-calc(2); } */ }
+ button.expand, .button.expand {
+ padding-right: 0;
+ padding-left: 0;
+ width: 100%; }
+ button.left-align, .button.left-align {
+ text-align: left;
+ text-indent: 0.75rem; }
+ button.right-align, .button.right-align {
+ text-align: right;
+ padding-right: 0.75rem; }
+ button.radius, .button.radius {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+ button.round, .button.round {
+ -webkit-border-radius: 1000px;
+ border-radius: 1000px; }
+ button.disabled, button[disabled], .button.disabled, .button[disabled] {
+ background-color: #008cba;
+ border-color: #007295;
+ color: white;
+ cursor: default;
+ opacity: 0.7;
+ -webkit-box-shadow: none;
+ box-shadow: none; }
+ button.disabled:hover, button.disabled:focus, button[disabled]:hover, button[disabled]:focus, .button.disabled:hover, .button.disabled:focus, .button[disabled]:hover, .button[disabled]:focus {
+ background-color: #007295; }
+ button.disabled:hover, button.disabled:focus, button[disabled]:hover, button[disabled]:focus, .button.disabled:hover, .button.disabled:focus, .button[disabled]:hover, .button[disabled]:focus {
+ color: white; }
+ button.disabled:hover, button.disabled:focus, button[disabled]:hover, button[disabled]:focus, .button.disabled:hover, .button.disabled:focus, .button[disabled]:hover, .button[disabled]:focus {
+ background-color: #008cba; }
+ button.disabled.secondary, button[disabled].secondary, .button.disabled.secondary, .button[disabled].secondary {
+ background-color: #e7e7e7;
+ border-color: #b9b9b9;
+ color: #333333;
+ cursor: default;
+ opacity: 0.7;
+ -webkit-box-shadow: none;
+ box-shadow: none; }
+ button.disabled.secondary:hover, button.disabled.secondary:focus, button[disabled].secondary:hover, button[disabled].secondary:focus, .button.disabled.secondary:hover, .button.disabled.secondary:focus, .button[disabled].secondary:hover, .button[disabled].secondary:focus {
+ background-color: #b9b9b9; }
+ button.disabled.secondary:hover, button.disabled.secondary:focus, button[disabled].secondary:hover, button[disabled].secondary:focus, .button.disabled.secondary:hover, .button.disabled.secondary:focus, .button[disabled].secondary:hover, .button[disabled].secondary:focus {
+ color: #333333; }
+ button.disabled.secondary:hover, button.disabled.secondary:focus, button[disabled].secondary:hover, button[disabled].secondary:focus, .button.disabled.secondary:hover, .button.disabled.secondary:focus, .button[disabled].secondary:hover, .button[disabled].secondary:focus {
+ background-color: #e7e7e7; }
+ button.disabled.success, button[disabled].success, .button.disabled.success, .button[disabled].success {
+ background-color: #43ac6a;
+ border-color: #368a54;
+ color: white;
+ cursor: default;
+ opacity: 0.7;
+ -webkit-box-shadow: none;
+ box-shadow: none; }
+ button.disabled.success:hover, button.disabled.success:focus, button[disabled].success:hover, button[disabled].success:focus, .button.disabled.success:hover, .button.disabled.success:focus, .button[disabled].success:hover, .button[disabled].success:focus {
+ background-color: #368a54; }
+ button.disabled.success:hover, button.disabled.success:focus, button[disabled].success:hover, button[disabled].success:focus, .button.disabled.success:hover, .button.disabled.success:focus, .button[disabled].success:hover, .button[disabled].success:focus {
+ color: white; }
+ button.disabled.success:hover, button.disabled.success:focus, button[disabled].success:hover, button[disabled].success:focus, .button.disabled.success:hover, .button.disabled.success:focus, .button[disabled].success:hover, .button[disabled].success:focus {
+ background-color: #43ac6a; }
+ button.disabled.alert, button[disabled].alert, .button.disabled.alert, .button[disabled].alert {
+ background-color: #f04124;
+ border-color: #cf280e;
+ color: white;
+ cursor: default;
+ opacity: 0.7;
+ -webkit-box-shadow: none;
+ box-shadow: none; }
+ button.disabled.alert:hover, button.disabled.alert:focus, button[disabled].alert:hover, button[disabled].alert:focus, .button.disabled.alert:hover, .button.disabled.alert:focus, .button[disabled].alert:hover, .button[disabled].alert:focus {
+ background-color: #cf280e; }
+ button.disabled.alert:hover, button.disabled.alert:focus, button[disabled].alert:hover, button[disabled].alert:focus, .button.disabled.alert:hover, .button.disabled.alert:focus, .button[disabled].alert:hover, .button[disabled].alert:focus {
+ color: white; }
+ button.disabled.alert:hover, button.disabled.alert:focus, button[disabled].alert:hover, button[disabled].alert:focus, .button.disabled.alert:hover, .button.disabled.alert:focus, .button[disabled].alert:hover, .button[disabled].alert:focus {
+ background-color: #f04124; }
+
+@media only screen and (min-width:40.063em) {
+ button, .button {
+ display: inline-block; } }
+
+.button-group {
+ list-style: none;
+ margin: 0;
+ left: 0;
+ *zoom: 1; }
+ .button-group:before, .button-group:after {
+ content: " ";
+ display: table; }
+ .button-group:after {
+ clear: both; }
+ .button-group li {
+ margin: 0;
+ float: left; }
+ .button-group li > button, .button-group li .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group li:first-child button, .button-group li:first-child .button {
+ border-left: 0; }
+ .button-group li:first-child {
+ margin-left: 0; }
+ .button-group.radius > * > button, .button-group.radius > * .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group.radius > *:first-child button, .button-group.radius > *:first-child .button {
+ border-left: 0; }
+ .button-group.radius > *:first-child, .button-group.radius > *:first-child > a, .button-group.radius > *:first-child > button, .button-group.radius > *:first-child > .button {
+ -moz-border-radius-bottomleft: 3px;
+ -moz-border-radius-topleft: 3px;
+ -webkit-border-bottom-left-radius: 3px;
+ -webkit-border-top-left-radius: 3px;
+ border-bottom-left-radius: 3px;
+ border-top-left-radius: 3px; }
+ .button-group.radius > *:last-child, .button-group.radius > *:last-child > a, .button-group.radius > *:last-child > button, .button-group.radius > *:last-child > .button {
+ -moz-border-radius-bottomright: 3px;
+ -moz-border-radius-topright: 3px;
+ -webkit-border-bottom-right-radius: 3px;
+ -webkit-border-top-right-radius: 3px;
+ border-bottom-right-radius: 3px;
+ border-top-right-radius: 3px; }
+ .button-group.round > * > button, .button-group.round > * .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group.round > *:first-child button, .button-group.round > *:first-child .button {
+ border-left: 0; }
+ .button-group.round > *:first-child, .button-group.round > *:first-child > a, .button-group.round > *:first-child > button, .button-group.round > *:first-child > .button {
+ -moz-border-radius-bottomleft: 1000px;
+ -moz-border-radius-topleft: 1000px;
+ -webkit-border-bottom-left-radius: 1000px;
+ -webkit-border-top-left-radius: 1000px;
+ border-bottom-left-radius: 1000px;
+ border-top-left-radius: 1000px; }
+ .button-group.round > *:last-child, .button-group.round > *:last-child > a, .button-group.round > *:last-child > button, .button-group.round > *:last-child > .button {
+ -moz-border-radius-bottomright: 1000px;
+ -moz-border-radius-topright: 1000px;
+ -webkit-border-bottom-right-radius: 1000px;
+ -webkit-border-top-right-radius: 1000px;
+ border-bottom-right-radius: 1000px;
+ border-top-right-radius: 1000px; }
+ .button-group.even-2 li {
+ width: 50%; }
+ .button-group.even-2 li > button, .button-group.even-2 li .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group.even-2 li:first-child button, .button-group.even-2 li:first-child .button {
+ border-left: 0; }
+ .button-group.even-2 li button, .button-group.even-2 li .button {
+ width: 100%; }
+ .button-group.even-3 li {
+ width: 33.33333%; }
+ .button-group.even-3 li > button, .button-group.even-3 li .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group.even-3 li:first-child button, .button-group.even-3 li:first-child .button {
+ border-left: 0; }
+ .button-group.even-3 li button, .button-group.even-3 li .button {
+ width: 100%; }
+ .button-group.even-4 li {
+ width: 25%; }
+ .button-group.even-4 li > button, .button-group.even-4 li .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group.even-4 li:first-child button, .button-group.even-4 li:first-child .button {
+ border-left: 0; }
+ .button-group.even-4 li button, .button-group.even-4 li .button {
+ width: 100%; }
+ .button-group.even-5 li {
+ width: 20%; }
+ .button-group.even-5 li > button, .button-group.even-5 li .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group.even-5 li:first-child button, .button-group.even-5 li:first-child .button {
+ border-left: 0; }
+ .button-group.even-5 li button, .button-group.even-5 li .button {
+ width: 100%; }
+ .button-group.even-6 li {
+ width: 16.66667%; }
+ .button-group.even-6 li > button, .button-group.even-6 li .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group.even-6 li:first-child button, .button-group.even-6 li:first-child .button {
+ border-left: 0; }
+ .button-group.even-6 li button, .button-group.even-6 li .button {
+ width: 100%; }
+ .button-group.even-7 li {
+ width: 14.28571%; }
+ .button-group.even-7 li > button, .button-group.even-7 li .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group.even-7 li:first-child button, .button-group.even-7 li:first-child .button {
+ border-left: 0; }
+ .button-group.even-7 li button, .button-group.even-7 li .button {
+ width: 100%; }
+ .button-group.even-8 li {
+ width: 12.5%; }
+ .button-group.even-8 li > button, .button-group.even-8 li .button {
+ border-left: 1px solid;
+ border-color: rgba(255, 255, 255, 0.5); }
+ .button-group.even-8 li:first-child button, .button-group.even-8 li:first-child .button {
+ border-left: 0; }
+ .button-group.even-8 li button, .button-group.even-8 li .button {
+ width: 100%; }
+
+.button-bar {
+ *zoom: 1; }
+ .button-bar:before, .button-bar:after {
+ content: " ";
+ display: table; }
+ .button-bar:after {
+ clear: both; }
+ .button-bar .button-group {
+ float: left;
+ margin-right: 0.625rem; }
+ .button-bar .button-group div {
+ overflow: hidden; }
+
+/* Clearing Styles */
+.clearing-thumbs, [data-clearing] {
+ *zoom: 1;
+ margin-bottom: 0;
+ margin-left: 0;
+ list-style: none; }
+ .clearing-thumbs:before, .clearing-thumbs:after, [data-clearing]:before, [data-clearing]:after {
+ content: " ";
+ display: table; }
+ .clearing-thumbs:after, [data-clearing]:after {
+ clear: both; }
+ .clearing-thumbs li, [data-clearing] li {
+ float: left;
+ margin-right: 10px; }
+ .clearing-thumbs[class*="block-grid-"] li, [data-clearing][class*="block-grid-"] li {
+ margin-right: 0; }
+
+.clearing-blackout {
+ background: #333333;
+ position: fixed;
+ width: 100%;
+ height: 100%;
+ top: 0;
+ left: 0;
+ z-index: 998; }
+ .clearing-blackout .clearing-close {
+ display: block; }
+
+.clearing-container {
+ position: relative;
+ z-index: 998;
+ height: 100%;
+ overflow: hidden;
+ margin: 0; }
+
+.clearing-touch-label {
+ position: absolute;
+ top: 50%;
+ left: 50%;
+ color: #aaaaaa;
+ font-size: 0.6em; }
+
+.visible-img {
+ height: 95%;
+ position: relative; }
+ .visible-img img {
+ position: absolute;
+ left: 50%;
+ top: 50%;
+ margin-left: -50%;
+ max-height: 100%;
+ max-width: 100%; }
+
+.clearing-caption {
+ color: #cccccc;
+ font-size: 0.875em;
+ line-height: 1.3;
+ margin-bottom: 0;
+ text-align: center;
+ bottom: 0;
+ background: #333333;
+ width: 100%;
+ padding: 10px 30px 20px;
+ position: absolute;
+ left: 0; }
+
+.clearing-close {
+ z-index: 999;
+ padding-left: 20px;
+ padding-top: 10px;
+ font-size: 30px;
+ line-height: 1;
+ color: #cccccc;
+ display: none; }
+ .clearing-close:hover, .clearing-close:focus {
+ color: #cccccc; }
+
+.clearing-assembled .clearing-container {
+ height: 100%; }
+ .clearing-assembled .clearing-container .carousel > ul {
+ display: none; }
+
+.clearing-feature li {
+ display: none; }
+ .clearing-feature li.clearing-featured-img {
+ display: block; }
+
+@media only screen and (min-width:40.063em) {
+ .clearing-main-prev, .clearing-main-next {
+ position: absolute;
+ height: 100%;
+ width: 40px;
+ top: 0; }
+ .clearing-main-prev > span, .clearing-main-next > span {
+ position: absolute;
+ top: 50%;
+ display: block;
+ width: 0;
+ height: 0;
+ border: solid 12px; }
+ .clearing-main-prev > span:hover, .clearing-main-next > span:hover {
+ opacity: 0.8; }
+ .clearing-main-prev {
+ left: 0; }
+ .clearing-main-prev > span {
+ left: 5px;
+ border-color: transparent;
+ border-right-color: #cccccc; }
+ .clearing-main-next {
+ right: 0; }
+ .clearing-main-next > span {
+ border-color: transparent;
+ border-left-color: #cccccc; }
+ .clearing-main-prev.disabled, .clearing-main-next.disabled {
+ opacity: 0.3; }
+ .clearing-assembled .clearing-container .carousel {
+ background: rgba(51, 51, 51, 0.8);
+ height: 120px;
+ margin-top: 10px;
+ text-align: center; }
+ .clearing-assembled .clearing-container .carousel > ul {
+ display: inline-block;
+ z-index: 999;
+ height: 100%;
+ position: relative;
+ float: none; }
+ .clearing-assembled .clearing-container .carousel > ul li {
+ display: block;
+ width: 120px;
+ min-height: inherit;
+ float: left;
+ overflow: hidden;
+ margin-right: 0;
+ padding: 0;
+ position: relative;
+ cursor: pointer;
+ opacity: 0.4; }
+ .clearing-assembled .clearing-container .carousel > ul li.fix-height img {
+ height: 100%;
+ max-width: none; }
+ .clearing-assembled .clearing-container .carousel > ul li a.th {
+ border: none;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+ display: block; }
+ .clearing-assembled .clearing-container .carousel > ul li img {
+ cursor: pointer !important;
+ width: 100% !important; }
+ .clearing-assembled .clearing-container .carousel > ul li.visible {
+ opacity: 1; }
+ .clearing-assembled .clearing-container .carousel > ul li:hover {
+ opacity: 0.8; }
+ .clearing-assembled .clearing-container .visible-img {
+ background: #333333;
+ overflow: hidden;
+ height: 85%; }
+ .clearing-close {
+ position: absolute;
+ top: 10px;
+ right: 20px;
+ padding-left: 0;
+ padding-top: 0; } }
+
+@media only screen and (max-width: 40em) {
+ .f-dropdown {
+ max-width: 100%;
+ left: 0; } }
+
+/* Foundation Dropdowns */
+.f-dropdown {
+ position: absolute;
+ left: -9999px;
+ list-style: none;
+ margin-left: 0;
+ width: 100%;
+ max-height: none;
+ height: auto;
+ background: white;
+ border: solid 1px #cccccc;
+ font-size: 16px;
+ z-index: 99;
+ margin-top: 2px;
+ max-width: 200px; }
+ .f-dropdown > *:first-child {
+ margin-top: 0; }
+ .f-dropdown > *:last-child {
+ margin-bottom: 0; }
+ .f-dropdown:before {
+ content: "";
+ display: block;
+ width: 0;
+ height: 0;
+ border: inset 6px;
+ border-color: transparent transparent white transparent;
+ border-bottom-style: solid;
+ position: absolute;
+ top: -12px;
+ left: 10px;
+ z-index: 99; }
+ .f-dropdown:after {
+ content: "";
+ display: block;
+ width: 0;
+ height: 0;
+ border: inset 7px;
+ border-color: transparent transparent #cccccc transparent;
+ border-bottom-style: solid;
+ position: absolute;
+ top: -14px;
+ left: 9px;
+ z-index: 98; }
+ .f-dropdown.right:before {
+ left: auto;
+ right: 10px; }
+ .f-dropdown.right:after {
+ left: auto;
+ right: 9px; }
+ .f-dropdown li {
+ font-size: 0.875rem;
+ cursor: pointer;
+ line-height: 1.125rem;
+ margin: 0; }
+ .f-dropdown li:hover, .f-dropdown li:focus {
+ background: #eeeeee; }
+ .f-dropdown li a {
+ display: block;
+ padding: 0.5rem;
+ color: #555555; }
+ .f-dropdown.content {
+ position: absolute;
+ left: -9999px;
+ list-style: none;
+ margin-left: 0;
+ padding: 1.25rem;
+ width: 100%;
+ height: auto;
+ max-height: none;
+ background: white;
+ border: solid 1px #cccccc;
+ font-size: 16px;
+ z-index: 99;
+ max-width: 200px; }
+ .f-dropdown.content > *:first-child {
+ margin-top: 0; }
+ .f-dropdown.content > *:last-child {
+ margin-bottom: 0; }
+ .f-dropdown.tiny {
+ max-width: 200px; }
+ .f-dropdown.small {
+ max-width: 300px; }
+ .f-dropdown.medium {
+ max-width: 500px; }
+ .f-dropdown.large {
+ max-width: 800px; }
+
+.dropdown.button, button.dropdown {
+ position: relative;
+ padding-right: 3.5625rem; }
+ .dropdown.button:before, button.dropdown:before {
+ position: absolute;
+ content: "";
+ width: 0;
+ height: 0;
+ display: block;
+ border-style: solid;
+ border-color: white transparent transparent transparent;
+ top: 50%; }
+ .dropdown.button:before, button.dropdown:before {
+ border-width: 0.375rem;
+ right: 1.40625rem;
+ margin-top: -0.15625rem; }
+ .dropdown.button:before, button.dropdown:before {
+ border-color: white transparent transparent transparent; }
+ .dropdown.button.tiny, button.dropdown.tiny {
+ padding-right: 2.625rem; }
+ .dropdown.button.tiny:before, button.dropdown.tiny:before {
+ border-width: 0.375rem;
+ right: 1.125rem;
+ margin-top: -0.125rem; }
+ .dropdown.button.tiny:before, button.dropdown.tiny:before {
+ border-color: white transparent transparent transparent; }
+ .dropdown.button.small, button.dropdown.small {
+ padding-right: 3.0625rem; }
+ .dropdown.button.small:before, button.dropdown.small:before {
+ border-width: 0.4375rem;
+ right: 1.3125rem;
+ margin-top: -0.15625rem; }
+ .dropdown.button.small:before, button.dropdown.small:before {
+ border-color: white transparent transparent transparent; }
+ .dropdown.button.large, button.dropdown.large {
+ padding-right: 3.625rem; }
+ .dropdown.button.large:before, button.dropdown.large:before {
+ border-width: 0.3125rem;
+ right: 1.71875rem;
+ margin-top: -0.15625rem; }
+ .dropdown.button.large:before, button.dropdown.large:before {
+ border-color: white transparent transparent transparent; }
+ .dropdown.button.secondary:before, button.dropdown.secondary:before {
+ border-color: #333333 transparent transparent transparent; }
+
+.flex-video {
+ position: relative;
+ padding-top: 1.5625rem;
+ padding-bottom: 67.5%;
+ height: 0;
+ margin-bottom: 1rem;
+ overflow: hidden; }
+ .flex-video.widescreen {
+ padding-bottom: 56.55%; }
+ .flex-video.vimeo {
+ padding-top: 0; }
+ .flex-video iframe, .flex-video object, .flex-video embed, .flex-video video {
+ position: absolute;
+ top: 0;
+ left: 0;
+ width: 100%;
+ height: 100%; }
+
+/* Standard Forms */
+form {
+ margin: 0 0 1rem; }
+
+/* Using forms within rows, we need to set some defaults */
+form .row .row {
+ margin: 0 -0.5rem; }
+ form .row .row .column, form .row .row .columns {
+ padding: 0 0.5rem; }
+ form .row .row.collapse {
+ margin: 0; }
+ form .row .row.collapse .column, form .row .row.collapse .columns {
+ padding: 0; }
+ form .row .row.collapse input {
+ -moz-border-radius-bottomright: 0;
+ -moz-border-radius-topright: 0;
+ -webkit-border-bottom-right-radius: 0;
+ -webkit-border-top-right-radius: 0; }
+form .row input.column, form .row input.columns, form .row textarea.column, form .row textarea.columns {
+ padding-left: 0.5rem; }
+
+/* Label Styles */
+label {
+ font-size: 0.875rem;
+ color: #4d4d4d;
+ cursor: pointer;
+ display: block;
+ font-weight: normal;
+ line-height: 1.5;
+ margin-bottom: 0;
+ /* Styles for required inputs */ }
+ label.right {
+ float: none;
+ text-align: right; }
+ label.inline {
+ margin: 0 0 1rem 0;
+ padding: 0.625rem 0; }
+ label small {
+ text-transform: capitalize;
+ color: #686868; }
+
+select {
+ -webkit-appearance: none !important;
+ background: #fafafa url('data:image/svg+xml;base64, PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZlcnNpb249IjEuMSIgeD0iMHB4IiB5PSIwcHgiIHdpZHRoPSI2cHgiIGhlaWdodD0iM3B4IiB2aWV3Qm94PSIwIDAgNiAzIiBlbmFibGUtYmFja2dyb3VuZD0ibmV3IDAgMCA2IDMiIHhtbDpzcGFjZT0icHJlc2VydmUiPjxwb2x5Z29uIHBvaW50cz0iNS45OTIsMCAyLjk5MiwzIC0wLjAwOCwwICIvPjwvc3ZnPg==') no-repeat;
+ background-position-x: 97%;
+ background-position-y: center;
+ border: 1px solid #cccccc;
+ padding: 0.5rem;
+ font-size: 0.875rem;
+ -webkit-border-radius: 0;
+ border-radius: 0; }
+ select.radius {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+ select:hover {
+ background: #f3f3f3 url('data:image/svg+xml;base64, PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZlcnNpb249IjEuMSIgeD0iMHB4IiB5PSIwcHgiIHdpZHRoPSI2cHgiIGhlaWdodD0iM3B4IiB2aWV3Qm94PSIwIDAgNiAzIiBlbmFibGUtYmFja2dyb3VuZD0ibmV3IDAgMCA2IDMiIHhtbDpzcGFjZT0icHJlc2VydmUiPjxwb2x5Z29uIHBvaW50cz0iNS45OTIsMCAyLjk5MiwzIC0wLjAwOCwwICIvPjwvc3ZnPg==') no-repeat;
+ background-position-x: 97%;
+ background-position-y: center;
+ border-color: #999999; }
+
+select::-ms-expand {
+ display: none; }
+
+@-moz-document url-prefix() {
+ select {
+ background: #fafafa; }
+
+ select:hover {
+ background: #f3f3f3; } }
+
+/* Attach elements to the beginning or end of an input */
+.prefix, .postfix {
+ display: block;
+ position: relative;
+ z-index: 2;
+ text-align: center;
+ width: 100%;
+ padding-top: 0;
+ padding-bottom: 0;
+ border-style: solid;
+ border-width: 1px;
+ overflow: hidden;
+ font-size: 0.875rem;
+ height: 2.3125rem;
+ line-height: 2.3125rem; }
+
+/* Adjust padding, alignment and radius if pre/post element is a button */
+.postfix.button {
+ padding-left: 0;
+ padding-right: 0;
+ padding-top: 0;
+ padding-bottom: 0;
+ text-align: center;
+ line-height: 2.125rem;
+ border: none; }
+
+.prefix.button {
+ padding-left: 0;
+ padding-right: 0;
+ padding-top: 0;
+ padding-bottom: 0;
+ text-align: center;
+ line-height: 2.125rem;
+ border: none; }
+
+.prefix.button.radius {
+ -webkit-border-radius: 0;
+ border-radius: 0;
+ -moz-border-radius-bottomleft: 3px;
+ -moz-border-radius-topleft: 3px;
+ -webkit-border-bottom-left-radius: 3px;
+ -webkit-border-top-left-radius: 3px;
+ border-bottom-left-radius: 3px;
+ border-top-left-radius: 3px; }
+
+.postfix.button.radius {
+ -webkit-border-radius: 0;
+ border-radius: 0;
+ -moz-border-radius-bottomright: 3px;
+ -moz-border-radius-topright: 3px;
+ -webkit-border-bottom-right-radius: 3px;
+ -webkit-border-top-right-radius: 3px;
+ border-bottom-right-radius: 3px;
+ border-top-right-radius: 3px; }
+
+.prefix.button.round {
+ -webkit-border-radius: 0;
+ border-radius: 0;
+ -moz-border-radius-bottomleft: 1000px;
+ -moz-border-radius-topleft: 1000px;
+ -webkit-border-bottom-left-radius: 1000px;
+ -webkit-border-top-left-radius: 1000px;
+ border-bottom-left-radius: 1000px;
+ border-top-left-radius: 1000px; }
+
+.postfix.button.round {
+ -webkit-border-radius: 0;
+ border-radius: 0;
+ -moz-border-radius-bottomright: 1000px;
+ -moz-border-radius-topright: 1000px;
+ -webkit-border-bottom-right-radius: 1000px;
+ -webkit-border-top-right-radius: 1000px;
+ border-bottom-right-radius: 1000px;
+ border-top-right-radius: 1000px; }
+
+/* Separate prefix and postfix styles when on span or label so buttons keep their own */
+span.prefix, label.prefix {
+ background: #f2f2f2;
+ border-right: none;
+ color: #333333;
+ border-color: #cccccc; }
+ span.prefix.radius, label.prefix.radius {
+ -webkit-border-radius: 0;
+ border-radius: 0;
+ -moz-border-radius-bottomleft: 3px;
+ -moz-border-radius-topleft: 3px;
+ -webkit-border-bottom-left-radius: 3px;
+ -webkit-border-top-left-radius: 3px;
+ border-bottom-left-radius: 3px;
+ border-top-left-radius: 3px; }
+
+span.postfix, label.postfix {
+ background: #f2f2f2;
+ border-left: none;
+ color: #333333;
+ border-color: #cccccc; }
+ span.postfix.radius, label.postfix.radius {
+ -webkit-border-radius: 0;
+ border-radius: 0;
+ -moz-border-radius-bottomright: 3px;
+ -moz-border-radius-topright: 3px;
+ -webkit-border-bottom-right-radius: 3px;
+ -webkit-border-top-right-radius: 3px;
+ border-bottom-right-radius: 3px;
+ border-top-right-radius: 3px; }
+
+/* We use this to get basic styling on all basic form elements */
+input[type="text"], input[type="password"], input[type="date"], input[type="datetime"], input[type="datetime-local"], input[type="month"], input[type="week"], input[type="email"], input[type="number"], input[type="search"], input[type="tel"], input[type="time"], input[type="url"], textarea {
+ -webkit-appearance: none;
+ background-color: white;
+ font-family: inherit;
+ border: 1px solid #cccccc;
+ -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
+ box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
+ color: rgba(0, 0, 0, 0.75);
+ display: block;
+ font-size: 0.875rem;
+ margin: 0 0 1rem 0;
+ padding: 0.5rem;
+ height: 2.3125rem;
+ width: 100%;
+ -moz-box-sizing: border-box;
+ -webkit-box-sizing: border-box;
+ box-sizing: border-box;
+ -webkit-transition: -webkit-box-shadow 0.45s, border-color 0.45s ease-in-out;
+ -moz-transition: -moz-box-shadow 0.45s, border-color 0.45s ease-in-out;
+ transition: box-shadow 0.45s, border-color 0.45s ease-in-out;
+ -webkit-transition: all 0.15s linear;
+ -moz-transition: all 0.15s linear;
+ transition: all 0.15s linear; }
+ input[type="text"]:focus, input[type="password"]:focus, input[type="date"]:focus, input[type="datetime"]:focus, input[type="datetime-local"]:focus, input[type="month"]:focus, input[type="week"]:focus, input[type="email"]:focus, input[type="number"]:focus, input[type="search"]:focus, input[type="tel"]:focus, input[type="time"]:focus, input[type="url"]:focus, textarea:focus {
+ -webkit-box-shadow: 0 0 5px #999999;
+ -moz-box-shadow: 0 0 5px #999999;
+ box-shadow: 0 0 5px #999999;
+ border-color: #999999; }
+ input[type="text"]:focus, input[type="password"]:focus, input[type="date"]:focus, input[type="datetime"]:focus, input[type="datetime-local"]:focus, input[type="month"]:focus, input[type="week"]:focus, input[type="email"]:focus, input[type="number"]:focus, input[type="search"]:focus, input[type="tel"]:focus, input[type="time"]:focus, input[type="url"]:focus, textarea:focus {
+ background: #fafafa;
+ border-color: #999999;
+ outline: none; }
+ input[type="text"][disabled], input[type="password"][disabled], input[type="date"][disabled], input[type="datetime"][disabled], input[type="datetime-local"][disabled], input[type="month"][disabled], input[type="week"][disabled], input[type="email"][disabled], input[type="number"][disabled], input[type="search"][disabled], input[type="tel"][disabled], input[type="time"][disabled], input[type="url"][disabled], textarea[disabled] {
+ background-color: #dddddd; }
+ input[type="text"].radius, input[type="password"].radius, input[type="date"].radius, input[type="datetime"].radius, input[type="datetime-local"].radius, input[type="month"].radius, input[type="week"].radius, input[type="email"].radius, input[type="number"].radius, input[type="search"].radius, input[type="tel"].radius, input[type="time"].radius, input[type="url"].radius, textarea.radius {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+
+/* Add height value for select elements to match text input height */
+select {
+ height: 2.3125rem; }
+
+/* Adjust margin for form elements below */
+input[type="file"], input[type="checkbox"], input[type="radio"], select {
+ margin: 0 0 1rem 0; }
+
+input[type="checkbox"] + label, input[type="radio"] + label {
+ display: inline-block;
+ margin-left: 0.5rem;
+ margin-right: 1rem;
+ margin-bottom: 0;
+ vertical-align: baseline; }
+
+/* Normalize file input width */
+input[type="file"] {
+ width: 100%; }
+
+/* We add basic fieldset styling */
+fieldset {
+ border: solid 1px #dddddd;
+ padding: 1.25rem;
+ margin: 1.125rem 0; }
+ fieldset legend {
+ font-weight: bold;
+ background: white;
+ padding: 0 0.1875rem;
+ margin: 0;
+ margin-left: -0.1875rem; }
+
+/* Error Handling */
+[data-abide] .error small.error, [data-abide] span.error, [data-abide] small.error {
+ display: block;
+ padding: 0.375rem 0.5625rem 0.5625rem;
+ margin-top: -1px;
+ margin-bottom: 1rem;
+ font-size: 0.75rem;
+ font-weight: normal;
+ font-style: italic;
+ background: #f04124;
+ color: white; }
+[data-abide] span.error, [data-abide] small.error {
+ display: none; }
+
+span.error, small.error {
+ display: block;
+ padding: 0.375rem 0.5625rem 0.5625rem;
+ margin-top: -1px;
+ margin-bottom: 1rem;
+ font-size: 0.75rem;
+ font-weight: normal;
+ font-style: italic;
+ background: #f04124;
+ color: white; }
+
+.error input, .error textarea, .error select {
+ margin-bottom: 0; }
+.error input[type="checkbox"], .error input[type="radio"] {
+ margin-bottom: 1rem; }
+.error label, .error label.error {
+ color: #f04124; }
+.error small.error {
+ display: block;
+ padding: 0.375rem 0.5625rem 0.5625rem;
+ margin-top: -1px;
+ margin-bottom: 1rem;
+ font-size: 0.75rem;
+ font-weight: normal;
+ font-style: italic;
+ background: #f04124;
+ color: white; }
+.error > label > small {
+ color: #686868;
+ background: transparent;
+ padding: 0;
+ text-transform: capitalize;
+ font-style: normal;
+ font-size: 60%;
+ margin: 0;
+ display: inline; }
+.error span.error-message {
+ display: block; }
+
+input.error, textarea.error {
+ margin-bottom: 0; }
+
+label.error {
+ color: #f04124; }
+
+.inline-list {
+ margin: 0 auto 1.0625rem auto;
+ margin-left: -1.375rem;
+ margin-right: 0;
+ padding: 0;
+ list-style: none;
+ overflow: hidden; }
+ .inline-list > li {
+ list-style: none;
+ float: left;
+ margin-left: 1.375rem;
+ display: block; }
+ .inline-list > li > * {
+ display: block; }
+
+/* Foundation Joyride */
+.joyride-list {
+ display: none; }
+
+/* Default styles for the container */
+.joyride-tip-guide {
+ display: none;
+ position: absolute;
+ background: #333333;
+ color: white;
+ z-index: 101;
+ top: 0;
+ left: 2.5%;
+ font-family: inherit;
+ font-weight: normal;
+ width: 95%; }
+
+.lt-ie9 .joyride-tip-guide {
+ max-width: 800px;
+ left: 50%;
+ margin-left: -400px; }
+
+.joyride-content-wrapper {
+ width: 100%;
+ padding: 1.125rem 1.25rem 1.5rem; }
+ .joyride-content-wrapper .button {
+ margin-bottom: 0 !important; }
+
+/* Add a little css triangle pip, older browser just miss out on the fanciness of it */
+.joyride-tip-guide .joyride-nub {
+ display: block;
+ position: absolute;
+ left: 22px;
+ width: 0;
+ height: 0;
+ border: 10px solid #333333; }
+ .joyride-tip-guide .joyride-nub.top {
+ border-top-style: solid;
+ border-color: #333333;
+ border-top-color: transparent !important;
+ border-left-color: transparent !important;
+ border-right-color: transparent !important;
+ top: -20px; }
+ .joyride-tip-guide .joyride-nub.bottom {
+ border-bottom-style: solid;
+ border-color: #333333 !important;
+ border-bottom-color: transparent !important;
+ border-left-color: transparent !important;
+ border-right-color: transparent !important;
+ bottom: -20px; }
+ .joyride-tip-guide .joyride-nub.right {
+ right: -20px; }
+ .joyride-tip-guide .joyride-nub.left {
+ left: -20px; }
+
+/* Typography */
+.joyride-tip-guide h1, .joyride-tip-guide h2, .joyride-tip-guide h3, .joyride-tip-guide h4, .joyride-tip-guide h5, .joyride-tip-guide h6 {
+ line-height: 1.25;
+ margin: 0;
+ font-weight: bold;
+ color: white; }
+
+.joyride-tip-guide p {
+ margin: 0 0 1.125rem 0;
+ font-size: 0.875rem;
+ line-height: 1.3; }
+
+.joyride-timer-indicator-wrap {
+ width: 50px;
+ height: 3px;
+ border: solid 1px #555555;
+ position: absolute;
+ right: 1.0625rem;
+ bottom: 1rem; }
+
+.joyride-timer-indicator {
+ display: block;
+ width: 0;
+ height: inherit;
+ background: #666666; }
+
+.joyride-close-tip {
+ position: absolute;
+ right: 12px;
+ top: 10px;
+ color: #777777 !important;
+ text-decoration: none;
+ font-size: 24px;
+ font-weight: normal;
+ line-height: 0.5 !important; }
+ .joyride-close-tip:hover, .joyride-close-tip:focus {
+ color: #eeeeee !important; }
+
+.joyride-modal-bg {
+ position: fixed;
+ height: 100%;
+ width: 100%;
+ background: transparent;
+ background: rgba(0, 0, 0, 0.5);
+ z-index: 100;
+ display: none;
+ top: 0;
+ left: 0;
+ cursor: pointer; }
+
+.joyride-expose-wrapper {
+ background-color: white;
+ position: absolute;
+ border-radius: 3px;
+ z-index: 102;
+ -moz-box-shadow: 0 0 30px white;
+ -webkit-box-shadow: 0 0 15px white;
+ box-shadow: 0 0 15px white; }
+
+.joyride-expose-cover {
+ background: transparent;
+ border-radius: 3px;
+ position: absolute;
+ z-index: 9999;
+ top: 0;
+ left: 0; }
+
+/* Styles for screens that are at least 768px; */
+@media only screen and (min-width:40.063em) {
+ .joyride-tip-guide {
+ width: 300px;
+ left: inherit; }
+ .joyride-tip-guide .joyride-nub.bottom {
+ border-color: #333333 !important;
+ border-bottom-color: transparent !important;
+ border-left-color: transparent !important;
+ border-right-color: transparent !important;
+ bottom: -20px; }
+ .joyride-tip-guide .joyride-nub.right {
+ border-color: #333333 !important;
+ border-top-color: transparent !important;
+ border-right-color: transparent !important;
+ border-bottom-color: transparent !important;
+ top: 22px;
+ left: auto;
+ right: -20px; }
+ .joyride-tip-guide .joyride-nub.left {
+ border-color: #333333 !important;
+ border-top-color: transparent !important;
+ border-left-color: transparent !important;
+ border-bottom-color: transparent !important;
+ top: 22px;
+ left: -20px;
+ right: auto; } }
+
+.keystroke, kbd {
+ background-color: #ededed;
+ border-color: gainsboro;
+ color: #222222;
+ border-style: solid;
+ border-width: 1px;
+ margin: 0;
+ font-family: "Consolas", "Menlo", "Courier", monospace;
+ font-size: 0.875rem;
+ padding: 0.125rem 0.25rem 0;
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+
+.label {
+ font-weight: normal;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif;
+ text-align: center;
+ text-decoration: none;
+ line-height: 1;
+ white-space: nowrap;
+ display: inline-block;
+ position: relative;
+ margin-bottom: inherit;
+ padding: 0.25rem 0.5rem 0.375rem;
+ font-size: 0.6875rem;
+ background-color: #008cba;
+ color: white; }
+ .label.radius {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+ .label.round {
+ -webkit-border-radius: 1000px;
+ border-radius: 1000px; }
+ .label.alert {
+ background-color: #f04124;
+ color: white; }
+ .label.success {
+ background-color: #43ac6a;
+ color: white; }
+ .label.secondary {
+ background-color: #e7e7e7;
+ color: #333333; }
+
+[data-magellan-expedition] {
+ background: white;
+ z-index: 50;
+ min-width: 100%;
+ padding: 10px; }
+ [data-magellan-expedition] .sub-nav {
+ margin-bottom: 0; }
+ [data-magellan-expedition] .sub-nav dd {
+ margin-bottom: 0; }
+ [data-magellan-expedition] .sub-nav a {
+ line-height: 1.8em; }
+
+@-webkit-keyframes rotate {
+ from {
+ -webkit-transform: rotate(0deg); }
+
+ to {
+ -webkit-transform: rotate(360deg); } }
+
+@-moz-keyframes rotate {
+ from {
+ -moz-transform: rotate(0deg); }
+
+ to {
+ -moz-transform: rotate(360deg); } }
+
+@-o-keyframes rotate {
+ from {
+ -o-transform: rotate(0deg); }
+
+ to {
+ -o-transform: rotate(360deg); } }
+
+@keyframes rotate {
+ from {
+ transform: rotate(0deg); }
+
+ to {
+ transform: rotate(360deg); } }
+
+/* Orbit Graceful Loading */
+.slideshow-wrapper {
+ position: relative; }
+ .slideshow-wrapper ul {
+ list-style-type: none;
+ margin: 0; }
+ .slideshow-wrapper ul li, .slideshow-wrapper ul li .orbit-caption {
+ display: none; }
+ .slideshow-wrapper ul li:first-child {
+ display: block; }
+ .slideshow-wrapper .orbit-container {
+ background-color: transparent; }
+ .slideshow-wrapper .orbit-container li {
+ display: block; }
+ .slideshow-wrapper .orbit-container li .orbit-caption {
+ display: block; }
+
+.preloader {
+ display: block;
+ width: 40px;
+ height: 40px;
+ position: absolute;
+ top: 50%;
+ left: 50%;
+ margin-top: -20px;
+ margin-left: -20px;
+ border: solid 3px;
+ border-color: #555555 white;
+ -webkit-border-radius: 1000px;
+ border-radius: 1000px;
+ -webkit-animation-name: rotate;
+ -webkit-animation-duration: 1.5s;
+ -webkit-animation-iteration-count: infinite;
+ -webkit-animation-timing-function: linear;
+ -moz-animation-name: rotate;
+ -moz-animation-duration: 1.5s;
+ -moz-animation-iteration-count: infinite;
+ -moz-animation-timing-function: linear;
+ -o-animation-name: rotate;
+ -o-animation-duration: 1.5s;
+ -o-animation-iteration-count: infinite;
+ -o-animation-timing-function: linear;
+ animation-name: rotate;
+ animation-duration: 1.5s;
+ animation-iteration-count: infinite;
+ animation-timing-function: linear; }
+
+.orbit-container {
+ overflow: hidden;
+ width: 100%;
+ position: relative;
+ background: none; }
+ .orbit-container .orbit-slides-container {
+ list-style: none;
+ margin: 0;
+ padding: 0;
+ position: relative;
+ -webkit-transform: translateZ(0); }
+ .orbit-container .orbit-slides-container img {
+ display: block;
+ max-width: 100%; }
+ .orbit-container .orbit-slides-container > * {
+ position: absolute;
+ top: 0;
+ width: 100%;
+ margin-left: 100%; }
+ .orbit-container .orbit-slides-container > *:first-child {
+ margin-left: 0%; }
+ .orbit-container .orbit-slides-container > * .orbit-caption {
+ position: absolute;
+ bottom: 0;
+ background-color: rgba(51, 51, 51, 0.8);
+ color: white;
+ width: 100%;
+ padding: 0.625rem 0.875rem;
+ font-size: 0.875rem; }
+ .orbit-container .orbit-slide-number {
+ position: absolute;
+ top: 10px;
+ left: 10px;
+ font-size: 12px;
+ color: white;
+ background: rgba(0, 0, 0, 0);
+ z-index: 10; }
+ .orbit-container .orbit-slide-number span {
+ font-weight: 700;
+ padding: 0.3125rem; }
+ .orbit-container .orbit-timer {
+ position: absolute;
+ top: 12px;
+ right: 10px;
+ height: 6px;
+ width: 100px;
+ z-index: 10; }
+ .orbit-container .orbit-timer .orbit-progress {
+ height: 3px;
+ background-color: rgba(255, 255, 255, 0.3);
+ display: block;
+ width: 0%;
+ position: relative;
+ right: 20px;
+ top: 5px; }
+ .orbit-container .orbit-timer > span {
+ display: none;
+ position: absolute;
+ top: 0px;
+ right: 0;
+ width: 11px;
+ height: 14px;
+ border: solid 4px white;
+ border-top: none;
+ border-bottom: none; }
+ .orbit-container .orbit-timer.paused > span {
+ right: -4px;
+ top: 0px;
+ width: 11px;
+ height: 14px;
+ border: inset 8px;
+ border-right-style: solid;
+ border-color: transparent transparent transparent white; }
+ .orbit-container .orbit-timer.paused > span.dark {
+ border-color: transparent transparent transparent #333333; }
+ .orbit-container:hover .orbit-timer > span {
+ display: block; }
+ .orbit-container .orbit-prev, .orbit-container .orbit-next {
+ position: absolute;
+ top: 45%;
+ margin-top: -25px;
+ width: 36px;
+ height: 60px;
+ line-height: 50px;
+ color: white;
+ background-color: none;
+ text-indent: -9999px !important;
+ z-index: 10; }
+ .orbit-container .orbit-prev:hover, .orbit-container .orbit-next:hover {
+ background-color: rgba(0, 0, 0, 0.3); }
+ .orbit-container .orbit-prev > span, .orbit-container .orbit-next > span {
+ position: absolute;
+ top: 50%;
+ margin-top: -10px;
+ display: block;
+ width: 0;
+ height: 0;
+ border: inset 10px; }
+ .orbit-container .orbit-prev {
+ left: 0; }
+ .orbit-container .orbit-prev > span {
+ border-right-style: solid;
+ border-color: transparent;
+ border-right-color: white; }
+ .orbit-container .orbit-prev:hover > span {
+ border-right-color: white; }
+ .orbit-container .orbit-next {
+ right: 0; }
+ .orbit-container .orbit-next > span {
+ border-color: transparent;
+ border-left-style: solid;
+ border-left-color: white;
+ left: 50%;
+ margin-left: -4px; }
+ .orbit-container .orbit-next:hover > span {
+ border-left-color: white; }
+
+.orbit-bullets-container {
+ text-align: center; }
+
+.orbit-bullets {
+ margin: 0 auto 30px auto;
+ overflow: hidden;
+ position: relative;
+ top: 10px;
+ float: none;
+ text-align: center;
+ display: block; }
+ .orbit-bullets li {
+ display: inline-block;
+ width: 0.5625rem;
+ height: 0.5625rem;
+ background: #cccccc;
+ float: none;
+ margin-right: 6px;
+ -webkit-border-radius: 1000px;
+ border-radius: 1000px; }
+ .orbit-bullets li.active {
+ background: #999999; }
+ .orbit-bullets li:last-child {
+ margin-right: 0; }
+
+.touch .orbit-container .orbit-prev, .touch .orbit-container .orbit-next {
+ display: none; }
+.touch .orbit-bullets {
+ display: none; }
+
+@media only screen and (min-width:40.063em) {
+ .touch .orbit-container .orbit-prev, .touch .orbit-container .orbit-next {
+ display: inherit; }
+ .touch .orbit-bullets {
+ display: block; } }
+
+@media only screen and (max-width: 40em) {
+ .orbit-stack-on-small .orbit-slides-container {
+ height: auto !important; }
+ .orbit-stack-on-small .orbit-slides-container > * {
+ position: relative;
+ margin-left: 0% !important; }
+ .orbit-stack-on-small .orbit-timer, .orbit-stack-on-small .orbit-next, .orbit-stack-on-small .orbit-prev, .orbit-stack-on-small .orbit-bullets {
+ display: none; } }
+
+ul.pagination {
+ display: block;
+ height: 1.5rem;
+ margin-left: -0.3125rem; }
+ ul.pagination li {
+ height: 1.5rem;
+ color: #222222;
+ font-size: 0.875rem;
+ margin-left: 0.3125rem; }
+ ul.pagination li a {
+ display: block;
+ padding: 0.0625rem 0.625rem 0.0625rem;
+ color: #999999;
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+ ul.pagination li:hover a, ul.pagination li a:focus {
+ background: #e6e6e6; }
+ ul.pagination li.unavailable a {
+ cursor: default;
+ color: #999999; }
+ ul.pagination li.unavailable:hover a, ul.pagination li.unavailable a:focus {
+ background: transparent; }
+ ul.pagination li.current a {
+ background: #008cba;
+ color: white;
+ font-weight: bold;
+ cursor: default; }
+ ul.pagination li.current a:hover, ul.pagination li.current a:focus {
+ background: #008cba; }
+ ul.pagination li {
+ float: left;
+ display: block; }
+
+/* Pagination centred wrapper */
+.pagination-centered {
+ text-align: center; }
+ .pagination-centered ul.pagination li {
+ float: none;
+ display: inline-block; }
+
+/* Panels */
+.panel {
+ border-style: solid;
+ border-width: 1px;
+ border-color: #d7d7d7;
+ margin-bottom: 1.25rem;
+ padding: 1.25rem;
+ background: #f2f2f2; }
+ .panel > :first-child {
+ margin-top: 0; }
+ .panel > :last-child {
+ margin-bottom: 0; }
+ .panel h1, .panel h2, .panel h3, .panel h4, .panel h5, .panel h6, .panel p {
+ color: #333333; }
+ .panel h1, .panel h2, .panel h3, .panel h4, .panel h5, .panel h6 {
+ line-height: 1;
+ margin-bottom: 0.625rem; }
+ .panel h1.subheader, .panel h2.subheader, .panel h3.subheader, .panel h4.subheader, .panel h5.subheader, .panel h6.subheader {
+ line-height: 1.4; }
+ .panel.callout {
+ border-style: solid;
+ border-width: 1px;
+ border-color: #b6edff;
+ margin-bottom: 1.25rem;
+ padding: 1.25rem;
+ background: #ecfaff; }
+ .panel.callout > :first-child {
+ margin-top: 0; }
+ .panel.callout > :last-child {
+ margin-bottom: 0; }
+ .panel.callout h1, .panel.callout h2, .panel.callout h3, .panel.callout h4, .panel.callout h5, .panel.callout h6, .panel.callout p {
+ color: #333333; }
+ .panel.callout h1, .panel.callout h2, .panel.callout h3, .panel.callout h4, .panel.callout h5, .panel.callout h6 {
+ line-height: 1;
+ margin-bottom: 0.625rem; }
+ .panel.callout h1.subheader, .panel.callout h2.subheader, .panel.callout h3.subheader, .panel.callout h4.subheader, .panel.callout h5.subheader, .panel.callout h6.subheader {
+ line-height: 1.4; }
+ .panel.callout a {
+ color: #008cba; }
+ .panel.radius {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+
+/* Pricing Tables */
+.pricing-table {
+ border: solid 1px #dddddd;
+ margin-left: 0;
+ margin-bottom: 1.25rem; }
+ .pricing-table * {
+ list-style: none;
+ line-height: 1; }
+ .pricing-table .title {
+ background-color: #333333;
+ padding: 0.9375rem 1.25rem;
+ text-align: center;
+ color: #eeeeee;
+ font-weight: normal;
+ font-size: 1rem;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif; }
+ .pricing-table .price {
+ background-color: #f6f6f6;
+ padding: 0.9375rem 1.25rem;
+ text-align: center;
+ color: #333333;
+ font-weight: normal;
+ font-size: 2rem;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif; }
+ .pricing-table .description {
+ background-color: white;
+ padding: 0.9375rem;
+ text-align: center;
+ color: #777777;
+ font-size: 0.75rem;
+ font-weight: normal;
+ line-height: 1.4;
+ border-bottom: dotted 1px #dddddd; }
+ .pricing-table .bullet-item {
+ background-color: white;
+ padding: 0.9375rem;
+ text-align: center;
+ color: #333333;
+ font-size: 0.875rem;
+ font-weight: normal;
+ border-bottom: dotted 1px #dddddd; }
+ .pricing-table .cta-button {
+ background-color: white;
+ text-align: center;
+ padding: 1.25rem 1.25rem 0; }
+
+/* Progress Bar */
+.progress {
+ background-color: #f6f6f6;
+ height: 1.5625rem;
+ border: 1px solid white;
+ padding: 0.125rem;
+ margin-bottom: 0.625rem; }
+ .progress .meter {
+ background: #008cba;
+ height: 100%;
+ display: block; }
+ .progress.secondary .meter {
+ background: #e7e7e7;
+ height: 100%;
+ display: block; }
+ .progress.success .meter {
+ background: #43ac6a;
+ height: 100%;
+ display: block; }
+ .progress.alert .meter {
+ background: #f04124;
+ height: 100%;
+ display: block; }
+ .progress.radius {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+ .progress.radius .meter {
+ -webkit-border-radius: 2px;
+ border-radius: 2px; }
+ .progress.round {
+ -webkit-border-radius: 1000px;
+ border-radius: 1000px; }
+ .progress.round .meter {
+ -webkit-border-radius: 999px;
+ border-radius: 999px; }
+
+.reveal-modal-bg {
+ position: fixed;
+ height: 100%;
+ width: 100%;
+ background: black;
+ background: rgba(0, 0, 0, 0.45);
+ z-index: 98;
+ display: none;
+ top: 0;
+ left: 0; }
+
+dialog, .reveal-modal {
+ visibility: hidden;
+ display: none;
+ position: absolute;
+ left: 50%;
+ z-index: 99;
+ height: auto;
+ margin-left: -40%;
+ width: 80%;
+ background-color: white;
+ padding: 1.25rem;
+ border: solid 1px #666666;
+ -webkit-box-shadow: 0 0 10px rgba(0, 0, 0, 0.4);
+ box-shadow: 0 0 10px rgba(0, 0, 0, 0.4);
+ top: 6.25rem; }
+ dialog .column, dialog .columns, .reveal-modal .column, .reveal-modal .columns {
+ min-width: 0; }
+ dialog > :first-child, .reveal-modal > :first-child {
+ margin-top: 0; }
+ dialog > :last-child, .reveal-modal > :last-child {
+ margin-bottom: 0; }
+ dialog .close-reveal-modal, .reveal-modal .close-reveal-modal {
+ font-size: 1.375rem;
+ line-height: 1;
+ position: absolute;
+ top: 0.5rem;
+ right: 0.6875rem;
+ color: #aaaaaa;
+ font-weight: bold;
+ cursor: pointer; }
+
+dialog[open] {
+ display: block;
+ visibility: visible; }
+
+@media only screen and (min-width:40.063em) {
+ dialog, .reveal-modal {
+ padding: 1.875rem;
+ top: 6.25rem; }
+ dialog.tiny, .reveal-modal.tiny {
+ margin-left: -15%;
+ width: 30%; }
+ dialog.small, .reveal-modal.small {
+ margin-left: -20%;
+ width: 40%; }
+ dialog.medium, .reveal-modal.medium {
+ margin-left: -30%;
+ width: 60%; }
+ dialog.large, .reveal-modal.large {
+ margin-left: -35%;
+ width: 70%; }
+ dialog.xlarge, .reveal-modal.xlarge {
+ margin-left: -47.5%;
+ width: 95%; } }
+
+@media print {
+ dialog, .reveal-modal {
+ background: white !important; } }
+
+.side-nav {
+ display: block;
+ margin: 0;
+ padding: 0.875rem 0;
+ list-style-type: none;
+ list-style-position: inside;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif; }
+ .side-nav li {
+ margin: 0 0 0.4375rem 0;
+ font-size: 0.875rem; }
+ .side-nav li a:not(.button) {
+ display: block;
+ color: #008cba; }
+ .side-nav li a:not(.button):hover, .side-nav li a:not(.button):focus {
+ color: #1ccaff; }
+ .side-nav li.active > a:first-child:not(.button) {
+ color: #1ccaff;
+ font-weight: normal;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif; }
+ .side-nav li.divider {
+ border-top: 1px solid;
+ height: 0;
+ padding: 0;
+ list-style: none;
+ border-top-color: white; }
+
+.split.button {
+ position: relative;
+ padding-right: 5.0625rem; }
+ .split.button span {
+ display: block;
+ height: 100%;
+ position: absolute;
+ right: 0;
+ top: 0;
+ border-left: solid 1px; }
+ .split.button span:before {
+ position: absolute;
+ content: "";
+ width: 0;
+ height: 0;
+ display: block;
+ border-style: inset;
+ top: 50%;
+ left: 50%; }
+ .split.button span:active {
+ background-color: rgba(0, 0, 0, 0.1); }
+ .split.button span {
+ border-left-color: rgba(255, 255, 255, 0.5); }
+ .split.button span {
+ width: 3.09375rem; }
+ .split.button span:before {
+ border-top-style: solid;
+ border-width: 0.375rem;
+ top: 48%;
+ margin-left: -0.375rem; }
+ .split.button span:before {
+ border-color: white transparent transparent transparent; }
+ .split.button.secondary span {
+ border-left-color: rgba(255, 255, 255, 0.5); }
+ .split.button.secondary span:before {
+ border-color: white transparent transparent transparent; }
+ .split.button.alert span {
+ border-left-color: rgba(255, 255, 255, 0.5); }
+ .split.button.success span {
+ border-left-color: rgba(255, 255, 255, 0.5); }
+ .split.button.tiny {
+ padding-right: 3.75rem; }
+ .split.button.tiny span {
+ width: 2.25rem; }
+ .split.button.tiny span:before {
+ border-top-style: solid;
+ border-width: 0.375rem;
+ top: 48%;
+ margin-left: -0.375rem; }
+ .split.button.small {
+ padding-right: 4.375rem; }
+ .split.button.small span {
+ width: 2.625rem; }
+ .split.button.small span:before {
+ border-top-style: solid;
+ border-width: 0.4375rem;
+ top: 48%;
+ margin-left: -0.375rem; }
+ .split.button.large {
+ padding-right: 5.5rem; }
+ .split.button.large span {
+ width: 3.4375rem; }
+ .split.button.large span:before {
+ border-top-style: solid;
+ border-width: 0.3125rem;
+ top: 48%;
+ margin-left: -0.375rem; }
+ .split.button.expand {
+ padding-left: 2rem; }
+ .split.button.secondary span:before {
+ border-color: #333333 transparent transparent transparent; }
+ .split.button.radius span {
+ -moz-border-radius-bottomright: 3px;
+ -moz-border-radius-topright: 3px;
+ -webkit-border-bottom-right-radius: 3px;
+ -webkit-border-top-right-radius: 3px;
+ border-bottom-right-radius: 3px;
+ border-top-right-radius: 3px; }
+ .split.button.round span {
+ -moz-border-radius-bottomright: 1000px;
+ -moz-border-radius-topright: 1000px;
+ -webkit-border-bottom-right-radius: 1000px;
+ -webkit-border-top-right-radius: 1000px;
+ border-bottom-right-radius: 1000px;
+ border-top-right-radius: 1000px; }
+
+.sub-nav {
+ display: block;
+ width: auto;
+ overflow: hidden;
+ margin: -0.25rem 0 1.125rem;
+ padding-top: 0.25rem;
+ margin-right: 0;
+ margin-left: -0.75rem; }
+ .sub-nav dt {
+ text-transform: uppercase; }
+ .sub-nav dt, .sub-nav dd, .sub-nav li {
+ float: left;
+ display: inline;
+ margin-left: 1rem;
+ margin-bottom: 0.625rem;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif;
+ font-weight: normal;
+ font-size: 0.875rem;
+ color: #999999; }
+ .sub-nav dt a, .sub-nav dd a, .sub-nav li a {
+ text-decoration: none;
+ color: #999999;
+ padding: 0.1875rem 1rem; }
+ .sub-nav dt a:hover, .sub-nav dd a:hover, .sub-nav li a:hover {
+ color: #737373; }
+ .sub-nav dt.active a, .sub-nav dd.active a, .sub-nav li.active a {
+ -webkit-border-radius: 3px;
+ border-radius: 3px;
+ font-weight: normal;
+ background: #008cba;
+ padding: 0.1875rem 1rem;
+ cursor: default;
+ color: white; }
+ .sub-nav dt.active a:hover, .sub-nav dd.active a:hover, .sub-nav li.active a:hover {
+ background: #007ba0; }
+
+div.switch {
+ position: relative;
+ padding: 0;
+ display: block;
+ overflow: hidden;
+ border-style: solid;
+ border-width: 1px;
+ margin-bottom: 1.25rem;
+ height: 2.25rem;
+ background: white;
+ border-color: #cccccc; }
+ div.switch label {
+ position: relative;
+ left: 0;
+ z-index: 2;
+ float: left;
+ width: 50%;
+ height: 100%;
+ margin: 0;
+ font-weight: bold;
+ text-align: left;
+ -webkit-transition: all 0.1s ease-out;
+ -moz-transition: all 0.1s ease-out;
+ transition: all 0.1s ease-out; }
+ div.switch input {
+ position: absolute;
+ z-index: 3;
+ opacity: 0;
+ width: 100%;
+ height: 100%;
+ -moz-appearance: none; }
+ div.switch input:hover, div.switch input:focus {
+ cursor: pointer; }
+ div.switch span:last-child {
+ position: absolute;
+ top: -1px;
+ left: -1px;
+ z-index: 1;
+ display: block;
+ padding: 0;
+ border-width: 1px;
+ border-style: solid;
+ -webkit-transition: all 0.1s ease-out;
+ -moz-transition: all 0.1s ease-out;
+ transition: all 0.1s ease-out; }
+ div.switch input:not(:checked) + label {
+ opacity: 0; }
+ div.switch input:checked {
+ display: none !important; }
+ div.switch input {
+ left: 0;
+ display: block !important; }
+ div.switch input:first-of-type + label, div.switch input:first-of-type + span + label {
+ left: -50%; }
+ div.switch input:first-of-type:checked + label, div.switch input:first-of-type:checked + span + label {
+ left: 0%; }
+ div.switch input:last-of-type + label, div.switch input:last-of-type + span + label {
+ right: -50%;
+ left: auto;
+ text-align: right; }
+ div.switch input:last-of-type:checked + label, div.switch input:last-of-type:checked + span + label {
+ right: 0%;
+ left: auto; }
+ div.switch span.custom {
+ display: none !important; }
+ form.custom div.switch .hidden-field {
+ margin-left: auto;
+ position: absolute;
+ visibility: visible; }
+ div.switch label {
+ padding: 0;
+ line-height: 2.3rem;
+ font-size: 0.875rem; }
+ div.switch input:first-of-type:checked ~ span:last-child {
+ left: 100%;
+ margin-left: -2.1875rem; }
+ div.switch span:last-child {
+ width: 2.25rem;
+ height: 2.25rem; }
+ div.switch span:last-child {
+ border-color: #b3b3b3;
+ background: white;
+ background: -moz-linear-gradient(top, #ffffff 0%, #f2f2f2 100%);
+ background: -webkit-linear-gradient(top, #ffffff 0%, #f2f2f2 100%);
+ background: linear-gradient(to bottom, #ffffff 0%, #f2f2f2 100%);
+ -webkit-box-shadow: 2px 0 10px 0 rgba(0, 0, 0, 0.07), 1000px 0 0 1000px #f3faf6, -2px 0 10px 0 rgba(0, 0, 0, 0.07), -1000px 0 0 1000px whitesmoke;
+ box-shadow: 2px 0 10px 0 rgba(0, 0, 0, 0.07), 1000px 0 0 980px #f3faf6, -2px 0 10px 0 rgba(0, 0, 0, 0.07), -1000px 0 0 1000px whitesmoke; }
+ div.switch:hover span:last-child, div.switch:focus span:last-child {
+ background: white;
+ background: -moz-linear-gradient(top, #ffffff 0%, #e6e6e6 100%);
+ background: -webkit-linear-gradient(top, #ffffff 0%, #e6e6e6 100%);
+ background: linear-gradient(to bottom, #ffffff 0%, #e6e6e6 100%); }
+ div.switch:active {
+ background: transparent; }
+ div.switch.large {
+ height: 2.75rem; }
+ div.switch.large label {
+ padding: 0;
+ line-height: 2.3rem;
+ font-size: 1.0625rem; }
+ div.switch.large input:first-of-type:checked ~ span:last-child {
+ left: 100%;
+ margin-left: -2.6875rem; }
+ div.switch.large span:last-child {
+ width: 2.75rem;
+ height: 2.75rem; }
+ div.switch.small {
+ height: 1.75rem; }
+ div.switch.small label {
+ padding: 0;
+ line-height: 2.1rem;
+ font-size: 0.75rem; }
+ div.switch.small input:first-of-type:checked ~ span:last-child {
+ left: 100%;
+ margin-left: -1.6875rem; }
+ div.switch.small span:last-child {
+ width: 1.75rem;
+ height: 1.75rem; }
+ div.switch.tiny {
+ height: 1.375rem; }
+ div.switch.tiny label {
+ padding: 0;
+ line-height: 1.9rem;
+ font-size: 0.6875rem; }
+ div.switch.tiny input:first-of-type:checked ~ span:last-child {
+ left: 100%;
+ margin-left: -1.3125rem; }
+ div.switch.tiny span:last-child {
+ width: 1.375rem;
+ height: 1.375rem; }
+ div.switch.radius {
+ -webkit-border-radius: 4px;
+ border-radius: 4px; }
+ div.switch.radius span:last-child {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+ div.switch.round {
+ -webkit-border-radius: 1000px;
+ border-radius: 1000px; }
+ div.switch.round span:last-child {
+ -webkit-border-radius: 999px;
+ border-radius: 999px; }
+ div.switch.round label {
+ padding: 0 0.5625rem; }
+
+@-webkit-keyframes webkitSiblingBugfix {
+ from {
+ position: relative; }
+
+ to {
+ position: relative; } }
+
+table {
+ background: white;
+ margin-bottom: 1.25rem;
+ border: solid 1px #dddddd; }
+ table thead, table tfoot {
+ background: whitesmoke; }
+ table thead tr th, table thead tr td, table tfoot tr th, table tfoot tr td {
+ padding: 0.5rem 0.625rem 0.625rem;
+ font-size: 0.875rem;
+ font-weight: bold;
+ color: #222222;
+ text-align: left; }
+ table tr th, table tr td {
+ padding: 0.5625rem 0.625rem;
+ font-size: 0.875rem;
+ color: #222222; }
+ table tr.even, table tr.alt, table tr:nth-of-type(even) {
+ background: #f9f9f9; }
+ table thead tr th, table tfoot tr th, table tbody tr td, table tr td, table tfoot tr td {
+ display: table-cell;
+ line-height: 1.125rem; }
+
+.tabs {
+ *zoom: 1;
+ margin-bottom: 0 !important; }
+ .tabs:before, .tabs:after {
+ content: " ";
+ display: table; }
+ .tabs:after {
+ clear: both; }
+ .tabs dd {
+ position: relative;
+ margin-bottom: 0 !important;
+ top: 1px;
+ float: left; }
+ .tabs dd > a {
+ display: block;
+ background: #efefef;
+ color: #222222;
+ padding-top: 1rem;
+ padding-right: 2rem;
+ padding-bottom: 1.0625rem;
+ padding-left: 2rem;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif;
+ font-size: 1rem; }
+ .tabs dd > a:hover {
+ background: #e1e1e1; }
+ .tabs dd.active a {
+ background: white; }
+ .tabs.radius dd:first-child a {
+ -moz-border-radius-bottomleft: 3px;
+ -moz-border-radius-topleft: 3px;
+ -webkit-border-bottom-left-radius: 3px;
+ -webkit-border-top-left-radius: 3px;
+ border-bottom-left-radius: 3px;
+ border-top-left-radius: 3px; }
+ .tabs.radius dd:last-child a {
+ -moz-border-radius-bottomright: 3px;
+ -moz-border-radius-topright: 3px;
+ -webkit-border-bottom-right-radius: 3px;
+ -webkit-border-top-right-radius: 3px;
+ border-bottom-right-radius: 3px;
+ border-top-right-radius: 3px; }
+ .tabs.vertical dd {
+ position: inherit;
+ float: none;
+ display: block;
+ top: auto; }
+
+.tabs-content {
+ *zoom: 1;
+ margin-bottom: 1.5rem;
+ width: 100%; }
+ .tabs-content:before, .tabs-content:after {
+ content: " ";
+ display: table; }
+ .tabs-content:after {
+ clear: both; }
+ .tabs-content > .content {
+ display: none;
+ float: left;
+ padding: 0.9375rem 0;
+ width: 100%; }
+ .tabs-content > .content.active {
+ display: block; }
+ .tabs-content > .content.contained {
+ padding: 0.9375rem; }
+ .tabs-content.vertical {
+ display: block; }
+ .tabs-content.vertical > .content {
+ padding: 0 0.9375rem; }
+
+@media only screen and (min-width:40.063em) {
+ .tabs.vertical {
+ width: 20%;
+ float: left;
+ margin-bottom: 1.25rem; }
+ .tabs-content.vertical {
+ width: 80%;
+ float: left;
+ margin-left: -1px; } }
+
+/* Image Thumbnails */
+.th {
+ line-height: 0;
+ display: inline-block;
+ border: solid 4px white;
+ max-width: 100%;
+ -webkit-box-shadow: 0 0 0 1px rgba(0, 0, 0, 0.2);
+ box-shadow: 0 0 0 1px rgba(0, 0, 0, 0.2);
+ -webkit-transition: all 200ms ease-out;
+ -moz-transition: all 200ms ease-out;
+ transition: all 200ms ease-out; }
+ .th:hover, .th:focus {
+ -webkit-box-shadow: 0 0 6px 1px rgba(0, 140, 186, 0.5);
+ box-shadow: 0 0 6px 1px rgba(0, 140, 186, 0.5); }
+ .th.radius {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+
+/* Tooltips */
+.has-tip {
+ border-bottom: dotted 1px #cccccc;
+ cursor: help;
+ font-weight: bold;
+ color: #333333; }
+ .has-tip:hover, .has-tip:focus {
+ border-bottom: dotted 1px #004054;
+ color: #008cba; }
+ .has-tip.tip-left, .has-tip.tip-right {
+ float: none !important; }
+
+.tooltip {
+ display: none;
+ position: absolute;
+ z-index: 999;
+ font-weight: normal;
+ font-size: 0.875rem;
+ line-height: 1.3;
+ padding: 0.75rem;
+ max-width: 85%;
+ left: 50%;
+ width: 100%;
+ color: white;
+ background: #333333; }
+ .tooltip > .nub {
+ display: block;
+ left: 5px;
+ position: absolute;
+ width: 0;
+ height: 0;
+ border: solid 5px;
+ border-color: transparent transparent #333333 transparent;
+ top: -10px; }
+ .tooltip.radius {
+ -webkit-border-radius: 3px;
+ border-radius: 3px; }
+ .tooltip.round {
+ -webkit-border-radius: 1000px;
+ border-radius: 1000px; }
+ .tooltip.round > .nub {
+ left: 2rem; }
+ .tooltip.opened {
+ color: #008cba !important;
+ border-bottom: dotted 1px #004054 !important; }
+
+.tap-to-close {
+ display: block;
+ font-size: 0.625rem;
+ color: #777777;
+ font-weight: normal; }
+
+@media only screen and (min-width:40.063em) {
+ .tooltip > .nub {
+ border-color: transparent transparent #333333 transparent;
+ top: -10px; }
+ .tooltip.tip-top > .nub {
+ border-color: #333333 transparent transparent transparent;
+ top: auto;
+ bottom: -10px; }
+ .tooltip.tip-left, .tooltip.tip-right {
+ float: none !important; }
+ .tooltip.tip-left > .nub {
+ border-color: transparent transparent transparent #333333;
+ right: -10px;
+ left: auto;
+ top: 50%;
+ margin-top: -5px; }
+ .tooltip.tip-right > .nub {
+ border-color: transparent #333333 transparent transparent;
+ right: auto;
+ left: -10px;
+ top: 50%;
+ margin-top: -5px; } }
+
+meta.foundation-mq-topbar {
+ font-family: "/only screen and (min-width:40.063em)/";
+ width: 40.063em; }
+
+/* Wrapped around .top-bar to contain to grid width */
+.contain-to-grid {
+ width: 100%;
+ background: #333333; }
+ .contain-to-grid .top-bar {
+ margin-bottom: 0; }
+
+.fixed {
+ width: 100%;
+ left: 0;
+ position: fixed;
+ top: 0;
+ z-index: 99; }
+ .fixed.expanded:not(.top-bar) {
+ overflow-y: auto;
+ height: auto;
+ width: 100%;
+ max-height: 100%; }
+ .fixed.expanded:not(.top-bar) .title-area {
+ position: fixed;
+ width: 100%;
+ z-index: 99; }
+ .fixed.expanded:not(.top-bar) .top-bar-section {
+ z-index: 98;
+ margin-top: 45px; }
+
+.top-bar {
+ overflow: hidden;
+ height: 45px;
+ line-height: 45px;
+ position: relative;
+ background: #333333;
+ margin-bottom: 0; }
+ .top-bar ul {
+ margin-bottom: 0;
+ list-style: none; }
+ .top-bar .row {
+ max-width: none; }
+ .top-bar form, .top-bar input {
+ margin-bottom: 0; }
+ .top-bar input {
+ height: auto;
+ padding-top: 0.35rem;
+ padding-bottom: 0.35rem;
+ font-size: 0.75rem; }
+ .top-bar .button {
+ padding-top: 0.45rem;
+ padding-bottom: 0.35rem;
+ margin-bottom: 0;
+ font-size: 0.75rem; }
+ .top-bar .title-area {
+ position: relative;
+ margin: 0; }
+ .top-bar .name {
+ height: 45px;
+ margin: 0;
+ font-size: 16px; }
+ .top-bar .name h1 {
+ line-height: 45px;
+ font-size: 1.0625rem;
+ margin: 0; }
+ .top-bar .name h1 a {
+ font-weight: normal;
+ color: white;
+ width: 50%;
+ display: block;
+ padding: 0 15px; }
+ .top-bar .toggle-topbar {
+ position: absolute;
+ right: 0;
+ top: 0; }
+ .top-bar .toggle-topbar a {
+ color: white;
+ text-transform: uppercase;
+ font-size: 0.8125rem;
+ font-weight: bold;
+ position: relative;
+ display: block;
+ padding: 0 15px;
+ height: 45px;
+ line-height: 45px; }
+ .top-bar .toggle-topbar.menu-icon {
+ right: 15px;
+ top: 50%;
+ margin-top: -16px;
+ padding-left: 40px; }
+ .top-bar .toggle-topbar.menu-icon a {
+ height: 34px;
+ line-height: 33px;
+ padding: 0;
+ padding-right: 25px;
+ color: white;
+ position: relative; }
+ .top-bar .toggle-topbar.menu-icon a::after {
+ content: "";
+ position: absolute;
+ right: 0;
+ display: block;
+ width: 16px;
+ top: 0;
+ height: 0;
+ -webkit-box-shadow: 0 10px 0 1px white, 0 16px 0 1px white, 0 22px 0 1px white;
+ box-shadow: 0 10px 0 1px white, 0 16px 0 1px white, 0 22px 0 1px white; }
+ .top-bar.expanded {
+ height: auto;
+ background: transparent; }
+ .top-bar.expanded .title-area {
+ background: #333333; }
+ .top-bar.expanded .toggle-topbar a {
+ color: #888888; }
+ .top-bar.expanded .toggle-topbar a span {
+ -webkit-box-shadow: 0 10px 0 1px #888888, 0 16px 0 1px #888888, 0 22px 0 1px #888888;
+ box-shadow: 0 10px 0 1px #888888, 0 16px 0 1px #888888, 0 22px 0 1px #888888; }
+
+.top-bar-section {
+ left: 0;
+ position: relative;
+ width: auto;
+ -webkit-transition: left 300ms ease-out;
+ -moz-transition: left 300ms ease-out;
+ transition: left 300ms ease-out; }
+ .top-bar-section ul {
+ width: 100%;
+ height: auto;
+ display: block;
+ background: #333333;
+ font-size: 16px;
+ margin: 0; }
+ .top-bar-section .divider, .top-bar-section [role="separator"] {
+ border-top: solid 1px #1a1a1a;
+ clear: both;
+ height: 1px;
+ width: 100%; }
+ .top-bar-section ul li > a {
+ display: block;
+ width: 100%;
+ color: white;
+ padding: 12px 0 12px 0;
+ padding-left: 15px;
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif;
+ font-size: 0.8125rem;
+ font-weight: normal;
+ background: #333333; }
+ .top-bar-section ul li > a.button {
+ background: #008cba;
+ font-size: 0.8125rem;
+ padding-right: 15px;
+ padding-left: 15px; }
+ .top-bar-section ul li > a.button:hover {
+ background: #006888; }
+ .top-bar-section ul li > a.button.secondary {
+ background: #e7e7e7; }
+ .top-bar-section ul li > a.button.secondary:hover {
+ background: #cecece; }
+ .top-bar-section ul li > a.button.success {
+ background: #43ac6a; }
+ .top-bar-section ul li > a.button.success:hover {
+ background: #358853; }
+ .top-bar-section ul li > a.button.alert {
+ background: #f04124; }
+ .top-bar-section ul li > a.button.alert:hover {
+ background: #d4290f; }
+ .top-bar-section ul li:hover > a {
+ background: #272727;
+ color: white; }
+ .top-bar-section ul li.active > a {
+ background: #008cba;
+ color: white; }
+ .top-bar-section ul li.active > a:hover {
+ background: #007ba0;
+ color: white; }
+ .top-bar-section .has-form {
+ padding: 15px; }
+ .top-bar-section .has-dropdown {
+ position: relative; }
+ .top-bar-section .has-dropdown > a:after {
+ content: "";
+ display: block;
+ width: 0;
+ height: 0;
+ border: inset 5px;
+ border-color: transparent transparent transparent rgba(255, 255, 255, 0.4);
+ border-left-style: solid;
+ margin-right: 15px;
+ margin-top: -4.5px;
+ position: absolute;
+ top: 50%;
+ right: 0; }
+ .top-bar-section .has-dropdown.moved {
+ position: static; }
+ .top-bar-section .has-dropdown.moved > .dropdown {
+ display: block; }
+ .top-bar-section .dropdown {
+ position: absolute;
+ left: 100%;
+ top: 0;
+ display: none;
+ z-index: 99; }
+ .top-bar-section .dropdown li {
+ width: 100%;
+ height: auto; }
+ .top-bar-section .dropdown li a {
+ font-weight: normal;
+ padding: 8px 15px; }
+ .top-bar-section .dropdown li a.parent-link {
+ font-weight: normal; }
+ .top-bar-section .dropdown li.title h5 {
+ margin-bottom: 0; }
+ .top-bar-section .dropdown li.title h5 a {
+ color: white;
+ line-height: 22.5px;
+ display: block; }
+ .top-bar-section .dropdown li.has-form {
+ padding: 8px 15px; }
+ .top-bar-section .dropdown li .button {
+ top: auto; }
+ .top-bar-section .dropdown label {
+ padding: 8px 15px 2px;
+ margin-bottom: 0;
+ text-transform: uppercase;
+ color: #777777;
+ font-weight: bold;
+ font-size: 0.625rem; }
+
+.js-generated {
+ display: block; }
+
+@media only screen and (min-width:40.063em) {
+ .top-bar {
+ background: #333333;
+ *zoom: 1;
+ overflow: visible; }
+ .top-bar:before, .top-bar:after {
+ content: " ";
+ display: table; }
+ .top-bar:after {
+ clear: both; }
+ .top-bar .toggle-topbar {
+ display: none; }
+ .top-bar .title-area {
+ float: left; }
+ .top-bar .name h1 a {
+ width: auto; }
+ .top-bar input, .top-bar .button {
+ font-size: 0.875rem;
+ position: relative;
+ top: 7px; }
+ .top-bar.expanded {
+ background: #333333; }
+ .contain-to-grid .top-bar {
+ max-width: 62.5rem;
+ margin: 0 auto;
+ margin-bottom: 0; }
+ .top-bar-section {
+ -webkit-transition: none 0 0;
+ -moz-transition: none 0 0;
+ transition: none 0 0;
+ left: 0 !important; }
+ .top-bar-section ul {
+ width: auto;
+ height: auto !important;
+ display: inline; }
+ .top-bar-section ul li {
+ float: left; }
+ .top-bar-section ul li .js-generated {
+ display: none; }
+ .top-bar-section li.hover > a:not(.button) {
+ background: #272727;
+ color: white; }
+ .top-bar-section li:not(.has-form) a:not(.button) {
+ padding: 0 15px;
+ line-height: 45px;
+ background: #333333; }
+ .top-bar-section li:not(.has-form) a:not(.button):hover {
+ background: #272727; }
+ .top-bar-section li.active:not(.has-form) a:not(.button) {
+ padding: 0 15px;
+ line-height: 45px;
+ color: white;
+ background: #008cba; }
+ .top-bar-section li.active:not(.has-form) a:not(.button):hover {
+ background: #007ba0; }
+ .top-bar-section .has-dropdown > a {
+ padding-right: 35px !important; }
+ .top-bar-section .has-dropdown > a:after {
+ content: "";
+ display: block;
+ width: 0;
+ height: 0;
+ border: inset 5px;
+ border-color: rgba(255, 255, 255, 0.4) transparent transparent transparent;
+ border-top-style: solid;
+ margin-top: -2.5px;
+ top: 22.5px; }
+ .top-bar-section .has-dropdown.moved {
+ position: relative; }
+ .top-bar-section .has-dropdown.moved > .dropdown {
+ display: none; }
+ .top-bar-section .has-dropdown.hover > .dropdown, .top-bar-section .has-dropdown.not-click:hover > .dropdown {
+ display: block; }
+ .top-bar-section .has-dropdown .dropdown li.has-dropdown > a:after {
+ border: none;
+ content: "\00bb";
+ top: 1rem;
+ margin-top: -2px;
+ right: 5px;
+ line-height: 1.2; }
+ .top-bar-section .dropdown {
+ left: 0;
+ top: auto;
+ background: transparent;
+ min-width: 100%; }
+ .top-bar-section .dropdown li a {
+ color: white;
+ line-height: 1;
+ white-space: nowrap;
+ padding: 12px 15px;
+ background: #333333; }
+ .top-bar-section .dropdown li label {
+ white-space: nowrap;
+ background: #333333; }
+ .top-bar-section .dropdown li .dropdown {
+ left: 100%;
+ top: 0; }
+ .top-bar-section > ul > .divider, .top-bar-section > ul > [role="separator"] {
+ border-bottom: none;
+ border-top: none;
+ border-right: solid 1px #4e4e4e;
+ clear: none;
+ height: 45px;
+ width: 0; }
+ .top-bar-section .has-form {
+ background: #333333;
+ padding: 0 15px;
+ height: 45px; }
+ .top-bar-section .right li .dropdown {
+ left: auto;
+ right: 0; }
+ .top-bar-section .right li .dropdown li .dropdown {
+ right: 100%; }
+ .top-bar-section .left li .dropdown {
+ right: auto;
+ left: 0; }
+ .top-bar-section .left li .dropdown li .dropdown {
+ left: 100%; }
+ .no-js .top-bar-section ul li:hover > a {
+ background: #272727;
+ color: white; }
+ .no-js .top-bar-section ul li:active > a {
+ background: #008cba;
+ color: white; }
+ .no-js .top-bar-section .has-dropdown:hover > .dropdown {
+ display: block; } }
+
+.text-left {
+ text-align: left !important; }
+
+.text-right {
+ text-align: right !important; }
+
+.text-center {
+ text-align: center !important; }
+
+.text-justify {
+ text-align: justify !important; }
+
+@media only screen and (max-width: 40em) {
+ .small-only-text-left {
+ text-align: left !important; }
+ .small-only-text-right {
+ text-align: right !important; }
+ .small-only-text-center {
+ text-align: center !important; }
+ .small-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen {
+ .small-text-left {
+ text-align: left !important; }
+ .small-text-right {
+ text-align: right !important; }
+ .small-text-center {
+ text-align: center !important; }
+ .small-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:40.063em) and (max-width:64em) {
+ .medium-only-text-left {
+ text-align: left !important; }
+ .medium-only-text-right {
+ text-align: right !important; }
+ .medium-only-text-center {
+ text-align: center !important; }
+ .medium-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:40.063em) {
+ .medium-text-left {
+ text-align: left !important; }
+ .medium-text-right {
+ text-align: right !important; }
+ .medium-text-center {
+ text-align: center !important; }
+ .medium-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:64.063em) and (max-width:90em) {
+ .large-only-text-left {
+ text-align: left !important; }
+ .large-only-text-right {
+ text-align: right !important; }
+ .large-only-text-center {
+ text-align: center !important; }
+ .large-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:64.063em) {
+ .large-text-left {
+ text-align: left !important; }
+ .large-text-right {
+ text-align: right !important; }
+ .large-text-center {
+ text-align: center !important; }
+ .large-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:90.063em) and (max-width:120em) {
+ .xlarge-only-text-left {
+ text-align: left !important; }
+ .xlarge-only-text-right {
+ text-align: right !important; }
+ .xlarge-only-text-center {
+ text-align: center !important; }
+ .xlarge-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:90.063em) {
+ .xlarge-text-left {
+ text-align: left !important; }
+ .xlarge-text-right {
+ text-align: right !important; }
+ .xlarge-text-center {
+ text-align: center !important; }
+ .xlarge-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:120.063em) and (max-width:99999999em) {
+ .xxlarge-only-text-left {
+ text-align: left !important; }
+ .xxlarge-only-text-right {
+ text-align: right !important; }
+ .xxlarge-only-text-center {
+ text-align: center !important; }
+ .xxlarge-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:120.063em) {
+ .xxlarge-text-left {
+ text-align: left !important; }
+ .xxlarge-text-right {
+ text-align: right !important; }
+ .xxlarge-text-center {
+ text-align: center !important; }
+ .xxlarge-text-justify {
+ text-align: justify !important; } }
+
+/* Typography resets */
+div, dl, dt, dd, ul, ol, li, h1, h2, h3, h4, h5, h6, pre, form, p, blockquote, th, td {
+ margin: 0;
+ padding: 0; }
+
+/* Default Link Styles */
+a {
+ color: #008cba;
+ text-decoration: none;
+ line-height: inherit; }
+ a:hover, a:focus {
+ color: #007ba0; }
+ a img {
+ border: none; }
+
+/* Default paragraph styles */
+p {
+ font-family: inherit;
+ font-weight: normal;
+ font-size: 1rem;
+ line-height: 1.6;
+ margin-bottom: 1.25rem;
+ text-rendering: optimizeLegibility; }
+ p.lead {
+ font-size: 1.21875rem;
+ line-height: 1.6; }
+ p aside {
+ font-size: 0.875rem;
+ line-height: 1.35;
+ font-style: italic; }
+
+/* Default header styles */
+h1, h2, h3, h4, h5, h6 {
+ font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif;
+ font-weight: normal;
+ font-style: normal;
+ color: #222222;
+ text-rendering: optimizeLegibility;
+ margin-top: 0.2rem;
+ margin-bottom: 0.5rem;
+ line-height: 1.4; }
+ h1 small, h2 small, h3 small, h4 small, h5 small, h6 small {
+ font-size: 60%;
+ color: #6f6f6f;
+ line-height: 0; }
+
+h1 {
+ font-size: 2.125rem; }
+
+h2 {
+ font-size: 1.6875rem; }
+
+h3 {
+ font-size: 1.375rem; }
+
+h4 {
+ font-size: 1.125rem; }
+
+h5 {
+ font-size: 1.125rem; }
+
+h6 {
+ font-size: 1rem; }
+
+.subheader {
+ line-height: 1.4;
+ color: #6f6f6f;
+ font-weight: normal;
+ margin-top: 0.2rem;
+ margin-bottom: 0.5rem; }
+
+hr {
+ border: solid #dddddd;
+ border-width: 1px 0 0;
+ clear: both;
+ margin: 1.25rem 0 1.1875rem;
+ height: 0; }
+
+/* Helpful Typography Defaults */
+em, i {
+ font-style: italic;
+ line-height: inherit; }
+
+strong, b {
+ font-weight: bold;
+ line-height: inherit; }
+
+small {
+ font-size: 60%;
+ line-height: inherit; }
+
+code {
+ font-family: Consolas, 'Liberation Mono', Courier, monospace;
+ font-weight: bold;
+ color: #bd240d; }
+
+/* Lists */
+ul, ol, dl {
+ font-size: 1rem;
+ line-height: 1.6;
+ margin-bottom: 1.25rem;
+ list-style-position: outside;
+ font-family: inherit; }
+
+ul {
+ margin-left: 1.1rem; }
+ ul.no-bullet {
+ margin-left: 0; }
+ ul.no-bullet li ul, ul.no-bullet li ol {
+ margin-left: 1.25rem;
+ margin-bottom: 0;
+ list-style: none; }
+
+/* Unordered Lists */
+ul li ul, ul li ol {
+ margin-left: 1.25rem;
+ margin-bottom: 0; }
+ul.square li ul, ul.circle li ul, ul.disc li ul {
+ list-style: inherit; }
+ul.square {
+ list-style-type: square;
+ margin-left: 1.1rem; }
+ul.circle {
+ list-style-type: circle;
+ margin-left: 1.1rem; }
+ul.disc {
+ list-style-type: disc;
+ margin-left: 1.1rem; }
+ul.no-bullet {
+ list-style: none; }
+
+/* Ordered Lists */
+ol {
+ margin-left: 1.4rem; }
+ ol li ul, ol li ol {
+ margin-left: 1.25rem;
+ margin-bottom: 0; }
+
+/* Definition Lists */
+dl dt {
+ margin-bottom: 0.3rem;
+ font-weight: bold; }
+dl dd {
+ margin-bottom: 0.75rem; }
+
+/* Abbreviations */
+abbr, acronym {
+ text-transform: uppercase;
+ font-size: 90%;
+ color: #222222;
+ border-bottom: 1px dotted #dddddd;
+ cursor: help; }
+
+abbr {
+ text-transform: none; }
+
+/* Blockquotes */
+blockquote {
+ margin: 0 0 1.25rem;
+ padding: 0.5625rem 1.25rem 0 1.1875rem;
+ border-left: 1px solid #dddddd; }
+ blockquote cite {
+ display: block;
+ font-size: 0.8125rem;
+ color: #555555; }
+ blockquote cite:before {
+ content: "\2014 \0020"; }
+ blockquote cite a, blockquote cite a:visited {
+ color: #555555; }
+
+blockquote, blockquote p {
+ line-height: 1.6;
+ color: #6f6f6f; }
+
+/* Microformats */
+.vcard {
+ display: inline-block;
+ margin: 0 0 1.25rem 0;
+ border: 1px solid #dddddd;
+ padding: 0.625rem 0.75rem; }
+ .vcard li {
+ margin: 0;
+ display: block; }
+ .vcard .fn {
+ font-weight: bold;
+ font-size: 0.9375rem; }
+
+.vevent .summary {
+ font-weight: bold; }
+.vevent abbr {
+ cursor: default;
+ text-decoration: none;
+ font-weight: bold;
+ border: none;
+ padding: 0 0.0625rem; }
+
+@media only screen and (min-width:40.063em) {
+ h1, h2, h3, h4, h5, h6 {
+ line-height: 1.4; }
+ h1 {
+ font-size: 2.75rem; }
+ h2 {
+ font-size: 2.3125rem; }
+ h3 {
+ font-size: 1.6875rem; }
+ h4 {
+ font-size: 1.4375rem; } }
+
+/*
+ * Print styles.
+ *
+ * Inlined to avoid required HTTP connection: www.phpied.com/delay-loading-your-print-css/
+ * Credit to Paul Irish and HTML5 Boilerplate (html5boilerplate.com)
+ */
+.print-only {
+ display: none !important; }
+
+@media print {
+ @page {
+ margin: 0.5cm; }
+
+ * {
+ background: transparent !important;
+ color: black !important;
+ /* Black prints faster: h5bp.com/s */
+ box-shadow: none !important;
+ text-shadow: none !important; }
+ a, a:visited {
+ text-decoration: underline; }
+ a[href]:after {
+ content: " (" attr(href) ")"; }
+ abbr[title]:after {
+ content: " (" attr(title) ")"; }
+ .ir a:after, a[href^="javascript:"]:after, a[href^="#"]:after {
+ content: ""; }
+ pre, blockquote {
+ border: 1px solid #999999;
+ page-break-inside: avoid; }
+ thead {
+ display: table-header-group;
+ /* h5bp.com/t */ }
+ tr, img {
+ page-break-inside: avoid; }
+ img {
+ max-width: 100% !important; }
+ p, h2, h3 {
+ orphans: 3;
+ widows: 3; }
+ h2, h3 {
+ page-break-after: avoid; }
+ .hide-on-print {
+ display: none !important; }
+ .print-only {
+ display: block !important; }
+ .hide-for-print {
+ display: none !important; }
+ .show-for-print {
+ display: inherit !important; } }
+
+.text-left {
+ text-align: left !important; }
+
+.text-right {
+ text-align: right !important; }
+
+.text-center {
+ text-align: center !important; }
+
+.text-justify {
+ text-align: justify !important; }
+
+@media only screen and (max-width: 40em) {
+ .small-only-text-left {
+ text-align: left !important; }
+ .small-only-text-right {
+ text-align: right !important; }
+ .small-only-text-center {
+ text-align: center !important; }
+ .small-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen {
+ .small-text-left {
+ text-align: left !important; }
+ .small-text-right {
+ text-align: right !important; }
+ .small-text-center {
+ text-align: center !important; }
+ .small-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:40.063em) and (max-width:64em) {
+ .medium-only-text-left {
+ text-align: left !important; }
+ .medium-only-text-right {
+ text-align: right !important; }
+ .medium-only-text-center {
+ text-align: center !important; }
+ .medium-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:40.063em) {
+ .medium-text-left {
+ text-align: left !important; }
+ .medium-text-right {
+ text-align: right !important; }
+ .medium-text-center {
+ text-align: center !important; }
+ .medium-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:64.063em) and (max-width:90em) {
+ .large-only-text-left {
+ text-align: left !important; }
+ .large-only-text-right {
+ text-align: right !important; }
+ .large-only-text-center {
+ text-align: center !important; }
+ .large-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:64.063em) {
+ .large-text-left {
+ text-align: left !important; }
+ .large-text-right {
+ text-align: right !important; }
+ .large-text-center {
+ text-align: center !important; }
+ .large-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:90.063em) and (max-width:120em) {
+ .xlarge-only-text-left {
+ text-align: left !important; }
+ .xlarge-only-text-right {
+ text-align: right !important; }
+ .xlarge-only-text-center {
+ text-align: center !important; }
+ .xlarge-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:90.063em) {
+ .xlarge-text-left {
+ text-align: left !important; }
+ .xlarge-text-right {
+ text-align: right !important; }
+ .xlarge-text-center {
+ text-align: center !important; }
+ .xlarge-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:120.063em) and (max-width:99999999em) {
+ .xxlarge-only-text-left {
+ text-align: left !important; }
+ .xxlarge-only-text-right {
+ text-align: right !important; }
+ .xxlarge-only-text-center {
+ text-align: center !important; }
+ .xxlarge-only-text-justify {
+ text-align: justify !important; } }
+
+@media only screen and (min-width:120.063em) {
+ .xxlarge-text-left {
+ text-align: left !important; }
+ .xxlarge-text-right {
+ text-align: right !important; }
+ .xxlarge-text-center {
+ text-align: center !important; }
+ .xxlarge-text-justify {
+ text-align: justify !important; } }
+
+.off-canvas-wrap {
+ -webkit-backface-visibility: hidden;
+ position: relative;
+ width: 100%;
+ overflow-x: hidden; }
+ .off-canvas-wrap.move-right, .off-canvas-wrap.move-left {
+ height: 100%; }
+
+.inner-wrap {
+ -webkit-backface-visibility: hidden;
+ position: relative;
+ width: 100%;
+ *zoom: 1;
+ -webkit-transition: -webkit-transform 500ms ease;
+ -moz-transition: -moz-transform 500ms ease;
+ -ms-transition: -ms-transform 500ms ease;
+ -o-transition: -o-transform 500ms ease;
+ transition: transform 500ms ease; }
+ .inner-wrap:before, .inner-wrap:after {
+ content: " ";
+ display: table; }
+ .inner-wrap:after {
+ clear: both; }
+
+nav.tab-bar {
+ -webkit-backface-visibility: hidden;
+ background: #333333;
+ color: white;
+ height: 2.8125rem;
+ line-height: 2.8125rem;
+ position: relative; }
+ nav.tab-bar h1, nav.tab-bar h2, nav.tab-bar h3, nav.tab-bar h4, nav.tab-bar h5, nav.tab-bar h6 {
+ color: white;
+ font-weight: bold;
+ line-height: 2.8125rem;
+ margin: 0; }
+ nav.tab-bar h1, nav.tab-bar h2, nav.tab-bar h3, nav.tab-bar h4 {
+ font-size: 1.125rem; }
+
+section.left-small {
+ width: 2.8125rem;
+ height: 2.8125rem;
+ position: absolute;
+ top: 0;
+ border-right: solid 1px #1a1a1a;
+ box-shadow: 1px 0 0 #4e4e4e;
+ left: 0; }
+
+section.right-small {
+ width: 2.8125rem;
+ height: 2.8125rem;
+ position: absolute;
+ top: 0;
+ border-left: solid 1px #4e4e4e;
+ box-shadow: -1px 0 0 #1a1a1a;
+ right: 0; }
+
+section.tab-bar-section {
+ padding: 0 0.625rem;
+ position: absolute;
+ text-align: center;
+ height: 2.8125rem;
+ top: 0; }
+ @media only screen and (min-width:40.063em) {
+ section.tab-bar-section {
+ text-align: left; } }
+ section.tab-bar-section.left {
+ left: 0;
+ right: 2.8125rem; }
+ section.tab-bar-section.right {
+ left: 2.8125rem;
+ right: 0; }
+ section.tab-bar-section.middle {
+ left: 2.8125rem;
+ right: 2.8125rem; }
+
+a.menu-icon {
+ text-indent: 2.1875rem;
+ width: 2.8125rem;
+ height: 2.8125rem;
+ display: block;
+ line-height: 2.0625rem;
+ padding: 0;
+ color: white;
+ position: relative; }
+ a.menu-icon span {
+ position: absolute;
+ display: block;
+ width: 1rem;
+ height: 0;
+ left: 0.8125rem;
+ top: 0.3125rem;
+ -webkit-box-shadow: 1px 10px 1px 1px white, 1px 16px 1px 1px white, 1px 22px 1px 1px white;
+ box-shadow: 0 10px 0 1px white, 0 16px 0 1px white, 0 22px 0 1px white; }
+ a.menu-icon:hover span {
+ -webkit-box-shadow: 1px 10px 1px 1px #b3b3b3, 1px 16px 1px 1px #b3b3b3, 1px 22px 1px 1px #b3b3b3;
+ box-shadow: 0 10px 0 1px #b3b3b3, 0 16px 0 1px #b3b3b3, 0 22px 0 1px #b3b3b3; }
+
+.left-off-canvas-menu {
+ -webkit-backface-visibility: hidden;
+ width: 250px;
+ top: 0;
+ bottom: 0;
+ position: absolute;
+ overflow-y: auto;
+ background: #333333;
+ z-index: 1001;
+ box-sizing: content-box;
+ -webkit-transform: translate3d(-100%, 0, 0);
+ -moz-transform: translate3d(-100%, 0, 0);
+ -ms-transform: translate3d(-100%, 0, 0);
+ -o-transform: translate3d(-100%, 0, 0);
+ transform: translate3d(-100%, 0, 0);
+ left: 0; }
+ .left-off-canvas-menu * {
+ -webkit-backface-visibility: hidden; }
+
+.right-off-canvas-menu {
+ -webkit-backface-visibility: hidden;
+ width: 250px;
+ top: 0;
+ bottom: 0;
+ position: absolute;
+ overflow-y: auto;
+ background: #333333;
+ z-index: 1001;
+ box-sizing: content-box;
+ -webkit-transform: translate3d(100%, 0, 0);
+ -moz-transform: translate3d(100%, 0, 0);
+ -ms-transform: translate3d(100%, 0, 0);
+ -o-transform: translate3d(100%, 0, 0);
+ transform: translate3d(100%, 0, 0);
+ right: 0; }
+
+ul.off-canvas-list {
+ list-style-type: none;
+ padding: 0;
+ margin: 0; }
+ ul.off-canvas-list li label {
+ padding: 0.3rem 0.9375rem;
+ color: #999999;
+ text-transform: uppercase;
+ font-weight: bold;
+ background: #444444;
+ border-top: 1px solid #5e5e5e;
+ border-bottom: none;
+ margin: 0; }
+ ul.off-canvas-list li a {
+ display: block;
+ padding: 0.66667rem;
+ color: rgba(255, 255, 255, 0.7);
+ border-bottom: 1px solid #262626; }
+
+.move-right > .inner-wrap {
+ -webkit-transform: translate3d(250px, 0, 0);
+ -moz-transform: translate3d(250px, 0, 0);
+ -ms-transform: translate3d(250px, 0, 0);
+ -o-transform: translate3d(250px, 0, 0);
+ transform: translate3d(250px, 0, 0); }
+.move-right a.exit-off-canvas {
+ -webkit-backface-visibility: hidden;
+ transition: background 300ms ease;
+ cursor: pointer;
+ box-shadow: -4px 0 4px rgba(0, 0, 0, 0.5), 4px 0 4px rgba(0, 0, 0, 0.5);
+ display: block;
+ position: absolute;
+ background: rgba(255, 255, 255, 0.2);
+ top: 0;
+ bottom: 0;
+ left: 0;
+ right: 0;
+ z-index: 1002;
+ -webkit-tap-highlight-color: rgba(0, 0, 0, 0); }
+ @media only screen and (min-width:40.063em) {
+ .move-right a.exit-off-canvas:hover {
+ background: rgba(255, 255, 255, 0.05); } }
+
+.move-left > .inner-wrap {
+ -webkit-transform: translate3d(-250px, 0, 0);
+ -moz-transform: translate3d(-250px, 0, 0);
+ -ms-transform: translate3d(-250px, 0, 0);
+ -o-transform: translate3d(-250px, 0, 0);
+ transform: translate3d(-250px, 0, 0); }
+.move-left a.exit-off-canvas {
+ -webkit-backface-visibility: hidden;
+ transition: background 300ms ease;
+ cursor: pointer;
+ box-shadow: -4px 0 4px rgba(0, 0, 0, 0.5), 4px 0 4px rgba(0, 0, 0, 0.5);
+ display: block;
+ position: absolute;
+ background: rgba(255, 255, 255, 0.2);
+ top: 0;
+ bottom: 0;
+ left: 0;
+ right: 0;
+ z-index: 1002;
+ -webkit-tap-highlight-color: rgba(0, 0, 0, 0); }
+ @media only screen and (min-width:40.063em) {
+ .move-left a.exit-off-canvas:hover {
+ background: rgba(255, 255, 255, 0.05); } }
+
+.csstransforms.no-csstransforms3d .left-off-canvas-menu {
+ -webkit-transform: translate(-100%, 0);
+ -moz-transform: translate(-100%, 0);
+ -ms-transform: translate(-100%, 0);
+ -o-transform: translate(-100%, 0);
+ transform: translate(-100%, 0); }
+.csstransforms.no-csstransforms3d .right-off-canvas-menu {
+ -webkit-transform: translate(100%, 0);
+ -moz-transform: translate(100%, 0);
+ -ms-transform: translate(100%, 0);
+ -o-transform: translate(100%, 0);
+ transform: translate(100%, 0); }
+.csstransforms.no-csstransforms3d .move-left > .inner-wrap {
+ -webkit-transform: translate(-250px, 0);
+ -moz-transform: translate(-250px, 0);
+ -ms-transform: translate(-250px, 0);
+ -o-transform: translate(-250px, 0);
+ transform: translate(-250px, 0); }
+.csstransforms.no-csstransforms3d .move-right > .inner-wrap {
+ -webkit-transform: translate(250px, 0);
+ -moz-transform: translate(250px, 0);
+ -ms-transform: translate(250px, 0);
+ -o-transform: translate(250px, 0);
+ transform: translate(250px, 0); }
+
+.no-csstransforms .left-off-canvas-menu {
+ left: -250px; }
+.no-csstransforms .right-off-canvas-menu {
+ right: -250px; }
+.no-csstransforms .move-left > .inner-wrap {
+ right: 250px; }
+.no-csstransforms .move-right > .inner-wrap {
+ left: 250px; }
+
+/* Foundation Visibility HTML Classes */
+.show-for-small, .show-for-small-only, .show-for-medium-down, .show-for-large-down, .hide-for-medium, .hide-for-medium-up, .hide-for-medium-only, .hide-for-large, .hide-for-large-up, .hide-for-large-only, .hide-for-xlarge, .hide-for-xlarge-up, .hide-for-xlarge-only, .hide-for-xxlarge-up, .hide-for-xxlarge-only {
+ display: inherit !important; }
+
+.hide-for-small, .hide-for-small-only, .hide-for-medium-down, .show-for-medium, .show-for-medium-up, .show-for-medium-only, .hide-for-large-down, .show-for-large, .show-for-large-up, .show-for-large-only, .show-for-xlarge, .show-for-xlarge-up, .show-for-xlarge-only, .show-for-xxlarge-up, .show-for-xxlarge-only {
+ display: none !important; }
+
+/* Specific visibility for tables */
+table.show-for-small, table.show-for-small-only, table.show-for-medium-down, table.show-for-large-down, table.hide-for-medium, table.hide-for-medium-up, table.hide-for-medium-only, table.hide-for-large, table.hide-for-large-up, table.hide-for-large-only, table.hide-for-xlarge, table.hide-for-xlarge-up, table.hide-for-xlarge-only, table.hide-for-xxlarge-up, table.hide-for-xxlarge-only {
+ display: table; }
+
+thead.show-for-small, thead.show-for-small-only, thead.show-for-medium-down, thead.show-for-large-down, thead.hide-for-medium, thead.hide-for-medium-up, thead.hide-for-medium-only, thead.hide-for-large, thead.hide-for-large-up, thead.hide-for-large-only, thead.hide-for-xlarge, thead.hide-for-xlarge-up, thead.hide-for-xlarge-only, thead.hide-for-xxlarge-up, thead.hide-for-xxlarge-only {
+ display: table-header-group !important; }
+
+tbody.show-for-small, tbody.show-for-small-only, tbody.show-for-medium-down, tbody.show-for-large-down, tbody.hide-for-medium, tbody.hide-for-medium-up, tbody.hide-for-medium-only, tbody.hide-for-large, tbody.hide-for-large-up, tbody.hide-for-large-only, tbody.hide-for-xlarge, tbody.hide-for-xlarge-up, tbody.hide-for-xlarge-only, tbody.hide-for-xxlarge-up, tbody.hide-for-xxlarge-only {
+ display: table-row-group !important; }
+
+tr.show-for-small, tr.show-for-small-only, tr.show-for-medium-down, tr.show-for-large-down, tr.hide-for-medium, tr.hide-for-medium-up, tr.hide-for-medium-only, tr.hide-for-large, tr.hide-for-large-up, tr.hide-for-large-only, tr.hide-for-xlarge, tr.hide-for-xlarge-up, tr.hide-for-xlarge-only, tr.hide-for-xxlarge-up, tr.hide-for-xxlarge-only {
+ display: table-row !important; }
+
+td.show-for-small, td.show-for-small-only, td.show-for-medium-down, td.show-for-large-down, td.hide-for-medium, td.hide-for-medium-up, td.hide-for-large, td.hide-for-large-up, td.hide-for-xlarge, td.hide-for-xlarge-up, td.hide-for-xxlarge-up, th.show-for-small, th.show-for-small-only, th.show-for-medium-down, th.show-for-large-down, th.hide-for-medium, th.hide-for-medium-up, th.hide-for-large, th.hide-for-large-up, th.hide-for-xlarge, th.hide-for-xlarge-up, th.hide-for-xxlarge-up {
+ display: table-cell !important; }
+
+/* Medium Displays: 641px and up */
+@media only screen and (min-width:40.063em) {
+ /* Specific visibility for tables */
+ .hide-for-small, .hide-for-small-only, .show-for-medium, .show-for-medium-down, .show-for-medium-up, .show-for-medium-only, .hide-for-large, .hide-for-large-up, .hide-for-large-only, .hide-for-xlarge, .hide-for-xlarge-up, .hide-for-xlarge-only, .hide-for-xxlarge-up, .hide-for-xxlarge-only {
+ display: inherit !important; }
+ .show-for-small, .show-for-small-only, .hide-for-medium, .hide-for-medium-down, .hide-for-medium-up, .hide-for-medium-only, .hide-for-large-down, .show-for-large, .show-for-large-up, .show-for-large-only, .show-for-xlarge, .show-for-xlarge-up, .show-for-xlarge-only, .show-for-xxlarge-up, .show-for-xxlarge-only {
+ display: none !important; }
+ table.hide-for-small, table.hide-for-small-only, table.show-for-medium, table.show-for-medium-down, table.show-for-medium-up, table.show-for-medium-only, table.hide-for-large, table.hide-for-large-up, table.hide-for-large-only, table.hide-for-xlarge, table.hide-for-xlarge-up, table.hide-for-xlarge-only, table.hide-for-xxlarge-up, table.hide-for-xxlarge-only {
+ display: table; }
+ thead.hide-for-small, thead.hide-for-small-only, thead.show-for-medium, thead.show-for-medium-down, thead.show-for-medium-up, thead.show-for-medium-only, thead.hide-for-large, thead.hide-for-large-up, thead.hide-for-large-only, thead.hide-for-xlarge, thead.hide-for-xlarge-up, thead.hide-for-xlarge-only, thead.hide-for-xxlarge-up, thead.hide-for-xxlarge-only {
+ display: table-header-group !important; }
+ tbody.hide-for-small, tbody.hide-for-small-only, tbody.show-for-medium, tbody.show-for-medium-down, tbody.show-for-medium-up, tbody.show-for-medium-only, tbody.hide-for-large, tbody.hide-for-large-up, tbody.hide-for-large-only, tbody.hide-for-xlarge, tbody.hide-for-xlarge-up, tbody.hide-for-xlarge-only, tbody.hide-for-xxlarge-up, tbody.hide-for-xxlarge-only {
+ display: table-row-group !important; }
+ tr.hide-for-small, tr.hide-for-small-only, tr.show-for-medium, tr.show-for-medium-down, tr.show-for-medium-up, tr.show-for-medium-only, tr.hide-for-large, tr.hide-for-large-up, tr.hide-for-large-only, tr.hide-for-xlarge, tr.hide-for-xlarge-up, tr.hide-for-xlarge-only, tr.hide-for-xxlarge-up, tr.hide-for-xxlarge-only {
+ display: table-row !important; }
+ td.hide-for-small, td.hide-for-small-only, td.show-for-medium, td.show-for-medium-down, td.show-for-medium-up, td.show-for-medium-only, td.hide-for-large, td.hide-for-large-up, td.hide-for-large-only, td.hide-for-xlarge, td.hide-for-xlarge-up, td.hide-for-xlarge-only, td.hide-for-xxlarge-up, td.hide-for-xxlarge-only, th.hide-for-small, th.hide-for-small-only, th.show-for-medium, th.show-for-medium-down, th.show-for-medium-up, th.show-for-medium-only, th.hide-for-large, th.hide-for-large-up, th.hide-for-large-only, th.hide-for-xlarge, th.hide-for-xlarge-up, th.hide-for-xlarge-only, th.hide-for-xxlarge-up, th.hide-for-xxlarge-only {
+ display: table-cell !important; } }
+
+/* Large Displays: 1024px and up */
+@media only screen and (min-width:64.063em) {
+ /* Specific visibility for tables */
+ .hide-for-small, .hide-for-small-only, .hide-for-medium, .hide-for-medium-down, .hide-for-medium-only, .show-for-medium-up, .show-for-large, .show-for-large-up, .show-for-large-only, .hide-for-xlarge, .hide-for-xlarge-up, .hide-for-xlarge-only, .hide-for-xxlarge-up, .hide-for-xxlarge-only {
+ display: inherit !important; }
+ .show-for-small-only, .show-for-medium, .show-for-medium-down, .show-for-medium-only, .hide-for-large, .hide-for-large-up, .hide-for-large-only, .show-for-xlarge, .show-for-xlarge-up, .show-for-xlarge-only, .show-for-xxlarge-up, .show-for-xxlarge-only {
+ display: none !important; }
+ table.hide-for-small, table.hide-for-small-only, table.hide-for-medium, table.hide-for-medium-down, table.hide-for-medium-only, table.show-for-medium-up, table.show-for-large, table.show-for-large-up, table.show-for-large-only, table.hide-for-xlarge, table.hide-for-xlarge-up, table.hide-for-xlarge-only, table.hide-for-xxlarge-up, table.hide-for-xxlarge-only {
+ display: table; }
+ thead.hide-for-small, thead.hide-for-small-only, thead.hide-for-medium, thead.hide-for-medium-down, thead.hide-for-medium-only, thead.show-for-medium-up, thead.show-for-large, thead.show-for-large-up, thead.show-for-large-only, thead.hide-for-xlarge, thead.hide-for-xlarge-up, thead.hide-for-xlarge-only, thead.hide-for-xxlarge-up, thead.hide-for-xxlarge-only {
+ display: table-header-group !important; }
+ tbody.hide-for-small, tbody.hide-for-small-only, tbody.hide-for-medium, tbody.hide-for-medium-down, tbody.hide-for-medium-only, tbody.show-for-medium-up, tbody.show-for-large, tbody.show-for-large-up, tbody.show-for-large-only, tbody.hide-for-xlarge, tbody.hide-for-xlarge-up, tbody.hide-for-xlarge-only, tbody.hide-for-xxlarge-up, tbody.hide-for-xxlarge-only {
+ display: table-row-group !important; }
+ tr.hide-for-small, tr.hide-for-small-only, tr.hide-for-medium, tr.hide-for-medium-down, tr.hide-for-medium-only, tr.show-for-medium-up, tr.show-for-large, tr.show-for-large-up, tr.show-for-large-only, tr.hide-for-xlarge, tr.hide-for-xlarge-up, tr.hide-for-xlarge-only, tr.hide-for-xxlarge-up, tr.hide-for-xxlarge-only {
+ display: table-row !important; }
+ td.hide-for-small, td.hide-for-small-only, td.hide-for-medium, td.hide-for-medium-down, td.hide-for-medium-only, td.show-for-medium-up, td.show-for-large, td.show-for-large-up, td.show-for-large-only, td.hide-for-xlarge, td.hide-for-xlarge-up, td.hide-for-xlarge-only, td.hide-for-xxlarge-up, td.hide-for-xxlarge-only, th.hide-for-small, th.hide-for-small-only, th.hide-for-medium, th.hide-for-medium-down, th.hide-for-medium-only, th.show-for-medium-up, th.show-for-large, th.show-for-large-up, th.show-for-large-only, th.hide-for-xlarge, th.hide-for-xlarge-up, th.hide-for-xlarge-only, th.hide-for-xxlarge-up, th.hide-for-xxlarge-only {
+ display: table-cell !important; } }
+
+/* X-Large Displays: 1441 and up */
+@media only screen and (min-width:90.063em) {
+ /* Specific visibility for tables */
+ .hide-for-small, .hide-for-small-only, .hide-for-medium, .hide-for-medium-down, .hide-for-medium-only, .show-for-medium-up, .show-for-large-up, .hide-for-large-only, .show-for-xlarge, .show-for-xlarge-up, .show-for-xlarge-only, .hide-for-xxlarge-up, .hide-for-xxlarge-only {
+ display: inherit !important; }
+ .show-for-small-only, .show-for-medium, .show-for-medium-down, .show-for-medium-only, .show-for-large, .show-for-large-only, .show-for-large-down, .hide-for-xlarge, .hide-for-xlarge-up, .hide-for-xlarge-only, .show-for-xxlarge-up, .show-for-xxlarge-only {
+ display: none !important; }
+ table.hide-for-small, table.hide-for-small-only, table.hide-for-medium, table.hide-for-medium-down, table.hide-for-medium-only, table.show-for-medium-up, table.show-for-large-up, table.hide-for-large-only, table.show-for-xlarge, table.show-for-xlarge-up, table.show-for-xlarge-only, table.hide-for-xxlarge-up, table.hide-for-xxlarge-only {
+ display: table; }
+ thead.hide-for-small, thead.hide-for-small-only, thead.hide-for-medium, thead.hide-for-medium-down, thead.hide-for-medium-only, thead.show-for-medium-up, thead.show-for-large-up, thead.hide-for-large-only, thead.show-for-xlarge, thead.show-for-xlarge-up, thead.show-for-xlarge-only, thead.hide-for-xxlarge-up, thead.hide-for-xxlarge-only {
+ display: table-header-group !important; }
+ tbody.hide-for-small, tbody.hide-for-small-only, tbody.hide-for-medium, tbody.hide-for-medium-down, tbody.hide-for-medium-only, tbody.show-for-medium-up, tbody.show-for-large-up, tbody.hide-for-large-only, tbody.show-for-xlarge, tbody.show-for-xlarge-up, tbody.show-for-xlarge-only, tbody.hide-for-xxlarge-up, tbody.hide-for-xxlarge-only {
+ display: table-row-group !important; }
+ tr.hide-for-small, tr.hide-for-small-only, tr.hide-for-medium, tr.hide-for-medium-down, tr.hide-for-medium-only, tr.show-for-medium-up, tr.show-for-large-up, tr.hide-for-large-only, tr.show-for-xlarge, tr.show-for-xlarge-up, tr.show-for-xlarge-only, tr.hide-for-xxlarge-up, tr.hide-for-xxlarge-only {
+ display: table-row !important; }
+ td.hide-for-small, td.hide-for-small-only, td.hide-for-medium, td.hide-for-medium-down, td.hide-for-medium-only, td.show-for-medium-up, td.show-for-large-up, td.hide-for-large-only, td.show-for-xlarge, td.show-for-xlarge-up, td.show-for-xlarge-only, td.hide-for-xxlarge-up, td.hide-for-xxlarge-only, th.hide-for-small, th.hide-for-small-only, th.hide-for-medium, th.hide-for-medium-down, th.hide-for-medium-only, th.show-for-medium-up, th.show-for-large-up, th.hide-for-large-only, th.show-for-xlarge, th.show-for-xlarge-up, th.show-for-xlarge-only, th.hide-for-xxlarge-up, th.hide-for-xxlarge-only {
+ display: table-cell !important; } }
+
+/* XX-Large Displays: 1920 and up */
+@media only screen and (min-width:120.063em) {
+ /* Specific visibility for tables */
+ .hide-for-small, .hide-for-small-only, .hide-for-medium, .hide-for-medium-down, .hide-for-medium-only, .show-for-medium-up, .show-for-large-up, .hide-for-large-only, .hide-for-xlarge-only, .show-for-xlarge-up, .show-for-xxlarge-up, .show-for-xxlarge-only {
+ display: inherit !important; }
+ .show-for-small-only, .show-for-medium, .show-for-medium-down, .show-for-medium-only, .show-for-large, .show-for-large-only, .show-for-large-down, .hide-for-xlarge, .show-for-xlarge-only, .hide-for-xxlarge-up, .hide-for-xxlarge-only {
+ display: none !important; }
+ table.hide-for-small, table.hide-for-small-only, table.hide-for-medium, table.hide-for-medium-down, table.hide-for-medium-only, table.show-for-medium-up, table.show-for-large-up, table.hide-for-xlarge-only, table.show-for-xlarge-up, table.show-for-xxlarge-up, table.show-for-xxlarge-only {
+ display: table; }
+ thead.hide-for-small, thead.hide-for-small-only, thead.hide-for-medium, thead.hide-for-medium-down, thead.hide-for-medium-only, thead.show-for-medium-up, thead.show-for-large-up, thead.hide-for-xlarge-only, thead.show-for-xlarge-up, thead.show-for-xxlarge-up, thead.show-for-xxlarge-only {
+ display: table-header-group !important; }
+ tbody.hide-for-small, tbody.hide-for-small-only, tbody.hide-for-medium, tbody.hide-for-medium-down, tbody.hide-for-medium-only, tbody.show-for-medium-up, tbody.show-for-large-up, tbody.hide-for-xlarge-only, tbody.show-for-xlarge-up, tbody.show-for-xxlarge-up, tbody.show-for-xxlarge-only {
+ display: table-row-group !important; }
+ tr.hide-for-small, tr.hide-for-small-only, tr.hide-for-medium, tr.hide-for-medium-down, tr.hide-for-medium-only, tr.show-for-medium-up, tr.show-for-large-up, tr.hide-for-xlarge-only, tr.show-for-xlarge-up, tr.show-for-xxlarge-up, tr.show-for-xxlarge-only {
+ display: table-row !important; }
+ td.hide-for-small, td.hide-for-small-only, td.hide-for-medium, td.hide-for-medium-down, td.hide-for-medium-only, td.show-for-medium-up, td.show-for-large-up, td.hide-for-xlarge-only, td.show-for-xlarge-up, td.show-for-xxlarge-up, td.show-for-xxlarge-only, th.hide-for-small, th.hide-for-small-only, th.hide-for-medium, th.hide-for-medium-down, th.hide-for-medium-only, th.show-for-medium-up, th.show-for-large-up, th.hide-for-xlarge-only, th.show-for-xlarge-up, th.show-for-xxlarge-up, th.show-for-xxlarge-only {
+ display: table-cell !important; } }
+
+/* Orientation targeting */
+.show-for-landscape, .hide-for-portrait {
+ display: inherit !important; }
+
+.hide-for-landscape, .show-for-portrait {
+ display: none !important; }
+
+/* Specific visibility for tables */
+table.hide-for-landscape, table.show-for-portrait {
+ display: table; }
+
+thead.hide-for-landscape, thead.show-for-portrait {
+ display: table-header-group !important; }
+
+tbody.hide-for-landscape, tbody.show-for-portrait {
+ display: table-row-group !important; }
+
+tr.hide-for-landscape, tr.show-for-portrait {
+ display: table-row !important; }
+
+td.hide-for-landscape, td.show-for-portrait, th.hide-for-landscape, th.show-for-portrait {
+ display: table-cell !important; }
+
+@media only screen and (orientation: landscape) {
+ /* Specific visibility for tables */
+ .show-for-landscape, .hide-for-portrait {
+ display: inherit !important; }
+ .hide-for-landscape, .show-for-portrait {
+ display: none !important; }
+ table.show-for-landscape, table.hide-for-portrait {
+ display: table; }
+ thead.show-for-landscape, thead.hide-for-portrait {
+ display: table-header-group !important; }
+ tbody.show-for-landscape, tbody.hide-for-portrait {
+ display: table-row-group !important; }
+ tr.show-for-landscape, tr.hide-for-portrait {
+ display: table-row !important; }
+ td.show-for-landscape, td.hide-for-portrait, th.show-for-landscape, th.hide-for-portrait {
+ display: table-cell !important; } }
+
+@media only screen and (orientation: portrait) {
+ /* Specific visibility for tables */
+ .show-for-portrait, .hide-for-landscape {
+ display: inherit !important; }
+ .hide-for-portrait, .show-for-landscape {
+ display: none !important; }
+ table.show-for-portrait, table.hide-for-landscape {
+ display: table; }
+ thead.show-for-portrait, thead.hide-for-landscape {
+ display: table-header-group !important; }
+ tbody.show-for-portrait, tbody.hide-for-landscape {
+ display: table-row-group !important; }
+ tr.show-for-portrait, tr.hide-for-landscape {
+ display: table-row !important; }
+ td.show-for-portrait, td.hide-for-landscape, th.show-for-portrait, th.hide-for-landscape {
+ display: table-cell !important; } }
+
+/* Touch-enabled device targeting */
+.show-for-touch {
+ display: none !important; }
+
+.hide-for-touch {
+ display: inherit !important; }
+
+.touch .show-for-touch {
+ display: inherit !important; }
+
+.touch .hide-for-touch {
+ display: none !important; }
+
+/* Specific visibility for tables */
+table.hide-for-touch {
+ display: table; }
+
+.touch table.show-for-touch {
+ display: table; }
+
+thead.hide-for-touch {
+ display: table-header-group !important; }
+
+.touch thead.show-for-touch {
+ display: table-header-group !important; }
+
+tbody.hide-for-touch {
+ display: table-row-group !important; }
+
+.touch tbody.show-for-touch {
+ display: table-row-group !important; }
+
+tr.hide-for-touch {
+ display: table-row !important; }
+
+.touch tr.show-for-touch {
+ display: table-row !important; }
+
+td.hide-for-touch {
+ display: table-cell !important; }
+
+.touch td.show-for-touch {
+ display: table-cell !important; }
+
+th.hide-for-touch {
+ display: table-cell !important; }
+
+.touch th.show-for-touch {
+ display: table-cell !important; }
--- /dev/null
+meta.foundation-version {font-family:"/5.1.0/";}meta.foundation-mq-small {font-family:"/only screen and (max-width: 40em)/";width:0em;}meta.foundation-mq-medium {font-family:"/only screen and (min-width:40.063em)/";width:40.063em;}meta.foundation-mq-large {font-family:"/only screen and (min-width:64.063em)/";width:64.063em;}meta.foundation-mq-xlarge {font-family:"/only screen and (min-width:90.063em)/";width:90.063em;}meta.foundation-mq-xxlarge {font-family:"/only screen and (min-width:120.063em)/";width:120.063em;}meta.foundation-data-attribute-namespace {font-family:false;}html ,body {height:100%;}* ,*:before ,*:after {-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box;}html ,body {font-size:100%;}body {background:#ffffff;color:#222222;padding:0;margin:0;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;font-weight:normal;font-style:normal;line-height:1;position:relative;cursor:default;}a:hover {cursor:pointer;}img ,object ,embed {max-width:100%;height:auto;}object ,embed {height:100%;}img {-ms-interpolation-mode:bicubic;}#map_canvas img ,#map_canvas embed ,#map_canvas object ,.map_canvas img ,.map_canvas embed ,.map_canvas object {max-width:none !important;}.left {float:left !important;}.right {float:right !important;}.clearfix {*zoom:1;}.clearfix:before ,.clearfix:after {content:" ";display:table;}.clearfix:after {clear:both;}.hide {display:none;}.antialiased {-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;}img {display:inline-block;vertical-align:middle;}textarea {height:auto;min-height:50px;}select {width:100%;}.row {width:100%;margin-left:auto;margin-right:auto;margin-top:0;margin-bottom:0;max-width:62.5rem;*zoom:1;}.row:before ,.row:after {content:" ";display:table;}.row:after {clear:both;}.row.collapse>.column ,.row.collapse>.columns {padding-left:0;padding-right:0;float:left;}.row.collapse .row {margin-left:0;margin-right:0;}.row .row {width:auto;margin-left:-0.9375rem;margin-right:-0.9375rem;margin-top:0;margin-bottom:0;max-width:none;*zoom:1;}.row .row:before ,.row .row:after {content:" ";display:table;}.row .row:after {clear:both;}.row .row.collapse {width:auto;margin:0;max-width:none;*zoom:1;}.row .row.collapse:before ,.row .row.collapse:after {content:" ";display:table;}.row .row.collapse:after {clear:both;}.column ,.columns {padding-left:0.9375rem;padding-right:0.9375rem;width:100%;float:left;}@media only screen{.column.small-centered ,.columns.small-centered {margin-left:auto;margin-right:auto;float:none;}.column.small-uncentered ,.columns.small-uncentered {margin-left:0;margin-right:0;float:left;}.column.small-uncentered.opposite ,.columns.small-uncentered.opposite {float:right;}.small-push-0 {left:0%;right:auto;}.small-pull-0 {right:0%;left:auto;}.small-push-1 {left:8.33333%;right:auto;}.small-pull-1 {right:8.33333%;left:auto;}.small-push-2 {left:16.66667%;right:auto;}.small-pull-2 {right:16.66667%;left:auto;}.small-push-3 {left:25%;right:auto;}.small-pull-3 {right:25%;left:auto;}.small-push-4 {left:33.33333%;right:auto;}.small-pull-4 {right:33.33333%;left:auto;}.small-push-5 {left:41.66667%;right:auto;}.small-pull-5 {right:41.66667%;left:auto;}.small-push-6 {left:50%;right:auto;}.small-pull-6 {right:50%;left:auto;}.small-push-7 {left:58.33333%;right:auto;}.small-pull-7 {right:58.33333%;left:auto;}.small-push-8 {left:66.66667%;right:auto;}.small-pull-8 {right:66.66667%;left:auto;}.small-push-9 {left:75%;right:auto;}.small-pull-9 {right:75%;left:auto;}.small-push-10 {left:83.33333%;right:auto;}.small-pull-10 {right:83.33333%;left:auto;}.small-push-11 {left:91.66667%;right:auto;}.small-pull-11 {right:91.66667%;left:auto;}.column ,.columns {position:relative;padding-left:0.9375rem;padding-right:0.9375rem;float:left;}.small-1 {width:8.33333%;}.small-2 {width:16.66667%;}.small-3 {width:25%;}.small-4 {width:33.33333%;}.small-5 {width:41.66667%;}.small-6 {width:50%;}.small-7 {width:58.33333%;}.small-8 {width:66.66667%;}.small-9 {width:75%;}.small-10 {width:83.33333%;}.small-11 {width:91.66667%;}.small-12 {width:100%;}[class*="column"]+[class*="column"]:last-child {float:right;}[class*="column"]+[class*="column"].end {float:left;}.small-offset-0 {margin-left:0% !important;}.small-offset-1 {margin-left:8.33333% !important;}.small-offset-2 {margin-left:16.66667% !important;}.small-offset-3 {margin-left:25% !important;}.small-offset-4 {margin-left:33.33333% !important;}.small-offset-5 {margin-left:41.66667% !important;}.small-offset-6 {margin-left:50% !important;}.small-offset-7 {margin-left:58.33333% !important;}.small-offset-8 {margin-left:66.66667% !important;}.small-offset-9 {margin-left:75% !important;}.small-offset-10 {margin-left:83.33333% !important;}.small-offset-11 {margin-left:91.66667% !important;}.small-reset-order ,.small-reset-order {margin-left:0;margin-right:0;left:auto;right:auto;float:left;}}@media only screen and (min-width:40.063em){.column.medium-centered ,.columns.medium-centered {margin-left:auto;margin-right:auto;float:none;}.column.medium-uncentered ,.columns.medium-uncentered {margin-left:0;margin-right:0;float:left;}.column.medium-uncentered.opposite ,.columns.medium-uncentered.opposite {float:right;}.medium-push-0 {left:0%;right:auto;}.medium-pull-0 {right:0%;left:auto;}.medium-push-1 {left:8.33333%;right:auto;}.medium-pull-1 {right:8.33333%;left:auto;}.medium-push-2 {left:16.66667%;right:auto;}.medium-pull-2 {right:16.66667%;left:auto;}.medium-push-3 {left:25%;right:auto;}.medium-pull-3 {right:25%;left:auto;}.medium-push-4 {left:33.33333%;right:auto;}.medium-pull-4 {right:33.33333%;left:auto;}.medium-push-5 {left:41.66667%;right:auto;}.medium-pull-5 {right:41.66667%;left:auto;}.medium-push-6 {left:50%;right:auto;}.medium-pull-6 {right:50%;left:auto;}.medium-push-7 {left:58.33333%;right:auto;}.medium-pull-7 {right:58.33333%;left:auto;}.medium-push-8 {left:66.66667%;right:auto;}.medium-pull-8 {right:66.66667%;left:auto;}.medium-push-9 {left:75%;right:auto;}.medium-pull-9 {right:75%;left:auto;}.medium-push-10 {left:83.33333%;right:auto;}.medium-pull-10 {right:83.33333%;left:auto;}.medium-push-11 {left:91.66667%;right:auto;}.medium-pull-11 {right:91.66667%;left:auto;}.column ,.columns {position:relative;padding-left:0.9375rem;padding-right:0.9375rem;float:left;}.medium-1 {width:8.33333%;}.medium-2 {width:16.66667%;}.medium-3 {width:25%;}.medium-4 {width:33.33333%;}.medium-5 {width:41.66667%;}.medium-6 {width:50%;}.medium-7 {width:58.33333%;}.medium-8 {width:66.66667%;}.medium-9 {width:75%;}.medium-10 {width:83.33333%;}.medium-11 {width:91.66667%;}.medium-12 {width:100%;}[class*="column"]+[class*="column"]:last-child {float:right;}[class*="column"]+[class*="column"].end {float:left;}.medium-offset-0 {margin-left:0% !important;}.medium-offset-1 {margin-left:8.33333% !important;}.medium-offset-2 {margin-left:16.66667% !important;}.medium-offset-3 {margin-left:25% !important;}.medium-offset-4 {margin-left:33.33333% !important;}.medium-offset-5 {margin-left:41.66667% !important;}.medium-offset-6 {margin-left:50% !important;}.medium-offset-7 {margin-left:58.33333% !important;}.medium-offset-8 {margin-left:66.66667% !important;}.medium-offset-9 {margin-left:75% !important;}.medium-offset-10 {margin-left:83.33333% !important;}.medium-offset-11 {margin-left:91.66667% !important;}.medium-reset-order ,.medium-reset-order {margin-left:0;margin-right:0;left:auto;right:auto;float:left;}.push-0 {left:0%;right:auto;}.pull-0 {right:0%;left:auto;}.push-1 {left:8.33333%;right:auto;}.pull-1 {right:8.33333%;left:auto;}.push-2 {left:16.66667%;right:auto;}.pull-2 {right:16.66667%;left:auto;}.push-3 {left:25%;right:auto;}.pull-3 {right:25%;left:auto;}.push-4 {left:33.33333%;right:auto;}.pull-4 {right:33.33333%;left:auto;}.push-5 {left:41.66667%;right:auto;}.pull-5 {right:41.66667%;left:auto;}.push-6 {left:50%;right:auto;}.pull-6 {right:50%;left:auto;}.push-7 {left:58.33333%;right:auto;}.pull-7 {right:58.33333%;left:auto;}.push-8 {left:66.66667%;right:auto;}.pull-8 {right:66.66667%;left:auto;}.push-9 {left:75%;right:auto;}.pull-9 {right:75%;left:auto;}.push-10 {left:83.33333%;right:auto;}.pull-10 {right:83.33333%;left:auto;}.push-11 {left:91.66667%;right:auto;}.pull-11 {right:91.66667%;left:auto;}}@media only screen and (min-width:64.063em){.column.large-centered ,.columns.large-centered {margin-left:auto;margin-right:auto;float:none;}.column.large-uncentered ,.columns.large-uncentered {margin-left:0;margin-right:0;float:left;}.column.large-uncentered.opposite ,.columns.large-uncentered.opposite {float:right;}.large-push-0 {left:0%;right:auto;}.large-pull-0 {right:0%;left:auto;}.large-push-1 {left:8.33333%;right:auto;}.large-pull-1 {right:8.33333%;left:auto;}.large-push-2 {left:16.66667%;right:auto;}.large-pull-2 {right:16.66667%;left:auto;}.large-push-3 {left:25%;right:auto;}.large-pull-3 {right:25%;left:auto;}.large-push-4 {left:33.33333%;right:auto;}.large-pull-4 {right:33.33333%;left:auto;}.large-push-5 {left:41.66667%;right:auto;}.large-pull-5 {right:41.66667%;left:auto;}.large-push-6 {left:50%;right:auto;}.large-pull-6 {right:50%;left:auto;}.large-push-7 {left:58.33333%;right:auto;}.large-pull-7 {right:58.33333%;left:auto;}.large-push-8 {left:66.66667%;right:auto;}.large-pull-8 {right:66.66667%;left:auto;}.large-push-9 {left:75%;right:auto;}.large-pull-9 {right:75%;left:auto;}.large-push-10 {left:83.33333%;right:auto;}.large-pull-10 {right:83.33333%;left:auto;}.large-push-11 {left:91.66667%;right:auto;}.large-pull-11 {right:91.66667%;left:auto;}.column ,.columns {position:relative;padding-left:0.9375rem;padding-right:0.9375rem;float:left;}.large-1 {width:8.33333%;}.large-2 {width:16.66667%;}.large-3 {width:25%;}.large-4 {width:33.33333%;}.large-5 {width:41.66667%;}.large-6 {width:50%;}.large-7 {width:58.33333%;}.large-8 {width:66.66667%;}.large-9 {width:75%;}.large-10 {width:83.33333%;}.large-11 {width:91.66667%;}.large-12 {width:100%;}[class*="column"]+[class*="column"]:last-child {float:right;}[class*="column"]+[class*="column"].end {float:left;}.large-offset-0 {margin-left:0% !important;}.large-offset-1 {margin-left:8.33333% !important;}.large-offset-2 {margin-left:16.66667% !important;}.large-offset-3 {margin-left:25% !important;}.large-offset-4 {margin-left:33.33333% !important;}.large-offset-5 {margin-left:41.66667% !important;}.large-offset-6 {margin-left:50% !important;}.large-offset-7 {margin-left:58.33333% !important;}.large-offset-8 {margin-left:66.66667% !important;}.large-offset-9 {margin-left:75% !important;}.large-offset-10 {margin-left:83.33333% !important;}.large-offset-11 {margin-left:91.66667% !important;}.large-reset-order ,.large-reset-order {margin-left:0;margin-right:0;left:auto;right:auto;float:left;}.push-0 {left:0%;right:auto;}.pull-0 {right:0%;left:auto;}.push-1 {left:8.33333%;right:auto;}.pull-1 {right:8.33333%;left:auto;}.push-2 {left:16.66667%;right:auto;}.pull-2 {right:16.66667%;left:auto;}.push-3 {left:25%;right:auto;}.pull-3 {right:25%;left:auto;}.push-4 {left:33.33333%;right:auto;}.pull-4 {right:33.33333%;left:auto;}.push-5 {left:41.66667%;right:auto;}.pull-5 {right:41.66667%;left:auto;}.push-6 {left:50%;right:auto;}.pull-6 {right:50%;left:auto;}.push-7 {left:58.33333%;right:auto;}.pull-7 {right:58.33333%;left:auto;}.push-8 {left:66.66667%;right:auto;}.pull-8 {right:66.66667%;left:auto;}.push-9 {left:75%;right:auto;}.pull-9 {right:75%;left:auto;}.push-10 {left:83.33333%;right:auto;}.pull-10 {right:83.33333%;left:auto;}.push-11 {left:91.66667%;right:auto;}.pull-11 {right:91.66667%;left:auto;}}.accordion {*zoom:1;margin-bottom:0;}.accordion:before ,.accordion:after {content:" ";display:table;}.accordion:after {clear:both;}.accordion dd {display:block;margin-bottom:0 !important;}.accordion dd.active a {background:#e8e8e8;}.accordion dd>a {background:#efefef;color:#222222;padding:1rem;display:block;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;font-size:1rem;}.accordion dd > a:hover {background:#e3e3e3;}.accordion .content {display:none;padding:0.9375rem;}.accordion .content.active {display:block;background:#ffffff;}.alert-box {border-style:solid;border-width:1px;display:block;font-weight:normal;margin-bottom:1.25rem;position:relative;padding:0.875rem 1.5rem 0.875rem 0.875rem;font-size:0.8125rem;background-color:#008cba;border-color:#007ba0;color:#ffffff;}.alert-box .close {font-size:1.375rem;padding:9px 6px 4px;line-height:0;position:absolute;top:50%;margin-top:-0.6875rem;right:0.25rem;color:#333333;opacity:0.3;}.alert-box .close:hover ,.alert-box .close:focus {opacity:0.5;}.alert-box.radius {-webkit-border-radius:3px;border-radius:3px;}.alert-box.round {-webkit-border-radius:1000px;border-radius:1000px;}.alert-box.success {background-color:#43ac6a;border-color:#3a945b;color:#ffffff;}.alert-box.alert {background-color:#f04124;border-color:#de2b0f;color:#ffffff;}.alert-box.secondary {background-color:#e7e7e7;border-color:#c7c7c7;color:#4f4f4f;}.alert-box.warning {background-color:#f08a24;border-color:#de770f;color:#ffffff;}.alert-box.info {background-color:#a0d3e8;border-color:#74bfdd;color:#4f4f4f;}[class*="block-grid-"] {display:block;padding:0;margin:0 -0.625rem;*zoom:1;}[class*="block-grid-"]:before ,[class*="block-grid-"]:after {content:" ";display:table;}[class*="block-grid-"]:after {clear:both;}[class*="block-grid-"]>li {display:block;height:auto;float:left;padding:0 0.625rem 1.25rem;}@media only screen{.small-block-grid-1>li {width:100%;list-style:none;}.small-block-grid-1 > li:nth-of-type(n) {clear:none;}.small-block-grid-1 > li:nth-of-type(1n+1) {clear:both;}.small-block-grid-2>li {width:50%;list-style:none;}.small-block-grid-2 > li:nth-of-type(n) {clear:none;}.small-block-grid-2 > li:nth-of-type(2n+1) {clear:both;}.small-block-grid-3>li {width:33.33333%;list-style:none;}.small-block-grid-3 > li:nth-of-type(n) {clear:none;}.small-block-grid-3 > li:nth-of-type(3n+1) {clear:both;}.small-block-grid-4>li {width:25%;list-style:none;}.small-block-grid-4 > li:nth-of-type(n) {clear:none;}.small-block-grid-4 > li:nth-of-type(4n+1) {clear:both;}.small-block-grid-5>li {width:20%;list-style:none;}.small-block-grid-5 > li:nth-of-type(n) {clear:none;}.small-block-grid-5 > li:nth-of-type(5n+1) {clear:both;}.small-block-grid-6>li {width:16.66667%;list-style:none;}.small-block-grid-6 > li:nth-of-type(n) {clear:none;}.small-block-grid-6 > li:nth-of-type(6n+1) {clear:both;}.small-block-grid-7>li {width:14.28571%;list-style:none;}.small-block-grid-7 > li:nth-of-type(n) {clear:none;}.small-block-grid-7 > li:nth-of-type(7n+1) {clear:both;}.small-block-grid-8>li {width:12.5%;list-style:none;}.small-block-grid-8 > li:nth-of-type(n) {clear:none;}.small-block-grid-8 > li:nth-of-type(8n+1) {clear:both;}.small-block-grid-9>li {width:11.11111%;list-style:none;}.small-block-grid-9 > li:nth-of-type(n) {clear:none;}.small-block-grid-9 > li:nth-of-type(9n+1) {clear:both;}.small-block-grid-10>li {width:10%;list-style:none;}.small-block-grid-10 > li:nth-of-type(n) {clear:none;}.small-block-grid-10 > li:nth-of-type(10n+1) {clear:both;}.small-block-grid-11>li {width:9.09091%;list-style:none;}.small-block-grid-11 > li:nth-of-type(n) {clear:none;}.small-block-grid-11 > li:nth-of-type(11n+1) {clear:both;}.small-block-grid-12>li {width:8.33333%;list-style:none;}.small-block-grid-12 > li:nth-of-type(n) {clear:none;}.small-block-grid-12 > li:nth-of-type(12n+1) {clear:both;}}@media only screen and (min-width:40.063em){.medium-block-grid-1>li {width:100%;list-style:none;}.medium-block-grid-1 > li:nth-of-type(n) {clear:none;}.medium-block-grid-1 > li:nth-of-type(1n+1) {clear:both;}.medium-block-grid-2>li {width:50%;list-style:none;}.medium-block-grid-2 > li:nth-of-type(n) {clear:none;}.medium-block-grid-2 > li:nth-of-type(2n+1) {clear:both;}.medium-block-grid-3>li {width:33.33333%;list-style:none;}.medium-block-grid-3 > li:nth-of-type(n) {clear:none;}.medium-block-grid-3 > li:nth-of-type(3n+1) {clear:both;}.medium-block-grid-4>li {width:25%;list-style:none;}.medium-block-grid-4 > li:nth-of-type(n) {clear:none;}.medium-block-grid-4 > li:nth-of-type(4n+1) {clear:both;}.medium-block-grid-5>li {width:20%;list-style:none;}.medium-block-grid-5 > li:nth-of-type(n) {clear:none;}.medium-block-grid-5 > li:nth-of-type(5n+1) {clear:both;}.medium-block-grid-6>li {width:16.66667%;list-style:none;}.medium-block-grid-6 > li:nth-of-type(n) {clear:none;}.medium-block-grid-6 > li:nth-of-type(6n+1) {clear:both;}.medium-block-grid-7>li {width:14.28571%;list-style:none;}.medium-block-grid-7 > li:nth-of-type(n) {clear:none;}.medium-block-grid-7 > li:nth-of-type(7n+1) {clear:both;}.medium-block-grid-8>li {width:12.5%;list-style:none;}.medium-block-grid-8 > li:nth-of-type(n) {clear:none;}.medium-block-grid-8 > li:nth-of-type(8n+1) {clear:both;}.medium-block-grid-9>li {width:11.11111%;list-style:none;}.medium-block-grid-9 > li:nth-of-type(n) {clear:none;}.medium-block-grid-9 > li:nth-of-type(9n+1) {clear:both;}.medium-block-grid-10>li {width:10%;list-style:none;}.medium-block-grid-10 > li:nth-of-type(n) {clear:none;}.medium-block-grid-10 > li:nth-of-type(10n+1) {clear:both;}.medium-block-grid-11>li {width:9.09091%;list-style:none;}.medium-block-grid-11 > li:nth-of-type(n) {clear:none;}.medium-block-grid-11 > li:nth-of-type(11n+1) {clear:both;}.medium-block-grid-12>li {width:8.33333%;list-style:none;}.medium-block-grid-12 > li:nth-of-type(n) {clear:none;}.medium-block-grid-12 > li:nth-of-type(12n+1) {clear:both;}}@media only screen and (min-width:64.063em){.large-block-grid-1>li {width:100%;list-style:none;}.large-block-grid-1 > li:nth-of-type(n) {clear:none;}.large-block-grid-1 > li:nth-of-type(1n+1) {clear:both;}.large-block-grid-2>li {width:50%;list-style:none;}.large-block-grid-2 > li:nth-of-type(n) {clear:none;}.large-block-grid-2 > li:nth-of-type(2n+1) {clear:both;}.large-block-grid-3>li {width:33.33333%;list-style:none;}.large-block-grid-3 > li:nth-of-type(n) {clear:none;}.large-block-grid-3 > li:nth-of-type(3n+1) {clear:both;}.large-block-grid-4>li {width:25%;list-style:none;}.large-block-grid-4 > li:nth-of-type(n) {clear:none;}.large-block-grid-4 > li:nth-of-type(4n+1) {clear:both;}.large-block-grid-5>li {width:20%;list-style:none;}.large-block-grid-5 > li:nth-of-type(n) {clear:none;}.large-block-grid-5 > li:nth-of-type(5n+1) {clear:both;}.large-block-grid-6>li {width:16.66667%;list-style:none;}.large-block-grid-6 > li:nth-of-type(n) {clear:none;}.large-block-grid-6 > li:nth-of-type(6n+1) {clear:both;}.large-block-grid-7>li {width:14.28571%;list-style:none;}.large-block-grid-7 > li:nth-of-type(n) {clear:none;}.large-block-grid-7 > li:nth-of-type(7n+1) {clear:both;}.large-block-grid-8>li {width:12.5%;list-style:none;}.large-block-grid-8 > li:nth-of-type(n) {clear:none;}.large-block-grid-8 > li:nth-of-type(8n+1) {clear:both;}.large-block-grid-9>li {width:11.11111%;list-style:none;}.large-block-grid-9 > li:nth-of-type(n) {clear:none;}.large-block-grid-9 > li:nth-of-type(9n+1) {clear:both;}.large-block-grid-10>li {width:10%;list-style:none;}.large-block-grid-10 > li:nth-of-type(n) {clear:none;}.large-block-grid-10 > li:nth-of-type(10n+1) {clear:both;}.large-block-grid-11>li {width:9.09091%;list-style:none;}.large-block-grid-11 > li:nth-of-type(n) {clear:none;}.large-block-grid-11 > li:nth-of-type(11n+1) {clear:both;}.large-block-grid-12>li {width:8.33333%;list-style:none;}.large-block-grid-12 > li:nth-of-type(n) {clear:none;}.large-block-grid-12 > li:nth-of-type(12n+1) {clear:both;}}.breadcrumbs {display:block;padding:0.5625rem 0.875rem 0.5625rem;overflow:hidden;margin-left:0;list-style:none;border-style:solid;border-width:1px;background-color:#f4f4f4;border-color:#dcdcdc;-webkit-border-radius:3px;border-radius:3px;}.breadcrumbs>* {margin:0;float:left;font-size:0.6875rem;text-transform:uppercase;}.breadcrumbs > *:hover a ,.breadcrumbs > *:focus a {text-decoration:underline;}.breadcrumbs > * a ,.breadcrumbs > * span {text-transform:uppercase;color:#008cba;}.breadcrumbs > *.current {cursor:default;color:#333333;}.breadcrumbs > *.current a {cursor:default;color:#333333;}.breadcrumbs > *.current:hover ,.breadcrumbs > *.current:hover a ,.breadcrumbs > *.current:focus ,.breadcrumbs > *.current:focus a {text-decoration:none;}.breadcrumbs > *.unavailable {color:#999999;}.breadcrumbs > *.unavailable a {color:#999999;}.breadcrumbs > *.unavailable:hover ,.breadcrumbs > *.unavailable:hover a ,.breadcrumbs > *.unavailable:focus ,.breadcrumbs > *.unavailable a:focus {text-decoration:none;color:#999999;cursor:default;}.breadcrumbs > *:before {content:"/";color:#aaaaaa;margin:0 0.75rem;position:relative;top:1px;}.breadcrumbs > *:first-child:before {content:" ";margin:0;}button ,.button {border-style:solid;border-width:0px;cursor:pointer;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;font-weight:normal;line-height:normal;margin:0 0 1.25rem;position:relative;text-decoration:none;text-align:center;display:inline-block;padding-top:1rem;padding-right:2rem;padding-bottom:1.0625rem;padding-left:2rem;font-size:1rem;background-color:#008cba;border-color:#007295;color:#ffffff;-webkit-transition:background-color 300ms ease-out;-moz-transition:background-color 300ms ease-out;transition:background-color 300ms ease-out;padding-top:1.0625rem;padding-bottom:1rem;-webkit-appearance:none;border:none;font-weight:normal !important;}button:hover ,button:focus ,.button:hover ,.button:focus {background-color:#007295;}button:hover ,button:focus ,.button:hover ,.button:focus {color:#ffffff;}button.secondary ,.button.secondary {background-color:#e7e7e7;border-color:#b9b9b9;color:#333333;}button.secondary:hover ,button.secondary:focus ,.button.secondary:hover ,.button.secondary:focus {background-color:#b9b9b9;}button.secondary:hover ,button.secondary:focus ,.button.secondary:hover ,.button.secondary:focus {color:#333333;}button.success ,.button.success {background-color:#43ac6a;border-color:#368a54;color:#ffffff;}button.success:hover ,button.success:focus ,.button.success:hover ,.button.success:focus {background-color:#368a54;}button.success:hover ,button.success:focus ,.button.success:hover ,.button.success:focus {color:#ffffff;}button.alert ,.button.alert {background-color:#f04124;border-color:#cf280e;color:#ffffff;}button.alert:hover ,button.alert:focus ,.button.alert:hover ,.button.alert:focus {background-color:#cf280e;}button.alert:hover ,button.alert:focus ,.button.alert:hover ,.button.alert:focus {color:#ffffff;}button.large ,.button.large {padding-top:1.125rem;padding-right:2.25rem;padding-bottom:1.1875rem;padding-left:2.25rem;font-size:1.25rem;}button.small ,.button.small {padding-top:0.875rem;padding-right:1.75rem;padding-bottom:0.9375rem;padding-left:1.75rem;font-size:0.8125rem;}button.tiny ,.button.tiny {padding-top:0.625rem;padding-right:1.25rem;padding-bottom:0.6875rem;padding-left:1.25rem;font-size:0.6875rem;}button.expand ,.button.expand {padding-right:0;padding-left:0;width:100%;}button.left-align ,.button.left-align {text-align:left;text-indent:0.75rem;}button.right-align ,.button.right-align {text-align:right;padding-right:0.75rem;}button.radius ,.button.radius {-webkit-border-radius:3px;border-radius:3px;}button.round ,.button.round {-webkit-border-radius:1000px;border-radius:1000px;}button.disabled ,button[disabled] ,.button.disabled ,.button[disabled] {background-color:#008cba;border-color:#007295;color:#ffffff;cursor:default;opacity:0.7;-webkit-box-shadow:none;box-shadow:none;}button.disabled:hover ,button.disabled:focus ,button[disabled]:hover ,button[disabled]:focus ,.button.disabled:hover ,.button.disabled:focus ,.button[disabled]:hover ,.button[disabled]:focus {background-color:#007295;}button.disabled:hover ,button.disabled:focus ,button[disabled]:hover ,button[disabled]:focus ,.button.disabled:hover ,.button.disabled:focus ,.button[disabled]:hover ,.button[disabled]:focus {color:#ffffff;}button.disabled:hover ,button.disabled:focus ,button[disabled]:hover ,button[disabled]:focus ,.button.disabled:hover ,.button.disabled:focus ,.button[disabled]:hover ,.button[disabled]:focus {background-color:#008cba;}button.disabled.secondary ,button[disabled].secondary ,.button.disabled.secondary ,.button[disabled].secondary {background-color:#e7e7e7;border-color:#b9b9b9;color:#333333;cursor:default;opacity:0.7;-webkit-box-shadow:none;box-shadow:none;}button.disabled.secondary:hover ,button.disabled.secondary:focus ,button[disabled].secondary:hover ,button[disabled].secondary:focus ,.button.disabled.secondary:hover ,.button.disabled.secondary:focus ,.button[disabled].secondary:hover ,.button[disabled].secondary:focus {background-color:#b9b9b9;}button.disabled.secondary:hover ,button.disabled.secondary:focus ,button[disabled].secondary:hover ,button[disabled].secondary:focus ,.button.disabled.secondary:hover ,.button.disabled.secondary:focus ,.button[disabled].secondary:hover ,.button[disabled].secondary:focus {color:#333333;}button.disabled.secondary:hover ,button.disabled.secondary:focus ,button[disabled].secondary:hover ,button[disabled].secondary:focus ,.button.disabled.secondary:hover ,.button.disabled.secondary:focus ,.button[disabled].secondary:hover ,.button[disabled].secondary:focus {background-color:#e7e7e7;}button.disabled.success ,button[disabled].success ,.button.disabled.success ,.button[disabled].success {background-color:#43ac6a;border-color:#368a54;color:#ffffff;cursor:default;opacity:0.7;-webkit-box-shadow:none;box-shadow:none;}button.disabled.success:hover ,button.disabled.success:focus ,button[disabled].success:hover ,button[disabled].success:focus ,.button.disabled.success:hover ,.button.disabled.success:focus ,.button[disabled].success:hover ,.button[disabled].success:focus {background-color:#368a54;}button.disabled.success:hover ,button.disabled.success:focus ,button[disabled].success:hover ,button[disabled].success:focus ,.button.disabled.success:hover ,.button.disabled.success:focus ,.button[disabled].success:hover ,.button[disabled].success:focus {color:#ffffff;}button.disabled.success:hover ,button.disabled.success:focus ,button[disabled].success:hover ,button[disabled].success:focus ,.button.disabled.success:hover ,.button.disabled.success:focus ,.button[disabled].success:hover ,.button[disabled].success:focus {background-color:#43ac6a;}button.disabled.alert ,button[disabled].alert ,.button.disabled.alert ,.button[disabled].alert {background-color:#f04124;border-color:#cf280e;color:#ffffff;cursor:default;opacity:0.7;-webkit-box-shadow:none;box-shadow:none;}button.disabled.alert:hover ,button.disabled.alert:focus ,button[disabled].alert:hover ,button[disabled].alert:focus ,.button.disabled.alert:hover ,.button.disabled.alert:focus ,.button[disabled].alert:hover ,.button[disabled].alert:focus {background-color:#cf280e;}button.disabled.alert:hover ,button.disabled.alert:focus ,button[disabled].alert:hover ,button[disabled].alert:focus ,.button.disabled.alert:hover ,.button.disabled.alert:focus ,.button[disabled].alert:hover ,.button[disabled].alert:focus {color:#ffffff;}button.disabled.alert:hover ,button.disabled.alert:focus ,button[disabled].alert:hover ,button[disabled].alert:focus ,.button.disabled.alert:hover ,.button.disabled.alert:focus ,.button[disabled].alert:hover ,.button[disabled].alert:focus {background-color:#f04124;}@media only screen and (min-width:40.063em){button ,.button {display:inline-block;}}.button-group {list-style:none;margin:0;left:0;*zoom:1;}.button-group:before ,.button-group:after {content:" ";display:table;}.button-group:after {clear:both;}.button-group li {margin:0;float:left;}.button-group li>button ,.button-group li .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group li:first-child button ,.button-group li:first-child .button {border-left:0;}.button-group li:first-child {margin-left:0;}.button-group.radius > *>button ,.button-group.radius > * .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group.radius > *:first-child button ,.button-group.radius > *:first-child .button {border-left:0;}.button-group.radius > *:first-child ,.button-group.radius > *:first-child>a ,.button-group.radius > *:first-child>button ,.button-group.radius > *:first-child>.button {-moz-border-radius-bottomleft:3px;-moz-border-radius-topleft:3px;-webkit-border-bottom-left-radius:3px;-webkit-border-top-left-radius:3px;border-bottom-left-radius:3px;border-top-left-radius:3px;}.button-group.radius > *:last-child ,.button-group.radius > *:last-child>a ,.button-group.radius > *:last-child>button ,.button-group.radius > *:last-child>.button {-moz-border-radius-bottomright:3px;-moz-border-radius-topright:3px;-webkit-border-bottom-right-radius:3px;-webkit-border-top-right-radius:3px;border-bottom-right-radius:3px;border-top-right-radius:3px;}.button-group.round > *>button ,.button-group.round > * .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group.round > *:first-child button ,.button-group.round > *:first-child .button {border-left:0;}.button-group.round > *:first-child ,.button-group.round > *:first-child>a ,.button-group.round > *:first-child>button ,.button-group.round > *:first-child>.button {-moz-border-radius-bottomleft:1000px;-moz-border-radius-topleft:1000px;-webkit-border-bottom-left-radius:1000px;-webkit-border-top-left-radius:1000px;border-bottom-left-radius:1000px;border-top-left-radius:1000px;}.button-group.round > *:last-child ,.button-group.round > *:last-child>a ,.button-group.round > *:last-child>button ,.button-group.round > *:last-child>.button {-moz-border-radius-bottomright:1000px;-moz-border-radius-topright:1000px;-webkit-border-bottom-right-radius:1000px;-webkit-border-top-right-radius:1000px;border-bottom-right-radius:1000px;border-top-right-radius:1000px;}.button-group.even-2 li {width:50%;}.button-group.even-2 li>button ,.button-group.even-2 li .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group.even-2 li:first-child button ,.button-group.even-2 li:first-child .button {border-left:0;}.button-group.even-2 li button ,.button-group.even-2 li .button {width:100%;}.button-group.even-3 li {width:33.33333%;}.button-group.even-3 li>button ,.button-group.even-3 li .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group.even-3 li:first-child button ,.button-group.even-3 li:first-child .button {border-left:0;}.button-group.even-3 li button ,.button-group.even-3 li .button {width:100%;}.button-group.even-4 li {width:25%;}.button-group.even-4 li>button ,.button-group.even-4 li .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group.even-4 li:first-child button ,.button-group.even-4 li:first-child .button {border-left:0;}.button-group.even-4 li button ,.button-group.even-4 li .button {width:100%;}.button-group.even-5 li {width:20%;}.button-group.even-5 li>button ,.button-group.even-5 li .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group.even-5 li:first-child button ,.button-group.even-5 li:first-child .button {border-left:0;}.button-group.even-5 li button ,.button-group.even-5 li .button {width:100%;}.button-group.even-6 li {width:16.66667%;}.button-group.even-6 li>button ,.button-group.even-6 li .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group.even-6 li:first-child button ,.button-group.even-6 li:first-child .button {border-left:0;}.button-group.even-6 li button ,.button-group.even-6 li .button {width:100%;}.button-group.even-7 li {width:14.28571%;}.button-group.even-7 li>button ,.button-group.even-7 li .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group.even-7 li:first-child button ,.button-group.even-7 li:first-child .button {border-left:0;}.button-group.even-7 li button ,.button-group.even-7 li .button {width:100%;}.button-group.even-8 li {width:12.5%;}.button-group.even-8 li>button ,.button-group.even-8 li .button {border-left:1px solid;border-color:rgba(255, 255, 255, 0.5);}.button-group.even-8 li:first-child button ,.button-group.even-8 li:first-child .button {border-left:0;}.button-group.even-8 li button ,.button-group.even-8 li .button {width:100%;}.button-bar {*zoom:1;}.button-bar:before ,.button-bar:after {content:" ";display:table;}.button-bar:after {clear:both;}.button-bar .button-group {float:left;margin-right:0.625rem;}.button-bar .button-group div {overflow:hidden;}.clearing-thumbs ,[data-clearing] {*zoom:1;margin-bottom:0;margin-left:0;list-style:none;}.clearing-thumbs:before ,.clearing-thumbs:after ,[data-clearing]:before ,[data-clearing]:after {content:" ";display:table;}.clearing-thumbs:after ,[data-clearing]:after {clear:both;}.clearing-thumbs li ,[data-clearing] li {float:left;margin-right:10px;}.clearing-thumbs[class*="block-grid-"] li ,[data-clearing][class*="block-grid-"] li {margin-right:0;}.clearing-blackout {background:#333333;position:fixed;width:100%;height:100%;top:0;left:0;z-index:998;}.clearing-blackout .clearing-close {display:block;}.clearing-container {position:relative;z-index:998;height:100%;overflow:hidden;margin:0;}.clearing-touch-label {position:absolute;top:50%;left:50%;color:#aaaaaa;font-size:0.6em;}.visible-img {height:95%;position:relative;}.visible-img img {position:absolute;left:50%;top:50%;margin-left:-50%;max-height:100%;max-width:100%;}.clearing-caption {color:#cccccc;font-size:0.875em;line-height:1.3;margin-bottom:0;text-align:center;bottom:0;background:#333333;width:100%;padding:10px 30px 20px;position:absolute;left:0;}.clearing-close {z-index:999;padding-left:20px;padding-top:10px;font-size:30px;line-height:1;color:#cccccc;display:none;}.clearing-close:hover ,.clearing-close:focus {color:#cccccc;}.clearing-assembled .clearing-container {height:100%;}.clearing-assembled .clearing-container .carousel>ul {display:none;}.clearing-feature li {display:none;}.clearing-feature li.clearing-featured-img {display:block;}@media only screen and (min-width:40.063em){.clearing-main-prev ,.clearing-main-next {position:absolute;height:100%;width:40px;top:0;}.clearing-main-prev>span ,.clearing-main-next>span {position:absolute;top:50%;display:block;width:0;height:0;border:solid 12px;}.clearing-main-prev > span:hover ,.clearing-main-next > span:hover {opacity:0.8;}.clearing-main-prev {left:0;}.clearing-main-prev>span {left:5px;border-color:transparent;border-right-color:#cccccc;}.clearing-main-next {right:0;}.clearing-main-next>span {border-color:transparent;border-left-color:#cccccc;}.clearing-main-prev.disabled ,.clearing-main-next.disabled {opacity:0.3;}.clearing-assembled .clearing-container .carousel {background:rgba(51, 51, 51, 0.8);height:120px;margin-top:10px;text-align:center;}.clearing-assembled .clearing-container .carousel>ul {display:inline-block;z-index:999;height:100%;position:relative;float:none;}.clearing-assembled .clearing-container .carousel > ul li {display:block;width:120px;min-height:inherit;float:left;overflow:hidden;margin-right:0;padding:0;position:relative;cursor:pointer;opacity:0.4;}.clearing-assembled .clearing-container .carousel > ul li.fix-height img {height:100%;max-width:none;}.clearing-assembled .clearing-container .carousel > ul li a.th {border:none;-webkit-box-shadow:none;box-shadow:none;display:block;}.clearing-assembled .clearing-container .carousel > ul li img {cursor:pointer !important;width:100% !important;}.clearing-assembled .clearing-container .carousel > ul li.visible {opacity:1;}.clearing-assembled .clearing-container .carousel > ul li:hover {opacity:0.8;}.clearing-assembled .clearing-container .visible-img {background:#333333;overflow:hidden;height:85%;}.clearing-close {position:absolute;top:10px;right:20px;padding-left:0;padding-top:0;}}@media only screen and (max-width: 40em){.f-dropdown {max-width:100%;left:0;}}.f-dropdown {position:absolute;left:-9999px;list-style:none;margin-left:0;width:100%;max-height:none;height:auto;background:#ffffff;border:solid 1px #cccccc;font-size:16px;z-index:99;margin-top:2px;max-width:200px;}.f-dropdown>*:first-child {margin-top:0;}.f-dropdown>*:last-child {margin-bottom:0;}.f-dropdown:before {content:"";display:block;width:0;height:0;border:inset 6px;border-color:transparent transparent #ffffff transparent;border-bottom-style:solid;position:absolute;top:-12px;left:10px;z-index:99;}.f-dropdown:after {content:"";display:block;width:0;height:0;border:inset 7px;border-color:transparent transparent #cccccc transparent;border-bottom-style:solid;position:absolute;top:-14px;left:9px;z-index:98;}.f-dropdown.right:before {left:auto;right:10px;}.f-dropdown.right:after {left:auto;right:9px;}.f-dropdown li {font-size:0.875rem;cursor:pointer;line-height:1.125rem;margin:0;}.f-dropdown li:hover ,.f-dropdown li:focus {background:#eeeeee;}.f-dropdown li a {display:block;padding:0.5rem;color:#555555;}.f-dropdown.content {position:absolute;left:-9999px;list-style:none;margin-left:0;padding:1.25rem;width:100%;height:auto;max-height:none;background:#ffffff;border:solid 1px #cccccc;font-size:16px;z-index:99;max-width:200px;}.f-dropdown.content>*:first-child {margin-top:0;}.f-dropdown.content>*:last-child {margin-bottom:0;}.f-dropdown.tiny {max-width:200px;}.f-dropdown.small {max-width:300px;}.f-dropdown.medium {max-width:500px;}.f-dropdown.large {max-width:800px;}.dropdown.button ,button.dropdown {position:relative;padding-right:3.5625rem;}.dropdown.button:before ,button.dropdown:before {position:absolute;content:"";width:0;height:0;display:block;border-style:solid;border-color:#ffffff transparent transparent transparent;top:50%;}.dropdown.button:before ,button.dropdown:before {border-width:0.375rem;right:1.40625rem;margin-top:-0.15625rem;}.dropdown.button:before ,button.dropdown:before {border-color:#ffffff transparent transparent transparent;}.dropdown.button.tiny ,button.dropdown.tiny {padding-right:2.625rem;}.dropdown.button.tiny:before ,button.dropdown.tiny:before {border-width:0.375rem;right:1.125rem;margin-top:-0.125rem;}.dropdown.button.tiny:before ,button.dropdown.tiny:before {border-color:#ffffff transparent transparent transparent;}.dropdown.button.small ,button.dropdown.small {padding-right:3.0625rem;}.dropdown.button.small:before ,button.dropdown.small:before {border-width:0.4375rem;right:1.3125rem;margin-top:-0.15625rem;}.dropdown.button.small:before ,button.dropdown.small:before {border-color:#ffffff transparent transparent transparent;}.dropdown.button.large ,button.dropdown.large {padding-right:3.625rem;}.dropdown.button.large:before ,button.dropdown.large:before {border-width:0.3125rem;right:1.71875rem;margin-top:-0.15625rem;}.dropdown.button.large:before ,button.dropdown.large:before {border-color:#ffffff transparent transparent transparent;}.dropdown.button.secondary:before ,button.dropdown.secondary:before {border-color:#333333 transparent transparent transparent;}.flex-video {position:relative;padding-top:1.5625rem;padding-bottom:67.5%;height:0;margin-bottom:1rem;overflow:hidden;}.flex-video.widescreen {padding-bottom:56.55%;}.flex-video.vimeo {padding-top:0;}.flex-video iframe ,.flex-video object ,.flex-video embed ,.flex-video video {position:absolute;top:0;left:0;width:100%;height:100%;}form {margin:0 0 1rem;}form .row .row {margin:0 -0.5rem;}form .row .row .column ,form .row .row .columns {padding:0 0.5rem;}form .row .row.collapse {margin:0;}form .row .row.collapse .column ,form .row .row.collapse .columns {padding:0;}form .row .row.collapse input {-moz-border-radius-bottomright:0;-moz-border-radius-topright:0;-webkit-border-bottom-right-radius:0;-webkit-border-top-right-radius:0;}form .row input.column ,form .row input.columns ,form .row textarea.column ,form .row textarea.columns {padding-left:0.5rem;}label {font-size:0.875rem;color:#4d4d4d;cursor:pointer;display:block;font-weight:normal;line-height:1.5;margin-bottom:0;}label.right {float:none;text-align:right;}label.inline {margin:0 0 1rem 0;padding:0.625rem 0;}label small {text-transform:capitalize;color:#686868;}select {-webkit-appearance:none !important;background:#fafafa url('data:image/svg+xml;base64, PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZlcnNpb249IjEuMSIgeD0iMHB4IiB5PSIwcHgiIHdpZHRoPSI2cHgiIGhlaWdodD0iM3B4IiB2aWV3Qm94PSIwIDAgNiAzIiBlbmFibGUtYmFja2dyb3VuZD0ibmV3IDAgMCA2IDMiIHhtbDpzcGFjZT0icHJlc2VydmUiPjxwb2x5Z29uIHBvaW50cz0iNS45OTIsMCAyLjk5MiwzIC0wLjAwOCwwICIvPjwvc3ZnPg==') no-repeat;background-position-x:97%;background-position-y:center;border:1px solid #cccccc;padding:0.5rem;font-size:0.875rem;-webkit-border-radius:0;border-radius:0;}select.radius {-webkit-border-radius:3px;border-radius:3px;}select:hover {background:#f3f3f3 url('data:image/svg+xml;base64, PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZlcnNpb249IjEuMSIgeD0iMHB4IiB5PSIwcHgiIHdpZHRoPSI2cHgiIGhlaWdodD0iM3B4IiB2aWV3Qm94PSIwIDAgNiAzIiBlbmFibGUtYmFja2dyb3VuZD0ibmV3IDAgMCA2IDMiIHhtbDpzcGFjZT0icHJlc2VydmUiPjxwb2x5Z29uIHBvaW50cz0iNS45OTIsMCAyLjk5MiwzIC0wLjAwOCwwICIvPjwvc3ZnPg==') no-repeat;background-position-x:97%;background-position-y:center;border-color:#999999;}select::-ms-expand {display:none;}@-moz-document url-prefix() {select {background:#fafafa;}select:hover {background:#f3f3f3;}}.prefix ,.postfix {display:block;position:relative;z-index:2;text-align:center;width:100%;padding-top:0;padding-bottom:0;border-style:solid;border-width:1px;overflow:hidden;font-size:0.875rem;height:2.3125rem;line-height:2.3125rem;}.postfix.button {padding-left:0;padding-right:0;padding-top:0;padding-bottom:0;text-align:center;line-height:2.125rem;border:none;}.prefix.button {padding-left:0;padding-right:0;padding-top:0;padding-bottom:0;text-align:center;line-height:2.125rem;border:none;}.prefix.button.radius {-webkit-border-radius:0;border-radius:0;-moz-border-radius-bottomleft:3px;-moz-border-radius-topleft:3px;-webkit-border-bottom-left-radius:3px;-webkit-border-top-left-radius:3px;border-bottom-left-radius:3px;border-top-left-radius:3px;}.postfix.button.radius {-webkit-border-radius:0;border-radius:0;-moz-border-radius-bottomright:3px;-moz-border-radius-topright:3px;-webkit-border-bottom-right-radius:3px;-webkit-border-top-right-radius:3px;border-bottom-right-radius:3px;border-top-right-radius:3px;}.prefix.button.round {-webkit-border-radius:0;border-radius:0;-moz-border-radius-bottomleft:1000px;-moz-border-radius-topleft:1000px;-webkit-border-bottom-left-radius:1000px;-webkit-border-top-left-radius:1000px;border-bottom-left-radius:1000px;border-top-left-radius:1000px;}.postfix.button.round {-webkit-border-radius:0;border-radius:0;-moz-border-radius-bottomright:1000px;-moz-border-radius-topright:1000px;-webkit-border-bottom-right-radius:1000px;-webkit-border-top-right-radius:1000px;border-bottom-right-radius:1000px;border-top-right-radius:1000px;}span.prefix ,label.prefix {background:#f2f2f2;border-right:none;color:#333333;border-color:#cccccc;}span.prefix.radius ,label.prefix.radius {-webkit-border-radius:0;border-radius:0;-moz-border-radius-bottomleft:3px;-moz-border-radius-topleft:3px;-webkit-border-bottom-left-radius:3px;-webkit-border-top-left-radius:3px;border-bottom-left-radius:3px;border-top-left-radius:3px;}span.postfix ,label.postfix {background:#f2f2f2;border-left:none;color:#333333;border-color:#cccccc;}span.postfix.radius ,label.postfix.radius {-webkit-border-radius:0;border-radius:0;-moz-border-radius-bottomright:3px;-moz-border-radius-topright:3px;-webkit-border-bottom-right-radius:3px;-webkit-border-top-right-radius:3px;border-bottom-right-radius:3px;border-top-right-radius:3px;}input[type="text"] ,input[type="password"] ,input[type="date"] ,input[type="datetime"] ,input[type="datetime-local"] ,input[type="month"] ,input[type="week"] ,input[type="email"] ,input[type="number"] ,input[type="search"] ,input[type="tel"] ,input[type="time"] ,input[type="url"] ,textarea {-webkit-appearance:none;background-color:#ffffff;font-family:inherit;border:1px solid #cccccc;-webkit-box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.1);box-shadow:inset 0 1px 2px rgba(0, 0, 0, 0.1);color:rgba(0, 0, 0, 0.75);display:block;font-size:0.875rem;margin:0 0 1rem 0;padding:0.5rem;height:2.3125rem;width:100%;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box;-webkit-transition:-webkit-box-shadow 0.45s,border-color 0.45s ease-in-out;-moz-transition:-moz-box-shadow 0.45s,border-color 0.45s ease-in-out;transition:box-shadow 0.45s,border-color 0.45s ease-in-out;-webkit-transition:all 0.15s linear;-moz-transition:all 0.15s linear;transition:all 0.15s linear;}input[type="text"]:focus ,input[type="password"]:focus ,input[type="date"]:focus ,input[type="datetime"]:focus ,input[type="datetime-local"]:focus ,input[type="month"]:focus ,input[type="week"]:focus ,input[type="email"]:focus ,input[type="number"]:focus ,input[type="search"]:focus ,input[type="tel"]:focus ,input[type="time"]:focus ,input[type="url"]:focus ,textarea:focus {-webkit-box-shadow:0 0 5px #999999;-moz-box-shadow:0 0 5px #999999;box-shadow:0 0 5px #999999;border-color:#999999;}input[type="text"]:focus ,input[type="password"]:focus ,input[type="date"]:focus ,input[type="datetime"]:focus ,input[type="datetime-local"]:focus ,input[type="month"]:focus ,input[type="week"]:focus ,input[type="email"]:focus ,input[type="number"]:focus ,input[type="search"]:focus ,input[type="tel"]:focus ,input[type="time"]:focus ,input[type="url"]:focus ,textarea:focus {background:#fafafa;border-color:#999999;outline:none;}input[type="text"][disabled] ,input[type="password"][disabled] ,input[type="date"][disabled] ,input[type="datetime"][disabled] ,input[type="datetime-local"][disabled] ,input[type="month"][disabled] ,input[type="week"][disabled] ,input[type="email"][disabled] ,input[type="number"][disabled] ,input[type="search"][disabled] ,input[type="tel"][disabled] ,input[type="time"][disabled] ,input[type="url"][disabled] ,textarea[disabled] {background-color:#dddddd;}input[type="text"].radius ,input[type="password"].radius ,input[type="date"].radius ,input[type="datetime"].radius ,input[type="datetime-local"].radius ,input[type="month"].radius ,input[type="week"].radius ,input[type="email"].radius ,input[type="number"].radius ,input[type="search"].radius ,input[type="tel"].radius ,input[type="time"].radius ,input[type="url"].radius ,textarea.radius {-webkit-border-radius:3px;border-radius:3px;}select {height:2.3125rem;}input[type="file"] ,input[type="checkbox"] ,input[type="radio"] ,select {margin:0 0 1rem 0;}input[type="checkbox"]+label ,input[type="radio"]+label {display:inline-block;margin-left:0.5rem;margin-right:1rem;margin-bottom:0;vertical-align:baseline;}input[type="file"] {width:100%;}fieldset {border:solid 1px #dddddd;padding:1.25rem;margin:1.125rem 0;}fieldset legend {font-weight:bold;background:#ffffff;padding:0 0.1875rem;margin:0;margin-left:-0.1875rem;}[data-abide] .error small.error ,[data-abide] span.error ,[data-abide] small.error {display:block;padding:0.375rem 0.5625rem 0.5625rem;margin-top:-1px;margin-bottom:1rem;font-size:0.75rem;font-weight:normal;font-style:italic;background:#f04124;color:#ffffff;}[data-abide] span.error ,[data-abide] small.error {display:none;}span.error ,small.error {display:block;padding:0.375rem 0.5625rem 0.5625rem;margin-top:-1px;margin-bottom:1rem;font-size:0.75rem;font-weight:normal;font-style:italic;background:#f04124;color:#ffffff;}.error input ,.error textarea ,.error select {margin-bottom:0;}.error input[type="checkbox"] ,.error input[type="radio"] {margin-bottom:1rem;}.error label ,.error label.error {color:#f04124;}.error small.error {display:block;padding:0.375rem 0.5625rem 0.5625rem;margin-top:-1px;margin-bottom:1rem;font-size:0.75rem;font-weight:normal;font-style:italic;background:#f04124;color:#ffffff;}.error > label>small {color:#686868;background:transparent;padding:0;text-transform:capitalize;font-style:normal;font-size:60%;margin:0;display:inline;}.error span.error-message {display:block;}input.error ,textarea.error {margin-bottom:0;}label.error {color:#f04124;}.inline-list {margin:0 auto 1.0625rem auto;margin-left:-1.375rem;margin-right:0;padding:0;list-style:none;overflow:hidden;}.inline-list>li {list-style:none;float:left;margin-left:1.375rem;display:block;}.inline-list > li>* {display:block;}.joyride-list {display:none;}.joyride-tip-guide {display:none;position:absolute;background:#333333;color:#ffffff;z-index:101;top:0;left:2.5%;font-family:inherit;font-weight:normal;width:95%;}.lt-ie9 .joyride-tip-guide {max-width:800px;left:50%;margin-left:-400px;}.joyride-content-wrapper {width:100%;padding:1.125rem 1.25rem 1.5rem;}.joyride-content-wrapper .button {margin-bottom:0 !important;}.joyride-tip-guide .joyride-nub {display:block;position:absolute;left:22px;width:0;height:0;border:10px solid #333333;}.joyride-tip-guide .joyride-nub.top {border-top-style:solid;border-color:#333333;border-top-color:transparent !important;border-left-color:transparent !important;border-right-color:transparent !important;top:-20px;}.joyride-tip-guide .joyride-nub.bottom {border-bottom-style:solid;border-color:#333333 !important;border-bottom-color:transparent !important;border-left-color:transparent !important;border-right-color:transparent !important;bottom:-20px;}.joyride-tip-guide .joyride-nub.right {right:-20px;}.joyride-tip-guide .joyride-nub.left {left:-20px;}.joyride-tip-guide h1 ,.joyride-tip-guide h2 ,.joyride-tip-guide h3 ,.joyride-tip-guide h4 ,.joyride-tip-guide h5 ,.joyride-tip-guide h6 {line-height:1.25;margin:0;font-weight:bold;color:#ffffff;}.joyride-tip-guide p {margin:0 0 1.125rem 0;font-size:0.875rem;line-height:1.3;}.joyride-timer-indicator-wrap {width:50px;height:3px;border:solid 1px #555555;position:absolute;right:1.0625rem;bottom:1rem;}.joyride-timer-indicator {display:block;width:0;height:inherit;background:#666666;}.joyride-close-tip {position:absolute;right:12px;top:10px;color:#777777 !important;text-decoration:none;font-size:24px;font-weight:normal;line-height:0.5 !important;}.joyride-close-tip:hover ,.joyride-close-tip:focus {color:#eeeeee !important;}.joyride-modal-bg {position:fixed;height:100%;width:100%;background:transparent;background:rgba(0, 0, 0, 0.5);z-index:100;display:none;top:0;left:0;cursor:pointer;}.joyride-expose-wrapper {background-color:#ffffff;position:absolute;border-radius:3px;z-index:102;-moz-box-shadow:0 0 30px #ffffff;-webkit-box-shadow:0 0 15px #ffffff;box-shadow:0 0 15px #ffffff;}.joyride-expose-cover {background:transparent;border-radius:3px;position:absolute;z-index:9999;top:0;left:0;}@media only screen and (min-width:40.063em){.joyride-tip-guide {width:300px;left:inherit;}.joyride-tip-guide .joyride-nub.bottom {border-color:#333333 !important;border-bottom-color:transparent !important;border-left-color:transparent !important;border-right-color:transparent !important;bottom:-20px;}.joyride-tip-guide .joyride-nub.right {border-color:#333333 !important;border-top-color:transparent !important;border-right-color:transparent !important;border-bottom-color:transparent !important;top:22px;left:auto;right:-20px;}.joyride-tip-guide .joyride-nub.left {border-color:#333333 !important;border-top-color:transparent !important;border-left-color:transparent !important;border-bottom-color:transparent !important;top:22px;left:-20px;right:auto;}}.keystroke ,kbd {background-color:#ededed;border-color:#dcdcdc;color:#222222;border-style:solid;border-width:1px;margin:0;font-family:"Consolas","Menlo","Courier",monospace;font-size:0.875rem;padding:0.125rem 0.25rem 0;-webkit-border-radius:3px;border-radius:3px;}.label {font-weight:normal;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;text-align:center;text-decoration:none;line-height:1;white-space:nowrap;display:inline-block;position:relative;margin-bottom:inherit;padding:0.25rem 0.5rem 0.375rem;font-size:0.6875rem;background-color:#008cba;color:#ffffff;}.label.radius {-webkit-border-radius:3px;border-radius:3px;}.label.round {-webkit-border-radius:1000px;border-radius:1000px;}.label.alert {background-color:#f04124;color:#ffffff;}.label.success {background-color:#43ac6a;color:#ffffff;}.label.secondary {background-color:#e7e7e7;color:#333333;}[data-magellan-expedition] {background:#ffffff;z-index:50;min-width:100%;padding:10px;}[data-magellan-expedition] .sub-nav {margin-bottom:0;}[data-magellan-expedition] .sub-nav dd {margin-bottom:0;}[data-magellan-expedition] .sub-nav a {line-height:1.8em;}@-webkit-keyframes rotate {from {-webkit-transform:rotate(0deg);}to {-webkit-transform:rotate(360deg);}}@-moz-keyframes rotate {from {-moz-transform:rotate(0deg);}to {-moz-transform:rotate(360deg);}}@-o-keyframes rotate {from {-o-transform:rotate(0deg);}to {-o-transform:rotate(360deg);}}@keyframes rotate {from {transform:rotate(0deg);}to {transform:rotate(360deg);}}.slideshow-wrapper {position:relative;}.slideshow-wrapper ul {list-style-type:none;margin:0;}.slideshow-wrapper ul li ,.slideshow-wrapper ul li .orbit-caption {display:none;}.slideshow-wrapper ul li:first-child {display:block;}.slideshow-wrapper .orbit-container {background-color:transparent;}.slideshow-wrapper .orbit-container li {display:block;}.slideshow-wrapper .orbit-container li .orbit-caption {display:block;}.preloader {display:block;width:40px;height:40px;position:absolute;top:50%;left:50%;margin-top:-20px;margin-left:-20px;border:solid 3px;border-color:#555555 #ffffff;-webkit-border-radius:1000px;border-radius:1000px;-webkit-animation-name:rotate;-webkit-animation-duration:1.5s;-webkit-animation-iteration-count:infinite;-webkit-animation-timing-function:linear;-moz-animation-name:rotate;-moz-animation-duration:1.5s;-moz-animation-iteration-count:infinite;-moz-animation-timing-function:linear;-o-animation-name:rotate;-o-animation-duration:1.5s;-o-animation-iteration-count:infinite;-o-animation-timing-function:linear;animation-name:rotate;animation-duration:1.5s;animation-iteration-count:infinite;animation-timing-function:linear;}.orbit-container {overflow:hidden;width:100%;position:relative;background:none;}.orbit-container .orbit-slides-container {list-style:none;margin:0;padding:0;position:relative;-webkit-transform:translateZ(0);}.orbit-container .orbit-slides-container img {display:block;max-width:100%;}.orbit-container .orbit-slides-container>* {position:absolute;top:0;width:100%;margin-left:100%;}.orbit-container .orbit-slides-container > *:first-child {margin-left:0%;}.orbit-container .orbit-slides-container > * .orbit-caption {position:absolute;bottom:0;background-color:rgba(51, 51, 51, 0.8);color:#ffffff;width:100%;padding:0.625rem 0.875rem;font-size:0.875rem;}.orbit-container .orbit-slide-number {position:absolute;top:10px;left:10px;font-size:12px;color:#ffffff;background:rgba(0, 0, 0, 0);z-index:10;}.orbit-container .orbit-slide-number span {font-weight:700;padding:0.3125rem;}.orbit-container .orbit-timer {position:absolute;top:12px;right:10px;height:6px;width:100px;z-index:10;}.orbit-container .orbit-timer .orbit-progress {height:3px;background-color:rgba(255, 255, 255, 0.3);display:block;width:0%;position:relative;right:20px;top:5px;}.orbit-container .orbit-timer>span {display:none;position:absolute;top:0px;right:0;width:11px;height:14px;border:solid 4px #ffffff;border-top:none;border-bottom:none;}.orbit-container .orbit-timer.paused>span {right:-4px;top:0px;width:11px;height:14px;border:inset 8px;border-right-style:solid;border-color:transparent transparent transparent #ffffff;}.orbit-container .orbit-timer.paused > span.dark {border-color:transparent transparent transparent #333333;}.orbit-container:hover .orbit-timer>span {display:block;}.orbit-container .orbit-prev ,.orbit-container .orbit-next {position:absolute;top:45%;margin-top:-25px;width:36px;height:60px;line-height:50px;color:white;background-color:none;text-indent:-9999px !important;z-index:10;}.orbit-container .orbit-prev:hover ,.orbit-container .orbit-next:hover {background-color:rgba(0, 0, 0, 0.3);}.orbit-container .orbit-prev>span ,.orbit-container .orbit-next>span {position:absolute;top:50%;margin-top:-10px;display:block;width:0;height:0;border:inset 10px;}.orbit-container .orbit-prev {left:0;}.orbit-container .orbit-prev>span {border-right-style:solid;border-color:transparent;border-right-color:#ffffff;}.orbit-container .orbit-prev:hover>span {border-right-color:#ffffff;}.orbit-container .orbit-next {right:0;}.orbit-container .orbit-next>span {border-color:transparent;border-left-style:solid;border-left-color:#ffffff;left:50%;margin-left:-4px;}.orbit-container .orbit-next:hover>span {border-left-color:#ffffff;}.orbit-bullets-container {text-align:center;}.orbit-bullets {margin:0 auto 30px auto;overflow:hidden;position:relative;top:10px;float:none;text-align:center;display:block;}.orbit-bullets li {display:inline-block;width:0.5625rem;height:0.5625rem;background:#cccccc;float:none;margin-right:6px;-webkit-border-radius:1000px;border-radius:1000px;}.orbit-bullets li.active {background:#999999;}.orbit-bullets li:last-child {margin-right:0;}.touch .orbit-container .orbit-prev ,.touch .orbit-container .orbit-next {display:none;}.touch .orbit-bullets {display:none;}@media only screen and (min-width:40.063em){.touch .orbit-container .orbit-prev ,.touch .orbit-container .orbit-next {display:inherit;}.touch .orbit-bullets {display:block;}}@media only screen and (max-width: 40em){.orbit-stack-on-small .orbit-slides-container {height:auto !important;}.orbit-stack-on-small .orbit-slides-container>* {position:relative;margin-left:0% !important;}.orbit-stack-on-small .orbit-timer ,.orbit-stack-on-small .orbit-next ,.orbit-stack-on-small .orbit-prev ,.orbit-stack-on-small .orbit-bullets {display:none;}}ul.pagination {display:block;height:1.5rem;margin-left:-0.3125rem;}ul.pagination li {height:1.5rem;color:#222222;font-size:0.875rem;margin-left:0.3125rem;}ul.pagination li a {display:block;padding:0.0625rem 0.625rem 0.0625rem;color:#999999;-webkit-border-radius:3px;border-radius:3px;}ul.pagination li:hover a ,ul.pagination li a:focus {background:#e6e6e6;}ul.pagination li.unavailable a {cursor:default;color:#999999;}ul.pagination li.unavailable:hover a ,ul.pagination li.unavailable a:focus {background:transparent;}ul.pagination li.current a {background:#008cba;color:#ffffff;font-weight:bold;cursor:default;}ul.pagination li.current a:hover ,ul.pagination li.current a:focus {background:#008cba;}ul.pagination li {float:left;display:block;}.pagination-centered {text-align:center;}.pagination-centered ul.pagination li {float:none;display:inline-block;}.panel {border-style:solid;border-width:1px;border-color:#d7d7d7;margin-bottom:1.25rem;padding:1.25rem;background:#f2f2f2;}.panel>:first-child {margin-top:0;}.panel>:last-child {margin-bottom:0;}.panel h1 ,.panel h2 ,.panel h3 ,.panel h4 ,.panel h5 ,.panel h6 ,.panel p {color:#333333;}.panel h1 ,.panel h2 ,.panel h3 ,.panel h4 ,.panel h5 ,.panel h6 {line-height:1;margin-bottom:0.625rem;}.panel h1.subheader ,.panel h2.subheader ,.panel h3.subheader ,.panel h4.subheader ,.panel h5.subheader ,.panel h6.subheader {line-height:1.4;}.panel.callout {border-style:solid;border-width:1px;border-color:#b6edff;margin-bottom:1.25rem;padding:1.25rem;background:#ecfaff;}.panel.callout>:first-child {margin-top:0;}.panel.callout>:last-child {margin-bottom:0;}.panel.callout h1 ,.panel.callout h2 ,.panel.callout h3 ,.panel.callout h4 ,.panel.callout h5 ,.panel.callout h6 ,.panel.callout p {color:#333333;}.panel.callout h1 ,.panel.callout h2 ,.panel.callout h3 ,.panel.callout h4 ,.panel.callout h5 ,.panel.callout h6 {line-height:1;margin-bottom:0.625rem;}.panel.callout h1.subheader ,.panel.callout h2.subheader ,.panel.callout h3.subheader ,.panel.callout h4.subheader ,.panel.callout h5.subheader ,.panel.callout h6.subheader {line-height:1.4;}.panel.callout a {color:#008cba;}.panel.radius {-webkit-border-radius:3px;border-radius:3px;}.pricing-table {border:solid 1px #dddddd;margin-left:0;margin-bottom:1.25rem;}.pricing-table * {list-style:none;line-height:1;}.pricing-table .title {background-color:#333333;padding:0.9375rem 1.25rem;text-align:center;color:#eeeeee;font-weight:normal;font-size:1rem;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;}.pricing-table .price {background-color:#f6f6f6;padding:0.9375rem 1.25rem;text-align:center;color:#333333;font-weight:normal;font-size:2rem;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;}.pricing-table .description {background-color:#ffffff;padding:0.9375rem;text-align:center;color:#777777;font-size:0.75rem;font-weight:normal;line-height:1.4;border-bottom:dotted 1px #dddddd;}.pricing-table .bullet-item {background-color:#ffffff;padding:0.9375rem;text-align:center;color:#333333;font-size:0.875rem;font-weight:normal;border-bottom:dotted 1px #dddddd;}.pricing-table .cta-button {background-color:#ffffff;text-align:center;padding:1.25rem 1.25rem 0;}.progress {background-color:#f6f6f6;height:1.5625rem;border:1px solid #ffffff;padding:0.125rem;margin-bottom:0.625rem;}.progress .meter {background:#008cba;height:100%;display:block;}.progress.secondary .meter {background:#e7e7e7;height:100%;display:block;}.progress.success .meter {background:#43ac6a;height:100%;display:block;}.progress.alert .meter {background:#f04124;height:100%;display:block;}.progress.radius {-webkit-border-radius:3px;border-radius:3px;}.progress.radius .meter {-webkit-border-radius:2px;border-radius:2px;}.progress.round {-webkit-border-radius:1000px;border-radius:1000px;}.progress.round .meter {-webkit-border-radius:999px;border-radius:999px;}.reveal-modal-bg {position:fixed;height:100%;width:100%;background:#000000;background:rgba(0, 0, 0, 0.45);z-index:98;display:none;top:0;left:0;}dialog ,.reveal-modal {visibility:hidden;display:none;position:absolute;left:50%;z-index:99;height:auto;margin-left:-40%;width:80%;background-color:#ffffff;padding:1.25rem;border:solid 1px #666666;-webkit-box-shadow:0 0 10px rgba(0, 0, 0, 0.4);box-shadow:0 0 10px rgba(0, 0, 0, 0.4);top:6.25rem;}dialog .column ,dialog .columns ,.reveal-modal .column ,.reveal-modal .columns {min-width:0;}dialog>:first-child ,.reveal-modal>:first-child {margin-top:0;}dialog>:last-child ,.reveal-modal>:last-child {margin-bottom:0;}dialog .close-reveal-modal ,.reveal-modal .close-reveal-modal {font-size:1.375rem;line-height:1;position:absolute;top:0.5rem;right:0.6875rem;color:#aaaaaa;font-weight:bold;cursor:pointer;}dialog[open] {display:block;visibility:visible;}@media only screen and (min-width:40.063em){dialog ,.reveal-modal {padding:1.875rem;top:6.25rem;}dialog.tiny ,.reveal-modal.tiny {margin-left:-15%;width:30%;}dialog.small ,.reveal-modal.small {margin-left:-20%;width:40%;}dialog.medium ,.reveal-modal.medium {margin-left:-30%;width:60%;}dialog.large ,.reveal-modal.large {margin-left:-35%;width:70%;}dialog.xlarge ,.reveal-modal.xlarge {margin-left:-47.5%;width:95%;}}@media print{dialog ,.reveal-modal {background:#ffffff !important;}}.side-nav {display:block;margin:0;padding:0.875rem 0;list-style-type:none;list-style-position:inside;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;}.side-nav li {margin:0 0 0.4375rem 0;font-size:0.875rem;}.side-nav li a:not(.button) {display:block;color:#008cba;}.side-nav li a:not(.button):hover ,.side-nav li a:not(.button):focus {color:#1ccaff;}.side-nav li.active>a:first-child:not(.button) {color:#1ccaff;font-weight:normal;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;}.side-nav li.divider {border-top:1px solid;height:0;padding:0;list-style:none;border-top-color:#ffffff;}.split.button {position:relative;padding-right:5.0625rem;}.split.button span {display:block;height:100%;position:absolute;right:0;top:0;border-left:solid 1px;}.split.button span:before {position:absolute;content:"";width:0;height:0;display:block;border-style:inset;top:50%;left:50%;}.split.button span:active {background-color:rgba(0, 0, 0, 0.1);}.split.button span {border-left-color:rgba(255, 255, 255, 0.5);}.split.button span {width:3.09375rem;}.split.button span:before {border-top-style:solid;border-width:0.375rem;top:48%;margin-left:-0.375rem;}.split.button span:before {border-color:#ffffff transparent transparent transparent;}.split.button.secondary span {border-left-color:rgba(255, 255, 255, 0.5);}.split.button.secondary span:before {border-color:#ffffff transparent transparent transparent;}.split.button.alert span {border-left-color:rgba(255, 255, 255, 0.5);}.split.button.success span {border-left-color:rgba(255, 255, 255, 0.5);}.split.button.tiny {padding-right:3.75rem;}.split.button.tiny span {width:2.25rem;}.split.button.tiny span:before {border-top-style:solid;border-width:0.375rem;top:48%;margin-left:-0.375rem;}.split.button.small {padding-right:4.375rem;}.split.button.small span {width:2.625rem;}.split.button.small span:before {border-top-style:solid;border-width:0.4375rem;top:48%;margin-left:-0.375rem;}.split.button.large {padding-right:5.5rem;}.split.button.large span {width:3.4375rem;}.split.button.large span:before {border-top-style:solid;border-width:0.3125rem;top:48%;margin-left:-0.375rem;}.split.button.expand {padding-left:2rem;}.split.button.secondary span:before {border-color:#333333 transparent transparent transparent;}.split.button.radius span {-moz-border-radius-bottomright:3px;-moz-border-radius-topright:3px;-webkit-border-bottom-right-radius:3px;-webkit-border-top-right-radius:3px;border-bottom-right-radius:3px;border-top-right-radius:3px;}.split.button.round span {-moz-border-radius-bottomright:1000px;-moz-border-radius-topright:1000px;-webkit-border-bottom-right-radius:1000px;-webkit-border-top-right-radius:1000px;border-bottom-right-radius:1000px;border-top-right-radius:1000px;}.sub-nav {display:block;width:auto;overflow:hidden;margin:-0.25rem 0 1.125rem;padding-top:0.25rem;margin-right:0;margin-left:-0.75rem;}.sub-nav dt {text-transform:uppercase;}.sub-nav dt ,.sub-nav dd ,.sub-nav li {float:left;display:inline;margin-left:1rem;margin-bottom:0.625rem;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;font-weight:normal;font-size:0.875rem;color:#999999;}.sub-nav dt a ,.sub-nav dd a ,.sub-nav li a {text-decoration:none;color:#999999;padding:0.1875rem 1rem;}.sub-nav dt a:hover ,.sub-nav dd a:hover ,.sub-nav li a:hover {color:#737373;}.sub-nav dt.active a ,.sub-nav dd.active a ,.sub-nav li.active a {-webkit-border-radius:3px;border-radius:3px;font-weight:normal;background:#008cba;padding:0.1875rem 1rem;cursor:default;color:#ffffff;}.sub-nav dt.active a:hover ,.sub-nav dd.active a:hover ,.sub-nav li.active a:hover {background:#007ba0;}div.switch {position:relative;padding:0;display:block;overflow:hidden;border-style:solid;border-width:1px;margin-bottom:1.25rem;height:2.25rem;background:#ffffff;border-color:#cccccc;}div.switch label {position:relative;left:0;z-index:2;float:left;width:50%;height:100%;margin:0;font-weight:bold;text-align:left;-webkit-transition:all 0.1s ease-out;-moz-transition:all 0.1s ease-out;transition:all 0.1s ease-out;}div.switch input {position:absolute;z-index:3;opacity:0;width:100%;height:100%;-moz-appearance:none;}div.switch input:hover ,div.switch input:focus {cursor:pointer;}div.switch span:last-child {position:absolute;top:-1px;left:-1px;z-index:1;display:block;padding:0;border-width:1px;border-style:solid;-webkit-transition:all 0.1s ease-out;-moz-transition:all 0.1s ease-out;transition:all 0.1s ease-out;}div.switch input:not(:checked)+label {opacity:0;}div.switch input:checked {display:none !important;}div.switch input {left:0;display:block !important;}div.switch input:first-of-type+label ,div.switch input:first-of-type+span+label {left:-50%;}div.switch input:first-of-type:checked+label ,div.switch input:first-of-type:checked+span+label {left:0%;}div.switch input:last-of-type+label ,div.switch input:last-of-type+span+label {right:-50%;left:auto;text-align:right;}div.switch input:last-of-type:checked+label ,div.switch input:last-of-type:checked+span+label {right:0%;left:auto;}div.switch span.custom {display:none !important;}form.custom div.switch .hidden-field {margin-left:auto;position:absolute;visibility:visible;}div.switch label {padding:0;line-height:2.3rem;font-size:0.875rem;}div.switch input:first-of-type:checked~span:last-child {left:100%;margin-left:-2.1875rem;}div.switch span:last-child {width:2.25rem;height:2.25rem;}div.switch span:last-child {border-color:#b3b3b3;background:#ffffff;background:-moz-linear-gradient(top, #ffffff 0%, #f2f2f2 100%);background:-webkit-linear-gradient(top, #ffffff 0%, #f2f2f2 100%);background:linear-gradient(to bottom, #ffffff 0%, #f2f2f2 100%);-webkit-box-shadow:2px 0 10px 0 rgba(0, 0, 0, 0.07),1000px 0 0 1000px #f3faf6,-2px 0 10px 0 rgba(0, 0, 0, 0.07),-1000px 0 0 1000px #f5f5f5;box-shadow:2px 0 10px 0 rgba(0, 0, 0, 0.07),1000px 0 0 980px #f3faf6,-2px 0 10px 0 rgba(0, 0, 0, 0.07),-1000px 0 0 1000px #f5f5f5;}div.switch:hover span:last-child ,div.switch:focus span:last-child {background:#ffffff;background:-moz-linear-gradient(top, #ffffff 0%, #e6e6e6 100%);background:-webkit-linear-gradient(top, #ffffff 0%, #e6e6e6 100%);background:linear-gradient(to bottom, #ffffff 0%, #e6e6e6 100%);}div.switch:active {background:transparent;}div.switch.large {height:2.75rem;}div.switch.large label {padding:0;line-height:2.3rem;font-size:1.0625rem;}div.switch.large input:first-of-type:checked~span:last-child {left:100%;margin-left:-2.6875rem;}div.switch.large span:last-child {width:2.75rem;height:2.75rem;}div.switch.small {height:1.75rem;}div.switch.small label {padding:0;line-height:2.1rem;font-size:0.75rem;}div.switch.small input:first-of-type:checked~span:last-child {left:100%;margin-left:-1.6875rem;}div.switch.small span:last-child {width:1.75rem;height:1.75rem;}div.switch.tiny {height:1.375rem;}div.switch.tiny label {padding:0;line-height:1.9rem;font-size:0.6875rem;}div.switch.tiny input:first-of-type:checked~span:last-child {left:100%;margin-left:-1.3125rem;}div.switch.tiny span:last-child {width:1.375rem;height:1.375rem;}div.switch.radius {-webkit-border-radius:4px;border-radius:4px;}div.switch.radius span:last-child {-webkit-border-radius:3px;border-radius:3px;}div.switch.round {-webkit-border-radius:1000px;border-radius:1000px;}div.switch.round span:last-child {-webkit-border-radius:999px;border-radius:999px;}div.switch.round label {padding:0 0.5625rem;}@-webkit-keyframes webkitSiblingBugfix {from {position:relative;}to {position:relative;}}table {background:#ffffff;margin-bottom:1.25rem;border:solid 1px #dddddd;}table thead ,table tfoot {background:#f5f5f5;}table thead tr th ,table thead tr td ,table tfoot tr th ,table tfoot tr td {padding:0.5rem 0.625rem 0.625rem;font-size:0.875rem;font-weight:bold;color:#222222;text-align:left;}table tr th ,table tr td {padding:0.5625rem 0.625rem;font-size:0.875rem;color:#222222;}table tr.even ,table tr.alt ,table tr:nth-of-type(even) {background:#f9f9f9;}table thead tr th ,table tfoot tr th ,table tbody tr td ,table tr td ,table tfoot tr td {display:table-cell;line-height:1.125rem;}.tabs {*zoom:1;margin-bottom:0 !important;}.tabs:before ,.tabs:after {content:" ";display:table;}.tabs:after {clear:both;}.tabs dd {position:relative;margin-bottom:0 !important;top:1px;float:left;}.tabs dd>a {display:block;background:#efefef;color:#222222;padding-top:1rem;padding-right:2rem;padding-bottom:1.0625rem;padding-left:2rem;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;font-size:1rem;}.tabs dd > a:hover {background:#e1e1e1;}.tabs dd.active a {background:#ffffff;}.tabs.radius dd:first-child a {-moz-border-radius-bottomleft:3px;-moz-border-radius-topleft:3px;-webkit-border-bottom-left-radius:3px;-webkit-border-top-left-radius:3px;border-bottom-left-radius:3px;border-top-left-radius:3px;}.tabs.radius dd:last-child a {-moz-border-radius-bottomright:3px;-moz-border-radius-topright:3px;-webkit-border-bottom-right-radius:3px;-webkit-border-top-right-radius:3px;border-bottom-right-radius:3px;border-top-right-radius:3px;}.tabs.vertical dd {position:inherit;float:none;display:block;top:auto;}.tabs-content {*zoom:1;margin-bottom:1.5rem;width:100%;}.tabs-content:before ,.tabs-content:after {content:" ";display:table;}.tabs-content:after {clear:both;}.tabs-content>.content {display:none;float:left;padding:0.9375rem 0;width:100%;}.tabs-content > .content.active {display:block;}.tabs-content > .content.contained {padding:0.9375rem;}.tabs-content.vertical {display:block;}.tabs-content.vertical>.content {padding:0 0.9375rem;}@media only screen and (min-width:40.063em){.tabs.vertical {width:20%;float:left;margin-bottom:1.25rem;}.tabs-content.vertical {width:80%;float:left;margin-left:-1px;}}.th {line-height:0;display:inline-block;border:solid 4px #ffffff;max-width:100%;-webkit-box-shadow:0 0 0 1px rgba(0, 0, 0, 0.2);box-shadow:0 0 0 1px rgba(0, 0, 0, 0.2);-webkit-transition:all 200ms ease-out;-moz-transition:all 200ms ease-out;transition:all 200ms ease-out;}.th:hover ,.th:focus {-webkit-box-shadow:0 0 6px 1px rgba(0, 140, 186, 0.5);box-shadow:0 0 6px 1px rgba(0, 140, 186, 0.5);}.th.radius {-webkit-border-radius:3px;border-radius:3px;}.has-tip {border-bottom:dotted 1px #cccccc;cursor:help;font-weight:bold;color:#333333;}.has-tip:hover ,.has-tip:focus {border-bottom:dotted 1px #004054;color:#008cba;}.has-tip.tip-left ,.has-tip.tip-right {float:none !important;}.tooltip {display:none;position:absolute;z-index:999;font-weight:normal;font-size:0.875rem;line-height:1.3;padding:0.75rem;max-width:85%;left:50%;width:100%;color:#ffffff;background:#333333;}.tooltip>.nub {display:block;left:5px;position:absolute;width:0;height:0;border:solid 5px;border-color:transparent transparent #333333 transparent;top:-10px;}.tooltip.radius {-webkit-border-radius:3px;border-radius:3px;}.tooltip.round {-webkit-border-radius:1000px;border-radius:1000px;}.tooltip.round>.nub {left:2rem;}.tooltip.opened {color:#008cba !important;border-bottom:dotted 1px #004054 !important;}.tap-to-close {display:block;font-size:0.625rem;color:#777777;font-weight:normal;}@media only screen and (min-width:40.063em){.tooltip>.nub {border-color:transparent transparent #333333 transparent;top:-10px;}.tooltip.tip-top>.nub {border-color:#333333 transparent transparent transparent;top:auto;bottom:-10px;}.tooltip.tip-left ,.tooltip.tip-right {float:none !important;}.tooltip.tip-left>.nub {border-color:transparent transparent transparent #333333;right:-10px;left:auto;top:50%;margin-top:-5px;}.tooltip.tip-right>.nub {border-color:transparent #333333 transparent transparent;right:auto;left:-10px;top:50%;margin-top:-5px;}}meta.foundation-mq-topbar {font-family:"/only screen and (min-width:40.063em)/";width:40.063em;}.contain-to-grid {width:100%;background:#333333;}.contain-to-grid .top-bar {margin-bottom:0;}.fixed {width:100%;left:0;position:fixed;top:0;z-index:99;}.fixed.expanded:not(.top-bar) {overflow-y:auto;height:auto;width:100%;max-height:100%;}.fixed.expanded:not(.top-bar) .title-area {position:fixed;width:100%;z-index:99;}.fixed.expanded:not(.top-bar) .top-bar-section {z-index:98;margin-top:45px;}.top-bar {overflow:hidden;height:45px;line-height:45px;position:relative;background:#333333;margin-bottom:0;}.top-bar ul {margin-bottom:0;list-style:none;}.top-bar .row {max-width:none;}.top-bar form ,.top-bar input {margin-bottom:0;}.top-bar input {height:auto;padding-top:0.35rem;padding-bottom:0.35rem;font-size:0.75rem;}.top-bar .button {padding-top:0.45rem;padding-bottom:0.35rem;margin-bottom:0;font-size:0.75rem;}.top-bar .title-area {position:relative;margin:0;}.top-bar .name {height:45px;margin:0;font-size:16px;}.top-bar .name h1 {line-height:45px;font-size:1.0625rem;margin:0;}.top-bar .name h1 a {font-weight:normal;color:#ffffff;width:50%;display:block;padding:0 15px;}.top-bar .toggle-topbar {position:absolute;right:0;top:0;}.top-bar .toggle-topbar a {color:#ffffff;text-transform:uppercase;font-size:0.8125rem;font-weight:bold;position:relative;display:block;padding:0 15px;height:45px;line-height:45px;}.top-bar .toggle-topbar.menu-icon {right:15px;top:50%;margin-top:-16px;padding-left:40px;}.top-bar .toggle-topbar.menu-icon a {height:34px;line-height:33px;padding:0;padding-right:25px;color:#ffffff;position:relative;}.top-bar .toggle-topbar.menu-icon a::after {content:"";position:absolute;right:0;display:block;width:16px;top:0;height:0;-webkit-box-shadow:0 10px 0 1px #ffffff,0 16px 0 1px #ffffff,0 22px 0 1px #ffffff;box-shadow:0 10px 0 1px #ffffff,0 16px 0 1px #ffffff,0 22px 0 1px #ffffff;}.top-bar.expanded {height:auto;background:transparent;}.top-bar.expanded .title-area {background:#333333;}.top-bar.expanded .toggle-topbar a {color:#888888;}.top-bar.expanded .toggle-topbar a span {-webkit-box-shadow:0 10px 0 1px #888888,0 16px 0 1px #888888,0 22px 0 1px #888888;box-shadow:0 10px 0 1px #888888,0 16px 0 1px #888888,0 22px 0 1px #888888;}.top-bar-section {left:0;position:relative;width:auto;-webkit-transition:left 300ms ease-out;-moz-transition:left 300ms ease-out;transition:left 300ms ease-out;}.top-bar-section ul {width:100%;height:auto;display:block;background:#333333;font-size:16px;margin:0;}.top-bar-section .divider ,.top-bar-section [role="separator"] {border-top:solid 1px #1a1a1a;clear:both;height:1px;width:100%;}.top-bar-section ul li>a {display:block;width:100%;color:#ffffff;padding:12px 0 12px 0;padding-left:15px;font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;font-size:0.8125rem;font-weight:normal;background:#333333;}.top-bar-section ul li > a.button {background:#008cba;font-size:0.8125rem;padding-right:15px;padding-left:15px;}.top-bar-section ul li > a.button:hover {background:#006888;}.top-bar-section ul li > a.button.secondary {background:#e7e7e7;}.top-bar-section ul li > a.button.secondary:hover {background:#cecece;}.top-bar-section ul li > a.button.success {background:#43ac6a;}.top-bar-section ul li > a.button.success:hover {background:#358853;}.top-bar-section ul li > a.button.alert {background:#f04124;}.top-bar-section ul li > a.button.alert:hover {background:#d4290f;}.top-bar-section ul li:hover>a {background:#272727;color:#ffffff;}.top-bar-section ul li.active>a {background:#008cba;color:#ffffff;}.top-bar-section ul li.active > a:hover {background:#007ba0;color:#ffffff;}.top-bar-section .has-form {padding:15px;}.top-bar-section .has-dropdown {position:relative;}.top-bar-section .has-dropdown > a:after {content:"";display:block;width:0;height:0;border:inset 5px;border-color:transparent transparent transparent rgba(255, 255, 255, 0.4);border-left-style:solid;margin-right:15px;margin-top:-4.5px;position:absolute;top:50%;right:0;}.top-bar-section .has-dropdown.moved {position:static;}.top-bar-section .has-dropdown.moved>.dropdown {display:block;}.top-bar-section .dropdown {position:absolute;left:100%;top:0;display:none;z-index:99;}.top-bar-section .dropdown li {width:100%;height:auto;}.top-bar-section .dropdown li a {font-weight:normal;padding:8px 15px;}.top-bar-section .dropdown li a.parent-link {font-weight:normal;}.top-bar-section .dropdown li.title h5 {margin-bottom:0;}.top-bar-section .dropdown li.title h5 a {color:#ffffff;line-height:22.5px;display:block;}.top-bar-section .dropdown li.has-form {padding:8px 15px;}.top-bar-section .dropdown li .button {top:auto;}.top-bar-section .dropdown label {padding:8px 15px 2px;margin-bottom:0;text-transform:uppercase;color:#777777;font-weight:bold;font-size:0.625rem;}.js-generated {display:block;}@media only screen and (min-width:40.063em){.top-bar {background:#333333;*zoom:1;overflow:visible;}.top-bar:before ,.top-bar:after {content:" ";display:table;}.top-bar:after {clear:both;}.top-bar .toggle-topbar {display:none;}.top-bar .title-area {float:left;}.top-bar .name h1 a {width:auto;}.top-bar input ,.top-bar .button {font-size:0.875rem;position:relative;top:7px;}.top-bar.expanded {background:#333333;}.contain-to-grid .top-bar {max-width:62.5rem;margin:0 auto;margin-bottom:0;}.top-bar-section {-webkit-transition:none 0 0;-moz-transition:none 0 0;transition:none 0 0;left:0 !important;}.top-bar-section ul {width:auto;height:auto !important;display:inline;}.top-bar-section ul li {float:left;}.top-bar-section ul li .js-generated {display:none;}.top-bar-section li.hover>a:not(.button) {background:#272727;color:#ffffff;}.top-bar-section li:not(.has-form) a:not(.button) {padding:0 15px;line-height:45px;background:#333333;}.top-bar-section li:not(.has-form) a:not(.button):hover {background:#272727;}.top-bar-section li.active:not(.has-form) a:not(.button) {padding:0 15px;line-height:45px;color:#ffffff;background:#008cba;}.top-bar-section li.active:not(.has-form) a:not(.button):hover {background:#007ba0;}.top-bar-section .has-dropdown>a {padding-right:35px !important;}.top-bar-section .has-dropdown > a:after {content:"";display:block;width:0;height:0;border:inset 5px;border-color:rgba(255, 255, 255, 0.4) transparent transparent transparent;border-top-style:solid;margin-top:-2.5px;top:22.5px;}.top-bar-section .has-dropdown.moved {position:relative;}.top-bar-section .has-dropdown.moved>.dropdown {display:none;}.top-bar-section .has-dropdown.hover>.dropdown ,.top-bar-section .has-dropdown.not-click:hover>.dropdown {display:block;}.top-bar-section .has-dropdown .dropdown li.has-dropdown > a:after {border:none;content:"\00bb";top:1rem;margin-top:-2px;right:5px;line-height:1.2;}.top-bar-section .dropdown {left:0;top:auto;background:transparent;min-width:100%;}.top-bar-section .dropdown li a {color:#ffffff;line-height:1;white-space:nowrap;padding:12px 15px;background:#333333;}.top-bar-section .dropdown li label {white-space:nowrap;background:#333333;}.top-bar-section .dropdown li .dropdown {left:100%;top:0;}.top-bar-section>ul>.divider ,.top-bar-section>ul>[role="separator"] {border-bottom:none;border-top:none;border-right:solid 1px #4e4e4e;clear:none;height:45px;width:0;}.top-bar-section .has-form {background:#333333;padding:0 15px;height:45px;}.top-bar-section .right li .dropdown {left:auto;right:0;}.top-bar-section .right li .dropdown li .dropdown {right:100%;}.top-bar-section .left li .dropdown {right:auto;left:0;}.top-bar-section .left li .dropdown li .dropdown {left:100%;}.no-js .top-bar-section ul li:hover>a {background:#272727;color:#ffffff;}.no-js .top-bar-section ul li:active>a {background:#008cba;color:#ffffff;}.no-js .top-bar-section .has-dropdown:hover>.dropdown {display:block;}}.text-left {text-align:left !important;}.text-right {text-align:right !important;}.text-center {text-align:center !important;}.text-justify {text-align:justify !important;}@media only screen and (max-width: 40em){.small-only-text-left {text-align:left !important;}.small-only-text-right {text-align:right !important;}.small-only-text-center {text-align:center !important;}.small-only-text-justify {text-align:justify !important;}}@media only screen{.small-text-left {text-align:left !important;}.small-text-right {text-align:right !important;}.small-text-center {text-align:center !important;}.small-text-justify {text-align:justify !important;}}@media only screen and (min-width:40.063em) and (max-width:64em){.medium-only-text-left {text-align:left !important;}.medium-only-text-right {text-align:right !important;}.medium-only-text-center {text-align:center !important;}.medium-only-text-justify {text-align:justify !important;}}@media only screen and (min-width:40.063em){.medium-text-left {text-align:left !important;}.medium-text-right {text-align:right !important;}.medium-text-center {text-align:center !important;}.medium-text-justify {text-align:justify !important;}}@media only screen and (min-width:64.063em) and (max-width:90em){.large-only-text-left {text-align:left !important;}.large-only-text-right {text-align:right !important;}.large-only-text-center {text-align:center !important;}.large-only-text-justify {text-align:justify !important;}}@media only screen and (min-width:64.063em){.large-text-left {text-align:left !important;}.large-text-right {text-align:right !important;}.large-text-center {text-align:center !important;}.large-text-justify {text-align:justify !important;}}@media only screen and (min-width:90.063em) and (max-width:120em){.xlarge-only-text-left {text-align:left !important;}.xlarge-only-text-right {text-align:right !important;}.xlarge-only-text-center {text-align:center !important;}.xlarge-only-text-justify {text-align:justify !important;}}@media only screen and (min-width:90.063em){.xlarge-text-left {text-align:left !important;}.xlarge-text-right {text-align:right !important;}.xlarge-text-center {text-align:center !important;}.xlarge-text-justify {text-align:justify !important;}}@media only screen and (min-width:120.063em) and (max-width:99999999em){.xxlarge-only-text-left {text-align:left !important;}.xxlarge-only-text-right {text-align:right !important;}.xxlarge-only-text-center {text-align:center !important;}.xxlarge-only-text-justify {text-align:justify !important;}}@media only screen and (min-width:120.063em){.xxlarge-text-left {text-align:left !important;}.xxlarge-text-right {text-align:right !important;}.xxlarge-text-center {text-align:center !important;}.xxlarge-text-justify {text-align:justify !important;}}div ,dl ,dt ,dd ,ul ,ol ,li ,h1 ,h2 ,h3 ,h4 ,h5 ,h6 ,pre ,form ,p ,blockquote ,th ,td {margin:0;padding:0;}a {color:#008cba;text-decoration:none;line-height:inherit;}a:hover ,a:focus {color:#007ba0;}a img {border:none;}p {font-family:inherit;font-weight:normal;font-size:1rem;line-height:1.6;margin-bottom:1.25rem;text-rendering:optimizeLegibility;}p.lead {font-size:1.21875rem;line-height:1.6;}p aside {font-size:0.875rem;line-height:1.35;font-style:italic;}h1 ,h2 ,h3 ,h4 ,h5 ,h6 {font-family:"Helvetica Neue","Helvetica",Helvetica,Arial,sans-serif;font-weight:normal;font-style:normal;color:#222222;text-rendering:optimizeLegibility;margin-top:0.2rem;margin-bottom:0.5rem;line-height:1.4;}h1 small ,h2 small ,h3 small ,h4 small ,h5 small ,h6 small {font-size:60%;color:#6f6f6f;line-height:0;}h1 {font-size:2.125rem;}h2 {font-size:1.6875rem;}h3 {font-size:1.375rem;}h4 {font-size:1.125rem;}h5 {font-size:1.125rem;}h6 {font-size:1rem;}.subheader {line-height:1.4;color:#6f6f6f;font-weight:normal;margin-top:0.2rem;margin-bottom:0.5rem;}hr {border:solid #dddddd;border-width:1px 0 0;clear:both;margin:1.25rem 0 1.1875rem;height:0;}em ,i {font-style:italic;line-height:inherit;}strong ,b {font-weight:bold;line-height:inherit;}small {font-size:60%;line-height:inherit;}code {font-family:Consolas,'Liberation Mono',Courier,monospace;font-weight:bold;color:#bd240d;}ul ,ol ,dl {font-size:1rem;line-height:1.6;margin-bottom:1.25rem;list-style-position:outside;font-family:inherit;}ul {margin-left:1.1rem;}ul.no-bullet {margin-left:0;}ul.no-bullet li ul ,ul.no-bullet li ol {margin-left:1.25rem;margin-bottom:0;list-style:none;}ul li ul ,ul li ol {margin-left:1.25rem;margin-bottom:0;}ul.square li ul ,ul.circle li ul ,ul.disc li ul {list-style:inherit;}ul.square {list-style-type:square;margin-left:1.1rem;}ul.circle {list-style-type:circle;margin-left:1.1rem;}ul.disc {list-style-type:disc;margin-left:1.1rem;}ul.no-bullet {list-style:none;}ol {margin-left:1.4rem;}ol li ul ,ol li ol {margin-left:1.25rem;margin-bottom:0;}dl dt {margin-bottom:0.3rem;font-weight:bold;}dl dd {margin-bottom:0.75rem;}abbr ,acronym {text-transform:uppercase;font-size:90%;color:#222222;border-bottom:1px dotted #dddddd;cursor:help;}abbr {text-transform:none;}blockquote {margin:0 0 1.25rem;padding:0.5625rem 1.25rem 0 1.1875rem;border-left:1px solid #dddddd;}blockquote cite {display:block;font-size:0.8125rem;color:#555555;}blockquote cite:before {content:"\2014 \0020";}blockquote cite a ,blockquote cite a:visited {color:#555555;}blockquote ,blockquote p {line-height:1.6;color:#6f6f6f;}.vcard {display:inline-block;margin:0 0 1.25rem 0;border:1px solid #dddddd;padding:0.625rem 0.75rem;}.vcard li {margin:0;display:block;}.vcard .fn {font-weight:bold;font-size:0.9375rem;}.vevent .summary {font-weight:bold;}.vevent abbr {cursor:default;text-decoration:none;font-weight:bold;border:none;padding:0 0.0625rem;}@media only screen and (min-width:40.063em){h1 ,h2 ,h3 ,h4 ,h5 ,h6 {line-height:1.4;}h1 {font-size:2.75rem;}h2 {font-size:2.3125rem;}h3 {font-size:1.6875rem;}h4 {font-size:1.4375rem;}}.print-only {display:none !important;}@media print{@page{margin:0.5cm;}* {background:transparent !important;color:#000000 !important;box-shadow:none !important;text-shadow:none !important;}a ,a:visited {text-decoration:underline;}a[href]:after {content:" (" attr(href) ")";}abbr[title]:after {content:" (" attr(title) ")";}.ir a:after ,a[href^="javascript:"]:after ,a[href^="#"]:after {content:"";}pre ,blockquote {border:1px solid #999999;page-break-inside:avoid;}thead {display:table-header-group;}tr ,img {page-break-inside:avoid;}img {max-width:100% !important;}p ,h2 ,h3 {orphans:3;widows:3;}h2 ,h3 {page-break-after:avoid;}.hide-on-print {display:none !important;}.print-only {display:block !important;}.hide-for-print {display:none !important;}.show-for-print {display:inherit !important;}}.text-left {text-align:left !important;}.text-right {text-align:right !important;}.text-center {text-align:center !important;}.text-justify {text-align:justify !important;}@media only screen and (max-width: 40em){.small-only-text-left {text-align:left !important;}.small-only-text-right {text-align:right !important;}.small-only-text-center {text-align:center !important;}.small-only-text-justify {text-align:justify !important;}}@media only screen{.small-text-left {text-align:left !important;}.small-text-right {text-align:right !important;}.small-text-center {text-align:center !important;}.small-text-justify {text-align:justify !important;}}@media only screen and (min-width:40.063em) and (max-width:64em){.medium-only-text-left {text-align:left !important;}.medium-only-text-right {text-align:right !important;}.medium-only-text-center {text-align:center !important;}.medium-only-text-justify {text-align:justify !important;}}@media only screen and (min-width:40.063em){.medium-text-left {text-align:left !important;}.medium-text-right {text-align:right !important;}.medium-text-center {text-align:center !important;}.medium-text-justify {text-align:justify !important;}}@media only screen and (min-width:64.063em) and (max-width:90em){.large-only-text-left {text-align:left !important;}.large-only-text-right {text-align:right !important;}.large-only-text-center {text-align:center !important;}.large-only-text-justify {text-align:justify !important;}}@media only screen and (min-width:64.063em){.large-text-left {text-align:left !important;}.large-text-right {text-align:right !important;}.large-text-center {text-align:center !important;}.large-text-justify {text-align:justify !important;}}@media only screen and (min-width:90.063em) and (max-width:120em){.xlarge-only-text-left {text-align:left !important;}.xlarge-only-text-right {text-align:right !important;}.xlarge-only-text-center {text-align:center !important;}.xlarge-only-text-justify {text-align:justify !important;}}@media only screen and (min-width:90.063em){.xlarge-text-left {text-align:left !important;}.xlarge-text-right {text-align:right !important;}.xlarge-text-center {text-align:center !important;}.xlarge-text-justify {text-align:justify !important;}}@media only screen and (min-width:120.063em) and (max-width:99999999em){.xxlarge-only-text-left {text-align:left !important;}.xxlarge-only-text-right {text-align:right !important;}.xxlarge-only-text-center {text-align:center !important;}.xxlarge-only-text-justify {text-align:justify !important;}}@media only screen and (min-width:120.063em){.xxlarge-text-left {text-align:left !important;}.xxlarge-text-right {text-align:right !important;}.xxlarge-text-center {text-align:center !important;}.xxlarge-text-justify {text-align:justify !important;}}.off-canvas-wrap {-webkit-backface-visibility:hidden;position:relative;width:100%;overflow-x:hidden;}.off-canvas-wrap.move-right ,.off-canvas-wrap.move-left {height:100%;}.inner-wrap {-webkit-backface-visibility:hidden;position:relative;width:100%;*zoom:1;-webkit-transition:-webkit-transform 500ms ease;-moz-transition:-moz-transform 500ms ease;-ms-transition:-ms-transform 500ms ease;-o-transition:-o-transform 500ms ease;transition:transform 500ms ease;}.inner-wrap:before ,.inner-wrap:after {content:" ";display:table;}.inner-wrap:after {clear:both;}nav.tab-bar {-webkit-backface-visibility:hidden;background:#333333;color:#ffffff;height:2.8125rem;line-height:2.8125rem;position:relative;}nav.tab-bar h1 ,nav.tab-bar h2 ,nav.tab-bar h3 ,nav.tab-bar h4 ,nav.tab-bar h5 ,nav.tab-bar h6 {color:#ffffff;font-weight:bold;line-height:2.8125rem;margin:0;}nav.tab-bar h1 ,nav.tab-bar h2 ,nav.tab-bar h3 ,nav.tab-bar h4 {font-size:1.125rem;}section.left-small {width:2.8125rem;height:2.8125rem;position:absolute;top:0;border-right:solid 1px #1a1a1a;box-shadow:1px 0 0 #4e4e4e;left:0;}section.right-small {width:2.8125rem;height:2.8125rem;position:absolute;top:0;border-left:solid 1px #4e4e4e;box-shadow:-1px 0 0 #1a1a1a;right:0;}section.tab-bar-section {padding:0 0.625rem;position:absolute;text-align:center;height:2.8125rem;top:0;}@media only screen and (min-width:40.063em){section.tab-bar-section {text-align:left;}}section.tab-bar-section.left {left:0;right:2.8125rem;}section.tab-bar-section.right {left:2.8125rem;right:0;}section.tab-bar-section.middle {left:2.8125rem;right:2.8125rem;}a.menu-icon {text-indent:2.1875rem;width:2.8125rem;height:2.8125rem;display:block;line-height:2.0625rem;padding:0;color:#ffffff;position:relative;}a.menu-icon span {position:absolute;display:block;width:1rem;height:0;left:0.8125rem;top:0.3125rem;-webkit-box-shadow:1px 10px 1px 1px #ffffff,1px 16px 1px 1px #ffffff,1px 22px 1px 1px #ffffff;box-shadow:0 10px 0 1px #ffffff,0 16px 0 1px #ffffff,0 22px 0 1px #ffffff;}a.menu-icon:hover span {-webkit-box-shadow:1px 10px 1px 1px #b3b3b3,1px 16px 1px 1px #b3b3b3,1px 22px 1px 1px #b3b3b3;box-shadow:0 10px 0 1px #b3b3b3,0 16px 0 1px #b3b3b3,0 22px 0 1px #b3b3b3;}.left-off-canvas-menu {-webkit-backface-visibility:hidden;width:250px;top:0;bottom:0;position:absolute;overflow-y:auto;background:#333333;z-index:1001;box-sizing:content-box;-webkit-transform:translate3d(-100%, 0, 0);-moz-transform:translate3d(-100%, 0, 0);-ms-transform:translate3d(-100%, 0, 0);-o-transform:translate3d(-100%, 0, 0);transform:translate3d(-100%, 0, 0);left:0;}.left-off-canvas-menu * {-webkit-backface-visibility:hidden;}.right-off-canvas-menu {-webkit-backface-visibility:hidden;width:250px;top:0;bottom:0;position:absolute;overflow-y:auto;background:#333333;z-index:1001;box-sizing:content-box;-webkit-transform:translate3d(100%, 0, 0);-moz-transform:translate3d(100%, 0, 0);-ms-transform:translate3d(100%, 0, 0);-o-transform:translate3d(100%, 0, 0);transform:translate3d(100%, 0, 0);right:0;}ul.off-canvas-list {list-style-type:none;padding:0;margin:0;}ul.off-canvas-list li label {padding:0.3rem 0.9375rem;color:#999999;text-transform:uppercase;font-weight:bold;background:#444444;border-top:1px solid #5e5e5e;border-bottom:none;margin:0;}ul.off-canvas-list li a {display:block;padding:0.66667rem;color:rgba(255, 255, 255, 0.7);border-bottom:1px solid #262626;}.move-right>.inner-wrap {-webkit-transform:translate3d(250px, 0, 0);-moz-transform:translate3d(250px, 0, 0);-ms-transform:translate3d(250px, 0, 0);-o-transform:translate3d(250px, 0, 0);transform:translate3d(250px, 0, 0);}.move-right a.exit-off-canvas {-webkit-backface-visibility:hidden;transition:background 300ms ease;cursor:pointer;box-shadow:-4px 0 4px rgba(0, 0, 0, 0.5),4px 0 4px rgba(0, 0, 0, 0.5);display:block;position:absolute;background:rgba(255, 255, 255, 0.2);top:0;bottom:0;left:0;right:0;z-index:1002;-webkit-tap-highlight-color:rgba(0, 0, 0, 0);}@media only screen and (min-width:40.063em){.move-right a.exit-off-canvas:hover {background:rgba(255, 255, 255, 0.05);}}.move-left>.inner-wrap {-webkit-transform:translate3d(-250px, 0, 0);-moz-transform:translate3d(-250px, 0, 0);-ms-transform:translate3d(-250px, 0, 0);-o-transform:translate3d(-250px, 0, 0);transform:translate3d(-250px, 0, 0);}.move-left a.exit-off-canvas {-webkit-backface-visibility:hidden;transition:background 300ms ease;cursor:pointer;box-shadow:-4px 0 4px rgba(0, 0, 0, 0.5),4px 0 4px rgba(0, 0, 0, 0.5);display:block;position:absolute;background:rgba(255, 255, 255, 0.2);top:0;bottom:0;left:0;right:0;z-index:1002;-webkit-tap-highlight-color:rgba(0, 0, 0, 0);}@media only screen and (min-width:40.063em){.move-left a.exit-off-canvas:hover {background:rgba(255, 255, 255, 0.05);}}.csstransforms.no-csstransforms3d .left-off-canvas-menu {-webkit-transform:translate(-100%, 0);-moz-transform:translate(-100%, 0);-ms-transform:translate(-100%, 0);-o-transform:translate(-100%, 0);transform:translate(-100%, 0);}.csstransforms.no-csstransforms3d .right-off-canvas-menu {-webkit-transform:translate(100%, 0);-moz-transform:translate(100%, 0);-ms-transform:translate(100%, 0);-o-transform:translate(100%, 0);transform:translate(100%, 0);}.csstransforms.no-csstransforms3d .move-left>.inner-wrap {-webkit-transform:translate(-250px, 0);-moz-transform:translate(-250px, 0);-ms-transform:translate(-250px, 0);-o-transform:translate(-250px, 0);transform:translate(-250px, 0);}.csstransforms.no-csstransforms3d .move-right>.inner-wrap {-webkit-transform:translate(250px, 0);-moz-transform:translate(250px, 0);-ms-transform:translate(250px, 0);-o-transform:translate(250px, 0);transform:translate(250px, 0);}.no-csstransforms .left-off-canvas-menu {left:-250px;}.no-csstransforms .right-off-canvas-menu {right:-250px;}.no-csstransforms .move-left>.inner-wrap {right:250px;}.no-csstransforms .move-right>.inner-wrap {left:250px;}.show-for-small ,.show-for-small-only ,.show-for-medium-down ,.show-for-large-down ,.hide-for-medium ,.hide-for-medium-up ,.hide-for-medium-only ,.hide-for-large ,.hide-for-large-up ,.hide-for-large-only ,.hide-for-xlarge ,.hide-for-xlarge-up ,.hide-for-xlarge-only ,.hide-for-xxlarge-up ,.hide-for-xxlarge-only {display:inherit !important;}.hide-for-small ,.hide-for-small-only ,.hide-for-medium-down ,.show-for-medium ,.show-for-medium-up ,.show-for-medium-only ,.hide-for-large-down ,.show-for-large ,.show-for-large-up ,.show-for-large-only ,.show-for-xlarge ,.show-for-xlarge-up ,.show-for-xlarge-only ,.show-for-xxlarge-up ,.show-for-xxlarge-only {display:none !important;}table.show-for-small ,table.show-for-small-only ,table.show-for-medium-down ,table.show-for-large-down ,table.hide-for-medium ,table.hide-for-medium-up ,table.hide-for-medium-only ,table.hide-for-large ,table.hide-for-large-up ,table.hide-for-large-only ,table.hide-for-xlarge ,table.hide-for-xlarge-up ,table.hide-for-xlarge-only ,table.hide-for-xxlarge-up ,table.hide-for-xxlarge-only {display:table;}thead.show-for-small ,thead.show-for-small-only ,thead.show-for-medium-down ,thead.show-for-large-down ,thead.hide-for-medium ,thead.hide-for-medium-up ,thead.hide-for-medium-only ,thead.hide-for-large ,thead.hide-for-large-up ,thead.hide-for-large-only ,thead.hide-for-xlarge ,thead.hide-for-xlarge-up ,thead.hide-for-xlarge-only ,thead.hide-for-xxlarge-up ,thead.hide-for-xxlarge-only {display:table-header-group !important;}tbody.show-for-small ,tbody.show-for-small-only ,tbody.show-for-medium-down ,tbody.show-for-large-down ,tbody.hide-for-medium ,tbody.hide-for-medium-up ,tbody.hide-for-medium-only ,tbody.hide-for-large ,tbody.hide-for-large-up ,tbody.hide-for-large-only ,tbody.hide-for-xlarge ,tbody.hide-for-xlarge-up ,tbody.hide-for-xlarge-only ,tbody.hide-for-xxlarge-up ,tbody.hide-for-xxlarge-only {display:table-row-group !important;}tr.show-for-small ,tr.show-for-small-only ,tr.show-for-medium-down ,tr.show-for-large-down ,tr.hide-for-medium ,tr.hide-for-medium-up ,tr.hide-for-medium-only ,tr.hide-for-large ,tr.hide-for-large-up ,tr.hide-for-large-only ,tr.hide-for-xlarge ,tr.hide-for-xlarge-up ,tr.hide-for-xlarge-only ,tr.hide-for-xxlarge-up ,tr.hide-for-xxlarge-only {display:table-row !important;}td.show-for-small ,td.show-for-small-only ,td.show-for-medium-down ,td.show-for-large-down ,td.hide-for-medium ,td.hide-for-medium-up ,td.hide-for-large ,td.hide-for-large-up ,td.hide-for-xlarge ,td.hide-for-xlarge-up ,td.hide-for-xxlarge-up ,th.show-for-small ,th.show-for-small-only ,th.show-for-medium-down ,th.show-for-large-down ,th.hide-for-medium ,th.hide-for-medium-up ,th.hide-for-large ,th.hide-for-large-up ,th.hide-for-xlarge ,th.hide-for-xlarge-up ,th.hide-for-xxlarge-up {display:table-cell !important;}@media only screen and (min-width:40.063em){.hide-for-small ,.hide-for-small-only ,.show-for-medium ,.show-for-medium-down ,.show-for-medium-up ,.show-for-medium-only ,.hide-for-large ,.hide-for-large-up ,.hide-for-large-only ,.hide-for-xlarge ,.hide-for-xlarge-up ,.hide-for-xlarge-only ,.hide-for-xxlarge-up ,.hide-for-xxlarge-only {display:inherit !important;}.show-for-small ,.show-for-small-only ,.hide-for-medium ,.hide-for-medium-down ,.hide-for-medium-up ,.hide-for-medium-only ,.hide-for-large-down ,.show-for-large ,.show-for-large-up ,.show-for-large-only ,.show-for-xlarge ,.show-for-xlarge-up ,.show-for-xlarge-only ,.show-for-xxlarge-up ,.show-for-xxlarge-only {display:none !important;}table.hide-for-small ,table.hide-for-small-only ,table.show-for-medium ,table.show-for-medium-down ,table.show-for-medium-up ,table.show-for-medium-only ,table.hide-for-large ,table.hide-for-large-up ,table.hide-for-large-only ,table.hide-for-xlarge ,table.hide-for-xlarge-up ,table.hide-for-xlarge-only ,table.hide-for-xxlarge-up ,table.hide-for-xxlarge-only {display:table;}thead.hide-for-small ,thead.hide-for-small-only ,thead.show-for-medium ,thead.show-for-medium-down ,thead.show-for-medium-up ,thead.show-for-medium-only ,thead.hide-for-large ,thead.hide-for-large-up ,thead.hide-for-large-only ,thead.hide-for-xlarge ,thead.hide-for-xlarge-up ,thead.hide-for-xlarge-only ,thead.hide-for-xxlarge-up ,thead.hide-for-xxlarge-only {display:table-header-group !important;}tbody.hide-for-small ,tbody.hide-for-small-only ,tbody.show-for-medium ,tbody.show-for-medium-down ,tbody.show-for-medium-up ,tbody.show-for-medium-only ,tbody.hide-for-large ,tbody.hide-for-large-up ,tbody.hide-for-large-only ,tbody.hide-for-xlarge ,tbody.hide-for-xlarge-up ,tbody.hide-for-xlarge-only ,tbody.hide-for-xxlarge-up ,tbody.hide-for-xxlarge-only {display:table-row-group !important;}tr.hide-for-small ,tr.hide-for-small-only ,tr.show-for-medium ,tr.show-for-medium-down ,tr.show-for-medium-up ,tr.show-for-medium-only ,tr.hide-for-large ,tr.hide-for-large-up ,tr.hide-for-large-only ,tr.hide-for-xlarge ,tr.hide-for-xlarge-up ,tr.hide-for-xlarge-only ,tr.hide-for-xxlarge-up ,tr.hide-for-xxlarge-only {display:table-row !important;}td.hide-for-small ,td.hide-for-small-only ,td.show-for-medium ,td.show-for-medium-down ,td.show-for-medium-up ,td.show-for-medium-only ,td.hide-for-large ,td.hide-for-large-up ,td.hide-for-large-only ,td.hide-for-xlarge ,td.hide-for-xlarge-up ,td.hide-for-xlarge-only ,td.hide-for-xxlarge-up ,td.hide-for-xxlarge-only ,th.hide-for-small ,th.hide-for-small-only ,th.show-for-medium ,th.show-for-medium-down ,th.show-for-medium-up ,th.show-for-medium-only ,th.hide-for-large ,th.hide-for-large-up ,th.hide-for-large-only ,th.hide-for-xlarge ,th.hide-for-xlarge-up ,th.hide-for-xlarge-only ,th.hide-for-xxlarge-up ,th.hide-for-xxlarge-only {display:table-cell !important;}}@media only screen and (min-width:64.063em){.hide-for-small ,.hide-for-small-only ,.hide-for-medium ,.hide-for-medium-down ,.hide-for-medium-only ,.show-for-medium-up ,.show-for-large ,.show-for-large-up ,.show-for-large-only ,.hide-for-xlarge ,.hide-for-xlarge-up ,.hide-for-xlarge-only ,.hide-for-xxlarge-up ,.hide-for-xxlarge-only {display:inherit !important;}.show-for-small-only ,.show-for-medium ,.show-for-medium-down ,.show-for-medium-only ,.hide-for-large ,.hide-for-large-up ,.hide-for-large-only ,.show-for-xlarge ,.show-for-xlarge-up ,.show-for-xlarge-only ,.show-for-xxlarge-up ,.show-for-xxlarge-only {display:none !important;}table.hide-for-small ,table.hide-for-small-only ,table.hide-for-medium ,table.hide-for-medium-down ,table.hide-for-medium-only ,table.show-for-medium-up ,table.show-for-large ,table.show-for-large-up ,table.show-for-large-only ,table.hide-for-xlarge ,table.hide-for-xlarge-up ,table.hide-for-xlarge-only ,table.hide-for-xxlarge-up ,table.hide-for-xxlarge-only {display:table;}thead.hide-for-small ,thead.hide-for-small-only ,thead.hide-for-medium ,thead.hide-for-medium-down ,thead.hide-for-medium-only ,thead.show-for-medium-up ,thead.show-for-large ,thead.show-for-large-up ,thead.show-for-large-only ,thead.hide-for-xlarge ,thead.hide-for-xlarge-up ,thead.hide-for-xlarge-only ,thead.hide-for-xxlarge-up ,thead.hide-for-xxlarge-only {display:table-header-group !important;}tbody.hide-for-small ,tbody.hide-for-small-only ,tbody.hide-for-medium ,tbody.hide-for-medium-down ,tbody.hide-for-medium-only ,tbody.show-for-medium-up ,tbody.show-for-large ,tbody.show-for-large-up ,tbody.show-for-large-only ,tbody.hide-for-xlarge ,tbody.hide-for-xlarge-up ,tbody.hide-for-xlarge-only ,tbody.hide-for-xxlarge-up ,tbody.hide-for-xxlarge-only {display:table-row-group !important;}tr.hide-for-small ,tr.hide-for-small-only ,tr.hide-for-medium ,tr.hide-for-medium-down ,tr.hide-for-medium-only ,tr.show-for-medium-up ,tr.show-for-large ,tr.show-for-large-up ,tr.show-for-large-only ,tr.hide-for-xlarge ,tr.hide-for-xlarge-up ,tr.hide-for-xlarge-only ,tr.hide-for-xxlarge-up ,tr.hide-for-xxlarge-only {display:table-row !important;}td.hide-for-small ,td.hide-for-small-only ,td.hide-for-medium ,td.hide-for-medium-down ,td.hide-for-medium-only ,td.show-for-medium-up ,td.show-for-large ,td.show-for-large-up ,td.show-for-large-only ,td.hide-for-xlarge ,td.hide-for-xlarge-up ,td.hide-for-xlarge-only ,td.hide-for-xxlarge-up ,td.hide-for-xxlarge-only ,th.hide-for-small ,th.hide-for-small-only ,th.hide-for-medium ,th.hide-for-medium-down ,th.hide-for-medium-only ,th.show-for-medium-up ,th.show-for-large ,th.show-for-large-up ,th.show-for-large-only ,th.hide-for-xlarge ,th.hide-for-xlarge-up ,th.hide-for-xlarge-only ,th.hide-for-xxlarge-up ,th.hide-for-xxlarge-only {display:table-cell !important;}}@media only screen and (min-width:90.063em){.hide-for-small ,.hide-for-small-only ,.hide-for-medium ,.hide-for-medium-down ,.hide-for-medium-only ,.show-for-medium-up ,.show-for-large-up ,.hide-for-large-only ,.show-for-xlarge ,.show-for-xlarge-up ,.show-for-xlarge-only ,.hide-for-xxlarge-up ,.hide-for-xxlarge-only {display:inherit !important;}.show-for-small-only ,.show-for-medium ,.show-for-medium-down ,.show-for-medium-only ,.show-for-large ,.show-for-large-only ,.show-for-large-down ,.hide-for-xlarge ,.hide-for-xlarge-up ,.hide-for-xlarge-only ,.show-for-xxlarge-up ,.show-for-xxlarge-only {display:none !important;}table.hide-for-small ,table.hide-for-small-only ,table.hide-for-medium ,table.hide-for-medium-down ,table.hide-for-medium-only ,table.show-for-medium-up ,table.show-for-large-up ,table.hide-for-large-only ,table.show-for-xlarge ,table.show-for-xlarge-up ,table.show-for-xlarge-only ,table.hide-for-xxlarge-up ,table.hide-for-xxlarge-only {display:table;}thead.hide-for-small ,thead.hide-for-small-only ,thead.hide-for-medium ,thead.hide-for-medium-down ,thead.hide-for-medium-only ,thead.show-for-medium-up ,thead.show-for-large-up ,thead.hide-for-large-only ,thead.show-for-xlarge ,thead.show-for-xlarge-up ,thead.show-for-xlarge-only ,thead.hide-for-xxlarge-up ,thead.hide-for-xxlarge-only {display:table-header-group !important;}tbody.hide-for-small ,tbody.hide-for-small-only ,tbody.hide-for-medium ,tbody.hide-for-medium-down ,tbody.hide-for-medium-only ,tbody.show-for-medium-up ,tbody.show-for-large-up ,tbody.hide-for-large-only ,tbody.show-for-xlarge ,tbody.show-for-xlarge-up ,tbody.show-for-xlarge-only ,tbody.hide-for-xxlarge-up ,tbody.hide-for-xxlarge-only {display:table-row-group !important;}tr.hide-for-small ,tr.hide-for-small-only ,tr.hide-for-medium ,tr.hide-for-medium-down ,tr.hide-for-medium-only ,tr.show-for-medium-up ,tr.show-for-large-up ,tr.hide-for-large-only ,tr.show-for-xlarge ,tr.show-for-xlarge-up ,tr.show-for-xlarge-only ,tr.hide-for-xxlarge-up ,tr.hide-for-xxlarge-only {display:table-row !important;}td.hide-for-small ,td.hide-for-small-only ,td.hide-for-medium ,td.hide-for-medium-down ,td.hide-for-medium-only ,td.show-for-medium-up ,td.show-for-large-up ,td.hide-for-large-only ,td.show-for-xlarge ,td.show-for-xlarge-up ,td.show-for-xlarge-only ,td.hide-for-xxlarge-up ,td.hide-for-xxlarge-only ,th.hide-for-small ,th.hide-for-small-only ,th.hide-for-medium ,th.hide-for-medium-down ,th.hide-for-medium-only ,th.show-for-medium-up ,th.show-for-large-up ,th.hide-for-large-only ,th.show-for-xlarge ,th.show-for-xlarge-up ,th.show-for-xlarge-only ,th.hide-for-xxlarge-up ,th.hide-for-xxlarge-only {display:table-cell !important;}}@media only screen and (min-width:120.063em){.hide-for-small ,.hide-for-small-only ,.hide-for-medium ,.hide-for-medium-down ,.hide-for-medium-only ,.show-for-medium-up ,.show-for-large-up ,.hide-for-large-only ,.hide-for-xlarge-only ,.show-for-xlarge-up ,.show-for-xxlarge-up ,.show-for-xxlarge-only {display:inherit !important;}.show-for-small-only ,.show-for-medium ,.show-for-medium-down ,.show-for-medium-only ,.show-for-large ,.show-for-large-only ,.show-for-large-down ,.hide-for-xlarge ,.show-for-xlarge-only ,.hide-for-xxlarge-up ,.hide-for-xxlarge-only {display:none !important;}table.hide-for-small ,table.hide-for-small-only ,table.hide-for-medium ,table.hide-for-medium-down ,table.hide-for-medium-only ,table.show-for-medium-up ,table.show-for-large-up ,table.hide-for-xlarge-only ,table.show-for-xlarge-up ,table.show-for-xxlarge-up ,table.show-for-xxlarge-only {display:table;}thead.hide-for-small ,thead.hide-for-small-only ,thead.hide-for-medium ,thead.hide-for-medium-down ,thead.hide-for-medium-only ,thead.show-for-medium-up ,thead.show-for-large-up ,thead.hide-for-xlarge-only ,thead.show-for-xlarge-up ,thead.show-for-xxlarge-up ,thead.show-for-xxlarge-only {display:table-header-group !important;}tbody.hide-for-small ,tbody.hide-for-small-only ,tbody.hide-for-medium ,tbody.hide-for-medium-down ,tbody.hide-for-medium-only ,tbody.show-for-medium-up ,tbody.show-for-large-up ,tbody.hide-for-xlarge-only ,tbody.show-for-xlarge-up ,tbody.show-for-xxlarge-up ,tbody.show-for-xxlarge-only {display:table-row-group !important;}tr.hide-for-small ,tr.hide-for-small-only ,tr.hide-for-medium ,tr.hide-for-medium-down ,tr.hide-for-medium-only ,tr.show-for-medium-up ,tr.show-for-large-up ,tr.hide-for-xlarge-only ,tr.show-for-xlarge-up ,tr.show-for-xxlarge-up ,tr.show-for-xxlarge-only {display:table-row !important;}td.hide-for-small ,td.hide-for-small-only ,td.hide-for-medium ,td.hide-for-medium-down ,td.hide-for-medium-only ,td.show-for-medium-up ,td.show-for-large-up ,td.hide-for-xlarge-only ,td.show-for-xlarge-up ,td.show-for-xxlarge-up ,td.show-for-xxlarge-only ,th.hide-for-small ,th.hide-for-small-only ,th.hide-for-medium ,th.hide-for-medium-down ,th.hide-for-medium-only ,th.show-for-medium-up ,th.show-for-large-up ,th.hide-for-xlarge-only ,th.show-for-xlarge-up ,th.show-for-xxlarge-up ,th.show-for-xxlarge-only {display:table-cell !important;}}.show-for-landscape ,.hide-for-portrait {display:inherit !important;}.hide-for-landscape ,.show-for-portrait {display:none !important;}table.hide-for-landscape ,table.show-for-portrait {display:table;}thead.hide-for-landscape ,thead.show-for-portrait {display:table-header-group !important;}tbody.hide-for-landscape ,tbody.show-for-portrait {display:table-row-group !important;}tr.hide-for-landscape ,tr.show-for-portrait {display:table-row !important;}td.hide-for-landscape ,td.show-for-portrait ,th.hide-for-landscape ,th.show-for-portrait {display:table-cell !important;}@media only screen and (orientation: landscape){.show-for-landscape ,.hide-for-portrait {display:inherit !important;}.hide-for-landscape ,.show-for-portrait {display:none !important;}table.show-for-landscape ,table.hide-for-portrait {display:table;}thead.show-for-landscape ,thead.hide-for-portrait {display:table-header-group !important;}tbody.show-for-landscape ,tbody.hide-for-portrait {display:table-row-group !important;}tr.show-for-landscape ,tr.hide-for-portrait {display:table-row !important;}td.show-for-landscape ,td.hide-for-portrait ,th.show-for-landscape ,th.hide-for-portrait {display:table-cell !important;}}@media only screen and (orientation: portrait){.show-for-portrait ,.hide-for-landscape {display:inherit !important;}.hide-for-portrait ,.show-for-landscape {display:none !important;}table.show-for-portrait ,table.hide-for-landscape {display:table;}thead.show-for-portrait ,thead.hide-for-landscape {display:table-header-group !important;}tbody.show-for-portrait ,tbody.hide-for-landscape {display:table-row-group !important;}tr.show-for-portrait ,tr.hide-for-landscape {display:table-row !important;}td.show-for-portrait ,td.hide-for-landscape ,th.show-for-portrait ,th.hide-for-landscape {display:table-cell !important;}}.show-for-touch {display:none !important;}.hide-for-touch {display:inherit !important;}.touch .show-for-touch {display:inherit !important;}.touch .hide-for-touch {display:none !important;}table.hide-for-touch {display:table;}.touch table.show-for-touch {display:table;}thead.hide-for-touch {display:table-header-group !important;}.touch thead.show-for-touch {display:table-header-group !important;}tbody.hide-for-touch {display:table-row-group !important;}.touch tbody.show-for-touch {display:table-row-group !important;}tr.hide-for-touch {display:table-row !important;}.touch tr.show-for-touch {display:table-row !important;}td.hide-for-touch {display:table-cell !important;}.touch td.show-for-touch {display:table-cell !important;}th.hide-for-touch {display:table-cell !important;}.touch th.show-for-touch {display:table-cell !important;}
\ No newline at end of file
--- /dev/null
+/*! normalize.css v2.1.2 | MIT License | git.io/normalize */
+/* ==========================================================================
+ HTML5 display definitions
+ ========================================================================== */
+/**
+ * Correct `block` display not defined in IE 8/9.
+ */
+article, aside, details, figcaption, figure, footer, header, hgroup, main, nav, section, summary {
+ display: block; }
+
+/**
+ * Correct `inline-block` display not defined in IE 8/9.
+ */
+audio, canvas, video {
+ display: inline-block; }
+
+/**
+ * Prevent modern browsers from displaying `audio` without controls.
+ * Remove excess height in iOS 5 devices.
+ */
+audio:not([controls]) {
+ display: none;
+ height: 0; }
+
+/**
+ * Address `[hidden]` styling not present in IE 8/9.
+ * Hide the `template` element in IE, Safari, and Firefox < 22.
+ */
+[hidden], template {
+ display: none; }
+
+script {
+ display: none !important; }
+
+/* ==========================================================================
+ Base
+ ========================================================================== */
+/**
+ * 1. Set default font family to sans-serif.
+ * 2. Prevent iOS text size adjust after orientation change, without disabling
+ * user zoom.
+ */
+html {
+ font-family: sans-serif;
+ /* 1 */
+ -ms-text-size-adjust: 100%;
+ /* 2 */
+ -webkit-text-size-adjust: 100%;
+ /* 2 */ }
+
+/**
+ * Remove default margin.
+ */
+body {
+ margin: 0; }
+
+/* ==========================================================================
+ Links
+ ========================================================================== */
+/**
+ * Remove the gray background color from active links in IE 10.
+ */
+a {
+ background: transparent; }
+
+/**
+ * Address `outline` inconsistency between Chrome and other browsers.
+ */
+a:focus {
+ outline: thin dotted; }
+
+/**
+ * Improve readability when focused and also mouse hovered in all browsers.
+ */
+a:active, a:hover {
+ outline: 0; }
+
+/* ==========================================================================
+ Typography
+ ========================================================================== */
+/**
+ * Address variable `h1` font-size and margin within `section` and `article`
+ * contexts in Firefox 4+, Safari 5, and Chrome.
+ */
+h1 {
+ font-size: 2em;
+ margin: 0.67em 0; }
+
+/**
+ * Address styling not present in IE 8/9, Safari 5, and Chrome.
+ */
+abbr[title] {
+ border-bottom: 1px dotted; }
+
+/**
+ * Address style set to `bolder` in Firefox 4+, Safari 5, and Chrome.
+ */
+b, strong {
+ font-weight: bold; }
+
+/**
+ * Address styling not present in Safari 5 and Chrome.
+ */
+dfn {
+ font-style: italic; }
+
+/**
+ * Address differences between Firefox and other browsers.
+ */
+hr {
+ -moz-box-sizing: content-box;
+ box-sizing: content-box;
+ height: 0; }
+
+/**
+ * Address styling not present in IE 8/9.
+ */
+mark {
+ background: yellow;
+ color: black; }
+
+/**
+ * Correct font family set oddly in Safari 5 and Chrome.
+ */
+code, kbd, pre, samp {
+ font-family: monospace, serif;
+ font-size: 1em; }
+
+/**
+ * Improve readability of pre-formatted text in all browsers.
+ */
+pre {
+ white-space: pre-wrap; }
+
+/**
+ * Set consistent quote types.
+ */
+q {
+ quotes: "\201C" "\201D" "\2018" "\2019"; }
+
+/**
+ * Address inconsistent and variable font size in all browsers.
+ */
+small {
+ font-size: 80%; }
+
+/**
+ * Prevent `sub` and `sup` affecting `line-height` in all browsers.
+ */
+sub, sup {
+ font-size: 75%;
+ line-height: 0;
+ position: relative;
+ vertical-align: baseline; }
+
+sup {
+ top: -0.5em; }
+
+sub {
+ bottom: -0.25em; }
+
+/* ==========================================================================
+ Embedded content
+ ========================================================================== */
+/**
+ * Remove border when inside `a` element in IE 8/9.
+ */
+img {
+ border: 0; }
+
+/**
+ * Correct overflow displayed oddly in IE 9.
+ */
+svg:not(:root) {
+ overflow: hidden; }
+
+/* ==========================================================================
+ Figures
+ ========================================================================== */
+/**
+ * Address margin not present in IE 8/9 and Safari 5.
+ */
+figure {
+ margin: 0; }
+
+/* ==========================================================================
+ Forms
+ ========================================================================== */
+/**
+ * Define consistent border, margin, and padding.
+ */
+fieldset {
+ border: 1px solid silver;
+ margin: 0 2px;
+ padding: 0.35em 0.625em 0.75em; }
+
+/**
+ * 1. Correct `color` not being inherited in IE 8/9.
+ * 2. Remove padding so people aren't caught out if they zero out fieldsets.
+ */
+legend {
+ border: 0;
+ /* 1 */
+ padding: 0;
+ /* 2 */ }
+
+/**
+ * 1. Correct font family not being inherited in all browsers.
+ * 2. Correct font size not being inherited in all browsers.
+ * 3. Address margins set differently in Firefox 4+, Safari 5, and Chrome.
+ */
+button, input, select, textarea {
+ font-family: inherit;
+ /* 1 */
+ font-size: 100%;
+ /* 2 */
+ margin: 0;
+ /* 3 */ }
+
+/**
+ * Address Firefox 4+ setting `line-height` on `input` using `!important` in
+ * the UA stylesheet.
+ */
+button, input {
+ line-height: normal; }
+
+/**
+ * Address inconsistent `text-transform` inheritance for `button` and `select`.
+ * All other form control elements do not inherit `text-transform` values.
+ * Correct `button` style inheritance in Chrome, Safari 5+, and IE 8+.
+ * Correct `select` style inheritance in Firefox 4+ and Opera.
+ */
+button, select {
+ text-transform: none; }
+
+/**
+ * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio`
+ * and `video` controls.
+ * 2. Correct inability to style clickable `input` types in iOS.
+ * 3. Improve usability and consistency of cursor style between image-type
+ * `input` and others.
+ */
+button, html input[type="button"], input[type="reset"], input[type="submit"] {
+ -webkit-appearance: button;
+ /* 2 */
+ cursor: pointer;
+ /* 3 */ }
+
+/**
+ * Re-set default cursor for disabled elements.
+ */
+button[disabled], html input[disabled] {
+ cursor: default; }
+
+/**
+ * 1. Address box sizing set to `content-box` in IE 8/9.
+ * 2. Remove excess padding in IE 8/9.
+ */
+input[type="checkbox"], input[type="radio"] {
+ box-sizing: border-box;
+ /* 1 */
+ padding: 0;
+ /* 2 */ }
+
+/**
+ * 1. Address `appearance` set to `searchfield` in Safari 5 and Chrome.
+ * 2. Address `box-sizing` set to `border-box` in Safari 5 and Chrome
+ * (include `-moz` to future-proof).
+ */
+input[type="search"] {
+ -webkit-appearance: textfield;
+ /* 1 */
+ -moz-box-sizing: content-box;
+ -webkit-box-sizing: content-box;
+ /* 2 */
+ box-sizing: content-box; }
+
+/**
+ * Remove inner padding and search cancel button in Safari 5 and Chrome
+ * on OS X.
+ */
+input[type="search"]::-webkit-search-cancel-button, input[type="search"]::-webkit-search-decoration {
+ -webkit-appearance: none; }
+
+/**
+ * Remove inner padding and border in Firefox 4+.
+ */
+button::-moz-focus-inner, input::-moz-focus-inner {
+ border: 0;
+ padding: 0; }
+
+/**
+ * 1. Remove default vertical scrollbar in IE 8/9.
+ * 2. Improve readability and alignment in all browsers.
+ */
+textarea {
+ overflow: auto;
+ /* 1 */
+ vertical-align: top;
+ /* 2 */ }
+
+/* ==========================================================================
+ Tables
+ ========================================================================== */
+/**
+ * Remove most spacing between table cells.
+ */
+table {
+ border-collapse: collapse;
+ border-spacing: 0; }
--- /dev/null
+
+<!--<script src="/js/vendor/jquery.js"></script>
+<script src="/js/vendor/fastclick.js"></script>
+<script src="/js/foundation.min.js"></script>
+<script> (function($) {
+jQuery(document).foundation()
+
+})(jQuery); </script>-->
+
+ <div id="wildbillfooter">For Dune Buggy and Quad Rentals visit us at <a target="_blank" href="http://wildbillsatvs.com">Wild Bill's Atvs</a></div>
+ </div><!-- /#main -->
+ <div id="copyright">
+ Copyright©<?php echo date('Y');?> <?php bloginfo('name');?> - Produced by <a href="http://www.gaslightmedia.com">Gaslight Media</a>, All Rights Reserved.
+ </div><!-- /#copyright -->
+
+ </div> <!-- .row -->
+
+
+ </div><!-- /#wrapperInner" -->
+ </div><!-- /#wrapper -->
+
+
+<!-- </section> off-canvas wrap end section -->
+ <a class="exit-off-canvas">
+ </a>
+ </div>
+ </div>
+ </div>
+
+ <?php wp_footer();?>
+<script src="<?php bloginfo('template_url'); ?>/js/vendor/jquery.js"></script>
+<script src="<?php bloginfo('template_url'); ?>/js/foundation.min.js"></script>
+<script>
+jQuery(window).resize( function() {
+ if(jQuery(window).width() <= 640) {
+ jQuery("#logo").attr("src","<?php echo get_template_directory_uri();?>/assets/logo-small2.jpg");
+// jQuery("#logo").hide();
+ } else {
+ jQuery("#logo").attr("src","<?php echo get_template_directory_uri();?>/assets/logo.gif");
+// jQuery("#logo").show();
+ }
+});
+jQuery(document).foundation();
+</script>
+</body>
+</html>
--- /dev/null
+
+<?php
+
+echo "TESTTEST TEST TEST TEST";
+
+
+
+// This theme only works in WP version 3.6 or higher.
+//if ( version_compare( $GLOBALS['wp_version'], '3.6', '<' ) ) {
+// require get_template_directory() . '/inc/back-compat.php';
+//}
+
+// Register all navigation menus
+require_once('navigation.php');
+
+
+function register_my_menu() {
+ register_nav_menu('header-menu',__( 'Header Menu' ));
+}
+add_action( 'init', 'register_my_menu' );
+
+
+function register_my_menus() {
+ register_nav_menus(
+ array(
+ 'header-menu' => __( 'Header Menu' ),
+ 'extra-menu' => __( 'Extra Menu' )
+ )
+ );
+}
+add_action( 'init', 'register_my_menus' );
+
+wp_nav_menu( array( 'theme_location' => 'header-menu' ) );
+
+wp_nav_menu( array( 'theme_location' => 'extra-menu', 'container_class' => 'my_extra_menu_class' ) );
+
+// Register Navigation Menus
+function custom_navigation_menus() {
+
+ $locations = array(
+ );
+ register_nav_menus( $locations );
+
+}
+
+// Hook into the 'init' action
+add_action( 'init', 'custom_navigation_menus' );
+
+
+
+
+add_editor_style( array( 'css/editor-style.css', parrotslanding_font_url(), 'genericons/genericons.css' ) );
+
+
+
+
+
+?>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+/**
+ * Register Lato Google font for Theme.
+ *
+ * @since parrotslanding 1.0
+ *
+ * @return string
+ */
+function parrotslanding_font_url() {
+ $font_url = '';
+ /*
+ * Translators: If there are characters in your language that are not supported
+ * by Lato, translate this to 'off'. Do not translate into your own language.
+ */
+ if ( 'off' !== _x( 'on', 'Lato font: on or off', 'parrotslanding' ) ) {
+ $font_url = add_query_arg( 'family', urlencode( 'Lato:300,400,700,900,300italic,400italic,700italic' ), "//fonts.googleapis.com/css" );
+ }
+
+ return $font_url;
+}
\ No newline at end of file
--- /dev/null
+<?php get_header();?>
+
+
+<?php get_sidebar();?>
+
+ <div id="main" class="small-12 medium-9 columns">
+ <br>
+ <div class="breadcrumbs">
+ <?php if(function_exists('bcn_display'))
+ {
+ bcn_display();
+ }?>
+ <br> <br>
+ </div>
+
+ <div id="map_canvas"></div>
+<script src="https://maps.googleapis.com/maps/api/js"></script>
+<script>
+ jQuery(document).ready(
+ var myLatLng = new google.maps.LatLng(43.667814, -86.479338);
+
+ function initialize() {
+ var mapCanvas = document.getElementById('map_canvas');
+ var mapOptions = {
+ center: myLatLng,
+ zoom: 8,
+ mapTypeId: google.maps.MapTypeId.ROADMAP
+ };
+ var map = new google.maps.Map(mapCanvas, mapOptions);
+ });
+ var marker = new google.maps.Marker({
+ position: myLatlng,
+ title:"Hello World!"
+ });
+ marker.setMap(map);
+
+ google.maps.event.addDomListener(window, 'load', initialize);
+
+</script>
+
+<?php get_footer();?>
+
--- /dev/null
+<!doctype html>
+<html lang="en">
+<head>
+<title><?php wp_title();?></title>
+<meta http-equiv="content-type" content="text/html;charset=utf-8">
+<meta http-equiv="imagetoolbar" content="no">
+<meta http-equiv="imagetoolbar" content="false">
+
+<?php wp_head();?>
+<link rel="stylesheet" href="<?php bloginfo('template_url'); ?>/css/foundation.css" />
+<link type="text/css" rel="stylesheet" href="<?php echo get_template_directory_uri();?>/qs.css">
+<link type="text/css" rel="stylesheet" href="<?php echo get_stylesheet_uri();?>">
+
+<!--<script src="https://maps.googleapis.com/maps/api/js"></script>-->
+<script src="<?php bloginfo('template_url'); ?>/js/vendor/modernizr.js"></script>
+<!-- Google Analytics Code -->
+</head>
+
+<body>
+
+<div id="wrapper" class="row">
+
+ <div id="wrapperInner" class="row small-12 columns">
+
+ <div id="top" class="small-12 columns">
+ <a href="<?php echo home_url();?>">
+ <img id="logo" src="<?php echo get_template_directory_uri();?>/assets/logo.gif">
+ </a>
+ </div><!-- /#top -->
+ <div class="off-canvas-wrap" data-offcanvas>
+ <div class="inner-wrap">
+ <nav class="tab-bar">
+ <section class="left-small">
+ <a class="left-off-canvas-toggle menu-icon" href="#">
+ <span></span>
+ </a>
+ </section>
+
+<!-- <section class="middle tab-bar-section"> <
+ h1 class="title">Foundation</h1>
+ </section>-->
+ </nav>
+ <aside class="left-off-canvas-menu">
+ <ul class="off-canvas-list">
+ <?php wp_nav_menu(array('ParrotsLanding' => 'header-menu', 'menu_class' => 'left'));?>
+<!-- <li>
+ <label>Foundation</label>
+ </li>
+ <li>
+ <a href="#">The Psychohistorians</a>
+ </li>
+ <li>
+ <a href="#">...</a>
+ </li> -->
+ </ul>
+ </aside>
+ <section class="main-section"> <!-- content goes here --> </section>
--- /dev/null
+<?php get_header();?>
+<?php get_sidebar();?>
+
+ <div id="main" class="small-12 medium-9 columns">
+ <br> <br>
+ <div class="breadcrumbs">
+ <?php if(function_exists('bcn_display'))
+ {
+ bcn_display();
+ }?>
+ <br> <br>
+ </div>
+ <div id="toolbox">
+ <?php if(have_posts()) : while(have_posts()): the_post();?>
+ <?php the_content();?>
+ <?php endwhile; else:?>
+ <p><?php _e('Sorry, no posts yet');?></p>
+ <?php endif;?>
+ </div><!-- /#toolbox -->
+
+<?php get_footer();?>
--- /dev/null
+<?php get_header(); ?>
+<div id="main">
+<div id="content">
+<h1>Main Area</h1>
+<?php if (have_posts()) : while (have_posts()) : the_post(); ?>
+<h1><?php the_title(); ?></h1>
+<h4>Posted on <?php the_time('F jS, Y') ?></h4>
+<p><?php the_content(__('(more...)')); ?></p>
+<hr> <?php endwhile; else: ?>
+<p><?php _e('Sorry, no posts matched your criteria.'); ?></p><?php endif; ?>
+</div>
+<?php get_sidebar(); ?>
+</div>
+<div id="delimiter">
+</div>
+<?php get_footer(); ?>
--- /dev/null
+<?php
+$dbh = Toolkit_Database::getInstance();
+$catid = filter_input(INPUT_GET, 'catid', FILTER_VALIDATE_INT);
+if (!$catid) {
+ $catid = HOME_ID;
+}
+if ($catid != HOME_ID) {
+ require_once 'Text/CAPTCHA.php';
+ require_once 'Text/CAPTCHA/Driver/Image.php';
+}
+HTTP_Session2::useCookies(false);
+HTTP_Session2::start();
+
+if (defined('MOBILE_SITE') && MOBILE_SITE) {
+ include_once 'm_index.php';
+}
+// Create a new registry so we don't pollute the global namespace
+$registry = new Toolkit_Registry;
+
+$registry->cacheOptions = $GLOBALS['cacheOptions'];
+$registry->flexyOptions = $GLOBALS['flexyOptions'];
+$registry->catid = $catid;
+$registry->dbh = $dbh;
+$registry->logger = Toolkit_Logger::getLogger();
+
+// Create a router so we can get where we need to be.
+$registry->router = new Toolkit_Router($registry);
+$registry->router->setPath(BASE . 'Toolkit/Template');
+$registry->router->setApplication('Template');
+
+$registry->router->loader();
--- /dev/null
+/*
+ * Foundation Responsive Library
+ * http://foundation.zurb.com
+ * Copyright 2014, ZURB
+ * Free to use under the MIT license.
+ * http://www.opensource.org/licenses/mit-license.php
+*/
+
+(function ($, window, document, undefined) {
+ 'use strict';
+
+ var header_helpers = function (class_array) {
+ var i = class_array.length;
+
+ while (i--) {
+ if($('head').has('.' + class_array[i]).length === 0) {
+ $('head').append('<meta class="' + class_array[i] + '">');
+ }
+ }
+ };
+
+ header_helpers([
+ 'foundation-mq-small',
+ 'foundation-mq-medium',
+ 'foundation-mq-large',
+ 'foundation-mq-xlarge',
+ 'foundation-mq-xxlarge',
+ 'foundation-data-attribute-namespace']);
+
+ // Enable FastClick if present
+
+ $(function() {
+ if(typeof FastClick !== 'undefined') {
+ // Don't attach to body if undefined
+ if (typeof document.body !== 'undefined') {
+ FastClick.attach(document.body);
+ }
+ }
+ });
+
+ // private Fast Selector wrapper,
+ // returns jQuery object. Only use where
+ // getElementById is not available.
+ var S = function (selector, context) {
+ if (typeof selector === 'string') {
+ if (context) {
+ var cont;
+ if (context.jquery) {
+ cont = context[0];
+ } else {
+ cont = context;
+ }
+ return $(cont.querySelectorAll(selector));
+ }
+
+ return $(document.querySelectorAll(selector));
+ }
+
+ return $(selector, context);
+ };
+
+ // Namespace functions.
+
+ var attr_name = function (init) {
+ var arr = [];
+ if (!init) arr.push('data');
+ if (this.namespace.length > 0) arr.push(this.namespace);
+ arr.push(this.name);
+
+ return arr.join('-');
+ };
+
+ var header_helpers = function (class_array) {
+ var i = class_array.length;
+
+ while (i--) {
+ if($('head').has('.' + class_array[i]).length === 0) {
+ $('head').append('<meta class="' + class_array[i] + '">');
+ }
+ }
+ };
+
+ var add_namespace = function (str) {
+ var parts = str.split('-'),
+ i = parts.length,
+ arr = [];
+
+ while(i--) {
+ if (i !== 0) {
+ arr.push(parts[i]);
+ } else {
+ if (this.namespace.length > 0) {
+ arr.push(this.namespace, parts[i]);
+ } else {
+ arr.push(parts[i]);
+ }
+ }
+ }
+
+ return arr.reverse().join('-');
+ };
+
+ // Event binding and data-options updating.
+
+ var bindings = function (method, options) {
+ var self = this,
+ should_bind_events = !S(this).data(this.attr_name(true));
+
+ if (typeof method === 'string') {
+ return this[method].call(this, options);
+ }
+
+ if (S(this.scope).is('[' + this.attr_name() +']')) {
+ S(this.scope).data(this.attr_name(true) + '-init', $.extend({}, this.settings, (options || method), this.data_options(S(this.scope))));
+
+ if (should_bind_events) {
+ this.events(this.scope);
+ }
+
+ } else {
+ S('[' + this.attr_name() +']', this.scope).each(function () {
+ var should_bind_events = !S(this).data(self.attr_name(true) + '-init');
+
+ S(this).data(self.attr_name(true) + '-init', $.extend({}, self.settings, (options || method), self.data_options(S(this))));
+
+ if (should_bind_events) {
+ self.events(this);
+ }
+ });
+ }
+ };
+
+ var single_image_loaded = function (image, callback) {
+ function loaded () {
+ callback(image[0]);
+ }
+
+ function bindLoad () {
+ this.one('load', loaded);
+
+ if (/MSIE (\d+\.\d+);/.test(navigator.userAgent)) {
+ var src = this.attr( 'src' ),
+ param = src.match( /\?/ ) ? '&' : '?';
+
+ param += 'random=' + (new Date()).getTime();
+ this.attr('src', src + param);
+ }
+ }
+
+ if (!image.attr('src')) {
+ loaded();
+ return;
+ }
+
+ if (image[0].complete || image[0].readyState === 4) {
+ loaded();
+ } else {
+ bindLoad.call(image);
+ }
+ }
+
+ /*
+ https://github.com/paulirish/matchMedia.js
+ */
+
+ window.matchMedia = window.matchMedia || (function( doc, undefined ) {
+
+ "use strict";
+
+ var bool,
+ docElem = doc.documentElement,
+ refNode = docElem.firstElementChild || docElem.firstChild,
+ // fakeBody required for <FF4 when executed in <head>
+ fakeBody = doc.createElement( "body" ),
+ div = doc.createElement( "div" );
+
+ div.id = "mq-test-1";
+ div.style.cssText = "position:absolute;top:-100em";
+ fakeBody.style.background = "none";
+ fakeBody.appendChild(div);
+
+ return function(q){
+
+ div.innerHTML = "­<style media=\"" + q + "\"> #mq-test-1 { width: 42px; }</style>";
+
+ docElem.insertBefore( fakeBody, refNode );
+ bool = div.offsetWidth === 42;
+ docElem.removeChild( fakeBody );
+
+ return {
+ matches: bool,
+ media: q
+ };
+
+ };
+
+ }( document ));
+
+ /*
+ * jquery.requestAnimationFrame
+ * https://github.com/gnarf37/jquery-requestAnimationFrame
+ * Requires jQuery 1.8+
+ *
+ * Copyright (c) 2012 Corey Frang
+ * Licensed under the MIT license.
+ */
+
+ (function( $ ) {
+
+ // requestAnimationFrame polyfill adapted from Erik Möller
+ // fixes from Paul Irish and Tino Zijdel
+ // http://paulirish.com/2011/requestanimationframe-for-smart-animating/
+ // http://my.opera.com/emoller/blog/2011/12/20/requestanimationframe-for-smart-er-animating
+
+
+ var animating,
+ lastTime = 0,
+ vendors = ['webkit', 'moz'],
+ requestAnimationFrame = window.requestAnimationFrame,
+ cancelAnimationFrame = window.cancelAnimationFrame;
+
+ for(; lastTime < vendors.length && !requestAnimationFrame; lastTime++) {
+ requestAnimationFrame = window[ vendors[lastTime] + "RequestAnimationFrame" ];
+ cancelAnimationFrame = cancelAnimationFrame ||
+ window[ vendors[lastTime] + "CancelAnimationFrame" ] ||
+ window[ vendors[lastTime] + "CancelRequestAnimationFrame" ];
+ }
+
+ function raf() {
+ if ( animating ) {
+ requestAnimationFrame( raf );
+ jQuery.fx.tick();
+ }
+ }
+
+ if ( requestAnimationFrame ) {
+ // use rAF
+ window.requestAnimationFrame = requestAnimationFrame;
+ window.cancelAnimationFrame = cancelAnimationFrame;
+ jQuery.fx.timer = function( timer ) {
+ if ( timer() && jQuery.timers.push( timer ) && !animating ) {
+ animating = true;
+ raf();
+ }
+ };
+
+ jQuery.fx.stop = function() {
+ animating = false;
+ };
+ } else {
+ // polyfill
+ window.requestAnimationFrame = function( callback, element ) {
+ var currTime = new Date().getTime(),
+ timeToCall = Math.max( 0, 16 - ( currTime - lastTime ) ),
+ id = window.setTimeout( function() {
+ callback( currTime + timeToCall );
+ }, timeToCall );
+ lastTime = currTime + timeToCall;
+ return id;
+ };
+
+ window.cancelAnimationFrame = function(id) {
+ clearTimeout(id);
+ };
+
+ }
+
+ }( jQuery ));
+
+
+ function removeQuotes (string) {
+ if (typeof string === 'string' || string instanceof String) {
+ string = string.replace(/^['\\/"]+|(;\s?})+|['\\/"]+$/g, '');
+ }
+
+ return string;
+ }
+
+ window.Foundation = {
+ name : 'Foundation',
+
+ version : '5.1.1',
+
+ media_queries : {
+ small : S('.foundation-mq-small').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, ''),
+ medium : S('.foundation-mq-medium').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, ''),
+ large : S('.foundation-mq-large').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, ''),
+ xlarge: S('.foundation-mq-xlarge').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, ''),
+ xxlarge: S('.foundation-mq-xxlarge').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, '')
+ },
+
+ stylesheet : $('<style></style>').appendTo('head')[0].sheet,
+
+ global: {
+ namespace: ''
+ },
+
+ init : function (scope, libraries, method, options, response) {
+ var library_arr,
+ args = [scope, method, options, response],
+ responses = [];
+
+ // check RTL
+ this.rtl = /rtl/i.test(S('html').attr('dir'));
+
+ // set foundation global scope
+ this.scope = scope || this.scope;
+
+ this.set_namespace();
+
+ if (libraries && typeof libraries === 'string' && !/reflow/i.test(libraries)) {
+ if (this.libs.hasOwnProperty(libraries)) {
+ responses.push(this.init_lib(libraries, args));
+ }
+ } else {
+ for (var lib in this.libs) {
+ responses.push(this.init_lib(lib, libraries));
+ }
+ }
+
+ return scope;
+ },
+
+ init_lib : function (lib, args) {
+ if (this.libs.hasOwnProperty(lib)) {
+ this.patch(this.libs[lib]);
+
+ if (args && args.hasOwnProperty(lib)) {
+ return this.libs[lib].init.apply(this.libs[lib], [this.scope, args[lib]]);
+ }
+
+ args = args instanceof Array ? args : Array(args); // PATCH: added this line
+ return this.libs[lib].init.apply(this.libs[lib], args);
+ }
+
+ return function () {};
+ },
+
+ patch : function (lib) {
+ lib.scope = this.scope;
+ lib.namespace = this.global.namespace;
+ lib.rtl = this.rtl;
+ lib['data_options'] = this.utils.data_options;
+ lib['attr_name'] = attr_name;
+ lib['add_namespace'] = add_namespace;
+ lib['bindings'] = bindings;
+ lib['S'] = this.utils.S;
+ },
+
+ inherit : function (scope, methods) {
+ var methods_arr = methods.split(' '),
+ i = methods_arr.length;
+
+ while (i--) {
+ if (this.utils.hasOwnProperty(methods_arr[i])) {
+ scope[methods_arr[i]] = this.utils[methods_arr[i]];
+ }
+ }
+ },
+
+ set_namespace: function () {
+ var namespace = $('.foundation-data-attribute-namespace').css('font-family');
+
+ if (/false/i.test(namespace)) return;
+
+ this.global.namespace = namespace;
+ },
+
+ libs : {},
+
+ // methods that can be inherited in libraries
+ utils : {
+
+ // Description:
+ // Fast Selector wrapper returns jQuery object. Only use where getElementById
+ // is not available.
+ //
+ // Arguments:
+ // Selector (String): CSS selector describing the element(s) to be
+ // returned as a jQuery object.
+ //
+ // Scope (String): CSS selector describing the area to be searched. Default
+ // is document.
+ //
+ // Returns:
+ // Element (jQuery Object): jQuery object containing elements matching the
+ // selector within the scope.
+ S : S,
+
+ // Description:
+ // Executes a function a max of once every n milliseconds
+ //
+ // Arguments:
+ // Func (Function): Function to be throttled.
+ //
+ // Delay (Integer): Function execution threshold in milliseconds.
+ //
+ // Returns:
+ // Lazy_function (Function): Function with throttling applied.
+ throttle : function(func, delay) {
+ var timer = null;
+
+ return function () {
+ var context = this, args = arguments;
+
+ clearTimeout(timer);
+ timer = setTimeout(function () {
+ func.apply(context, args);
+ }, delay);
+ };
+ },
+
+ // Description:
+ // Executes a function when it stops being invoked for n seconds
+ // Modified version of _.debounce() http://underscorejs.org
+ //
+ // Arguments:
+ // Func (Function): Function to be debounced.
+ //
+ // Delay (Integer): Function execution threshold in milliseconds.
+ //
+ // Immediate (Bool): Whether the function should be called at the beginning
+ // of the delay instead of the end. Default is false.
+ //
+ // Returns:
+ // Lazy_function (Function): Function with debouncing applied.
+ debounce : function(func, delay, immediate) {
+ var timeout, result;
+ return function() {
+ var context = this, args = arguments;
+ var later = function() {
+ timeout = null;
+ if (!immediate) result = func.apply(context, args);
+ };
+ var callNow = immediate && !timeout;
+ clearTimeout(timeout);
+ timeout = setTimeout(later, delay);
+ if (callNow) result = func.apply(context, args);
+ return result;
+ };
+ },
+
+ // Description:
+ // Parses data-options attribute
+ //
+ // Arguments:
+ // El (jQuery Object): Element to be parsed.
+ //
+ // Returns:
+ // Options (Javascript Object): Contents of the element's data-options
+ // attribute.
+ data_options : function (el) {
+ var opts = {}, ii, p, opts_arr,
+ data_options = function (el) {
+ var namespace = Foundation.global.namespace;
+
+ if (namespace.length > 0) {
+ return el.data(namespace + '-options');
+ }
+
+ return el.data('options');
+ };
+
+ var cached_options = data_options(el);
+
+ if (typeof cached_options === 'object') {
+ return cached_options;
+ }
+
+ opts_arr = (cached_options || ':').split(';'),
+ ii = opts_arr.length;
+
+ function isNumber (o) {
+ return ! isNaN (o-0) && o !== null && o !== "" && o !== false && o !== true;
+ }
+
+ function trim(str) {
+ if (typeof str === 'string') return $.trim(str);
+ return str;
+ }
+
+ while (ii--) {
+ p = opts_arr[ii].split(':');
+
+ if (/true/i.test(p[1])) p[1] = true;
+ if (/false/i.test(p[1])) p[1] = false;
+ if (isNumber(p[1])) p[1] = parseInt(p[1], 10);
+
+ if (p.length === 2 && p[0].length > 0) {
+ opts[trim(p[0])] = trim(p[1]);
+ }
+ }
+
+ return opts;
+ },
+
+ // Description:
+ // Adds JS-recognizable media queries
+ //
+ // Arguments:
+ // Media (String): Key string for the media query to be stored as in
+ // Foundation.media_queries
+ //
+ // Class (String): Class name for the generated <meta> tag
+ register_media : function(media, media_class) {
+ if(Foundation.media_queries[media] === undefined) {
+ $('head').append('<meta class="' + media_class + '">');
+ Foundation.media_queries[media] = removeQuotes($('.' + media_class).css('font-family'));
+ }
+ },
+
+ // Description:
+ // Add custom CSS within a JS-defined media query
+ //
+ // Arguments:
+ // Rule (String): CSS rule to be appended to the document.
+ //
+ // Media (String): Optional media query string for the CSS rule to be
+ // nested under.
+ add_custom_rule : function(rule, media) {
+ if(media === undefined) {
+ Foundation.stylesheet.insertRule(rule, Foundation.stylesheet.cssRules.length);
+ } else {
+ var query = Foundation.media_queries[media];
+ if(query !== undefined) {
+ Foundation.stylesheet.insertRule('@media ' +
+ Foundation.media_queries[media] + '{ ' + rule + ' }');
+ }
+ }
+ },
+
+ // Description:
+ // Performs a callback function when an image is fully loaded
+ //
+ // Arguments:
+ // Image (jQuery Object): Image(s) to check if loaded.
+ //
+ // Callback (Function): Fundation to execute when image is fully loaded.
+ image_loaded : function (images, callback) {
+ var self = this,
+ unloaded = images.length;
+
+ images.each(function(){
+ single_image_loaded(self.S(this),function(){
+ unloaded -= 1;
+ if(unloaded == 0){
+ callback(images);
+ }
+ });
+ });
+ },
+
+ // Description:
+ // Returns a random, alphanumeric string
+ //
+ // Arguments:
+ // Length (Integer): Length of string to be generated. Defaults to random
+ // integer.
+ //
+ // Returns:
+ // Rand (String): Pseudo-random, alphanumeric string.
+ random_str : function (length) {
+ var chars = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz'.split('');
+
+ if (!length) {
+ length = Math.floor(Math.random() * chars.length);
+ }
+
+ var str = '';
+ while (length--) {
+ str += chars[Math.floor(Math.random() * chars.length)];
+ }
+ return str;
+ }
+ }
+ };
+
+ $.fn.foundation = function () {
+ var args = Array.prototype.slice.call(arguments, 0);
+
+ return this.each(function () {
+ Foundation.init.apply(Foundation, [this].concat(args));
+ return this;
+ });
+ };
+
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.abide = {
+ name : 'abide',
+
+ version : '5.1.1',
+
+ settings : {
+ live_validate : true,
+ focus_on_invalid : true,
+ error_labels: true, // labels with a for="inputId" will recieve an `error` class
+ timeout : 1000,
+ patterns : {
+ alpha: /^[a-zA-Z]+$/,
+ alpha_numeric : /^[a-zA-Z0-9]+$/,
+ integer: /^\d+$/,
+ number: /-?(?:\d+|\d{1,3}(?:,\d{3})+)?(?:\.\d+)?/,
+
+ // generic password: upper-case, lower-case, number/special character, and min 8 characters
+ password : /(?=^.{8,}$)((?=.*\d)|(?=.*\W+))(?![.\n])(?=.*[A-Z])(?=.*[a-z]).*$/,
+
+ // amex, visa, diners
+ card : /^(?:4[0-9]{12}(?:[0-9]{3})?|5[1-5][0-9]{14}|6(?:011|5[0-9][0-9])[0-9]{12}|3[47][0-9]{13}|3(?:0[0-5]|[68][0-9])[0-9]{11}|(?:2131|1800|35\d{3})\d{11})$/,
+ cvv : /^([0-9]){3,4}$/,
+
+ // http://www.whatwg.org/specs/web-apps/current-work/multipage/states-of-the-type-attribute.html#valid-e-mail-address
+ email : /^[a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*$/,
+
+ url: /(https?|ftp|file|ssh):\/\/(((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-zA-Z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-zA-Z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-zA-Z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-zA-Z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-zA-Z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-zA-Z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?/,
+ // abc.de
+ domain: /^([a-zA-Z0-9]([a-zA-Z0-9\-]{0,61}[a-zA-Z0-9])?\.)+[a-zA-Z]{2,6}$/,
+
+ datetime: /([0-2][0-9]{3})\-([0-1][0-9])\-([0-3][0-9])T([0-5][0-9])\:([0-5][0-9])\:([0-5][0-9])(Z|([\-\+]([0-1][0-9])\:00))/,
+ // YYYY-MM-DD
+ date: /(?:19|20)[0-9]{2}-(?:(?:0[1-9]|1[0-2])-(?:0[1-9]|1[0-9]|2[0-9])|(?:(?!02)(?:0[1-9]|1[0-2])-(?:30))|(?:(?:0[13578]|1[02])-31))/,
+ // HH:MM:SS
+ time : /(0[0-9]|1[0-9]|2[0-3])(:[0-5][0-9]){2}/,
+ dateISO: /\d{4}[\/\-]\d{1,2}[\/\-]\d{1,2}/,
+ // MM/DD/YYYY
+ month_day_year : /(0[1-9]|1[012])[- \/.](0[1-9]|[12][0-9]|3[01])[- \/.](19|20)\d\d/,
+
+ // #FFF or #FFFFFF
+ color: /^#?([a-fA-F0-9]{6}|[a-fA-F0-9]{3})$/
+ }
+ },
+
+ timer : null,
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ },
+
+ events : function (scope) {
+ var self = this,
+ form = self.S(scope).attr('novalidate', 'novalidate'),
+ settings = form.data(this.attr_name(true) + '-init');
+
+ this.invalid_attr = this.add_namespace('data-invalid');
+
+ form
+ .off('.abide')
+ .on('submit.fndtn.abide validate.fndtn.abide', function (e) {
+ var is_ajax = /ajax/i.test(self.S(this).attr(self.attr_name()));
+ return self.validate(self.S(this).find('input, textarea, select').get(), e, is_ajax);
+ })
+ .on('reset', function() {
+ return self.reset($(this));
+ })
+ .find('input, textarea, select')
+ .off('.abide')
+ .on('blur.fndtn.abide change.fndtn.abide', function (e) {
+ self.validate([this], e);
+ })
+ .on('keydown.fndtn.abide', function (e) {
+ var settings = $(this).closest('form').data('abide-init');
+ if (settings.live_validate === true) {
+ clearTimeout(self.timer);
+ self.timer = setTimeout(function () {
+ self.validate([this], e);
+ }.bind(this), settings.timeout);
+ }
+ });
+ },
+
+ reset : function (form) {
+ form.removeAttr(this.invalid_attr);
+ $(this.invalid_attr, form).removeAttr(this.invalid_attr);
+ $('.error', form).not('small').removeClass('error');
+ },
+
+ validate : function (els, e, is_ajax) {
+ var validations = this.parse_patterns(els),
+ validation_count = validations.length,
+ form = this.S(els[0]).closest('form'),
+ submit_event = /submit/.test(e.type);
+
+ // Has to count up to make sure the focus gets applied to the top error
+ for (var i=0; i < validation_count; i++) {
+ if (!validations[i] && (submit_event || is_ajax)) {
+ if (this.settings.focus_on_invalid) els[i].focus();
+ form.trigger('invalid');
+ this.S(els[i]).closest('form').attr(this.invalid_attr, '');
+ return false;
+ }
+ }
+
+ if (submit_event || is_ajax) {
+ form.trigger('valid');
+ }
+
+ form.removeAttr(this.invalid_attr);
+
+ if (is_ajax) return false;
+
+ return true;
+ },
+
+ parse_patterns : function (els) {
+ var i = els.length,
+ el_patterns = [];
+
+ while (i--) {
+ el_patterns.push(this.pattern(els[i]));
+ }
+
+ return this.check_validation_and_apply_styles(el_patterns);
+ },
+
+ pattern : function (el) {
+ var type = el.getAttribute('type'),
+ required = typeof el.getAttribute('required') === 'string';
+
+ var pattern = el.getAttribute('pattern') || '';
+
+ if (this.settings.patterns.hasOwnProperty(pattern) && pattern.length > 0) {
+ return [el, this.settings.patterns[pattern], required];
+ } else if (pattern.length > 0) {
+ return [el, new RegExp(pattern), required];
+ }
+
+ if (this.settings.patterns.hasOwnProperty(type)) {
+ return [el, this.settings.patterns[type], required];
+ }
+
+ pattern = /.*/;
+
+ return [el, pattern, required];
+ },
+
+ check_validation_and_apply_styles : function (el_patterns) {
+ var i = el_patterns.length,
+ validations = [];
+
+ while (i--) {
+ var el = el_patterns[i][0],
+ required = el_patterns[i][2],
+ value = el.value,
+ direct_parent = this.S(el).parent(),
+ is_equal = el.getAttribute(this.add_namespace('data-equalto')),
+ is_radio = el.type === "radio",
+ is_checkbox = el.type === "checkbox",
+ label = this.S('label[for="' + el.getAttribute('id') + '"]'),
+ valid_length = (required) ? (el.value.length > 0) : true;
+
+ var parent;
+
+ if (!direct_parent.is('label')) {
+ parent = direct_parent;
+ } else {
+ parent = direct_parent.parent();
+ }
+
+ if (is_radio && required) {
+ validations.push(this.valid_radio(el, required));
+ } else if (is_checkbox && required) {
+ validations.push(this.valid_checkbox(el, required));
+ } else if (is_equal && required) {
+ validations.push(this.valid_equal(el, required, parent));
+ } else {
+
+ if (el_patterns[i][1].test(value) && valid_length ||
+ !required && el.value.length < 1) {
+ this.S(el).removeAttr(this.invalid_attr);
+ parent.removeClass('error');
+ if (label.length > 0 && this.settings.error_labels) label.removeClass('error');
+
+ validations.push(true);
+ $(el).triggerHandler('valid');
+ } else {
+ this.S(el).attr(this.invalid_attr, '');
+ parent.addClass('error');
+ if (label.length > 0 && this.settings.error_labels) label.addClass('error');
+
+ validations.push(false);
+ $(el).triggerHandler('invalid');
+ }
+ }
+ }
+
+ return validations;
+ },
+
+ valid_checkbox : function(el, required) {
+ var el = this.S(el),
+ valid = (el.is(':checked') || !required);
+
+ if (valid) {
+ el.removeAttr(this.invalid_attr).parent().removeClass('error');
+ } else {
+ el.attr(this.invalid_attr, '').parent().addClass('error');
+ }
+
+ return valid;
+ },
+
+ valid_radio : function (el, required) {
+ var name = el.getAttribute('name'),
+ group = document.getElementsByName(name),
+ count = group.length,
+ valid = false;
+
+ // Has to count up to make sure the focus gets applied to the top error
+ for (var i=0; i < count; i++) {
+ if (group[i].checked) valid = true;
+ }
+
+ // Has to count up to make sure the focus gets applied to the top error
+ for (var i=0; i < count; i++) {
+ if (valid) {
+ this.S(group[i]).removeAttr(this.invalid_attr).parent().removeClass('error');
+ } else {
+ this.S(group[i]).attr(this.invalid_attr, '').parent().addClass('error');
+ }
+ }
+
+ return valid;
+ },
+
+ valid_equal: function(el, required, parent) {
+ var from = document.getElementById(el.getAttribute(this.add_namespace('data-equalto'))).value,
+ to = el.value,
+ valid = (from === to);
+
+ if (valid) {
+ this.S(el).removeAttr(this.invalid_attr);
+ parent.removeClass('error');
+ } else {
+ this.S(el).attr(this.invalid_attr, '');
+ parent.addClass('error');
+ }
+
+ return valid;
+ }
+ };
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.accordion = {
+ name : 'accordion',
+
+ version : '5.1.1',
+
+ settings : {
+ active_class: 'active',
+ toggleable: true
+ },
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this;
+ var S = this.S;
+ S(this.scope)
+ .off('.fndtn.accordion')
+ .on('click.fndtn.accordion', '[' + this.attr_name() + '] > dd > a', function (e) {
+ var accordion = S(this).closest('[' + self.attr_name() + ']'),
+ target = S('#' + this.href.split('#')[1]),
+ siblings = S('dd > .content', accordion),
+ aunts = $('> dd', accordion),
+ settings = accordion.data(self.attr_name(true) + '-init'),
+ active_content = S('dd > .content.' + settings.active_class, accordion),
+ active_parent = S('dd.' + settings.active_class, accordion);
+
+ e.preventDefault();
+
+ if (active_content[0] == target[0] && settings.toggleable) {
+ active_parent.toggleClass(settings.active_class, false);
+ return target.toggleClass(settings.active_class, false);
+ }
+
+ siblings.removeClass(settings.active_class);
+ aunts.removeClass(settings.active_class);
+ target.addClass(settings.active_class).parent().addClass(settings.active_class);
+ });
+ },
+
+ off : function () {},
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.alert = {
+ name : 'alert',
+
+ version : '5.1.1',
+
+ settings : {
+ animation: 'fadeOut',
+ speed: 300, // fade out speed
+ callback: function (){}
+ },
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this,
+ S = this.S;
+
+ $(this.scope).off('.alert').on('click.fndtn.alert', '[' + this.attr_name() + '] a.close', function (e) {
+ var alertBox = S(this).closest('[' + self.attr_name() + ']'),
+ settings = alertBox.data(self.attr_name(true) + '-init') || self.settings;
+
+ e.preventDefault();
+ alertBox[settings.animation](settings.speed, function () {
+ S(this).trigger('closed').remove();
+ settings.callback();
+ });
+ });
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.clearing = {
+ name : 'clearing',
+
+ version: '5.1.1',
+
+ settings : {
+ templates : {
+ viewing : '<a href="#" class="clearing-close">×</a>' +
+ '<div class="visible-img" style="display: none"><div class="clearing-touch-label"></div><img src="data:image/gif;base64,R0lGODlhAQABAAD/ACwAAAAAAQABAAACADs%3D" alt="" />' +
+ '<p class="clearing-caption"></p><a href="#" class="clearing-main-prev"><span></span></a>' +
+ '<a href="#" class="clearing-main-next"><span></span></a></div>'
+ },
+
+ // comma delimited list of selectors that, on click, will close clearing,
+ // add 'div.clearing-blackout, div.visible-img' to close on background click
+ close_selectors : '.clearing-close',
+
+ touch_label : '← Swipe to Advance →',
+
+ // event initializers and locks
+ init : false,
+ locked : false
+ },
+
+ init : function (scope, method, options) {
+ var self = this;
+ Foundation.inherit(this, 'throttle image_loaded');
+
+ this.bindings(method, options);
+
+ if (self.S(this.scope).is('[' + this.attr_name() + ']')) {
+ this.assemble(self.S('li', this.scope));
+ } else {
+ self.S('[' + this.attr_name() + ']', this.scope).each(function () {
+ self.assemble(self.S('li', this));
+ });
+ }
+ },
+
+ events : function (scope) {
+ var self = this,
+ S = self.S;
+
+ S(this.scope)
+ .off('.clearing')
+ .on('click.fndtn.clearing', 'ul[' + this.attr_name() + '] li',
+ function (e, current, target) {
+ var current = current || S(this),
+ target = target || current,
+ next = current.next('li'),
+ settings = current.closest('[' + self.attr_name() + ']').data(self.attr_name(true) + '-init'),
+ image = S(e.target);
+
+ e.preventDefault();
+
+ if (!settings) {
+ self.init();
+ settings = current.closest('[' + self.attr_name() + ']').data(self.attr_name(true) + '-init');
+ }
+
+ // if clearing is open and the current image is
+ // clicked, go to the next image in sequence
+ if (target.hasClass('visible') &&
+ current[0] === target[0] &&
+ next.length > 0 && self.is_open(current)) {
+ target = next;
+ image = S('img', target);
+ }
+
+ // set current and target to the clicked li if not otherwise defined.
+ self.open(image, current, target);
+ self.update_paddles(target);
+ })
+
+ .on('click.fndtn.clearing', '.clearing-main-next',
+ function (e) { self.nav(e, 'next') })
+ .on('click.fndtn.clearing', '.clearing-main-prev',
+ function (e) { self.nav(e, 'prev') })
+ .on('click.fndtn.clearing', this.settings.close_selectors,
+ function (e) { Foundation.libs.clearing.close(e, this) })
+ .on('keydown.fndtn.clearing',
+ function (e) { self.keydown(e) });
+
+ S(window).off('.clearing').on('resize.fndtn.clearing',
+ function () { self.resize() });
+
+ this.swipe_events(scope);
+ },
+
+ swipe_events : function (scope) {
+ var self = this,
+ S = self.S;
+
+ S(this.scope)
+ .on('touchstart.fndtn.clearing', '.visible-img', function(e) {
+ if (!e.touches) { e = e.originalEvent; }
+ var data = {
+ start_page_x: e.touches[0].pageX,
+ start_page_y: e.touches[0].pageY,
+ start_time: (new Date()).getTime(),
+ delta_x: 0,
+ is_scrolling: undefined
+ };
+
+ S(this).data('swipe-transition', data);
+ e.stopPropagation();
+ })
+ .on('touchmove.fndtn.clearing', '.visible-img', function(e) {
+ if (!e.touches) { e = e.originalEvent; }
+ // Ignore pinch/zoom events
+ if(e.touches.length > 1 || e.scale && e.scale !== 1) return;
+
+ var data = S(this).data('swipe-transition');
+
+ if (typeof data === 'undefined') {
+ data = {};
+ }
+
+ data.delta_x = e.touches[0].pageX - data.start_page_x;
+
+ if ( typeof data.is_scrolling === 'undefined') {
+ data.is_scrolling = !!( data.is_scrolling || Math.abs(data.delta_x) < Math.abs(e.touches[0].pageY - data.start_page_y) );
+ }
+
+ if (!data.is_scrolling && !data.active) {
+ e.preventDefault();
+ var direction = (data.delta_x < 0) ? 'next' : 'prev';
+ data.active = true;
+ self.nav(e, direction);
+ }
+ })
+ .on('touchend.fndtn.clearing', '.visible-img', function(e) {
+ S(this).data('swipe-transition', {});
+ e.stopPropagation();
+ });
+ },
+
+ assemble : function ($li) {
+ var $el = $li.parent();
+
+ if ($el.parent().hasClass('carousel')) return;
+ $el.after('<div id="foundationClearingHolder"></div>');
+
+ var holder = this.S('#foundationClearingHolder'),
+ settings = $el.data(this.attr_name(true) + '-init'),
+ grid = $el.detach(),
+ data = {
+ grid: '<div class="carousel">' + grid[0].outerHTML + '</div>',
+ viewing: settings.templates.viewing
+ },
+ wrapper = '<div class="clearing-assembled"><div>' + data.viewing +
+ data.grid + '</div></div>',
+ touch_label = this.settings.touch_label;
+
+ if (Modernizr.touch) {
+ wrapper = $(wrapper).find('.clearing-touch-label').html(touch_label).end();
+ }
+
+ holder.after(wrapper).remove();
+ },
+
+ open : function ($image, current, target) {
+ var self = this,
+ root = target.closest('.clearing-assembled'),
+ container = self.S('div', root).first(),
+ visible_image = self.S('.visible-img', container),
+ image = self.S('img', visible_image).not($image),
+ label = self.S('.clearing-touch-label', container);
+
+ if (!this.locked()) {
+ // set the image to the selected thumbnail
+ image
+ .attr('src', this.load($image))
+ .css('visibility', 'hidden');
+
+ this.image_loaded(image, function () {
+ image.css('visibility', 'visible');
+ // toggle the gallery
+ root.addClass('clearing-blackout');
+ container.addClass('clearing-container');
+ visible_image.show();
+ this.fix_height(target)
+ .caption(self.S('.clearing-caption', visible_image), $image)
+ .center_and_label(image,label)
+ .shift(current, target, function () {
+ target.siblings().removeClass('visible');
+ target.addClass('visible');
+ });
+ }.bind(this));
+ }
+ },
+
+ close : function (e, el) {
+ e.preventDefault();
+
+ var root = (function (target) {
+ if (/blackout/.test(target.selector)) {
+ return target;
+ } else {
+ return target.closest('.clearing-blackout');
+ }
+ }($(el))), container, visible_image;
+
+ if (el === e.target && root) {
+ container = $('div', root).first();
+ visible_image = $('.visible-img', container);
+ this.settings.prev_index = 0;
+ $('ul[' + this.attr_name() + ']', root)
+ .attr('style', '').closest('.clearing-blackout')
+ .removeClass('clearing-blackout');
+ container.removeClass('clearing-container');
+ visible_image.hide();
+ }
+
+ return false;
+ },
+
+ is_open : function (current) {
+ return current.parent().prop('style').length > 0;
+ },
+
+ keydown : function (e) {
+ var clearing = $('ul[' + this.attr_name() + ']', '.clearing-blackout'),
+ NEXT_KEY = this.rtl ? 37 : 39,
+ PREV_KEY = this.rtl ? 39 : 37,
+ ESC_KEY = 27;
+
+ if (e.which === NEXT_KEY) this.go(clearing, 'next');
+ if (e.which === PREV_KEY) this.go(clearing, 'prev');
+ if (e.which === ESC_KEY) this.S('a.clearing-close').trigger('click');
+ },
+
+ nav : function (e, direction) {
+ var clearing = $('ul[' + this.attr_name() + ']', '.clearing-blackout');
+
+ e.preventDefault();
+ this.go(clearing, direction);
+ },
+
+ resize : function () {
+ var image = $('img', '.clearing-blackout .visible-img'),
+ label = $('.clearing-touch-label', '.clearing-blackout');
+
+ if (image.length) {
+ this.center_and_label(image, label);
+ }
+ },
+
+ // visual adjustments
+ fix_height : function (target) {
+ var lis = target.parent().children(),
+ self = this;
+
+ lis.each(function () {
+ var li = self.S(this),
+ image = li.find('img');
+
+ if (li.height() > image.outerHeight()) {
+ li.addClass('fix-height');
+ }
+ })
+ .closest('ul')
+ .width(lis.length * 100 + '%');
+
+ return this;
+ },
+
+ update_paddles : function (target) {
+ var visible_image = target
+ .closest('.carousel')
+ .siblings('.visible-img');
+
+ if (target.next().length > 0) {
+ this.S('.clearing-main-next', visible_image)
+ .removeClass('disabled');
+ } else {
+ this.S('.clearing-main-next', visible_image)
+ .addClass('disabled');
+ }
+
+ if (target.prev().length > 0) {
+ this.S('.clearing-main-prev', visible_image)
+ .removeClass('disabled');
+ } else {
+ this.S('.clearing-main-prev', visible_image)
+ .addClass('disabled');
+ }
+ },
+
+ center_and_label : function (target, label) {
+ if (!this.rtl) {
+ target.css({
+ marginLeft : -(target.outerWidth() / 2),
+ marginTop : -(target.outerHeight() / 2)
+ });
+ label.css({
+ marginLeft : -(label.outerWidth() / 2),
+ marginTop : -(target.outerHeight() / 2)-label.outerHeight()-10
+ });
+ } else {
+ target.css({
+ marginRight : -(target.outerWidth() / 2),
+ marginTop : -(target.outerHeight() / 2),
+ left: 'auto',
+ right: '50%'
+ });
+ label.css({
+ marginRight : -(label.outerWidth() / 2),
+ marginTop : -(target.outerHeight() / 2)-label.outerHeight()-10,
+ left: 'auto',
+ right: '50%'
+ });
+ }
+ return this;
+ },
+
+ // image loading and preloading
+
+ load : function ($image) {
+ if ($image[0].nodeName === "A") {
+ var href = $image.attr('href');
+ } else {
+ var href = $image.parent().attr('href');
+ }
+
+ this.preload($image);
+
+ if (href) return href;
+ return $image.attr('src');
+ },
+
+ preload : function ($image) {
+ this
+ .img($image.closest('li').next())
+ .img($image.closest('li').prev());
+ },
+
+ img : function (img) {
+ if (img.length) {
+ var new_img = new Image(),
+ new_a = this.S('a', img);
+
+ if (new_a.length) {
+ new_img.src = new_a.attr('href');
+ } else {
+ new_img.src = this.S('img', img).attr('src');
+ }
+ }
+ return this;
+ },
+
+ // image caption
+
+ caption : function (container, $image) {
+ var caption = $image.data('caption');
+
+ if (caption) {
+ container
+ .html(caption)
+ .show();
+ } else {
+ container
+ .text('')
+ .hide();
+ }
+ return this;
+ },
+
+ // directional methods
+
+ go : function ($ul, direction) {
+ var current = this.S('.visible', $ul),
+ target = current[direction]();
+
+ if (target.length) {
+ this.S('img', target)
+ .trigger('click', [current, target]);
+ }
+ },
+
+ shift : function (current, target, callback) {
+ var clearing = target.parent(),
+ old_index = this.settings.prev_index || target.index(),
+ direction = this.direction(clearing, current, target),
+ dir = this.rtl ? 'right' : 'left',
+ left = parseInt(clearing.css('left'), 10),
+ width = target.outerWidth(),
+ skip_shift;
+
+ var dir_obj = {};
+
+ // we use jQuery animate instead of CSS transitions because we
+ // need a callback to unlock the next animation
+ // needs support for RTL **
+ if (target.index() !== old_index && !/skip/.test(direction)){
+ if (/left/.test(direction)) {
+ this.lock();
+ dir_obj[dir] = left + width;
+ clearing.animate(dir_obj, 300, this.unlock());
+ } else if (/right/.test(direction)) {
+ this.lock();
+ dir_obj[dir] = left - width;
+ clearing.animate(dir_obj, 300, this.unlock());
+ }
+ } else if (/skip/.test(direction)) {
+ // the target image is not adjacent to the current image, so
+ // do we scroll right or not
+ skip_shift = target.index() - this.settings.up_count;
+ this.lock();
+
+ if (skip_shift > 0) {
+ dir_obj[dir] = -(skip_shift * width);
+ clearing.animate(dir_obj, 300, this.unlock());
+ } else {
+ dir_obj[dir] = 0;
+ clearing.animate(dir_obj, 300, this.unlock());
+ }
+ }
+
+ callback();
+ },
+
+ direction : function ($el, current, target) {
+ var lis = this.S('li', $el),
+ li_width = lis.outerWidth() + (lis.outerWidth() / 4),
+ up_count = Math.floor(this.S('.clearing-container').outerWidth() / li_width) - 1,
+ target_index = lis.index(target),
+ response;
+
+ this.settings.up_count = up_count;
+
+ if (this.adjacent(this.settings.prev_index, target_index)) {
+ if ((target_index > up_count)
+ && target_index > this.settings.prev_index) {
+ response = 'right';
+ } else if ((target_index > up_count - 1)
+ && target_index <= this.settings.prev_index) {
+ response = 'left';
+ } else {
+ response = false;
+ }
+ } else {
+ response = 'skip';
+ }
+
+ this.settings.prev_index = target_index;
+
+ return response;
+ },
+
+ adjacent : function (current_index, target_index) {
+ for (var i = target_index + 1; i >= target_index - 1; i--) {
+ if (i === current_index) return true;
+ }
+ return false;
+ },
+
+ // lock management
+
+ lock : function () {
+ this.settings.locked = true;
+ },
+
+ unlock : function () {
+ this.settings.locked = false;
+ },
+
+ locked : function () {
+ return this.settings.locked;
+ },
+
+ off : function () {
+ this.S(this.scope).off('.fndtn.clearing');
+ this.S(window).off('.fndtn.clearing');
+ },
+
+ reflow : function () {
+ this.init();
+ }
+ };
+
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.dropdown = {
+ name : 'dropdown',
+
+ version : '5.1.1',
+
+ settings : {
+ active_class: 'open',
+ is_hover: false,
+ opened: function(){},
+ closed: function(){}
+ },
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'throttle');
+
+ this.bindings(method, options);
+ },
+
+ events : function (scope) {
+ var self = this,
+ S = self.S;
+
+ S(this.scope)
+ .off('.dropdown')
+ .on('click.fndtn.dropdown', '[' + this.attr_name() + ']', function (e) {
+ var settings = S(this).data(self.attr_name(true) + '-init') || self.settings;
+ e.preventDefault();
+ if (!settings.is_hover || Modernizr.touch) self.toggle(S(this));
+ })
+ .on('mouseenter.fndtn.dropdown', '[' + this.attr_name() + '], [' + this.attr_name() + '-content]', function (e) {
+ var $this = S(this);
+ clearTimeout(self.timeout);
+
+ if ($this.data(self.data_attr())) {
+ var dropdown = S('#' + $this.data(self.data_attr())),
+ target = $this;
+ } else {
+ var dropdown = $this;
+ target = S("[" + self.attr_name() + "='" + dropdown.attr('id') + "']");
+ }
+
+ var settings = target.data(self.attr_name(true) + '-init') || self.settings;
+
+ if(S(e.target).data(self.data_attr()) && settings.is_hover) {
+ self.closeall.call(self);
+ }
+
+ if (settings.is_hover) self.open.apply(self, [dropdown, target]);
+ })
+ .on('mouseleave.fndtn.dropdown', '[' + this.attr_name() + '], [' + this.attr_name() + '-content]', function (e) {
+ var $this = S(this);
+ self.timeout = setTimeout(function () {
+ if ($this.data(self.data_attr())) {
+ var settings = $this.data(self.data_attr(true) + '-init') || self.settings;
+ if (settings.is_hover) self.close.call(self, S('#' + $this.data(self.data_attr())));
+ } else {
+ var target = S('[' + self.attr_name() + '="' + S(this).attr('id') + '"]'),
+ settings = target.data(self.attr_name(true) + '-init') || self.settings;
+ if (settings.is_hover) self.close.call(self, $this);
+ }
+ }.bind(this), 150);
+ })
+ .on('click.fndtn.dropdown', function (e) {
+ var parent = S(e.target).closest('[' + self.attr_name() + '-content]');
+
+ if (S(e.target).data(self.data_attr()) || S(e.target).parent().data(self.data_attr())) {
+ return;
+ }
+ if (!(S(e.target).data('revealId')) &&
+ (parent.length > 0 && (S(e.target).is('[' + self.attr_name() + '-content]') ||
+ $.contains(parent.first()[0], e.target)))) {
+ e.stopPropagation();
+ return;
+ }
+
+ self.close.call(self, S('[' + self.attr_name() + '-content]'));
+ })
+ .on('opened.fndtn.dropdown', '[' + self.attr_name() + '-content]', function () {
+ self.settings.opened.call(this);
+ })
+ .on('closed.fndtn.dropdown', '[' + self.attr_name() + '-content]', function () {
+ self.settings.closed.call(this);
+ });
+
+ S(window)
+ .off('.dropdown')
+ .on('resize.fndtn.dropdown', self.throttle(function () {
+ self.resize.call(self);
+ }, 50)).trigger('resize');
+ },
+
+ close: function (dropdown) {
+ var self = this;
+ dropdown.each(function () {
+ if (self.S(this).hasClass(self.settings.active_class)) {
+ self.S(this)
+ .css(Foundation.rtl ? 'right':'left', '-99999px')
+ .removeClass(self.settings.active_class);
+ self.S(this).trigger('closed');
+ }
+ });
+ },
+
+ closeall: function() {
+ var self = this;
+ $.each(self.S('[' + this.attr_name() + '-content]'), function() {
+ self.close.call(self, self.S(this))
+ });
+ },
+
+ open: function (dropdown, target) {
+ this
+ .css(dropdown
+ .addClass(this.settings.active_class), target);
+ dropdown.trigger('opened');
+ },
+
+ data_attr: function () {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + this.name;
+ }
+
+ return this.name;
+ },
+
+ toggle : function (target) {
+ var dropdown = this.S('#' + target.data(this.data_attr()));
+ if (dropdown.length === 0) {
+ // No dropdown found, not continuing
+ return;
+ }
+
+ this.close.call(this, this.S('[' + this.attr_name() + '-content]').not(dropdown));
+
+ if (dropdown.hasClass(this.settings.active_class)) {
+ this.close.call(this, dropdown);
+ } else {
+ this.close.call(this, this.S('[' + this.attr_name() + '-content]'))
+ this.open.call(this, dropdown, target);
+ }
+ },
+
+ resize : function () {
+ var dropdown = this.S('[' + this.attr_name() + '-content].open'),
+ target = this.S("[" + this.attr_name() + "='" + dropdown.attr('id') + "']");
+
+ if (dropdown.length && target.length) {
+ this.css(dropdown, target);
+ }
+ },
+
+ css : function (dropdown, target) {
+ var offset_parent = dropdown.offsetParent(),
+ position = target.offset();
+
+ position.top -= offset_parent.offset().top;
+ position.left -= offset_parent.offset().left;
+
+ if (this.small()) {
+ dropdown.css({
+ position : 'absolute',
+ width: '95%',
+ 'max-width': 'none',
+ top: position.top + target.outerHeight()
+ });
+ dropdown.css(Foundation.rtl ? 'right':'left', '2.5%');
+ } else {
+ if (!Foundation.rtl && this.S(window).width() > dropdown.outerWidth() + target.offset().left) {
+ var left = position.left;
+ if (dropdown.hasClass('right')) {
+ dropdown.removeClass('right');
+ }
+ } else {
+ if (!dropdown.hasClass('right')) {
+ dropdown.addClass('right');
+ }
+ var left = position.left - (dropdown.outerWidth() - target.outerWidth());
+ }
+
+ dropdown.attr('style', '').css({
+ position : 'absolute',
+ top: position.top + target.outerHeight(),
+ left: left
+ });
+ }
+
+ return dropdown;
+ },
+
+ small : function () {
+ return matchMedia(Foundation.media_queries.small).matches &&
+ !matchMedia(Foundation.media_queries.medium).matches;
+ },
+
+ off: function () {
+ this.S(this.scope).off('.fndtn.dropdown');
+ this.S('html, body').off('.fndtn.dropdown');
+ this.S(window).off('.fndtn.dropdown');
+ this.S('[data-dropdown-content]').off('.fndtn.dropdown');
+ this.settings.init = false;
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.equalizer = {
+ name : 'equalizer',
+
+ version : '5.1.1',
+
+ settings : {
+ use_tallest: true,
+ before_height_change: $.noop,
+ after_height_change: $.noop
+ },
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ this.reflow();
+ },
+
+ events : function () {
+ this.S(window).off('.equalizer').on('resize.fndtn.equalizer', function(e){
+ this.reflow();
+ }.bind(this));
+ },
+
+ equalize: function(equalizer) {
+ var isStacked = false,
+ vals = equalizer.find('[' + this.attr_name() + '-watch]'),
+ firstTopOffset = vals.first().offset().top,
+ settings = equalizer.data(this.attr_name(true)+'-init');
+
+ if (vals.length === 0) return;
+ settings.before_height_change();
+ equalizer.trigger('before-height-change');
+ vals.height('inherit');
+ vals.each(function(){
+ var el = $(this);
+ if (el.offset().top !== firstTopOffset) {
+ isStacked = true;
+ }
+ });
+ if (isStacked) return;
+
+ var heights = vals.map(function(){ return $(this).outerHeight() });
+ if (settings.use_tallest) {
+ var max = Math.max.apply(null, heights);
+ vals.height(max);
+ } else {
+ var min = Math.min.apply(null, heights);
+ vals.height(min);
+ }
+ settings.after_height_change();
+ equalizer.trigger('after-height-change');
+ },
+
+ reflow : function () {
+ var self = this;
+
+ this.S('[' + this.attr_name() + ']', this.scope).each(function(){
+ self.equalize($(this));
+ });
+ }
+ };
+}(jQuery, this, this.document));
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.interchange = {
+ name : 'interchange',
+
+ version : '5.1.1',
+
+ cache : {},
+
+ images_loaded : false,
+ nodes_loaded : false,
+
+ settings : {
+ load_attr : 'interchange',
+
+ named_queries : {
+ 'default' : 'only screen',
+ small : Foundation.media_queries.small,
+ medium : Foundation.media_queries.medium,
+ large : Foundation.media_queries.large,
+ xlarge : Foundation.media_queries.xlarge,
+ xxlarge: Foundation.media_queries.xxlarge,
+ landscape : 'only screen and (orientation: landscape)',
+ portrait : 'only screen and (orientation: portrait)',
+ retina : 'only screen and (-webkit-min-device-pixel-ratio: 2),' +
+ 'only screen and (min--moz-device-pixel-ratio: 2),' +
+ 'only screen and (-o-min-device-pixel-ratio: 2/1),' +
+ 'only screen and (min-device-pixel-ratio: 2),' +
+ 'only screen and (min-resolution: 192dpi),' +
+ 'only screen and (min-resolution: 2dppx)'
+ },
+
+ directives : {
+ replace: function (el, path, trigger) {
+ // The trigger argument, if called within the directive, fires
+ // an event named after the directive on the element, passing
+ // any parameters along to the event that you pass to trigger.
+ //
+ // ex. trigger(), trigger([a, b, c]), or trigger(a, b, c)
+ //
+ // This allows you to bind a callback like so:
+ // $('#interchangeContainer').on('replace', function (e, a, b, c) {
+ // console.log($(this).html(), a, b, c);
+ // });
+
+ if (/IMG/.test(el[0].nodeName)) {
+ var orig_path = el[0].src;
+
+ if (new RegExp(path, 'i').test(orig_path)) return;
+
+ el[0].src = path;
+
+ return trigger(el[0].src);
+ }
+ var last_path = el.data(this.data_attr + '-last-path');
+
+ if (last_path == path) return;
+
+ return $.get(path, function (response) {
+ el.html(response);
+ el.data(this.data_attr + '-last-path', path);
+ trigger();
+ });
+
+ }
+ }
+ },
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'throttle random_str');
+
+ this.data_attr = this.set_data_attr();
+ $.extend(true, this.settings, method, options);
+
+ this.bindings(method, options);
+ this.load('images');
+ this.load('nodes');
+ },
+
+ events : function () {
+ var self = this;
+
+ $(window)
+ .off('.interchange')
+ .on('resize.fndtn.interchange', self.throttle(function () {
+ self.resize();
+ }, 50));
+
+ return this;
+ },
+
+ resize : function () {
+ var cache = this.cache;
+
+ if(!this.images_loaded || !this.nodes_loaded) {
+ setTimeout($.proxy(this.resize, this), 50);
+ return;
+ }
+
+ for (var uuid in cache) {
+ if (cache.hasOwnProperty(uuid)) {
+ var passed = this.results(uuid, cache[uuid]);
+
+ if (passed) {
+ this.settings.directives[passed
+ .scenario[1]].call(this, passed.el, passed.scenario[0], function () {
+ if (arguments[0] instanceof Array) {
+ var args = arguments[0];
+ } else {
+ var args = Array.prototype.slice.call(arguments, 0);
+ }
+
+ passed.el.trigger(passed.scenario[1], args);
+ });
+ }
+ }
+ }
+
+ },
+
+ results : function (uuid, scenarios) {
+ var count = scenarios.length;
+
+ if (count > 0) {
+ var el = this.S('[' + this.add_namespace('data-uuid') + '="' + uuid + '"]');
+
+ while (count--) {
+ var mq, rule = scenarios[count][2];
+ if (this.settings.named_queries.hasOwnProperty(rule)) {
+ mq = matchMedia(this.settings.named_queries[rule]);
+ } else {
+ mq = matchMedia(rule);
+ }
+ if (mq.matches) {
+ return {el: el, scenario: scenarios[count]};
+ }
+ }
+ }
+
+ return false;
+ },
+
+ load : function (type, force_update) {
+ if (typeof this['cached_' + type] === 'undefined' || force_update) {
+ this['update_' + type]();
+ }
+
+ return this['cached_' + type];
+ },
+
+ update_images : function () {
+ var images = this.S('img[' + this.data_attr + ']'),
+ count = images.length,
+ i = count,
+ loaded_count = 0,
+ data_attr = this.data_attr;
+
+ this.cache = {};
+ this.cached_images = [];
+ this.images_loaded = (count === 0);
+
+ while (i--) {
+ loaded_count++;
+ if (images[i]) {
+ var str = images[i].getAttribute(data_attr) || '';
+
+ if (str.length > 0) {
+ this.cached_images.push(images[i]);
+ }
+ }
+
+ if (loaded_count === count) {
+ this.images_loaded = true;
+ this.enhance('images');
+ }
+ }
+
+ return this;
+ },
+
+ update_nodes : function () {
+ var nodes = this.S('[' + this.data_attr + ']').not('img'),
+ count = nodes.length,
+ i = count,
+ loaded_count = 0,
+ data_attr = this.data_attr;
+
+ this.cached_nodes = [];
+ // Set nodes_loaded to true if there are no nodes
+ // this.nodes_loaded = false;
+ this.nodes_loaded = (count === 0);
+
+
+ while (i--) {
+ loaded_count++;
+ var str = nodes[i].getAttribute(data_attr) || '';
+
+ if (str.length > 0) {
+ this.cached_nodes.push(nodes[i]);
+ }
+
+ if(loaded_count === count) {
+ this.nodes_loaded = true;
+ this.enhance('nodes');
+ }
+ }
+
+ return this;
+ },
+
+ enhance : function (type) {
+ var i = this['cached_' + type].length;
+
+ while (i--) {
+ this.object($(this['cached_' + type][i]));
+ }
+
+ return $(window).trigger('resize');
+ },
+
+ parse_params : function (path, directive, mq) {
+ return [this.trim(path), this.convert_directive(directive), this.trim(mq)];
+ },
+
+ convert_directive : function (directive) {
+ var trimmed = this.trim(directive);
+
+ if (trimmed.length > 0) {
+ return trimmed;
+ }
+
+ return 'replace';
+ },
+
+ object : function(el) {
+ var raw_arr = this.parse_data_attr(el),
+ scenarios = [],
+ i = raw_arr.length;
+
+ if (i > 0) {
+ while (i--) {
+ var split = raw_arr[i].split(/\((.*?)(\))$/);
+
+ if (split.length > 1) {
+ var cached_split = split[0].split(','),
+ params = this.parse_params(cached_split[0],
+ cached_split[1], split[1]);
+
+ scenarios.push(params);
+ }
+ }
+ }
+
+ return this.store(el, scenarios);
+ },
+
+ uuid : function (separator) {
+ var delim = separator || "-",
+ self = this;
+
+ function S4() {
+ return self.random_str(6);
+ }
+
+ return (S4() + S4() + delim + S4() + delim + S4()
+ + delim + S4() + delim + S4() + S4() + S4());
+ },
+
+ store : function (el, scenarios) {
+ var uuid = this.uuid(),
+ current_uuid = el.data(this.add_namespace('uuid', true));
+
+ if (this.cache[current_uuid]) return this.cache[current_uuid];
+
+ el.attr(this.add_namespace('data-uuid'), uuid);
+
+ return this.cache[uuid] = scenarios;
+ },
+
+ trim : function(str) {
+ if (typeof str === 'string') {
+ return $.trim(str);
+ }
+
+ return str;
+ },
+
+ set_data_attr: function (init) {
+ if (init) {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + this.settings.load_attr;
+ }
+
+ return this.settings.load_attr;
+ }
+
+ if (this.namespace.length > 0) {
+ return 'data-' + this.namespace + '-' + this.settings.load_attr;
+ }
+
+ return 'data-' + this.settings.load_attr;
+ },
+
+ parse_data_attr : function (el) {
+ var raw = el.attr(this.attr_name()).split(/\[(.*?)\]/),
+ i = raw.length,
+ output = [];
+
+ while (i--) {
+ if (raw[i].replace(/[\W\d]+/, '').length > 4) {
+ output.push(raw[i]);
+ }
+ }
+
+ return output;
+ },
+
+ reflow : function () {
+ this.load('images', true);
+ this.load('nodes', true);
+ }
+
+ };
+
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ var Modernizr = Modernizr || false;
+
+ Foundation.libs.joyride = {
+ name : 'joyride',
+
+ version : '5.1.1',
+
+ defaults : {
+ expose : false, // turn on or off the expose feature
+ modal : true, // Whether to cover page with modal during the tour
+ tip_location : 'bottom', // 'top' or 'bottom' in relation to parent
+ nub_position : 'auto', // override on a per tooltip bases
+ scroll_speed : 1500, // Page scrolling speed in milliseconds, 0 = no scroll animation
+ scroll_animation : 'linear', // supports 'swing' and 'linear', extend with jQuery UI.
+ timer : 0, // 0 = no timer , all other numbers = timer in milliseconds
+ start_timer_on_click : true, // true or false - true requires clicking the first button start the timer
+ start_offset : 0, // the index of the tooltip you want to start on (index of the li)
+ next_button : true, // true or false to control whether a next button is used
+ tip_animation : 'fade', // 'pop' or 'fade' in each tip
+ pause_after : [], // array of indexes where to pause the tour after
+ exposed : [], // array of expose elements
+ tip_animation_fade_speed : 300, // when tipAnimation = 'fade' this is speed in milliseconds for the transition
+ cookie_monster : false, // true or false to control whether cookies are used
+ cookie_name : 'joyride', // Name the cookie you'll use
+ cookie_domain : false, // Will this cookie be attached to a domain, ie. '.notableapp.com'
+ cookie_expires : 365, // set when you would like the cookie to expire.
+ tip_container : 'body', // Where will the tip be attached
+ tip_location_patterns : {
+ top: ['bottom'],
+ bottom: [], // bottom should not need to be repositioned
+ left: ['right', 'top', 'bottom'],
+ right: ['left', 'top', 'bottom']
+ },
+ post_ride_callback : function (){}, // A method to call once the tour closes (canceled or complete)
+ post_step_callback : function (){}, // A method to call after each step
+ pre_step_callback : function (){}, // A method to call before each step
+ pre_ride_callback : function (){}, // A method to call before the tour starts (passed index, tip, and cloned exposed element)
+ post_expose_callback : function (){}, // A method to call after an element has been exposed
+ template : { // HTML segments for tip layout
+ link : '<a href="#close" class="joyride-close-tip">×</a>',
+ timer : '<div class="joyride-timer-indicator-wrap"><span class="joyride-timer-indicator"></span></div>',
+ tip : '<div class="joyride-tip-guide"><span class="joyride-nub"></span></div>',
+ wrapper : '<div class="joyride-content-wrapper"></div>',
+ button : '<a href="#" class="small button joyride-next-tip"></a>',
+ modal : '<div class="joyride-modal-bg"></div>',
+ expose : '<div class="joyride-expose-wrapper"></div>',
+ expose_cover: '<div class="joyride-expose-cover"></div>'
+ },
+ expose_add_class : '' // One or more space-separated class names to be added to exposed element
+ },
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'throttle random_str');
+
+ this.settings = this.defaults;
+
+ this.bindings(method, options)
+ },
+
+ events : function () {
+ var self = this;
+
+ $(this.scope)
+ .off('.joyride')
+ .on('click.fndtn.joyride', '.joyride-next-tip, .joyride-modal-bg', function (e) {
+ e.preventDefault();
+
+ if (this.settings.$li.next().length < 1) {
+ this.end();
+ } else if (this.settings.timer > 0) {
+ clearTimeout(this.settings.automate);
+ this.hide();
+ this.show();
+ this.startTimer();
+ } else {
+ this.hide();
+ this.show();
+ }
+
+ }.bind(this))
+
+ .on('click.fndtn.joyride', '.joyride-close-tip', function (e) {
+ e.preventDefault();
+ this.end();
+ }.bind(this));
+
+ $(window)
+ .off('.joyride')
+ .on('resize.fndtn.joyride', self.throttle(function () {
+ if ($('[' + self.attr_name() + ']').length > 0 && self.settings.$next_tip) {
+ if (self.settings.exposed.length > 0) {
+ var $els = $(self.settings.exposed);
+
+ $els.each(function () {
+ var $this = $(this);
+ self.un_expose($this);
+ self.expose($this);
+ });
+ }
+
+ if (self.is_phone()) {
+ self.pos_phone();
+ } else {
+ self.pos_default(false, true);
+ }
+ }
+ }, 100));
+ },
+
+ start : function () {
+ var self = this,
+ $this = $('[' + this.attr_name() + ']', this.scope),
+ integer_settings = ['timer', 'scrollSpeed', 'startOffset', 'tipAnimationFadeSpeed', 'cookieExpires'],
+ int_settings_count = integer_settings.length;
+
+ if (!$this.length > 0) return;
+
+ if (!this.settings.init) this.events();
+
+ this.settings = $this.data(this.attr_name(true) + '-init');
+
+ // non configureable settings
+ this.settings.$content_el = $this;
+ this.settings.$body = $(this.settings.tip_container);
+ this.settings.body_offset = $(this.settings.tip_container).position();
+ this.settings.$tip_content = this.settings.$content_el.find('> li');
+ this.settings.paused = false;
+ this.settings.attempts = 0;
+
+ // can we create cookies?
+ if (typeof $.cookie !== 'function') {
+ this.settings.cookie_monster = false;
+ }
+
+ // generate the tips and insert into dom.
+ if (!this.settings.cookie_monster || this.settings.cookie_monster && !$.cookie(this.settings.cookie_name)) {
+ this.settings.$tip_content.each(function (index) {
+ var $this = $(this);
+ this.settings = $.extend({}, self.defaults, self.data_options($this))
+
+ // Make sure that settings parsed from data_options are integers where necessary
+ var i = int_settings_count;
+ while (i--) {
+ self.settings[integer_settings[i]] = parseInt(self.settings[integer_settings[i]], 10);
+ }
+ self.create({$li : $this, index : index});
+ });
+
+ // show first tip
+ if (!this.settings.start_timer_on_click && this.settings.timer > 0) {
+ this.show('init');
+ this.startTimer();
+ } else {
+ this.show('init');
+ }
+
+ }
+ },
+
+ resume : function () {
+ this.set_li();
+ this.show();
+ },
+
+ tip_template : function (opts) {
+ var $blank, content;
+
+ opts.tip_class = opts.tip_class || '';
+
+ $blank = $(this.settings.template.tip).addClass(opts.tip_class);
+ content = $.trim($(opts.li).html()) +
+ this.button_text(opts.button_text) +
+ this.settings.template.link +
+ this.timer_instance(opts.index);
+
+ $blank.append($(this.settings.template.wrapper));
+ $blank.first().attr(this.add_namespace('data-index'), opts.index);
+ $('.joyride-content-wrapper', $blank).append(content);
+
+ return $blank[0];
+ },
+
+ timer_instance : function (index) {
+ var txt;
+
+ if ((index === 0 && this.settings.start_timer_on_click && this.settings.timer > 0) || this.settings.timer === 0) {
+ txt = '';
+ } else {
+ txt = $(this.settings.template.timer)[0].outerHTML;
+ }
+ return txt;
+ },
+
+ button_text : function (txt) {
+ if (this.settings.next_button) {
+ txt = $.trim(txt) || 'Next';
+ txt = $(this.settings.template.button).append(txt)[0].outerHTML;
+ } else {
+ txt = '';
+ }
+ return txt;
+ },
+
+ create : function (opts) {
+ console.log(opts.$li)
+ var buttonText = opts.$li.attr(this.add_namespace('data-button'))
+ || opts.$li.attr(this.add_namespace('data-text')),
+ tipClass = opts.$li.attr('class'),
+ $tip_content = $(this.tip_template({
+ tip_class : tipClass,
+ index : opts.index,
+ button_text : buttonText,
+ li : opts.$li
+ }));
+
+ $(this.settings.tip_container).append($tip_content);
+ },
+
+ show : function (init) {
+ var $timer = null;
+
+ // are we paused?
+ if (this.settings.$li === undefined
+ || ($.inArray(this.settings.$li.index(), this.settings.pause_after) === -1)) {
+
+ // don't go to the next li if the tour was paused
+ if (this.settings.paused) {
+ this.settings.paused = false;
+ } else {
+ this.set_li(init);
+ }
+
+ this.settings.attempts = 0;
+
+ if (this.settings.$li.length && this.settings.$target.length > 0) {
+ if (init) { //run when we first start
+ this.settings.pre_ride_callback(this.settings.$li.index(), this.settings.$next_tip);
+ if (this.settings.modal) {
+ this.show_modal();
+ }
+ }
+
+ this.settings.pre_step_callback(this.settings.$li.index(), this.settings.$next_tip);
+
+ if (this.settings.modal && this.settings.expose) {
+ this.expose();
+ }
+
+ this.settings.tip_settings = $.extend({}, this.settings, this.data_options(this.settings.$li));
+
+ this.settings.timer = parseInt(this.settings.timer, 10);
+
+ this.settings.tip_settings.tip_location_pattern = this.settings.tip_location_patterns[this.settings.tip_settings.tip_location];
+
+ // scroll if not modal
+ if (!/body/i.test(this.settings.$target.selector)) {
+ this.scroll_to();
+ }
+
+ if (this.is_phone()) {
+ this.pos_phone(true);
+ } else {
+ this.pos_default(true);
+ }
+
+ $timer = this.settings.$next_tip.find('.joyride-timer-indicator');
+
+ if (/pop/i.test(this.settings.tip_animation)) {
+
+ $timer.width(0);
+
+ if (this.settings.timer > 0) {
+
+ this.settings.$next_tip.show();
+
+ setTimeout(function () {
+ $timer.animate({
+ width: $timer.parent().width()
+ }, this.settings.timer, 'linear');
+ }.bind(this), this.settings.tip_animation_fade_speed);
+
+ } else {
+ this.settings.$next_tip.show();
+
+ }
+
+
+ } else if (/fade/i.test(this.settings.tip_animation)) {
+
+ $timer.width(0);
+
+ if (this.settings.timer > 0) {
+
+ this.settings.$next_tip
+ .fadeIn(this.settings.tip_animation_fade_speed)
+ .show();
+
+ setTimeout(function () {
+ $timer.animate({
+ width: $timer.parent().width()
+ }, this.settings.timer, 'linear');
+ }.bind(this), this.settings.tip_animation_fadeSpeed);
+
+ } else {
+ this.settings.$next_tip.fadeIn(this.settings.tip_animation_fade_speed);
+ }
+ }
+
+ this.settings.$current_tip = this.settings.$next_tip;
+
+ // skip non-existant targets
+ } else if (this.settings.$li && this.settings.$target.length < 1) {
+
+ this.show();
+
+ } else {
+
+ this.end();
+
+ }
+ } else {
+
+ this.settings.paused = true;
+
+ }
+
+ },
+
+ is_phone : function () {
+ return matchMedia(Foundation.media_queries.small).matches &&
+ !matchMedia(Foundation.media_queries.medium).matches;
+ },
+
+ hide : function () {
+ if (this.settings.modal && this.settings.expose) {
+ this.un_expose();
+ }
+
+ if (!this.settings.modal) {
+ $('.joyride-modal-bg').hide();
+ }
+
+ // Prevent scroll bouncing...wait to remove from layout
+ this.settings.$current_tip.css('visibility', 'hidden');
+ setTimeout($.proxy(function() {
+ this.hide();
+ this.css('visibility', 'visible');
+ }, this.settings.$current_tip), 0);
+ this.settings.post_step_callback(this.settings.$li.index(),
+ this.settings.$current_tip);
+ },
+
+ set_li : function (init) {
+ if (init) {
+ this.settings.$li = this.settings.$tip_content.eq(this.settings.start_offset);
+ this.set_next_tip();
+ this.settings.$current_tip = this.settings.$next_tip;
+ } else {
+ this.settings.$li = this.settings.$li.next();
+ this.set_next_tip();
+ }
+
+ this.set_target();
+ },
+
+ set_next_tip : function () {
+ this.settings.$next_tip = $(".joyride-tip-guide").eq(this.settings.$li.index());
+ this.settings.$next_tip.data('closed', '');
+ },
+
+ set_target : function () {
+ console.log(this.add_namespace('data-class'))
+ var cl = this.settings.$li.attr(this.add_namespace('data-class')),
+ id = this.settings.$li.attr(this.add_namespace('data-id')),
+ $sel = function () {
+ if (id) {
+ return $(document.getElementById(id));
+ } else if (cl) {
+ return $('.' + cl).first();
+ } else {
+ return $('body');
+ }
+ };
+
+ console.log(cl, id)
+
+ this.settings.$target = $sel();
+ },
+
+ scroll_to : function () {
+ var window_half, tipOffset;
+
+ window_half = $(window).height() / 2;
+ tipOffset = Math.ceil(this.settings.$target.offset().top - window_half + this.settings.$next_tip.outerHeight());
+
+ if (tipOffset != 0) {
+ $('html, body').animate({
+ scrollTop: tipOffset
+ }, this.settings.scroll_speed, 'swing');
+ }
+ },
+
+ paused : function () {
+ return ($.inArray((this.settings.$li.index() + 1), this.settings.pause_after) === -1);
+ },
+
+ restart : function () {
+ this.hide();
+ this.settings.$li = undefined;
+ this.show('init');
+ },
+
+ pos_default : function (init, resizing) {
+ var half_fold = Math.ceil($(window).height() / 2),
+ tip_position = this.settings.$next_tip.offset(),
+ $nub = this.settings.$next_tip.find('.joyride-nub'),
+ nub_width = Math.ceil($nub.outerWidth() / 2),
+ nub_height = Math.ceil($nub.outerHeight() / 2),
+ toggle = init || false;
+
+ // tip must not be "display: none" to calculate position
+ if (toggle) {
+ this.settings.$next_tip.css('visibility', 'hidden');
+ this.settings.$next_tip.show();
+ }
+
+ if (typeof resizing === 'undefined') {
+ resizing = false;
+ }
+
+ if (!/body/i.test(this.settings.$target.selector)) {
+ if (this.bottom()) {
+ if (this.rtl) {
+ this.settings.$next_tip.css({
+ top: (this.settings.$target.offset().top + nub_height + this.settings.$target.outerHeight()),
+ left: this.settings.$target.offset().left + this.settings.$target.outerWidth() - this.settings.$next_tip.outerWidth()});
+ } else {
+ this.settings.$next_tip.css({
+ top: (this.settings.$target.offset().top + nub_height + this.settings.$target.outerHeight()),
+ left: this.settings.$target.offset().left});
+ }
+
+ this.nub_position($nub, this.settings.tip_settings.nub_position, 'top');
+
+ } else if (this.top()) {
+ if (this.rtl) {
+ this.settings.$next_tip.css({
+ top: (this.settings.$target.offset().top - this.settings.$next_tip.outerHeight() - nub_height),
+ left: this.settings.$target.offset().left + this.settings.$target.outerWidth() - this.settings.$next_tip.outerWidth()});
+ } else {
+ this.settings.$next_tip.css({
+ top: (this.settings.$target.offset().top - this.settings.$next_tip.outerHeight() - nub_height),
+ left: this.settings.$target.offset().left});
+ }
+
+ this.nub_position($nub, this.settings.tip_settings.nub_position, 'bottom');
+
+ } else if (this.right()) {
+
+ this.settings.$next_tip.css({
+ top: this.settings.$target.offset().top,
+ left: (this.outerWidth(this.settings.$target) + this.settings.$target.offset().left + nub_width)});
+
+ this.nub_position($nub, this.settings.tip_settings.nub_position, 'left');
+
+ } else if (this.left()) {
+
+ this.settings.$next_tip.css({
+ top: this.settings.$target.offset().top,
+ left: (this.settings.$target.offset().left - this.outerWidth(this.settings.$next_tip) - nub_width)});
+
+ this.nub_position($nub, this.settings.tip_settings.nub_position, 'right');
+
+ }
+
+ if (!this.visible(this.corners(this.settings.$next_tip)) && this.settings.attempts < this.settings.tip_settings.tip_location_pattern.length) {
+
+ $nub.removeClass('bottom')
+ .removeClass('top')
+ .removeClass('right')
+ .removeClass('left');
+
+ this.settings.tip_settings.tip_location = this.settings.tip_settings.tip_location_pattern[this.settings.attempts];
+
+ this.settings.attempts++;
+
+ this.pos_default();
+
+ }
+
+ } else if (this.settings.$li.length) {
+
+ this.pos_modal($nub);
+
+ }
+
+ if (toggle) {
+ this.settings.$next_tip.hide();
+ this.settings.$next_tip.css('visibility', 'visible');
+ }
+
+ },
+
+ pos_phone : function (init) {
+ var tip_height = this.settings.$next_tip.outerHeight(),
+ tip_offset = this.settings.$next_tip.offset(),
+ target_height = this.settings.$target.outerHeight(),
+ $nub = $('.joyride-nub', this.settings.$next_tip),
+ nub_height = Math.ceil($nub.outerHeight() / 2),
+ toggle = init || false;
+
+ $nub.removeClass('bottom')
+ .removeClass('top')
+ .removeClass('right')
+ .removeClass('left');
+
+ if (toggle) {
+ this.settings.$next_tip.css('visibility', 'hidden');
+ this.settings.$next_tip.show();
+ }
+
+ if (!/body/i.test(this.settings.$target.selector)) {
+
+ if (this.top()) {
+
+ this.settings.$next_tip.offset({top: this.settings.$target.offset().top - tip_height - nub_height});
+ $nub.addClass('bottom');
+
+ } else {
+
+ this.settings.$next_tip.offset({top: this.settings.$target.offset().top + target_height + nub_height});
+ $nub.addClass('top');
+
+ }
+
+ } else if (this.settings.$li.length) {
+ this.pos_modal($nub);
+ }
+
+ if (toggle) {
+ this.settings.$next_tip.hide();
+ this.settings.$next_tip.css('visibility', 'visible');
+ }
+ },
+
+ pos_modal : function ($nub) {
+ this.center();
+ $nub.hide();
+
+ this.show_modal();
+ },
+
+ show_modal : function () {
+ if (!this.settings.$next_tip.data('closed')) {
+ var joyridemodalbg = $('.joyride-modal-bg');
+ if (joyridemodalbg.length < 1) {
+ $('body').append(this.settings.template.modal).show();
+ }
+
+ if (/pop/i.test(this.settings.tip_animation)) {
+ joyridemodalbg.show();
+ } else {
+ joyridemodalbg.fadeIn(this.settings.tip_animation_fade_speed);
+ }
+ }
+ },
+
+ expose : function () {
+ var expose,
+ exposeCover,
+ el,
+ origCSS,
+ origClasses,
+ randId = 'expose-' + this.random_str(6);
+
+ if (arguments.length > 0 && arguments[0] instanceof $) {
+ el = arguments[0];
+ } else if(this.settings.$target && !/body/i.test(this.settings.$target.selector)){
+ el = this.settings.$target;
+ } else {
+ return false;
+ }
+
+ if(el.length < 1){
+ if(window.console){
+ console.error('element not valid', el);
+ }
+ return false;
+ }
+
+ expose = $(this.settings.template.expose);
+ this.settings.$body.append(expose);
+ expose.css({
+ top: el.offset().top,
+ left: el.offset().left,
+ width: el.outerWidth(true),
+ height: el.outerHeight(true)
+ });
+
+ exposeCover = $(this.settings.template.expose_cover);
+
+ origCSS = {
+ zIndex: el.css('z-index'),
+ position: el.css('position')
+ };
+
+ origClasses = el.attr('class') == null ? '' : el.attr('class');
+
+ el.css('z-index',parseInt(expose.css('z-index'))+1);
+
+ if (origCSS.position == 'static') {
+ el.css('position','relative');
+ }
+
+ el.data('expose-css',origCSS);
+ el.data('orig-class', origClasses);
+ el.attr('class', origClasses + ' ' + this.settings.expose_add_class);
+
+ exposeCover.css({
+ top: el.offset().top,
+ left: el.offset().left,
+ width: el.outerWidth(true),
+ height: el.outerHeight(true)
+ });
+
+ if (this.settings.modal) this.show_modal();
+
+ this.settings.$body.append(exposeCover);
+ expose.addClass(randId);
+ exposeCover.addClass(randId);
+ el.data('expose', randId);
+ this.settings.post_expose_callback(this.settings.$li.index(), this.settings.$next_tip, el);
+ this.add_exposed(el);
+ },
+
+ un_expose : function () {
+ var exposeId,
+ el,
+ expose ,
+ origCSS,
+ origClasses,
+ clearAll = false;
+
+ if (arguments.length > 0 && arguments[0] instanceof $) {
+ el = arguments[0];
+ } else if(this.settings.$target && !/body/i.test(this.settings.$target.selector)){
+ el = this.settings.$target;
+ } else {
+ return false;
+ }
+
+ if(el.length < 1){
+ if (window.console) {
+ console.error('element not valid', el);
+ }
+ return false;
+ }
+
+ exposeId = el.data('expose');
+ expose = $('.' + exposeId);
+
+ if (arguments.length > 1) {
+ clearAll = arguments[1];
+ }
+
+ if (clearAll === true) {
+ $('.joyride-expose-wrapper,.joyride-expose-cover').remove();
+ } else {
+ expose.remove();
+ }
+
+ origCSS = el.data('expose-css');
+
+ if (origCSS.zIndex == 'auto') {
+ el.css('z-index', '');
+ } else {
+ el.css('z-index', origCSS.zIndex);
+ }
+
+ if (origCSS.position != el.css('position')) {
+ if(origCSS.position == 'static') {// this is default, no need to set it.
+ el.css('position', '');
+ } else {
+ el.css('position', origCSS.position);
+ }
+ }
+
+ origClasses = el.data('orig-class');
+ el.attr('class', origClasses);
+ el.removeData('orig-classes');
+
+ el.removeData('expose');
+ el.removeData('expose-z-index');
+ this.remove_exposed(el);
+ },
+
+ add_exposed: function(el){
+ this.settings.exposed = this.settings.exposed || [];
+ if (el instanceof $ || typeof el === 'object') {
+ this.settings.exposed.push(el[0]);
+ } else if (typeof el == 'string') {
+ this.settings.exposed.push(el);
+ }
+ },
+
+ remove_exposed: function(el){
+ var search, i;
+ if (el instanceof $) {
+ search = el[0]
+ } else if (typeof el == 'string'){
+ search = el;
+ }
+
+ this.settings.exposed = this.settings.exposed || [];
+ i = this.settings.exposed.length;
+
+ while (i--) {
+ if (this.settings.exposed[i] == search) {
+ this.settings.exposed.splice(i, 1);
+ return;
+ }
+ }
+ },
+
+ center : function () {
+ var $w = $(window);
+
+ this.settings.$next_tip.css({
+ top : ((($w.height() - this.settings.$next_tip.outerHeight()) / 2) + $w.scrollTop()),
+ left : ((($w.width() - this.settings.$next_tip.outerWidth()) / 2) + $w.scrollLeft())
+ });
+
+ return true;
+ },
+
+ bottom : function () {
+ return /bottom/i.test(this.settings.tip_settings.tip_location);
+ },
+
+ top : function () {
+ return /top/i.test(this.settings.tip_settings.tip_location);
+ },
+
+ right : function () {
+ return /right/i.test(this.settings.tip_settings.tip_location);
+ },
+
+ left : function () {
+ return /left/i.test(this.settings.tip_settings.tip_location);
+ },
+
+ corners : function (el) {
+ var w = $(window),
+ window_half = w.height() / 2,
+ //using this to calculate since scroll may not have finished yet.
+ tipOffset = Math.ceil(this.settings.$target.offset().top - window_half + this.settings.$next_tip.outerHeight()),
+ right = w.width() + w.scrollLeft(),
+ offsetBottom = w.height() + tipOffset,
+ bottom = w.height() + w.scrollTop(),
+ top = w.scrollTop();
+
+ if (tipOffset < top) {
+ if (tipOffset < 0) {
+ top = 0;
+ } else {
+ top = tipOffset;
+ }
+ }
+
+ if (offsetBottom > bottom) {
+ bottom = offsetBottom;
+ }
+
+ return [
+ el.offset().top < top,
+ right < el.offset().left + el.outerWidth(),
+ bottom < el.offset().top + el.outerHeight(),
+ w.scrollLeft() > el.offset().left
+ ];
+ },
+
+ visible : function (hidden_corners) {
+ var i = hidden_corners.length;
+
+ while (i--) {
+ if (hidden_corners[i]) return false;
+ }
+
+ return true;
+ },
+
+ nub_position : function (nub, pos, def) {
+ if (pos === 'auto') {
+ nub.addClass(def);
+ } else {
+ nub.addClass(pos);
+ }
+ },
+
+ startTimer : function () {
+ if (this.settings.$li.length) {
+ this.settings.automate = setTimeout(function () {
+ this.hide();
+ this.show();
+ this.startTimer();
+ }.bind(this), this.settings.timer);
+ } else {
+ clearTimeout(this.settings.automate);
+ }
+ },
+
+ end : function () {
+ if (this.settings.cookie_monster) {
+ $.cookie(this.settings.cookie_name, 'ridden', { expires: this.settings.cookie_expires, domain: this.settings.cookie_domain });
+ }
+
+ if (this.settings.timer > 0) {
+ clearTimeout(this.settings.automate);
+ }
+
+ if (this.settings.modal && this.settings.expose) {
+ this.un_expose();
+ }
+
+ this.settings.$next_tip.data('closed', true);
+
+ $('.joyride-modal-bg').hide();
+ this.settings.$current_tip.hide();
+ this.settings.post_step_callback(this.settings.$li.index(), this.settings.$current_tip);
+ this.settings.post_ride_callback(this.settings.$li.index(), this.settings.$current_tip);
+ $('.joyride-tip-guide').remove();
+ },
+
+ off : function () {
+ $(this.scope).off('.joyride');
+ $(window).off('.joyride');
+ $('.joyride-close-tip, .joyride-next-tip, .joyride-modal-bg').off('.joyride');
+ $('.joyride-tip-guide, .joyride-modal-bg').remove();
+ clearTimeout(this.settings.automate);
+ this.settings = {};
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs['magellan-expedition'] = {
+ name : 'magellan-expedition',
+
+ version : '5.1.1',
+
+ settings : {
+ active_class: 'active',
+ threshold: 0, // pixels from the top of the expedition for it to become fixes
+ destination_threshold: 20, // pixels from the top of destination for it to be considered active
+ throttle_delay: 30 // calculation throttling to increase framerate
+ },
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'throttle');
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this,
+ S = self.S,
+ settings = self.settings;
+
+ // initialize expedition offset
+ self.set_expedition_position();
+
+
+ S(self.scope)
+ .off('.magellan')
+ .on('click.fndtn.magellan', '[' + self.add_namespace('data-magellan-arrival') + '] a[href^="#"]', function (e) {
+ e.preventDefault();
+ var expedition = $(this).closest('[' + self.attr_name() + ']'),
+ settings = expedition.data('magellan-expedition-init');
+
+ var hash = this.hash.split('#').join(''),
+ target = $('a[name='+hash+']');
+ if (target.length === 0) target = $('#'+hash);
+
+ // Account for expedition height if fixed position
+ var scroll_top = target.offset().top;
+ if (expedition.css('position') === 'fixed') {
+ scroll_top = scroll_top - expedition.outerHeight();
+ }
+
+ $('html, body').stop().animate({
+ 'scrollTop': scroll_top
+ }, 700, 'swing', function () {
+ window.location.hash = '#'+hash;
+ });
+ })
+ .on('scroll.fndtn.magellan', self.throttle(this.check_for_arrivals.bind(this), settings.throttle_delay))
+ .on('resize.fndtn.magellan', self.throttle(this.set_expedition_position.bind(this), settings.throttle_delay));
+ },
+
+ check_for_arrivals : function() {
+ var self = this;
+ self.update_arrivals();
+ self.update_expedition_positions();
+ },
+
+ set_expedition_position : function() {
+ var self = this;
+ $('[' + this.attr_name() + '=fixed]', self.scope).each(function(idx, el) {
+ var expedition = $(this),
+ styles = expedition.attr('styles'), // save styles
+ top_offset;
+
+ expedition.attr('style', '');
+ top_offset = expedition.offset().top;
+
+ expedition.data(self.data_attr('magellan-top-offset'), top_offset);
+ expedition.attr('style', styles);
+ });
+ },
+
+ update_expedition_positions : function() {
+ var self = this,
+ window_top_offset = $(window).scrollTop();
+
+ $('[' + this.attr_name() + '=fixed]', self.scope).each(function() {
+ var expedition = $(this),
+ top_offset = expedition.data('magellan-top-offset');
+
+ if (window_top_offset >= top_offset) {
+ // Placeholder allows height calculations to be consistent even when
+ // appearing to switch between fixed/non-fixed placement
+ var placeholder = expedition.prev('[' + self.add_namespace('data-magellan-expedition-clone') + ']');
+ if (placeholder.length === 0) {
+ placeholder = expedition.clone();
+ placeholder.removeAttr(self.attr_name());
+ placeholder.attr(self.add_namespace('data-magellan-expedition-clone'),'');
+ expedition.before(placeholder);
+ }
+ expedition.css({position:'fixed', top: 0});
+ } else {
+ expedition.prev('[' + self.add_namespace('data-magellan-expedition-clone') + ']').remove();
+ expedition.attr('style','');
+ }
+ });
+ },
+
+ update_arrivals : function() {
+ var self = this,
+ window_top_offset = $(window).scrollTop();
+
+ $('[' + this.attr_name() + ']', self.scope).each(function() {
+ var expedition = $(this),
+ settings = settings = expedition.data(self.attr_name(true) + '-init'),
+ offsets = self.offsets(expedition, window_top_offset),
+ arrivals = expedition.find('[' + self.add_namespace('data-magellan-arrival') + ']'),
+ active_item = false;
+ offsets.each(function(idx, item) {
+ if (item.viewport_offset >= item.top_offset) {
+ var arrivals = expedition.find('[' + self.add_namespace('data-magellan-arrival') + ']');
+ arrivals.not(item.arrival).removeClass(settings.active_class);
+ item.arrival.addClass(settings.active_class);
+ active_item = true;
+ return true;
+ }
+ });
+
+ if (!active_item) arrivals.removeClass(settings.active_class);
+ });
+ },
+
+ offsets : function(expedition, window_offset) {
+ var self = this,
+ settings = expedition.data(self.attr_name(true) + '-init'),
+ viewport_offset = (window_offset + settings.destination_threshold);
+
+ return expedition.find('[' + self.add_namespace('data-magellan-arrival') + ']').map(function(idx, el) {
+ var name = $(this).data(self.data_attr('magellan-arrival')),
+ dest = $('[' + self.add_namespace('data-magellan-destination') + '=' + name + ']');
+ if (dest.length > 0) {
+ var top_offset = dest.offset().top;
+ return {
+ destination : dest,
+ arrival : $(this),
+ top_offset : top_offset,
+ viewport_offset : viewport_offset
+ }
+ }
+ }).sort(function(a, b) {
+ if (a.top_offset < b.top_offset) return -1;
+ if (a.top_offset > b.top_offset) return 1;
+ return 0;
+ });
+ },
+
+ data_attr: function (str) {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + str;
+ }
+
+ return str;
+ },
+
+ off : function () {
+ this.S(this.scope).off('.magellan');
+ this.S(window).off('.magellan');
+ },
+
+ reflow : function () {
+ var self = this;
+ // remove placeholder expeditions used for height calculation purposes
+ $('[' + self.add_namespace('data-magellan-expedition-clone') + ']', self.scope).remove();
+ }
+ };
+}(jQuery, this, this.document));
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.offcanvas = {
+ name : 'offcanvas',
+
+ version : '5.1.1',
+
+ settings : {},
+
+ init : function (scope, method, options) {
+ this.events();
+ },
+
+ events : function () {
+ var S = this.S;
+
+ S(this.scope).off('.offcanvas')
+ .on('click.fndtn.offcanvas', '.left-off-canvas-toggle', function (e) {
+ e.preventDefault();
+ S(this).closest('.off-canvas-wrap').toggleClass('move-right');
+ })
+ .on('click.fndtn.offcanvas', '.exit-off-canvas', function (e) {
+ e.preventDefault();
+ S(".off-canvas-wrap").removeClass("move-right");
+ })
+ .on('click.fndtn.offcanvas', '.right-off-canvas-toggle', function (e) {
+ e.preventDefault();
+ S(this).closest(".off-canvas-wrap").toggleClass("move-left");
+ })
+ .on('click.fndtn.offcanvas', '.exit-off-canvas', function (e) {
+ e.preventDefault();
+ S(".off-canvas-wrap").removeClass("move-left");
+ });
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ var noop = function() {};
+
+ var Orbit = function(el, settings) {
+ // Don't reinitialize plugin
+ if (el.hasClass(settings.slides_container_class)) {
+ return this;
+ }
+
+ var self = this,
+ container,
+ slides_container = el,
+ number_container,
+ bullets_container,
+ timer_container,
+ idx = 0,
+ animate,
+ timer,
+ locked = false,
+ adjust_height_after = false;
+
+
+ self.slides = function() {
+ return slides_container.children(settings.slide_selector);
+ };
+
+ self.slides().first().addClass(settings.active_slide_class);
+
+ self.update_slide_number = function(index) {
+ if (settings.slide_number) {
+ number_container.find('span:first').text(parseInt(index)+1);
+ number_container.find('span:last').text(self.slides().length);
+ }
+ if (settings.bullets) {
+ bullets_container.children().removeClass(settings.bullets_active_class);
+ $(bullets_container.children().get(index)).addClass(settings.bullets_active_class);
+ }
+ };
+
+ self.update_active_link = function(index) {
+ var link = $('a[data-orbit-link="'+self.slides().eq(index).attr('data-orbit-slide')+'"]');
+ link.siblings().removeClass(settings.bullets_active_class);
+ link.addClass(settings.bullets_active_class);
+ };
+
+ self.build_markup = function() {
+ slides_container.wrap('<div class="'+settings.container_class+'"></div>');
+ container = slides_container.parent();
+ slides_container.addClass(settings.slides_container_class);
+
+ if (settings.navigation_arrows) {
+ container.append($('<a href="#"><span></span></a>').addClass(settings.prev_class));
+ container.append($('<a href="#"><span></span></a>').addClass(settings.next_class));
+ }
+
+ if (settings.timer) {
+ timer_container = $('<div>').addClass(settings.timer_container_class);
+ timer_container.append('<span>');
+ timer_container.append($('<div>').addClass(settings.timer_progress_class));
+ timer_container.addClass(settings.timer_paused_class);
+ container.append(timer_container);
+ }
+
+ if (settings.slide_number) {
+ number_container = $('<div>').addClass(settings.slide_number_class);
+ number_container.append('<span></span> ' + settings.slide_number_text + ' <span></span>');
+ container.append(number_container);
+ }
+
+ if (settings.bullets) {
+ bullets_container = $('<ol>').addClass(settings.bullets_container_class);
+ container.append(bullets_container);
+ bullets_container.wrap('<div class="orbit-bullets-container"></div>');
+ self.slides().each(function(idx, el) {
+ var bullet = $('<li>').attr('data-orbit-slide', idx);
+ bullets_container.append(bullet);
+ });
+ }
+
+ if (settings.stack_on_small) {
+ container.addClass(settings.stack_on_small_class);
+ }
+ };
+
+ self._goto = function(next_idx, start_timer) {
+ // if (locked) {return false;}
+ if (next_idx === idx) {return false;}
+ if (typeof timer === 'object') {timer.restart();}
+ var slides = self.slides();
+
+ var dir = 'next';
+ locked = true;
+ if (next_idx < idx) {dir = 'prev';}
+ if (next_idx >= slides.length) {
+ if (!settings.circular) return false;
+ next_idx = 0;
+ } else if (next_idx < 0) {
+ if (!settings.circular) return false;
+ next_idx = slides.length - 1;
+ }
+
+ var current = $(slides.get(idx));
+ var next = $(slides.get(next_idx));
+
+ current.css('zIndex', 2);
+ current.removeClass(settings.active_slide_class);
+ next.css('zIndex', 4).addClass(settings.active_slide_class);
+
+ slides_container.trigger('before-slide-change.fndtn.orbit');
+ settings.before_slide_change();
+ self.update_active_link(next_idx);
+
+ var callback = function() {
+ var unlock = function() {
+ idx = next_idx;
+ locked = false;
+ if (start_timer === true) {timer = self.create_timer(); timer.start();}
+ self.update_slide_number(idx);
+ slides_container.trigger('after-slide-change.fndtn.orbit',[{slide_number: idx, total_slides: slides.length}]);
+ settings.after_slide_change(idx, slides.length);
+ };
+ if (slides_container.height() != next.height() && settings.variable_height) {
+ slides_container.animate({'height': next.height()}, 250, 'linear', unlock);
+ } else {
+ unlock();
+ }
+ };
+
+ if (slides.length === 1) {callback(); return false;}
+
+ var start_animation = function() {
+ if (dir === 'next') {animate.next(current, next, callback);}
+ if (dir === 'prev') {animate.prev(current, next, callback);}
+ };
+
+ if (next.height() > slides_container.height() && settings.variable_height) {
+ slides_container.animate({'height': next.height()}, 250, 'linear', start_animation);
+ } else {
+ start_animation();
+ }
+ };
+
+ self.next = function(e) {
+ e.stopImmediatePropagation();
+ e.preventDefault();
+ self._goto(idx + 1);
+ };
+
+ self.prev = function(e) {
+ e.stopImmediatePropagation();
+ e.preventDefault();
+ self._goto(idx - 1);
+ };
+
+ self.link_custom = function(e) {
+ e.preventDefault();
+ var link = $(this).attr('data-orbit-link');
+ if ((typeof link === 'string') && (link = $.trim(link)) != "") {
+ var slide = container.find('[data-orbit-slide='+link+']');
+ if (slide.index() != -1) {self._goto(slide.index());}
+ }
+ };
+
+ self.link_bullet = function(e) {
+ var index = $(this).attr('data-orbit-slide');
+ if ((typeof index === 'string') && (index = $.trim(index)) != "") {
+ if(isNaN(parseInt(index)))
+ {
+ var slide = container.find('[data-orbit-slide='+index+']');
+ if (slide.index() != -1) {self._goto(slide.index() + 1);}
+ }
+ else
+ {
+ self._goto(parseInt(index));
+ }
+ }
+
+ }
+
+ self.timer_callback = function() {
+ self._goto(idx + 1, true);
+ }
+
+ self.compute_dimensions = function() {
+ var current = $(self.slides().get(idx));
+ var h = current.height();
+ if (!settings.variable_height) {
+ self.slides().each(function(){
+ if ($(this).height() > h) { h = $(this).height(); }
+ });
+ }
+ slides_container.height(h);
+ };
+
+ self.create_timer = function() {
+ var t = new Timer(
+ container.find('.'+settings.timer_container_class),
+ settings,
+ self.timer_callback
+ );
+ return t;
+ };
+
+ self.stop_timer = function() {
+ if (typeof timer === 'object') timer.stop();
+ };
+
+ self.toggle_timer = function() {
+ var t = container.find('.'+settings.timer_container_class);
+ if (t.hasClass(settings.timer_paused_class)) {
+ if (typeof timer === 'undefined') {timer = self.create_timer();}
+ timer.start();
+ }
+ else {
+ if (typeof timer === 'object') {timer.stop();}
+ }
+ };
+
+ self.init = function() {
+ self.build_markup();
+ if (settings.timer) {
+ timer = self.create_timer();
+ Foundation.utils.image_loaded(this.slides().children('img'), timer.start);
+ }
+ animate = new FadeAnimation(settings, slides_container);
+ if (settings.animation === 'slide')
+ animate = new SlideAnimation(settings, slides_container);
+ container.on('click', '.'+settings.next_class, self.next);
+ container.on('click', '.'+settings.prev_class, self.prev);
+ container.on('click', '[data-orbit-slide]', self.link_bullet);
+ container.on('click', self.toggle_timer);
+ if (settings.swipe) {
+ container.on('touchstart.fndtn.orbit', function(e) {
+ if (!e.touches) {e = e.originalEvent;}
+ var data = {
+ start_page_x: e.touches[0].pageX,
+ start_page_y: e.touches[0].pageY,
+ start_time: (new Date()).getTime(),
+ delta_x: 0,
+ is_scrolling: undefined
+ };
+ container.data('swipe-transition', data);
+ e.stopPropagation();
+ })
+ .on('touchmove.fndtn.orbit', function(e) {
+ if (!e.touches) { e = e.originalEvent; }
+ // Ignore pinch/zoom events
+ if(e.touches.length > 1 || e.scale && e.scale !== 1) return;
+
+ var data = container.data('swipe-transition');
+ if (typeof data === 'undefined') {data = {};}
+
+ data.delta_x = e.touches[0].pageX - data.start_page_x;
+
+ if ( typeof data.is_scrolling === 'undefined') {
+ data.is_scrolling = !!( data.is_scrolling || Math.abs(data.delta_x) < Math.abs(e.touches[0].pageY - data.start_page_y) );
+ }
+
+ if (!data.is_scrolling && !data.active) {
+ e.preventDefault();
+ var direction = (data.delta_x < 0) ? (idx+1) : (idx-1);
+ data.active = true;
+ self._goto(direction);
+ }
+ })
+ .on('touchend.fndtn.orbit', function(e) {
+ container.data('swipe-transition', {});
+ e.stopPropagation();
+ })
+ }
+ container.on('mouseenter.fndtn.orbit', function(e) {
+ if (settings.timer && settings.pause_on_hover) {
+ self.stop_timer();
+ }
+ })
+ .on('mouseleave.fndtn.orbit', function(e) {
+ if (settings.timer && settings.resume_on_mouseout) {
+ timer.start();
+ }
+ });
+
+ $(document).on('click', '[data-orbit-link]', self.link_custom);
+ $(window).on('resize', self.compute_dimensions);
+ Foundation.utils.image_loaded(this.slides().children('img'), self.compute_dimensions);
+ Foundation.utils.image_loaded(this.slides().children('img'), function() {
+ container.prev('.preloader').css('display', 'none');
+ self.update_slide_number(0);
+ self.update_active_link(0);
+ slides_container.trigger('ready.fndtn.orbit');
+ });
+ };
+
+ self.init();
+ };
+
+ var Timer = function(el, settings, callback) {
+ var self = this,
+ duration = settings.timer_speed,
+ progress = el.find('.'+settings.timer_progress_class),
+ start,
+ timeout,
+ left = -1;
+
+ this.update_progress = function(w) {
+ var new_progress = progress.clone();
+ new_progress.attr('style', '');
+ new_progress.css('width', w+'%');
+ progress.replaceWith(new_progress);
+ progress = new_progress;
+ };
+
+ this.restart = function() {
+ clearTimeout(timeout);
+ el.addClass(settings.timer_paused_class);
+ left = -1;
+ self.update_progress(0);
+ };
+
+ this.start = function() {
+ if (!el.hasClass(settings.timer_paused_class)) {return true;}
+ left = (left === -1) ? duration : left;
+ el.removeClass(settings.timer_paused_class);
+ start = new Date().getTime();
+ progress.animate({'width': '100%'}, left, 'linear');
+ timeout = setTimeout(function() {
+ self.restart();
+ callback();
+ }, left);
+ el.trigger('timer-started.fndtn.orbit')
+ };
+
+ this.stop = function() {
+ if (el.hasClass(settings.timer_paused_class)) {return true;}
+ clearTimeout(timeout);
+ el.addClass(settings.timer_paused_class);
+ var end = new Date().getTime();
+ left = left - (end - start);
+ var w = 100 - ((left / duration) * 100);
+ self.update_progress(w);
+ el.trigger('timer-stopped.fndtn.orbit');
+ };
+ };
+
+ var SlideAnimation = function(settings, container) {
+ var duration = settings.animation_speed;
+ var is_rtl = ($('html[dir=rtl]').length === 1);
+ var margin = is_rtl ? 'marginRight' : 'marginLeft';
+ var animMargin = {};
+ animMargin[margin] = '0%';
+
+ this.next = function(current, next, callback) {
+ current.animate({marginLeft:'-100%'}, duration);
+ next.animate(animMargin, duration, function() {
+ current.css(margin, '100%');
+ callback();
+ });
+ };
+
+ this.prev = function(current, prev, callback) {
+ current.animate({marginLeft:'100%'}, duration);
+ prev.css(margin, '-100%');
+ prev.animate(animMargin, duration, function() {
+ current.css(margin, '100%');
+ callback();
+ });
+ };
+ };
+
+ var FadeAnimation = function(settings, container) {
+ var duration = settings.animation_speed;
+ var is_rtl = ($('html[dir=rtl]').length === 1);
+ var margin = is_rtl ? 'marginRight' : 'marginLeft';
+
+ this.next = function(current, next, callback) {
+ next.css({'margin':'0%', 'opacity':'0.01'});
+ next.animate({'opacity':'1'}, duration, 'linear', function() {
+ current.css('margin', '100%');
+ callback();
+ });
+ };
+
+ this.prev = function(current, prev, callback) {
+ prev.css({'margin':'0%', 'opacity':'0.01'});
+ prev.animate({'opacity':'1'}, duration, 'linear', function() {
+ current.css('margin', '100%');
+ callback();
+ });
+ };
+ };
+
+
+ Foundation.libs = Foundation.libs || {};
+
+ Foundation.libs.orbit = {
+ name: 'orbit',
+
+ version: '5.1.1',
+
+ settings: {
+ animation: 'slide',
+ timer_speed: 10000,
+ pause_on_hover: true,
+ resume_on_mouseout: false,
+ animation_speed: 500,
+ stack_on_small: false,
+ navigation_arrows: true,
+ slide_number: true,
+ slide_number_text: 'of',
+ container_class: 'orbit-container',
+ stack_on_small_class: 'orbit-stack-on-small',
+ next_class: 'orbit-next',
+ prev_class: 'orbit-prev',
+ timer_container_class: 'orbit-timer',
+ timer_paused_class: 'paused',
+ timer_progress_class: 'orbit-progress',
+ slides_container_class: 'orbit-slides-container',
+ slide_selector: '*',
+ bullets_container_class: 'orbit-bullets',
+ bullets_active_class: 'active',
+ slide_number_class: 'orbit-slide-number',
+ caption_class: 'orbit-caption',
+ active_slide_class: 'active',
+ orbit_transition_class: 'orbit-transitioning',
+ bullets: true,
+ circular: true,
+ timer: true,
+ variable_height: false,
+ swipe: true,
+ before_slide_change: noop,
+ after_slide_change: noop
+ },
+
+ init : function (scope, method, options) {
+ var self = this;
+ this.bindings(method, options);
+ },
+
+ events : function (instance) {
+ var orbit_instance = new Orbit(this.S(instance), this.S(instance).data('orbit-init'));
+ this.S(instance).data(self.name + '-instance', orbit_instance);
+ },
+
+ reflow : function () {
+ var self = this;
+
+ if (self.S(self.scope).is('[data-orbit]')) {
+ var $el = self.S(self.scope);
+ var instance = $el.data(self.name + '-instance');
+ instance.compute_dimensions();
+ } else {
+ self.S('[data-orbit]', self.scope).each(function(idx, el) {
+ var $el = self.S(el);
+ var opts = self.data_options($el);
+ var instance = $el.data(self.name + '-instance');
+ instance.compute_dimensions();
+ });
+ }
+ }
+ };
+
+
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.reveal = {
+ name : 'reveal',
+
+ version : '5.1.1',
+
+ locked : false,
+
+ settings : {
+ animation: 'fadeAndPop',
+ animation_speed: 250,
+ close_on_background_click: true,
+ close_on_esc: true,
+ dismiss_modal_class: 'close-reveal-modal',
+ bg_class: 'reveal-modal-bg',
+ open: function(){},
+ opened: function(){},
+ close: function(){},
+ closed: function(){},
+ bg : $('.reveal-modal-bg'),
+ css : {
+ open : {
+ 'opacity': 0,
+ 'visibility': 'visible',
+ 'display' : 'block'
+ },
+ close : {
+ 'opacity': 1,
+ 'visibility': 'hidden',
+ 'display': 'none'
+ }
+ }
+ },
+
+ init : function (scope, method, options) {
+ $.extend(true, this.settings, method, options);
+ this.bindings(method, options);
+ },
+
+ events : function (scope) {
+ var self = this,
+ S = self.S;
+
+ S(this.scope)
+ .off('.reveal')
+ .on('click.fndtn.reveal', '[' + this.add_namespace('data-reveal-id') + ']', function (e) {
+ e.preventDefault();
+
+ if (!self.locked) {
+ var element = S(this),
+ ajax = element.data(self.data_attr('reveal-ajax'));
+
+ self.locked = true;
+
+ if (typeof ajax === 'undefined') {
+ self.open.call(self, element);
+ } else {
+ var url = ajax === true ? element.attr('href') : ajax;
+
+ self.open.call(self, element, {url: url});
+ }
+ }
+ });
+
+ S(document)
+ .on('click.fndtn.reveal', this.close_targets(), function (e) {
+
+ e.preventDefault();
+
+ if (!self.locked) {
+ var settings = S('[' + self.attr_name() + '].open').data(self.attr_name(true) + '-init'),
+ bg_clicked = S(e.target)[0] === S('.' + settings.bg_class)[0];
+
+ if (bg_clicked && !settings.close_on_background_click) {
+ return;
+ }
+
+ self.locked = true;
+ self.close.call(self, bg_clicked ? S('[' + self.attr_name() + '].open') : S(this).closest('[' + self.attr_name() + ']'));
+ }
+ });
+
+ if(S('[' + self.attr_name() + ']', this.scope).length > 0) {
+ S(this.scope)
+ // .off('.reveal')
+ .on('open.fndtn.reveal', this.settings.open)
+ .on('opened.fndtn.reveal', this.settings.opened)
+ .on('opened.fndtn.reveal', this.open_video)
+ .on('close.fndtn.reveal', this.settings.close)
+ .on('closed.fndtn.reveal', this.settings.closed)
+ .on('closed.fndtn.reveal', this.close_video);
+ } else {
+ S(this.scope)
+ // .off('.reveal')
+ .on('open.fndtn.reveal', '[' + self.attr_name() + ']', this.settings.open)
+ .on('opened.fndtn.reveal', '[' + self.attr_name() + ']', this.settings.opened)
+ .on('opened.fndtn.reveal', '[' + self.attr_name() + ']', this.open_video)
+ .on('close.fndtn.reveal', '[' + self.attr_name() + ']', this.settings.close)
+ .on('closed.fndtn.reveal', '[' + self.attr_name() + ']', this.settings.closed)
+ .on('closed.fndtn.reveal', '[' + self.attr_name() + ']', this.close_video);
+ }
+
+ return true;
+ },
+
+ // PATCH #3: turning on key up capture only when a reveal window is open
+ key_up_on : function (scope) {
+ var self = this;
+
+ // PATCH #1: fixing multiple keyup event trigger from single key press
+ self.S('body').off('keyup.fndtn.reveal').on('keyup.fndtn.reveal', function ( event ) {
+ var open_modal = self.S('[' + self.attr_name() + '].open'),
+ settings = open_modal.data(self.attr_name(true) + '-init');
+ // PATCH #2: making sure that the close event can be called only while unlocked,
+ // so that multiple keyup.fndtn.reveal events don't prevent clean closing of the reveal window.
+ if ( settings && event.which === 27 && settings.close_on_esc && !self.locked) { // 27 is the keycode for the Escape key
+ self.close.call(self, open_modal);
+ }
+ });
+
+ return true;
+ },
+
+ // PATCH #3: turning on key up capture only when a reveal window is open
+ key_up_off : function (scope) {
+ this.S('body').off('keyup.fndtn.reveal');
+ return true;
+ },
+
+ open : function (target, ajax_settings) {
+ var self = this;
+ if (target) {
+ if (typeof target.selector !== 'undefined') {
+ var modal = self.S('#' + target.data(self.data_attr('reveal-id')));
+ } else {
+ var modal = self.S(this.scope);
+
+ ajax_settings = target;
+ }
+ } else {
+ var modal = self.S(this.scope);
+ }
+
+ var settings = modal.data(self.attr_name(true) + '-init');
+
+ if (!modal.hasClass('open')) {
+ var open_modal = self.S('[' + self.attr_name() + '].open');
+
+ if (typeof modal.data('css-top') === 'undefined') {
+ modal.data('css-top', parseInt(modal.css('top'), 10))
+ .data('offset', this.cache_offset(modal));
+ }
+
+ this.key_up_on(modal); // PATCH #3: turning on key up capture only when a reveal window is open
+ modal.trigger('open');
+
+ if (open_modal.length < 1) {
+ this.toggle_bg(modal);
+ }
+
+ if (typeof ajax_settings === 'string') {
+ ajax_settings = {
+ url: ajax_settings
+ };
+ }
+
+ if (typeof ajax_settings === 'undefined' || !ajax_settings.url) {
+ if (open_modal.length > 0) {
+ var open_modal_settings = open_modal.data(self.attr_name(true) + '-init');
+ this.hide(open_modal, open_modal_settings.css.close);
+ }
+
+ this.show(modal, settings.css.open);
+ } else {
+ var old_success = typeof ajax_settings.success !== 'undefined' ? ajax_settings.success : null;
+
+ $.extend(ajax_settings, {
+ success: function (data, textStatus, jqXHR) {
+ if ( $.isFunction(old_success) ) {
+ old_success(data, textStatus, jqXHR);
+ }
+
+ modal.html(data);
+ self.S(modal).foundation('section', 'reflow');
+
+ if (open_modal.length > 0) {
+ var open_modal_settings = open_modal.data(self.attr_name(true));
+ self.hide(open_modal, open_modal_settings.css.close);
+ }
+ self.show(modal, settings.css.open);
+ }
+ });
+
+ $.ajax(ajax_settings);
+ }
+ }
+ },
+
+ close : function (modal) {
+ var modal = modal && modal.length ? modal : this.S(this.scope),
+ open_modals = this.S('[' + this.attr_name() + '].open'),
+ settings = modal.data(this.attr_name(true) + '-init');
+
+ if (open_modals.length > 0) {
+ this.locked = true;
+ this.key_up_off(modal); // PATCH #3: turning on key up capture only when a reveal window is open
+ modal.trigger('close');
+ this.toggle_bg(modal);
+ this.hide(open_modals, settings.css.close, settings);
+ }
+ },
+
+ close_targets : function () {
+ var base = '.' + this.settings.dismiss_modal_class;
+
+ if (this.settings.close_on_background_click) {
+ return base + ', .' + this.settings.bg_class;
+ }
+
+ return base;
+ },
+
+ toggle_bg : function (modal) {
+ var settings = modal.data(this.attr_name(true));
+
+ if (this.S('.' + this.settings.bg_class).length === 0) {
+ this.settings.bg = $('<div />', {'class': this.settings.bg_class})
+ .appendTo('body');
+ }
+
+ if (this.settings.bg.filter(':visible').length > 0) {
+ this.hide(this.settings.bg);
+ } else {
+ this.show(this.settings.bg);
+ }
+ },
+
+ show : function (el, css) {
+ // is modal
+ if (css) {
+ var settings = el.data(this.attr_name(true) + '-init');
+ if (el.parent('body').length === 0) {
+ var placeholder = el.wrap('<div style="display: none;" />').parent(),
+ rootElement = this.settings.rootElement || 'body';
+
+ el.on('closed.fndtn.reveal.wrapped', function() {
+ el.detach().appendTo(placeholder);
+ el.unwrap().unbind('closed.fndtn.reveal.wrapped');
+ });
+
+ el.detach().appendTo(rootElement);
+ }
+
+ if (/pop/i.test(settings.animation)) {
+ css.top = $(window).scrollTop() - el.data('offset') + 'px';
+ var end_css = {
+ top: $(window).scrollTop() + el.data('css-top') + 'px',
+ opacity: 1
+ };
+
+ return setTimeout(function () {
+ return el
+ .css(css)
+ .animate(end_css, settings.animation_speed, 'linear', function () {
+ this.locked = false;
+ el.trigger('opened');
+ }.bind(this))
+ .addClass('open');
+ }.bind(this), settings.animation_speed / 2);
+ }
+
+ if (/fade/i.test(settings.animation)) {
+ var end_css = {opacity: 1};
+
+ return setTimeout(function () {
+ return el
+ .css(css)
+ .animate(end_css, settings.animation_speed, 'linear', function () {
+ this.locked = false;
+ el.trigger('opened');
+ }.bind(this))
+ .addClass('open');
+ }.bind(this), settings.animation_speed / 2);
+ }
+
+ return el.css(css).show().css({opacity: 1}).addClass('open').trigger('opened');
+ }
+
+ var settings = this.settings;
+
+ // should we animate the background?
+ if (/fade/i.test(settings.animation)) {
+ return el.fadeIn(settings.animation_speed / 2);
+ }
+
+ this.locked = false;
+
+ return el.show();
+ },
+
+ hide : function (el, css) {
+ // is modal
+ if (css) {
+ var settings = el.data(this.attr_name(true) + '-init');
+ if (/pop/i.test(settings.animation)) {
+ var end_css = {
+ top: - $(window).scrollTop() - el.data('offset') + 'px',
+ opacity: 0
+ };
+
+ return setTimeout(function () {
+ return el
+ .animate(end_css, settings.animation_speed, 'linear', function () {
+ this.locked = false;
+ el.css(css).trigger('closed');
+ }.bind(this))
+ .removeClass('open');
+ }.bind(this), settings.animation_speed / 2);
+ }
+
+ if (/fade/i.test(settings.animation)) {
+ var end_css = {opacity: 0};
+
+ return setTimeout(function () {
+ return el
+ .animate(end_css, settings.animation_speed, 'linear', function () {
+ this.locked = false;
+ el.css(css).trigger('closed');
+ }.bind(this))
+ .removeClass('open');
+ }.bind(this), settings.animation_speed / 2);
+ }
+
+ return el.hide().css(css).removeClass('open').trigger('closed');
+ }
+
+ var settings = this.settings;
+
+ // should we animate the background?
+ if (/fade/i.test(settings.animation)) {
+ return el.fadeOut(settings.animation_speed / 2);
+ }
+
+ return el.hide();
+ },
+
+ close_video : function (e) {
+ var video = $('.flex-video', e.target),
+ iframe = $('iframe', video);
+
+ if (iframe.length > 0) {
+ iframe.attr('data-src', iframe[0].src);
+ iframe.attr('src', 'about:blank');
+ video.hide();
+ }
+ },
+
+ open_video : function (e) {
+ var video = $('.flex-video', e.target),
+ iframe = video.find('iframe');
+
+ if (iframe.length > 0) {
+ var data_src = iframe.attr('data-src');
+ if (typeof data_src === 'string') {
+ iframe[0].src = iframe.attr('data-src');
+ } else {
+ var src = iframe[0].src;
+ iframe[0].src = undefined;
+ iframe[0].src = src;
+ }
+ video.show();
+ }
+ },
+
+ data_attr: function (str) {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + str;
+ }
+
+ return str;
+ },
+
+ cache_offset : function (modal) {
+ var offset = modal.show().height() + parseInt(modal.css('top'), 10);
+
+ modal.hide();
+
+ return offset;
+ },
+
+ off : function () {
+ $(this.scope).off('.fndtn.reveal');
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
+
+/*jslint unparam: true, browser: true, indent: 2 */
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.tab = {
+ name : 'tab',
+
+ version : '5.1.1',
+
+ settings : {
+ active_class: 'active',
+ callback : function () {}
+ },
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this,
+ S = this.S;
+
+ S(this.scope).off('.tab').on('click.fndtn.tab', '[' + this.attr_name() + '] > dd > a', function (e) {
+ e.preventDefault();
+ e.stopPropagation();
+
+ var tab = S(this).parent(),
+ tabs = tab.closest('[' + self.attr_name() + ']'),
+ target = S('#' + this.href.split('#')[1]),
+ siblings = tab.siblings(),
+ settings = tabs.data(self.attr_name(true) + '-init');
+
+ // allow usage of data-tab-content attribute instead of href
+ if (S(this).data(self.data_attr('tab-content'))) {
+ target = S('#' + S(this).data(self.data_attr('tab-content')).split('#')[1]);
+ }
+
+ tab.addClass(settings.active_class).triggerHandler('opened');
+ siblings.removeClass(settings.active_class);
+ target.siblings().removeClass(settings.active_class).end().addClass(settings.active_class);
+ settings.callback(tab);
+ tabs.triggerHandler('toggled', [tab]);
+ });
+ },
+
+ data_attr: function (str) {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + str;
+ }
+
+ return str;
+ },
+
+ off : function () {},
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.tooltip = {
+ name : 'tooltip',
+
+ version : '5.1.1',
+
+ settings : {
+ additional_inheritable_classes : [],
+ tooltip_class : '.tooltip',
+ append_to: 'body',
+ touch_close_text: 'Tap To Close',
+ disable_for_touch: false,
+ hover_delay: 200,
+ tip_template : function (selector, content) {
+ return '<span data-selector="' + selector + '" class="'
+ + Foundation.libs.tooltip.settings.tooltip_class.substring(1)
+ + '">' + content + '<span class="nub"></span></span>';
+ }
+ },
+
+ cache : {},
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'random_str');
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this,
+ S = self.S;
+
+ if (Modernizr.touch) {
+ S(document)
+ .off('.tooltip')
+ .on('click.fndtn.tooltip touchstart.fndtn.tooltip touchend.fndtn.tooltip',
+ '[' + this.attr_name() + ']:not(a)', function (e) {
+ var settings = $.extend({}, self.settings, self.data_options(S(this)));
+ if (!settings.disable_for_touch) {
+ e.preventDefault();
+ S(settings.tooltip_class).hide();
+ self.showOrCreateTip(S(this));
+ }
+ })
+ .on('click.fndtn.tooltip touchstart.fndtn.tooltip touchend.fndtn.tooltip',
+ this.settings.tooltip_class, function (e) {
+ e.preventDefault();
+ S(this).fadeOut(150);
+ });
+ } else {
+ S(document)
+ .off('.tooltip')
+ .on('mouseenter.fndtn.tooltip mouseleave.fndtn.tooltip',
+ '[' + this.attr_name() + ']', function (e) {
+ var $this = S(this);
+
+ if (/enter|over/i.test(e.type)) {
+ this.timer = setTimeout(function () {
+ var tip = self.showOrCreateTip($this);
+ }.bind(this), self.settings.hover_delay);
+ } else if (e.type === 'mouseout' || e.type === 'mouseleave') {
+ clearTimeout(this.timer);
+ self.hide($this);
+ }
+ });
+ }
+ },
+
+ showOrCreateTip : function ($target) {
+ var $tip = this.getTip($target);
+
+ if ($tip && $tip.length > 0) {
+ return this.show($target);
+ }
+
+ return this.create($target);
+ },
+
+ getTip : function ($target) {
+ var selector = this.selector($target),
+ tip = null;
+
+ if (selector) {
+ tip = this.S('span[data-selector="' + selector + '"]' + this.settings.tooltip_class);
+ }
+
+ return (typeof tip === 'object') ? tip : false;
+ },
+
+ selector : function ($target) {
+ var id = $target.attr('id'),
+ dataSelector = $target.attr(this.attr_name()) || $target.attr('data-selector');
+
+ if ((id && id.length < 1 || !id) && typeof dataSelector != 'string') {
+ dataSelector = 'tooltip' + this.random_str(6);
+ $target.attr('data-selector', dataSelector);
+ }
+
+ return (id && id.length > 0) ? id : dataSelector;
+ },
+
+ create : function ($target) {
+ var $tip = $(this.settings.tip_template(this.selector($target), $('<div></div>').html($target.attr('title')).html())),
+ classes = this.inheritable_classes($target);
+
+ $tip.addClass(classes).appendTo(this.settings.append_to);
+ if (Modernizr.touch) {
+ $tip.append('<span class="tap-to-close">'+this.settings.touch_close_text+'</span>');
+ }
+ $target.removeAttr('title').attr('title','');
+ this.show($target);
+ },
+
+ reposition : function (target, tip, classes) {
+ var width, nub, nubHeight, nubWidth, column, objPos;
+
+ tip.css('visibility', 'hidden').show();
+
+ width = target.data('width');
+ nub = tip.children('.nub');
+ nubHeight = nub.outerHeight();
+ nubWidth = nub.outerHeight();
+
+ if(this.small()) {
+ tip.css({'width' : '100%' });
+ } else {
+ tip.css({'width' : (width) ? width : 'auto'});
+ }
+
+ objPos = function (obj, top, right, bottom, left, width) {
+ return obj.css({
+ 'top' : (top) ? top : 'auto',
+ 'bottom' : (bottom) ? bottom : 'auto',
+ 'left' : (left) ? left : 'auto',
+ 'right' : (right) ? right : 'auto'
+ }).end();
+ };
+
+ objPos(tip, (target.offset().top + target.outerHeight() + 10), 'auto', 'auto', target.offset().left);
+
+ if (this.small()) {
+ objPos(tip, (target.offset().top + target.outerHeight() + 10), 'auto', 'auto', 12.5, this.S(this.scope).width());
+ tip.addClass('tip-override');
+ objPos(nub, -nubHeight, 'auto', 'auto', target.offset().left + 10);
+ } else {
+ var left = target.offset().left;
+ if (Foundation.rtl) {
+ left = target.offset().left + target.outerWidth() - tip.outerWidth();
+ }
+
+ objPos(tip, (target.offset().top + target.outerHeight() + 10), 'auto', 'auto', left);
+ tip.removeClass('tip-override');
+ nub.removeAttr( 'style' );
+ if (classes && classes.indexOf('tip-top') > -1) {
+ objPos(tip, (target.offset().top - tip.outerHeight() - 10), 'auto', 'auto', left)
+ .removeClass('tip-override');
+ } else if (classes && classes.indexOf('tip-left') > -1) {
+ objPos(tip, (target.offset().top + (target.outerHeight() / 2) - (tip.outerHeight() / 2)), 'auto', 'auto', (target.offset().left - tip.outerWidth() - nubHeight))
+ .removeClass('tip-override');
+ } else if (classes && classes.indexOf('tip-right') > -1) {
+ objPos(tip, (target.offset().top + (target.outerHeight() / 2) - (tip.outerHeight() / 2)), 'auto', 'auto', (target.offset().left + target.outerWidth() + nubHeight))
+ .removeClass('tip-override');
+ }
+ }
+
+ tip.css('visibility', 'visible').hide();
+ },
+
+ small : function () {
+ return matchMedia(Foundation.media_queries.small).matches;
+ },
+
+ inheritable_classes : function (target) {
+ var inheritables = ['tip-top', 'tip-left', 'tip-bottom', 'tip-right', 'radius', 'round'].concat(this.settings.additional_inheritable_classes),
+ classes = target.attr('class'),
+ filtered = classes ? $.map(classes.split(' '), function (el, i) {
+ if ($.inArray(el, inheritables) !== -1) {
+ return el;
+ }
+ }).join(' ') : '';
+
+ return $.trim(filtered);
+ },
+
+ show : function ($target) {
+ var $tip = this.getTip($target);
+
+ this.reposition($target, $tip, $target.attr('class'));
+ return $tip.fadeIn(150);
+ },
+
+ hide : function ($target) {
+ var $tip = this.getTip($target);
+
+ return $tip.fadeOut(150);
+ },
+
+ // deprecate reload
+ reload : function () {
+ var $self = $(this);
+
+ return ($self.data('fndtn-tooltips')) ? $self.foundationTooltips('destroy').foundationTooltips('init') : $self.foundationTooltips('init');
+ },
+
+ off : function () {
+ this.S(this.scope).off('.fndtn.tooltip');
+ this.S(this.settings.tooltip_class).each(function (i) {
+ $('[' + this.attr_name() + ']').get(i).attr('title', $(this).text());
+ }).remove();
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
+
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.topbar = {
+ name : 'topbar',
+
+ version: '5.1.1',
+
+ settings : {
+ index : 0,
+ sticky_class : 'sticky',
+ custom_back_text: true,
+ back_text: 'Back',
+ is_hover: true,
+ mobile_show_parent_link: false,
+ scrolltop : true // jump to top when sticky nav menu toggle is clicked
+ },
+
+ init : function (section, method, options) {
+ Foundation.inherit(this, 'add_custom_rule register_media throttle');
+ var self = this;
+
+ self.register_media('topbar', 'foundation-mq-topbar');
+
+ this.bindings(method, options);
+
+ self.S('[' + this.attr_name() + ']', this.scope).each(function () {
+ var topbar = self.S(this),
+ settings = topbar.data(self.attr_name(true) + '-init'),
+ section = self.S('section', this),
+ titlebar = $('> ul', this).first();
+
+ topbar.data('index', 0);
+
+ var topbarContainer = topbar.parent();
+ if(topbarContainer.hasClass('fixed') || topbarContainer.hasClass(settings.sticky_class)) {
+ self.settings.sticky_class = settings.sticky_class;
+ self.settings.sticky_topbar = topbar;
+ topbar.data('height', topbarContainer.outerHeight());
+ topbar.data('stickyoffset', topbarContainer.offset().top);
+ } else {
+ topbar.data('height', topbar.outerHeight());
+ }
+
+ if (!settings.assembled) self.assemble(topbar);
+
+ if (settings.is_hover) {
+ self.S('.has-dropdown', topbar).addClass('not-click');
+ } else {
+ self.S('.has-dropdown', topbar).removeClass('not-click');
+ }
+
+ // Pad body when sticky (scrolled) or fixed.
+ self.add_custom_rule('.f-topbar-fixed { padding-top: ' + topbar.data('height') + 'px }');
+
+ if (topbarContainer.hasClass('fixed')) {
+ self.S('body').addClass('f-topbar-fixed');
+ }
+ });
+
+ },
+
+ toggle: function (toggleEl) {
+ var self = this;
+
+ if (toggleEl) {
+ var topbar = self.S(toggleEl).closest('[' + this.attr_name() + ']');
+ } else {
+ var topbar = self.S('[' + this.attr_name() + ']');
+ }
+
+ var settings = topbar.data(this.attr_name(true) + '-init');
+
+ var section = self.S('section, .section', topbar);
+
+ if (self.breakpoint()) {
+ if (!self.rtl) {
+ section.css({left: '0%'});
+ $('>.name', section).css({left: '100%'});
+ } else {
+ section.css({right: '0%'});
+ $('>.name', section).css({right: '100%'});
+ }
+
+ self.S('li.moved', section).removeClass('moved');
+ topbar.data('index', 0);
+
+ topbar
+ .toggleClass('expanded')
+ .css('height', '');
+ }
+
+ if (settings.scrolltop) {
+ if (!topbar.hasClass('expanded')) {
+ if (topbar.hasClass('fixed')) {
+ topbar.parent().addClass('fixed');
+ topbar.removeClass('fixed');
+ self.S('body').addClass('f-topbar-fixed');
+ }
+ } else if (topbar.parent().hasClass('fixed')) {
+ if (settings.scrolltop) {
+ topbar.parent().removeClass('fixed');
+ topbar.addClass('fixed');
+ self.S('body').removeClass('f-topbar-fixed');
+
+ window.scrollTo(0,0);
+ } else {
+ topbar.parent().removeClass('expanded');
+ }
+ }
+ } else {
+ if(topbar.parent().hasClass(self.settings.sticky_class)) {
+ topbar.parent().addClass('fixed');
+ }
+
+ if(topbar.parent().hasClass('fixed')) {
+ if (!topbar.hasClass('expanded')) {
+ topbar.removeClass('fixed');
+ topbar.parent().removeClass('expanded');
+ self.update_sticky_positioning();
+ } else {
+ topbar.addClass('fixed');
+ topbar.parent().addClass('expanded');
+ self.S('body').addClass('f-topbar-fixed');
+ }
+ }
+ }
+ },
+
+ timer : null,
+
+ events : function (bar) {
+ var self = this,
+ S = this.S;
+
+ S(this.scope)
+ .off('.topbar')
+ .on('click.fndtn.topbar', '[' + this.attr_name() + '] .toggle-topbar', function (e) {
+ e.preventDefault();
+ self.toggle(this);
+ })
+ .on('click.fndtn.topbar', '[' + this.attr_name() + '] li.has-dropdown', function (e) {
+ var li = S(this),
+ target = S(e.target),
+ topbar = li.closest('[' + self.attr_name() + ']'),
+ settings = topbar.data(self.attr_name(true) + '-init');
+
+ if(target.data('revealId')) {
+ self.toggle();
+ return;
+ }
+
+ if (self.breakpoint()) return;
+ if (settings.is_hover && !Modernizr.touch) return;
+
+ e.stopImmediatePropagation();
+
+ if (li.hasClass('hover')) {
+ li
+ .removeClass('hover')
+ .find('li')
+ .removeClass('hover');
+
+ li.parents('li.hover')
+ .removeClass('hover');
+ } else {
+ li.addClass('hover');
+
+ if (target[0].nodeName === 'A' && target.parent().hasClass('has-dropdown')) {
+ e.preventDefault();
+ }
+ }
+ })
+ .on('click.fndtn.topbar', '[' + this.attr_name() + '] .has-dropdown>a', function (e) {
+ if (self.breakpoint()) {
+
+ e.preventDefault();
+
+ var $this = S(this),
+ topbar = $this.closest('[' + self.attr_name() + ']'),
+ section = topbar.find('section, .section'),
+ dropdownHeight = $this.next('.dropdown').outerHeight(),
+ $selectedLi = $this.closest('li');
+
+ topbar.data('index', topbar.data('index') + 1);
+ $selectedLi.addClass('moved');
+
+ if (!self.rtl) {
+ section.css({left: -(100 * topbar.data('index')) + '%'});
+ section.find('>.name').css({left: 100 * topbar.data('index') + '%'});
+ } else {
+ section.css({right: -(100 * topbar.data('index')) + '%'});
+ section.find('>.name').css({right: 100 * topbar.data('index') + '%'});
+ }
+
+ topbar.css('height', $this.siblings('ul').outerHeight(true) + topbar.data('height'));
+ }
+ });
+
+ S(window).off('.topbar').on('resize.fndtn.topbar', self.throttle(function () {
+ self.resize.call(self);
+ }, 50)).trigger('resize');
+
+ S('body').off('.topbar').on('click.fndtn.topbar touchstart.fndtn.topbar', function (e) {
+ var parent = S(e.target).closest('li').closest('li.hover');
+
+ if (parent.length > 0) {
+ return;
+ }
+
+ S('[' + self.attr_name() + '] li').removeClass('hover');
+ });
+
+ // Go up a level on Click
+ S(this.scope).on('click.fndtn.topbar', '[' + this.attr_name() + '] .has-dropdown .back', function (e) {
+ e.preventDefault();
+
+ var $this = S(this),
+ topbar = $this.closest('[' + self.attr_name() + ']'),
+ section = topbar.find('section, .section'),
+ settings = topbar.data(self.attr_name(true) + '-init'),
+ $movedLi = $this.closest('li.moved'),
+ $previousLevelUl = $movedLi.parent();
+
+ topbar.data('index', topbar.data('index') - 1);
+
+ if (!self.rtl) {
+ section.css({left: -(100 * topbar.data('index')) + '%'});
+ section.find('>.name').css({left: 100 * topbar.data('index') + '%'});
+ } else {
+ section.css({right: -(100 * topbar.data('index')) + '%'});
+ section.find('>.name').css({right: 100 * topbar.data('index') + '%'});
+ }
+
+ if (topbar.data('index') === 0) {
+ topbar.css('height', '');
+ } else {
+ topbar.css('height', $previousLevelUl.outerHeight(true) + topbar.data('height'));
+ }
+
+ setTimeout(function () {
+ $movedLi.removeClass('moved');
+ }, 300);
+ });
+ },
+
+ resize : function () {
+ var self = this;
+ self.S('[' + this.attr_name() + ']').each(function () {
+ var topbar = self.S(this),
+ settings = topbar.data(self.attr_name(true) + '-init');
+
+ var stickyContainer = topbar.parent('.' + self.settings.sticky_class);
+ var stickyOffset;
+
+ if (!self.breakpoint()) {
+ var doToggle = topbar.hasClass('expanded');
+ topbar
+ .css('height', '')
+ .removeClass('expanded')
+ .find('li')
+ .removeClass('hover');
+
+ if(doToggle) {
+ self.toggle(topbar);
+ }
+ }
+
+ if(stickyContainer.length > 0) {
+ if(stickyContainer.hasClass('fixed')) {
+ // Remove the fixed to allow for correct calculation of the offset.
+ stickyContainer.removeClass('fixed');
+
+ stickyOffset = stickyContainer.offset().top;
+ if(self.S(document.body).hasClass('f-topbar-fixed')) {
+ stickyOffset -= topbar.data('height');
+ }
+
+ topbar.data('stickyoffset', stickyOffset);
+ stickyContainer.addClass('fixed');
+ } else {
+ stickyOffset = stickyContainer.offset().top;
+ topbar.data('stickyoffset', stickyOffset);
+ }
+ }
+
+ });
+ },
+
+ breakpoint : function () {
+ return !matchMedia(Foundation.media_queries['topbar']).matches;
+ },
+
+ assemble : function (topbar) {
+ var self = this,
+ settings = topbar.data(this.attr_name(true) + '-init'),
+ section = self.S('section', topbar),
+ titlebar = $('> ul', topbar).first();
+
+ // Pull element out of the DOM for manipulation
+ section.detach();
+
+ self.S('.has-dropdown>a', section).each(function () {
+ var $link = self.S(this),
+ $dropdown = $link.siblings('.dropdown'),
+ url = $link.attr('href');
+
+ if (!$dropdown.find('.title.back').length) {
+ if (settings.mobile_show_parent_link && url && url.length > 1) {
+ var $titleLi = $('<li class="title back js-generated"><h5><a href="javascript:void(0)"></a></h5></li><li><a class="parent-link js-generated" href="' + url + '">' + $link.text() +'</a></li>');
+ } else {
+ var $titleLi = $('<li class="title back js-generated"><h5><a href="javascript:void(0)"></a></h5></li>');
+ }
+
+ // Copy link to subnav
+ if (settings.custom_back_text == true) {
+ $('h5>a', $titleLi).html(settings.back_text);
+ } else {
+ $('h5>a', $titleLi).html('« ' + $link.html());
+ }
+ $dropdown.prepend($titleLi);
+ }
+ });
+
+ // Put element back in the DOM
+ section.appendTo(topbar);
+
+ // check for sticky
+ this.sticky();
+
+ this.assembled(topbar);
+ },
+
+ assembled : function (topbar) {
+ topbar.data(this.attr_name(true), $.extend({}, topbar.data(this.attr_name(true)), {assembled: true}));
+ },
+
+ height : function (ul) {
+ var total = 0,
+ self = this;
+
+ $('> li', ul).each(function () { total += self.S(this).outerHeight(true); });
+
+ return total;
+ },
+
+ sticky : function () {
+ var $window = this.S(window),
+ self = this;
+
+ this.S(window).on('scroll', function() {
+ self.update_sticky_positioning();
+ });
+ },
+
+ update_sticky_positioning: function() {
+ var klass = '.' + this.settings.sticky_class,
+ $window = this.S(window),
+ self = this;
+
+
+ if (self.S(klass).length > 0) {
+ var distance = this.settings.sticky_topbar.data('stickyoffset');
+ if (!self.S(klass).hasClass('expanded')) {
+ if ($window.scrollTop() > (distance)) {
+ if (!self.S(klass).hasClass('fixed')) {
+ self.S(klass).addClass('fixed');
+ self.S('body').addClass('f-topbar-fixed');
+ }
+ } else if ($window.scrollTop() <= distance) {
+ if (self.S(klass).hasClass('fixed')) {
+ self.S(klass).removeClass('fixed');
+ self.S('body').removeClass('f-topbar-fixed');
+ }
+ }
+ }
+ }
+ },
+
+ off : function () {
+ this.S(this.scope).off('.fndtn.topbar');
+ this.S(window).off('.fndtn.topbar');
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+!function(a,b,c,d){"use strict";function e(a){return("string"==typeof a||a instanceof String)&&(a=a.replace(/^['\\/"]+|(;\s?})+|['\\/"]+$/g,"")),a}var f=function(b){for(var c=b.length;c--;)0===a("head").has("."+b[c]).length&&a("head").append('<meta class="'+b[c]+'">')};f(["foundation-mq-small","foundation-mq-medium","foundation-mq-large","foundation-mq-xlarge","foundation-mq-xxlarge","foundation-data-attribute-namespace"]),a(function(){"undefined"!=typeof FastClick&&"undefined"!=typeof c.body&&FastClick.attach(c.body)});var g=function(b,d){if("string"==typeof b){if(d){var e;return e=d.jquery?d[0]:d,a(e.querySelectorAll(b))}return a(c.querySelectorAll(b))}return a(b,d)},h=function(a){var b=[];return a||b.push("data"),this.namespace.length>0&&b.push(this.namespace),b.push(this.name),b.join("-")},f=function(b){for(var c=b.length;c--;)0===a("head").has("."+b[c]).length&&a("head").append('<meta class="'+b[c]+'">')},i=function(a){for(var b=a.split("-"),c=b.length,d=[];c--;)0!==c?d.push(b[c]):this.namespace.length>0?d.push(this.namespace,b[c]):d.push(b[c]);return d.reverse().join("-")},j=function(b,c){var d=this,e=!g(this).data(this.attr_name(!0));return"string"==typeof b?this[b].call(this,c):void(g(this.scope).is("["+this.attr_name()+"]")?(g(this.scope).data(this.attr_name(!0)+"-init",a.extend({},this.settings,c||b,this.data_options(g(this.scope)))),e&&this.events(this.scope)):g("["+this.attr_name()+"]",this.scope).each(function(){var e=!g(this).data(d.attr_name(!0)+"-init");g(this).data(d.attr_name(!0)+"-init",a.extend({},d.settings,c||b,d.data_options(g(this)))),e&&d.events(this)}))},k=function(a,b){function c(){b(a[0])}function d(){if(this.one("load",c),/MSIE (\d+\.\d+);/.test(navigator.userAgent)){var a=this.attr("src"),b=a.match(/\?/)?"&":"?";b+="random="+(new Date).getTime(),this.attr("src",a+b)}}return a.attr("src")?void(a[0].complete||4===a[0].readyState?c():d.call(a)):void c()};b.matchMedia=b.matchMedia||function(a){var b,c=a.documentElement,d=c.firstElementChild||c.firstChild,e=a.createElement("body"),f=a.createElement("div");return f.id="mq-test-1",f.style.cssText="position:absolute;top:-100em",e.style.background="none",e.appendChild(f),function(a){return f.innerHTML='­<style media="'+a+'"> #mq-test-1 { width: 42px; }</style>',c.insertBefore(e,d),b=42===f.offsetWidth,c.removeChild(e),{matches:b,media:a}}}(c),function(){function a(){c&&(f(a),jQuery.fx.tick())}for(var c,d=0,e=["webkit","moz"],f=b.requestAnimationFrame,g=b.cancelAnimationFrame;d<e.length&&!f;d++)f=b[e[d]+"RequestAnimationFrame"],g=g||b[e[d]+"CancelAnimationFrame"]||b[e[d]+"CancelRequestAnimationFrame"];f?(b.requestAnimationFrame=f,b.cancelAnimationFrame=g,jQuery.fx.timer=function(b){b()&&jQuery.timers.push(b)&&!c&&(c=!0,a())},jQuery.fx.stop=function(){c=!1}):(b.requestAnimationFrame=function(a){var c=(new Date).getTime(),e=Math.max(0,16-(c-d)),f=b.setTimeout(function(){a(c+e)},e);return d=c+e,f},b.cancelAnimationFrame=function(a){clearTimeout(a)})}(jQuery),b.Foundation={name:"Foundation",version:"5.1.1",media_queries:{small:g(".foundation-mq-small").css("font-family").replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g,""),medium:g(".foundation-mq-medium").css("font-family").replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g,""),large:g(".foundation-mq-large").css("font-family").replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g,""),xlarge:g(".foundation-mq-xlarge").css("font-family").replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g,""),xxlarge:g(".foundation-mq-xxlarge").css("font-family").replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g,"")},stylesheet:a("<style></style>").appendTo("head")[0].sheet,global:{namespace:""},init:function(a,b,c,d,e){var f=[a,c,d,e],h=[];if(this.rtl=/rtl/i.test(g("html").attr("dir")),this.scope=a||this.scope,this.set_namespace(),b&&"string"==typeof b&&!/reflow/i.test(b))this.libs.hasOwnProperty(b)&&h.push(this.init_lib(b,f));else for(var i in this.libs)h.push(this.init_lib(i,b));return a},init_lib:function(a,b){return this.libs.hasOwnProperty(a)?(this.patch(this.libs[a]),b&&b.hasOwnProperty(a)?this.libs[a].init.apply(this.libs[a],[this.scope,b[a]]):(b=b instanceof Array?b:Array(b),this.libs[a].init.apply(this.libs[a],b))):function(){}},patch:function(a){a.scope=this.scope,a.namespace=this.global.namespace,a.rtl=this.rtl,a.data_options=this.utils.data_options,a.attr_name=h,a.add_namespace=i,a.bindings=j,a.S=this.utils.S},inherit:function(a,b){for(var c=b.split(" "),d=c.length;d--;)this.utils.hasOwnProperty(c[d])&&(a[c[d]]=this.utils[c[d]])},set_namespace:function(){var b=a(".foundation-data-attribute-namespace").css("font-family");/false/i.test(b)||(this.global.namespace=b)},libs:{},utils:{S:g,throttle:function(a,b){var c=null;return function(){var d=this,e=arguments;clearTimeout(c),c=setTimeout(function(){a.apply(d,e)},b)}},debounce:function(a,b,c){var d,e;return function(){var f=this,g=arguments,h=function(){d=null,c||(e=a.apply(f,g))},i=c&&!d;return clearTimeout(d),d=setTimeout(h,b),i&&(e=a.apply(f,g)),e}},data_options:function(b){function c(a){return!isNaN(a-0)&&null!==a&&""!==a&&a!==!1&&a!==!0}function d(b){return"string"==typeof b?a.trim(b):b}var e,f,g,h={},i=function(a){var b=Foundation.global.namespace;return a.data(b.length>0?b+"-options":"options")},j=i(b);if("object"==typeof j)return j;for(g=(j||":").split(";"),e=g.length;e--;)f=g[e].split(":"),/true/i.test(f[1])&&(f[1]=!0),/false/i.test(f[1])&&(f[1]=!1),c(f[1])&&(f[1]=parseInt(f[1],10)),2===f.length&&f[0].length>0&&(h[d(f[0])]=d(f[1]));return h},register_media:function(b,c){Foundation.media_queries[b]===d&&(a("head").append('<meta class="'+c+'">'),Foundation.media_queries[b]=e(a("."+c).css("font-family")))},add_custom_rule:function(a,b){if(b===d)Foundation.stylesheet.insertRule(a,Foundation.stylesheet.cssRules.length);else{var c=Foundation.media_queries[b];c!==d&&Foundation.stylesheet.insertRule("@media "+Foundation.media_queries[b]+"{ "+a+" }")}},image_loaded:function(a,b){var c=this,d=a.length;a.each(function(){k(c.S(this),function(){d-=1,0==d&&b(a)})})},random_str:function(a){var b="0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz".split("");a||(a=Math.floor(Math.random()*b.length));for(var c="";a--;)c+=b[Math.floor(Math.random()*b.length)];return c}}},a.fn.foundation=function(){var a=Array.prototype.slice.call(arguments,0);return this.each(function(){return Foundation.init.apply(Foundation,[this].concat(a)),this})}}(jQuery,this,this.document),function(a,b,c){"use strict";Foundation.libs.abide={name:"abide",version:"5.1.1",settings:{live_validate:!0,focus_on_invalid:!0,error_labels:!0,timeout:1e3,patterns:{alpha:/^[a-zA-Z]+$/,alpha_numeric:/^[a-zA-Z0-9]+$/,integer:/^\d+$/,number:/-?(?:\d+|\d{1,3}(?:,\d{3})+)?(?:\.\d+)?/,password:/(?=^.{8,}$)((?=.*\d)|(?=.*\W+))(?![.\n])(?=.*[A-Z])(?=.*[a-z]).*$/,card:/^(?:4[0-9]{12}(?:[0-9]{3})?|5[1-5][0-9]{14}|6(?:011|5[0-9][0-9])[0-9]{12}|3[47][0-9]{13}|3(?:0[0-5]|[68][0-9])[0-9]{11}|(?:2131|1800|35\d{3})\d{11})$/,cvv:/^([0-9]){3,4}$/,email:/^[a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*$/,url:/(https?|ftp|file|ssh):\/\/(((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-zA-Z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-zA-Z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-zA-Z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-zA-Z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-zA-Z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-zA-Z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?/,domain:/^([a-zA-Z0-9]([a-zA-Z0-9\-]{0,61}[a-zA-Z0-9])?\.)+[a-zA-Z]{2,6}$/,datetime:/([0-2][0-9]{3})\-([0-1][0-9])\-([0-3][0-9])T([0-5][0-9])\:([0-5][0-9])\:([0-5][0-9])(Z|([\-\+]([0-1][0-9])\:00))/,date:/(?:19|20)[0-9]{2}-(?:(?:0[1-9]|1[0-2])-(?:0[1-9]|1[0-9]|2[0-9])|(?:(?!02)(?:0[1-9]|1[0-2])-(?:30))|(?:(?:0[13578]|1[02])-31))/,time:/(0[0-9]|1[0-9]|2[0-3])(:[0-5][0-9]){2}/,dateISO:/\d{4}[\/\-]\d{1,2}[\/\-]\d{1,2}/,month_day_year:/(0[1-9]|1[012])[- \/.](0[1-9]|[12][0-9]|3[01])[- \/.](19|20)\d\d/,color:/^#?([a-fA-F0-9]{6}|[a-fA-F0-9]{3})$/}},timer:null,init:function(a,b,c){this.bindings(b,c)},events:function(b){{var c=this,d=c.S(b).attr("novalidate","novalidate");d.data(this.attr_name(!0)+"-init")}this.invalid_attr=this.add_namespace("data-invalid"),d.off(".abide").on("submit.fndtn.abide validate.fndtn.abide",function(a){var b=/ajax/i.test(c.S(this).attr(c.attr_name()));return c.validate(c.S(this).find("input, textarea, select").get(),a,b)}).on("reset",function(){return c.reset(a(this))}).find("input, textarea, select").off(".abide").on("blur.fndtn.abide change.fndtn.abide",function(a){c.validate([this],a)}).on("keydown.fndtn.abide",function(b){var d=a(this).closest("form").data("abide-init");d.live_validate===!0&&(clearTimeout(c.timer),c.timer=setTimeout(function(){c.validate([this],b)}.bind(this),d.timeout))})},reset:function(b){b.removeAttr(this.invalid_attr),a(this.invalid_attr,b).removeAttr(this.invalid_attr),a(".error",b).not("small").removeClass("error")},validate:function(a,b,c){for(var d=this.parse_patterns(a),e=d.length,f=this.S(a[0]).closest("form"),g=/submit/.test(b.type),h=0;e>h;h++)if(!d[h]&&(g||c))return this.settings.focus_on_invalid&&a[h].focus(),f.trigger("invalid"),this.S(a[h]).closest("form").attr(this.invalid_attr,""),!1;return(g||c)&&f.trigger("valid"),f.removeAttr(this.invalid_attr),c?!1:!0},parse_patterns:function(a){for(var b=a.length,c=[];b--;)c.push(this.pattern(a[b]));return this.check_validation_and_apply_styles(c)},pattern:function(a){var b=a.getAttribute("type"),c="string"==typeof a.getAttribute("required"),d=a.getAttribute("pattern")||"";return this.settings.patterns.hasOwnProperty(d)&&d.length>0?[a,this.settings.patterns[d],c]:d.length>0?[a,new RegExp(d),c]:this.settings.patterns.hasOwnProperty(b)?[a,this.settings.patterns[b],c]:(d=/.*/,[a,d,c])},check_validation_and_apply_styles:function(b){for(var c=b.length,d=[];c--;){var e,f=b[c][0],g=b[c][2],h=f.value,i=this.S(f).parent(),j=f.getAttribute(this.add_namespace("data-equalto")),k="radio"===f.type,l="checkbox"===f.type,m=this.S('label[for="'+f.getAttribute("id")+'"]'),n=g?f.value.length>0:!0;e=i.is("label")?i.parent():i,k&&g?d.push(this.valid_radio(f,g)):l&&g?d.push(this.valid_checkbox(f,g)):j&&g?d.push(this.valid_equal(f,g,e)):b[c][1].test(h)&&n||!g&&f.value.length<1?(this.S(f).removeAttr(this.invalid_attr),e.removeClass("error"),m.length>0&&this.settings.error_labels&&m.removeClass("error"),d.push(!0),a(f).triggerHandler("valid")):(this.S(f).attr(this.invalid_attr,""),e.addClass("error"),m.length>0&&this.settings.error_labels&&m.addClass("error"),d.push(!1),a(f).triggerHandler("invalid"))}return d},valid_checkbox:function(a,b){var a=this.S(a),c=a.is(":checked")||!b;return c?a.removeAttr(this.invalid_attr).parent().removeClass("error"):a.attr(this.invalid_attr,"").parent().addClass("error"),c},valid_radio:function(a){for(var b=a.getAttribute("name"),d=c.getElementsByName(b),e=d.length,f=!1,g=0;e>g;g++)d[g].checked&&(f=!0);for(var g=0;e>g;g++)f?this.S(d[g]).removeAttr(this.invalid_attr).parent().removeClass("error"):this.S(d[g]).attr(this.invalid_attr,"").parent().addClass("error");return f},valid_equal:function(a,b,d){var e=c.getElementById(a.getAttribute(this.add_namespace("data-equalto"))).value,f=a.value,g=e===f;return g?(this.S(a).removeAttr(this.invalid_attr),d.removeClass("error")):(this.S(a).attr(this.invalid_attr,""),d.addClass("error")),g}}}(jQuery,this,this.document),function(a){"use strict";Foundation.libs.accordion={name:"accordion",version:"5.1.1",settings:{active_class:"active",toggleable:!0},init:function(a,b,c){this.bindings(b,c)},events:function(){var b=this,c=this.S;c(this.scope).off(".fndtn.accordion").on("click.fndtn.accordion","["+this.attr_name()+"] > dd > a",function(d){var e=c(this).closest("["+b.attr_name()+"]"),f=c("#"+this.href.split("#")[1]),g=c("dd > .content",e),h=a("> dd",e),i=e.data(b.attr_name(!0)+"-init"),j=c("dd > .content."+i.active_class,e),k=c("dd."+i.active_class,e);return d.preventDefault(),j[0]==f[0]&&i.toggleable?(k.toggleClass(i.active_class,!1),f.toggleClass(i.active_class,!1)):(g.removeClass(i.active_class),h.removeClass(i.active_class),void f.addClass(i.active_class).parent().addClass(i.active_class))})},off:function(){},reflow:function(){}}}(jQuery,this,this.document),function(a){"use strict";Foundation.libs.alert={name:"alert",version:"5.1.1",settings:{animation:"fadeOut",speed:300,callback:function(){}},init:function(a,b,c){this.bindings(b,c)},events:function(){var b=this,c=this.S;a(this.scope).off(".alert").on("click.fndtn.alert","["+this.attr_name()+"] a.close",function(a){var d=c(this).closest("["+b.attr_name()+"]"),e=d.data(b.attr_name(!0)+"-init")||b.settings;a.preventDefault(),d[e.animation](e.speed,function(){c(this).trigger("closed").remove(),e.callback()})})},reflow:function(){}}}(jQuery,this,this.document),function(a,b,c,d){"use strict";Foundation.libs.clearing={name:"clearing",version:"5.1.1",settings:{templates:{viewing:'<a href="#" class="clearing-close">×</a><div class="visible-img" style="display: none"><div class="clearing-touch-label"></div><img src="data:image/gif;base64,R0lGODlhAQABAAD/ACwAAAAAAQABAAACADs%3D" alt="" /><p class="clearing-caption"></p><a href="#" class="clearing-main-prev"><span></span></a><a href="#" class="clearing-main-next"><span></span></a></div>'},close_selectors:".clearing-close",touch_label:"← Swipe to Advance →",init:!1,locked:!1},init:function(a,b,c){var d=this;Foundation.inherit(this,"throttle image_loaded"),this.bindings(b,c),d.S(this.scope).is("["+this.attr_name()+"]")?this.assemble(d.S("li",this.scope)):d.S("["+this.attr_name()+"]",this.scope).each(function(){d.assemble(d.S("li",this))})},events:function(a){var c=this,d=c.S;d(this.scope).off(".clearing").on("click.fndtn.clearing","ul["+this.attr_name()+"] li",function(a,b,e){var b=b||d(this),e=e||b,f=b.next("li"),g=b.closest("["+c.attr_name()+"]").data(c.attr_name(!0)+"-init"),h=d(a.target);a.preventDefault(),g||(c.init(),g=b.closest("["+c.attr_name()+"]").data(c.attr_name(!0)+"-init")),e.hasClass("visible")&&b[0]===e[0]&&f.length>0&&c.is_open(b)&&(e=f,h=d("img",e)),c.open(h,b,e),c.update_paddles(e)}).on("click.fndtn.clearing",".clearing-main-next",function(a){c.nav(a,"next")}).on("click.fndtn.clearing",".clearing-main-prev",function(a){c.nav(a,"prev")}).on("click.fndtn.clearing",this.settings.close_selectors,function(a){Foundation.libs.clearing.close(a,this)}).on("keydown.fndtn.clearing",function(a){c.keydown(a)}),d(b).off(".clearing").on("resize.fndtn.clearing",function(){c.resize()}),this.swipe_events(a)},swipe_events:function(){var a=this,b=a.S;b(this.scope).on("touchstart.fndtn.clearing",".visible-img",function(a){a.touches||(a=a.originalEvent);var c={start_page_x:a.touches[0].pageX,start_page_y:a.touches[0].pageY,start_time:(new Date).getTime(),delta_x:0,is_scrolling:d};b(this).data("swipe-transition",c),a.stopPropagation()}).on("touchmove.fndtn.clearing",".visible-img",function(c){if(c.touches||(c=c.originalEvent),!(c.touches.length>1||c.scale&&1!==c.scale)){var d=b(this).data("swipe-transition");if("undefined"==typeof d&&(d={}),d.delta_x=c.touches[0].pageX-d.start_page_x,"undefined"==typeof d.is_scrolling&&(d.is_scrolling=!!(d.is_scrolling||Math.abs(d.delta_x)<Math.abs(c.touches[0].pageY-d.start_page_y))),!d.is_scrolling&&!d.active){c.preventDefault();var e=d.delta_x<0?"next":"prev";d.active=!0,a.nav(c,e)}}}).on("touchend.fndtn.clearing",".visible-img",function(a){b(this).data("swipe-transition",{}),a.stopPropagation()})},assemble:function(b){var c=b.parent();if(!c.parent().hasClass("carousel")){c.after('<div id="foundationClearingHolder"></div>');var d=this.S("#foundationClearingHolder"),e=c.data(this.attr_name(!0)+"-init"),f=c.detach(),g={grid:'<div class="carousel">'+f[0].outerHTML+"</div>",viewing:e.templates.viewing},h='<div class="clearing-assembled"><div>'+g.viewing+g.grid+"</div></div>",i=this.settings.touch_label;Modernizr.touch&&(h=a(h).find(".clearing-touch-label").html(i).end()),d.after(h).remove()}},open:function(a,b,c){var d=this,e=c.closest(".clearing-assembled"),f=d.S("div",e).first(),g=d.S(".visible-img",f),h=d.S("img",g).not(a),i=d.S(".clearing-touch-label",f);this.locked()||(h.attr("src",this.load(a)).css("visibility","hidden"),this.image_loaded(h,function(){h.css("visibility","visible"),e.addClass("clearing-blackout"),f.addClass("clearing-container"),g.show(),this.fix_height(c).caption(d.S(".clearing-caption",g),a).center_and_label(h,i).shift(b,c,function(){c.siblings().removeClass("visible"),c.addClass("visible")})}.bind(this)))},close:function(b,c){b.preventDefault();var d,e,f=function(a){return/blackout/.test(a.selector)?a:a.closest(".clearing-blackout")}(a(c));return c===b.target&&f&&(d=a("div",f).first(),e=a(".visible-img",d),this.settings.prev_index=0,a("ul["+this.attr_name()+"]",f).attr("style","").closest(".clearing-blackout").removeClass("clearing-blackout"),d.removeClass("clearing-container"),e.hide()),!1},is_open:function(a){return a.parent().prop("style").length>0},keydown:function(b){var c=a("ul["+this.attr_name()+"]",".clearing-blackout"),d=this.rtl?37:39,e=this.rtl?39:37,f=27;b.which===d&&this.go(c,"next"),b.which===e&&this.go(c,"prev"),b.which===f&&this.S("a.clearing-close").trigger("click")},nav:function(b,c){var d=a("ul["+this.attr_name()+"]",".clearing-blackout");b.preventDefault(),this.go(d,c)},resize:function(){var b=a("img",".clearing-blackout .visible-img"),c=a(".clearing-touch-label",".clearing-blackout");b.length&&this.center_and_label(b,c)},fix_height:function(a){var b=a.parent().children(),c=this;return b.each(function(){var a=c.S(this),b=a.find("img");a.height()>b.outerHeight()&&a.addClass("fix-height")}).closest("ul").width(100*b.length+"%"),this},update_paddles:function(a){var b=a.closest(".carousel").siblings(".visible-img");a.next().length>0?this.S(".clearing-main-next",b).removeClass("disabled"):this.S(".clearing-main-next",b).addClass("disabled"),a.prev().length>0?this.S(".clearing-main-prev",b).removeClass("disabled"):this.S(".clearing-main-prev",b).addClass("disabled")},center_and_label:function(a,b){return this.rtl?(a.css({marginRight:-(a.outerWidth()/2),marginTop:-(a.outerHeight()/2),left:"auto",right:"50%"}),b.css({marginRight:-(b.outerWidth()/2),marginTop:-(a.outerHeight()/2)-b.outerHeight()-10,left:"auto",right:"50%"})):(a.css({marginLeft:-(a.outerWidth()/2),marginTop:-(a.outerHeight()/2)}),b.css({marginLeft:-(b.outerWidth()/2),marginTop:-(a.outerHeight()/2)-b.outerHeight()-10})),this},load:function(a){if("A"===a[0].nodeName)var b=a.attr("href");else var b=a.parent().attr("href");return this.preload(a),b?b:a.attr("src")},preload:function(a){this.img(a.closest("li").next()).img(a.closest("li").prev())},img:function(a){if(a.length){var b=new Image,c=this.S("a",a);b.src=c.length?c.attr("href"):this.S("img",a).attr("src")}return this},caption:function(a,b){var c=b.data("caption");return c?a.html(c).show():a.text("").hide(),this},go:function(a,b){var c=this.S(".visible",a),d=c[b]();d.length&&this.S("img",d).trigger("click",[c,d])},shift:function(a,b,c){var d,e=b.parent(),f=this.settings.prev_index||b.index(),g=this.direction(e,a,b),h=this.rtl?"right":"left",i=parseInt(e.css("left"),10),j=b.outerWidth(),k={};b.index()===f||/skip/.test(g)?/skip/.test(g)&&(d=b.index()-this.settings.up_count,this.lock(),d>0?(k[h]=-(d*j),e.animate(k,300,this.unlock())):(k[h]=0,e.animate(k,300,this.unlock()))):/left/.test(g)?(this.lock(),k[h]=i+j,e.animate(k,300,this.unlock())):/right/.test(g)&&(this.lock(),k[h]=i-j,e.animate(k,300,this.unlock())),c()},direction:function(a,b,c){var d,e=this.S("li",a),f=e.outerWidth()+e.outerWidth()/4,g=Math.floor(this.S(".clearing-container").outerWidth()/f)-1,h=e.index(c);return this.settings.up_count=g,d=this.adjacent(this.settings.prev_index,h)?h>g&&h>this.settings.prev_index?"right":h>g-1&&h<=this.settings.prev_index?"left":!1:"skip",this.settings.prev_index=h,d},adjacent:function(a,b){for(var c=b+1;c>=b-1;c--)if(c===a)return!0;return!1},lock:function(){this.settings.locked=!0},unlock:function(){this.settings.locked=!1},locked:function(){return this.settings.locked},off:function(){this.S(this.scope).off(".fndtn.clearing"),this.S(b).off(".fndtn.clearing")},reflow:function(){this.init()}}}(jQuery,this,this.document),function(a,b){"use strict";Foundation.libs.dropdown={name:"dropdown",version:"5.1.1",settings:{active_class:"open",is_hover:!1,opened:function(){},closed:function(){}},init:function(a,b,c){Foundation.inherit(this,"throttle"),this.bindings(b,c)},events:function(){var c=this,d=c.S;d(this.scope).off(".dropdown").on("click.fndtn.dropdown","["+this.attr_name()+"]",function(a){var b=d(this).data(c.attr_name(!0)+"-init")||c.settings;a.preventDefault(),(!b.is_hover||Modernizr.touch)&&c.toggle(d(this))}).on("mouseenter.fndtn.dropdown","["+this.attr_name()+"], ["+this.attr_name()+"-content]",function(a){var b=d(this);if(clearTimeout(c.timeout),b.data(c.data_attr()))var e=d("#"+b.data(c.data_attr())),f=b;else{var e=b;f=d("["+c.attr_name()+"='"+e.attr("id")+"']")}var g=f.data(c.attr_name(!0)+"-init")||c.settings;d(a.target).data(c.data_attr())&&g.is_hover&&c.closeall.call(c),g.is_hover&&c.open.apply(c,[e,f])}).on("mouseleave.fndtn.dropdown","["+this.attr_name()+"], ["+this.attr_name()+"-content]",function(){var a=d(this);c.timeout=setTimeout(function(){if(a.data(c.data_attr())){var b=a.data(c.data_attr(!0)+"-init")||c.settings;b.is_hover&&c.close.call(c,d("#"+a.data(c.data_attr())))}else{var e=d("["+c.attr_name()+'="'+d(this).attr("id")+'"]'),b=e.data(c.attr_name(!0)+"-init")||c.settings;b.is_hover&&c.close.call(c,a)}}.bind(this),150)}).on("click.fndtn.dropdown",function(b){var e=d(b.target).closest("["+c.attr_name()+"-content]");if(!d(b.target).data(c.data_attr())&&!d(b.target).parent().data(c.data_attr()))return!d(b.target).data("revealId")&&e.length>0&&(d(b.target).is("["+c.attr_name()+"-content]")||a.contains(e.first()[0],b.target))?void b.stopPropagation():void c.close.call(c,d("["+c.attr_name()+"-content]"))}).on("opened.fndtn.dropdown","["+c.attr_name()+"-content]",function(){c.settings.opened.call(this)}).on("closed.fndtn.dropdown","["+c.attr_name()+"-content]",function(){c.settings.closed.call(this)}),d(b).off(".dropdown").on("resize.fndtn.dropdown",c.throttle(function(){c.resize.call(c)},50)).trigger("resize")},close:function(a){var b=this;a.each(function(){b.S(this).hasClass(b.settings.active_class)&&(b.S(this).css(Foundation.rtl?"right":"left","-99999px").removeClass(b.settings.active_class),b.S(this).trigger("closed"))})},closeall:function(){var b=this;a.each(b.S("["+this.attr_name()+"-content]"),function(){b.close.call(b,b.S(this))})},open:function(a,b){this.css(a.addClass(this.settings.active_class),b),a.trigger("opened")},data_attr:function(){return this.namespace.length>0?this.namespace+"-"+this.name:this.name},toggle:function(a){var b=this.S("#"+a.data(this.data_attr()));0!==b.length&&(this.close.call(this,this.S("["+this.attr_name()+"-content]").not(b)),b.hasClass(this.settings.active_class)?this.close.call(this,b):(this.close.call(this,this.S("["+this.attr_name()+"-content]")),this.open.call(this,b,a)))},resize:function(){var a=this.S("["+this.attr_name()+"-content].open"),b=this.S("["+this.attr_name()+"='"+a.attr("id")+"']");a.length&&b.length&&this.css(a,b)},css:function(a,c){var d=a.offsetParent(),e=c.offset();if(e.top-=d.offset().top,e.left-=d.offset().left,this.small())a.css({position:"absolute",width:"95%","max-width":"none",top:e.top+c.outerHeight()}),a.css(Foundation.rtl?"right":"left","2.5%");else{if(!Foundation.rtl&&this.S(b).width()>a.outerWidth()+c.offset().left){var f=e.left;a.hasClass("right")&&a.removeClass("right")}else{a.hasClass("right")||a.addClass("right");var f=e.left-(a.outerWidth()-c.outerWidth())}a.attr("style","").css({position:"absolute",top:e.top+c.outerHeight(),left:f})}return a},small:function(){return matchMedia(Foundation.media_queries.small).matches&&!matchMedia(Foundation.media_queries.medium).matches},off:function(){this.S(this.scope).off(".fndtn.dropdown"),this.S("html, body").off(".fndtn.dropdown"),this.S(b).off(".fndtn.dropdown"),this.S("[data-dropdown-content]").off(".fndtn.dropdown"),this.settings.init=!1},reflow:function(){}}}(jQuery,this,this.document),function(a,b){"use strict";Foundation.libs.equalizer={name:"equalizer",version:"5.1.1",settings:{use_tallest:!0,before_height_change:a.noop,after_height_change:a.noop},init:function(a,b,c){this.bindings(b,c),this.reflow()},events:function(){this.S(b).off(".equalizer").on("resize.fndtn.equalizer",function(){this.reflow()}.bind(this))},equalize:function(b){var c=!1,d=b.find("["+this.attr_name()+"-watch]"),e=d.first().offset().top,f=b.data(this.attr_name(!0)+"-init");if(0!==d.length&&(f.before_height_change(),b.trigger("before-height-change"),d.height("inherit"),d.each(function(){var b=a(this);b.offset().top!==e&&(c=!0)}),!c)){var g=d.map(function(){return a(this).outerHeight()});if(f.use_tallest){var h=Math.max.apply(null,g);d.height(h)}else{var i=Math.min.apply(null,g);d.height(i)}f.after_height_change(),b.trigger("after-height-change")}},reflow:function(){var b=this;this.S("["+this.attr_name()+"]",this.scope).each(function(){b.equalize(a(this))})}}}(jQuery,this,this.document),function(a,b){"use strict";Foundation.libs.interchange={name:"interchange",version:"5.1.1",cache:{},images_loaded:!1,nodes_loaded:!1,settings:{load_attr:"interchange",named_queries:{"default":"only screen",small:Foundation.media_queries.small,medium:Foundation.media_queries.medium,large:Foundation.media_queries.large,xlarge:Foundation.media_queries.xlarge,xxlarge:Foundation.media_queries.xxlarge,landscape:"only screen and (orientation: landscape)",portrait:"only screen and (orientation: portrait)",retina:"only screen and (-webkit-min-device-pixel-ratio: 2),only screen and (min--moz-device-pixel-ratio: 2),only screen and (-o-min-device-pixel-ratio: 2/1),only screen and (min-device-pixel-ratio: 2),only screen and (min-resolution: 192dpi),only screen and (min-resolution: 2dppx)"},directives:{replace:function(b,c,d){if(/IMG/.test(b[0].nodeName)){var e=b[0].src;if(new RegExp(c,"i").test(e))return;return b[0].src=c,d(b[0].src)}var f=b.data(this.data_attr+"-last-path");if(f!=c)return a.get(c,function(a){b.html(a),b.data(this.data_attr+"-last-path",c),d()})}}},init:function(b,c,d){Foundation.inherit(this,"throttle random_str"),this.data_attr=this.set_data_attr(),a.extend(!0,this.settings,c,d),this.bindings(c,d),this.load("images"),this.load("nodes")},events:function(){var c=this;return a(b).off(".interchange").on("resize.fndtn.interchange",c.throttle(function(){c.resize()},50)),this},resize:function(){var b=this.cache;if(!this.images_loaded||!this.nodes_loaded)return void setTimeout(a.proxy(this.resize,this),50);for(var c in b)if(b.hasOwnProperty(c)){var d=this.results(c,b[c]);d&&this.settings.directives[d.scenario[1]].call(this,d.el,d.scenario[0],function(){if(arguments[0]instanceof Array)var a=arguments[0];else var a=Array.prototype.slice.call(arguments,0);d.el.trigger(d.scenario[1],a)})}},results:function(a,b){var c=b.length;if(c>0)for(var d=this.S("["+this.add_namespace("data-uuid")+'="'+a+'"]');c--;){var e,f=b[c][2];if(e=matchMedia(this.settings.named_queries.hasOwnProperty(f)?this.settings.named_queries[f]:f),e.matches)return{el:d,scenario:b[c]}}return!1},load:function(a,b){return("undefined"==typeof this["cached_"+a]||b)&&this["update_"+a](),this["cached_"+a]},update_images:function(){var a=this.S("img["+this.data_attr+"]"),b=a.length,c=b,d=0,e=this.data_attr;for(this.cache={},this.cached_images=[],this.images_loaded=0===b;c--;){if(d++,a[c]){var f=a[c].getAttribute(e)||"";f.length>0&&this.cached_images.push(a[c])}d===b&&(this.images_loaded=!0,this.enhance("images"))}return this},update_nodes:function(){var a=this.S("["+this.data_attr+"]").not("img"),b=a.length,c=b,d=0,e=this.data_attr;for(this.cached_nodes=[],this.nodes_loaded=0===b;c--;){d++;var f=a[c].getAttribute(e)||"";f.length>0&&this.cached_nodes.push(a[c]),d===b&&(this.nodes_loaded=!0,this.enhance("nodes"))}return this},enhance:function(c){for(var d=this["cached_"+c].length;d--;)this.object(a(this["cached_"+c][d]));return a(b).trigger("resize")},parse_params:function(a,b,c){return[this.trim(a),this.convert_directive(b),this.trim(c)]},convert_directive:function(a){var b=this.trim(a);return b.length>0?b:"replace"},object:function(a){var b=this.parse_data_attr(a),c=[],d=b.length;if(d>0)for(;d--;){var e=b[d].split(/\((.*?)(\))$/);if(e.length>1){var f=e[0].split(","),g=this.parse_params(f[0],f[1],e[1]);c.push(g)}}return this.store(a,c)},uuid:function(a){function b(){return d.random_str(6)}var c=a||"-",d=this;return b()+b()+c+b()+c+b()+c+b()+c+b()+b()+b()},store:function(a,b){var c=this.uuid(),d=a.data(this.add_namespace("uuid",!0));return this.cache[d]?this.cache[d]:(a.attr(this.add_namespace("data-uuid"),c),this.cache[c]=b)},trim:function(b){return"string"==typeof b?a.trim(b):b},set_data_attr:function(a){return a?this.namespace.length>0?this.namespace+"-"+this.settings.load_attr:this.settings.load_attr:this.namespace.length>0?"data-"+this.namespace+"-"+this.settings.load_attr:"data-"+this.settings.load_attr},parse_data_attr:function(a){for(var b=a.attr(this.attr_name()).split(/\[(.*?)\]/),c=b.length,d=[];c--;)b[c].replace(/[\W\d]+/,"").length>4&&d.push(b[c]);return d},reflow:function(){this.load("images",!0),this.load("nodes",!0)}}}(jQuery,this,this.document),function(a,b,c,d){"use strict";Foundation.libs.joyride={name:"joyride",version:"5.1.1",defaults:{expose:!1,modal:!0,tip_location:"bottom",nub_position:"auto",scroll_speed:1500,scroll_animation:"linear",timer:0,start_timer_on_click:!0,start_offset:0,next_button:!0,tip_animation:"fade",pause_after:[],exposed:[],tip_animation_fade_speed:300,cookie_monster:!1,cookie_name:"joyride",cookie_domain:!1,cookie_expires:365,tip_container:"body",tip_location_patterns:{top:["bottom"],bottom:[],left:["right","top","bottom"],right:["left","top","bottom"]},post_ride_callback:function(){},post_step_callback:function(){},pre_step_callback:function(){},pre_ride_callback:function(){},post_expose_callback:function(){},template:{link:'<a href="#close" class="joyride-close-tip">×</a>',timer:'<div class="joyride-timer-indicator-wrap"><span class="joyride-timer-indicator"></span></div>',tip:'<div class="joyride-tip-guide"><span class="joyride-nub"></span></div>',wrapper:'<div class="joyride-content-wrapper"></div>',button:'<a href="#" class="small button joyride-next-tip"></a>',modal:'<div class="joyride-modal-bg"></div>',expose:'<div class="joyride-expose-wrapper"></div>',expose_cover:'<div class="joyride-expose-cover"></div>'},expose_add_class:""},init:function(a,b,c){Foundation.inherit(this,"throttle random_str"),this.settings=this.defaults,this.bindings(b,c)},events:function(){var c=this;a(this.scope).off(".joyride").on("click.fndtn.joyride",".joyride-next-tip, .joyride-modal-bg",function(a){a.preventDefault(),this.settings.$li.next().length<1?this.end():this.settings.timer>0?(clearTimeout(this.settings.automate),this.hide(),this.show(),this.startTimer()):(this.hide(),this.show())}.bind(this)).on("click.fndtn.joyride",".joyride-close-tip",function(a){a.preventDefault(),this.end()
+}.bind(this)),a(b).off(".joyride").on("resize.fndtn.joyride",c.throttle(function(){if(a("["+c.attr_name()+"]").length>0&&c.settings.$next_tip){if(c.settings.exposed.length>0){var b=a(c.settings.exposed);b.each(function(){var b=a(this);c.un_expose(b),c.expose(b)})}c.is_phone()?c.pos_phone():c.pos_default(!1,!0)}},100))},start:function(){var b=this,c=a("["+this.attr_name()+"]",this.scope),d=["timer","scrollSpeed","startOffset","tipAnimationFadeSpeed","cookieExpires"],e=d.length;!c.length>0||(this.settings.init||this.events(),this.settings=c.data(this.attr_name(!0)+"-init"),this.settings.$content_el=c,this.settings.$body=a(this.settings.tip_container),this.settings.body_offset=a(this.settings.tip_container).position(),this.settings.$tip_content=this.settings.$content_el.find("> li"),this.settings.paused=!1,this.settings.attempts=0,"function"!=typeof a.cookie&&(this.settings.cookie_monster=!1),(!this.settings.cookie_monster||this.settings.cookie_monster&&!a.cookie(this.settings.cookie_name))&&(this.settings.$tip_content.each(function(c){var f=a(this);this.settings=a.extend({},b.defaults,b.data_options(f));for(var g=e;g--;)b.settings[d[g]]=parseInt(b.settings[d[g]],10);b.create({$li:f,index:c})}),!this.settings.start_timer_on_click&&this.settings.timer>0?(this.show("init"),this.startTimer()):this.show("init")))},resume:function(){this.set_li(),this.show()},tip_template:function(b){var c,d;return b.tip_class=b.tip_class||"",c=a(this.settings.template.tip).addClass(b.tip_class),d=a.trim(a(b.li).html())+this.button_text(b.button_text)+this.settings.template.link+this.timer_instance(b.index),c.append(a(this.settings.template.wrapper)),c.first().attr(this.add_namespace("data-index"),b.index),a(".joyride-content-wrapper",c).append(d),c[0]},timer_instance:function(b){var c;return c=0===b&&this.settings.start_timer_on_click&&this.settings.timer>0||0===this.settings.timer?"":a(this.settings.template.timer)[0].outerHTML},button_text:function(b){return this.settings.next_button?(b=a.trim(b)||"Next",b=a(this.settings.template.button).append(b)[0].outerHTML):b="",b},create:function(b){console.log(b.$li);var c=b.$li.attr(this.add_namespace("data-button"))||b.$li.attr(this.add_namespace("data-text")),d=b.$li.attr("class"),e=a(this.tip_template({tip_class:d,index:b.index,button_text:c,li:b.$li}));a(this.settings.tip_container).append(e)},show:function(b){var c=null;this.settings.$li===d||-1===a.inArray(this.settings.$li.index(),this.settings.pause_after)?(this.settings.paused?this.settings.paused=!1:this.set_li(b),this.settings.attempts=0,this.settings.$li.length&&this.settings.$target.length>0?(b&&(this.settings.pre_ride_callback(this.settings.$li.index(),this.settings.$next_tip),this.settings.modal&&this.show_modal()),this.settings.pre_step_callback(this.settings.$li.index(),this.settings.$next_tip),this.settings.modal&&this.settings.expose&&this.expose(),this.settings.tip_settings=a.extend({},this.settings,this.data_options(this.settings.$li)),this.settings.timer=parseInt(this.settings.timer,10),this.settings.tip_settings.tip_location_pattern=this.settings.tip_location_patterns[this.settings.tip_settings.tip_location],/body/i.test(this.settings.$target.selector)||this.scroll_to(),this.is_phone()?this.pos_phone(!0):this.pos_default(!0),c=this.settings.$next_tip.find(".joyride-timer-indicator"),/pop/i.test(this.settings.tip_animation)?(c.width(0),this.settings.timer>0?(this.settings.$next_tip.show(),setTimeout(function(){c.animate({width:c.parent().width()},this.settings.timer,"linear")}.bind(this),this.settings.tip_animation_fade_speed)):this.settings.$next_tip.show()):/fade/i.test(this.settings.tip_animation)&&(c.width(0),this.settings.timer>0?(this.settings.$next_tip.fadeIn(this.settings.tip_animation_fade_speed).show(),setTimeout(function(){c.animate({width:c.parent().width()},this.settings.timer,"linear")}.bind(this),this.settings.tip_animation_fadeSpeed)):this.settings.$next_tip.fadeIn(this.settings.tip_animation_fade_speed)),this.settings.$current_tip=this.settings.$next_tip):this.settings.$li&&this.settings.$target.length<1?this.show():this.end()):this.settings.paused=!0},is_phone:function(){return matchMedia(Foundation.media_queries.small).matches&&!matchMedia(Foundation.media_queries.medium).matches},hide:function(){this.settings.modal&&this.settings.expose&&this.un_expose(),this.settings.modal||a(".joyride-modal-bg").hide(),this.settings.$current_tip.css("visibility","hidden"),setTimeout(a.proxy(function(){this.hide(),this.css("visibility","visible")},this.settings.$current_tip),0),this.settings.post_step_callback(this.settings.$li.index(),this.settings.$current_tip)},set_li:function(a){a?(this.settings.$li=this.settings.$tip_content.eq(this.settings.start_offset),this.set_next_tip(),this.settings.$current_tip=this.settings.$next_tip):(this.settings.$li=this.settings.$li.next(),this.set_next_tip()),this.set_target()},set_next_tip:function(){this.settings.$next_tip=a(".joyride-tip-guide").eq(this.settings.$li.index()),this.settings.$next_tip.data("closed","")},set_target:function(){console.log(this.add_namespace("data-class"));var b=this.settings.$li.attr(this.add_namespace("data-class")),d=this.settings.$li.attr(this.add_namespace("data-id")),e=function(){return d?a(c.getElementById(d)):b?a("."+b).first():a("body")};console.log(b,d),this.settings.$target=e()},scroll_to:function(){var c,d;c=a(b).height()/2,d=Math.ceil(this.settings.$target.offset().top-c+this.settings.$next_tip.outerHeight()),0!=d&&a("html, body").animate({scrollTop:d},this.settings.scroll_speed,"swing")},paused:function(){return-1===a.inArray(this.settings.$li.index()+1,this.settings.pause_after)},restart:function(){this.hide(),this.settings.$li=d,this.show("init")},pos_default:function(c,d){var e=(Math.ceil(a(b).height()/2),this.settings.$next_tip.offset(),this.settings.$next_tip.find(".joyride-nub")),f=Math.ceil(e.outerWidth()/2),g=Math.ceil(e.outerHeight()/2),h=c||!1;h&&(this.settings.$next_tip.css("visibility","hidden"),this.settings.$next_tip.show()),"undefined"==typeof d&&(d=!1),/body/i.test(this.settings.$target.selector)?this.settings.$li.length&&this.pos_modal(e):(this.bottom()?(this.settings.$next_tip.css(this.rtl?{top:this.settings.$target.offset().top+g+this.settings.$target.outerHeight(),left:this.settings.$target.offset().left+this.settings.$target.outerWidth()-this.settings.$next_tip.outerWidth()}:{top:this.settings.$target.offset().top+g+this.settings.$target.outerHeight(),left:this.settings.$target.offset().left}),this.nub_position(e,this.settings.tip_settings.nub_position,"top")):this.top()?(this.settings.$next_tip.css(this.rtl?{top:this.settings.$target.offset().top-this.settings.$next_tip.outerHeight()-g,left:this.settings.$target.offset().left+this.settings.$target.outerWidth()-this.settings.$next_tip.outerWidth()}:{top:this.settings.$target.offset().top-this.settings.$next_tip.outerHeight()-g,left:this.settings.$target.offset().left}),this.nub_position(e,this.settings.tip_settings.nub_position,"bottom")):this.right()?(this.settings.$next_tip.css({top:this.settings.$target.offset().top,left:this.outerWidth(this.settings.$target)+this.settings.$target.offset().left+f}),this.nub_position(e,this.settings.tip_settings.nub_position,"left")):this.left()&&(this.settings.$next_tip.css({top:this.settings.$target.offset().top,left:this.settings.$target.offset().left-this.outerWidth(this.settings.$next_tip)-f}),this.nub_position(e,this.settings.tip_settings.nub_position,"right")),!this.visible(this.corners(this.settings.$next_tip))&&this.settings.attempts<this.settings.tip_settings.tip_location_pattern.length&&(e.removeClass("bottom").removeClass("top").removeClass("right").removeClass("left"),this.settings.tip_settings.tip_location=this.settings.tip_settings.tip_location_pattern[this.settings.attempts],this.settings.attempts++,this.pos_default())),h&&(this.settings.$next_tip.hide(),this.settings.$next_tip.css("visibility","visible"))},pos_phone:function(b){var c=this.settings.$next_tip.outerHeight(),d=(this.settings.$next_tip.offset(),this.settings.$target.outerHeight()),e=a(".joyride-nub",this.settings.$next_tip),f=Math.ceil(e.outerHeight()/2),g=b||!1;e.removeClass("bottom").removeClass("top").removeClass("right").removeClass("left"),g&&(this.settings.$next_tip.css("visibility","hidden"),this.settings.$next_tip.show()),/body/i.test(this.settings.$target.selector)?this.settings.$li.length&&this.pos_modal(e):this.top()?(this.settings.$next_tip.offset({top:this.settings.$target.offset().top-c-f}),e.addClass("bottom")):(this.settings.$next_tip.offset({top:this.settings.$target.offset().top+d+f}),e.addClass("top")),g&&(this.settings.$next_tip.hide(),this.settings.$next_tip.css("visibility","visible"))},pos_modal:function(a){this.center(),a.hide(),this.show_modal()},show_modal:function(){if(!this.settings.$next_tip.data("closed")){var b=a(".joyride-modal-bg");b.length<1&&a("body").append(this.settings.template.modal).show(),/pop/i.test(this.settings.tip_animation)?b.show():b.fadeIn(this.settings.tip_animation_fade_speed)}},expose:function(){var c,d,e,f,g,h="expose-"+this.random_str(6);if(arguments.length>0&&arguments[0]instanceof a)e=arguments[0];else{if(!this.settings.$target||/body/i.test(this.settings.$target.selector))return!1;e=this.settings.$target}return e.length<1?(b.console&&console.error("element not valid",e),!1):(c=a(this.settings.template.expose),this.settings.$body.append(c),c.css({top:e.offset().top,left:e.offset().left,width:e.outerWidth(!0),height:e.outerHeight(!0)}),d=a(this.settings.template.expose_cover),f={zIndex:e.css("z-index"),position:e.css("position")},g=null==e.attr("class")?"":e.attr("class"),e.css("z-index",parseInt(c.css("z-index"))+1),"static"==f.position&&e.css("position","relative"),e.data("expose-css",f),e.data("orig-class",g),e.attr("class",g+" "+this.settings.expose_add_class),d.css({top:e.offset().top,left:e.offset().left,width:e.outerWidth(!0),height:e.outerHeight(!0)}),this.settings.modal&&this.show_modal(),this.settings.$body.append(d),c.addClass(h),d.addClass(h),e.data("expose",h),this.settings.post_expose_callback(this.settings.$li.index(),this.settings.$next_tip,e),void this.add_exposed(e))},un_expose:function(){var c,d,e,f,g,h=!1;if(arguments.length>0&&arguments[0]instanceof a)d=arguments[0];else{if(!this.settings.$target||/body/i.test(this.settings.$target.selector))return!1;d=this.settings.$target}return d.length<1?(b.console&&console.error("element not valid",d),!1):(c=d.data("expose"),e=a("."+c),arguments.length>1&&(h=arguments[1]),h===!0?a(".joyride-expose-wrapper,.joyride-expose-cover").remove():e.remove(),f=d.data("expose-css"),"auto"==f.zIndex?d.css("z-index",""):d.css("z-index",f.zIndex),f.position!=d.css("position")&&("static"==f.position?d.css("position",""):d.css("position",f.position)),g=d.data("orig-class"),d.attr("class",g),d.removeData("orig-classes"),d.removeData("expose"),d.removeData("expose-z-index"),void this.remove_exposed(d))},add_exposed:function(b){this.settings.exposed=this.settings.exposed||[],b instanceof a||"object"==typeof b?this.settings.exposed.push(b[0]):"string"==typeof b&&this.settings.exposed.push(b)},remove_exposed:function(b){var c,d;for(b instanceof a?c=b[0]:"string"==typeof b&&(c=b),this.settings.exposed=this.settings.exposed||[],d=this.settings.exposed.length;d--;)if(this.settings.exposed[d]==c)return void this.settings.exposed.splice(d,1)},center:function(){var c=a(b);return this.settings.$next_tip.css({top:(c.height()-this.settings.$next_tip.outerHeight())/2+c.scrollTop(),left:(c.width()-this.settings.$next_tip.outerWidth())/2+c.scrollLeft()}),!0},bottom:function(){return/bottom/i.test(this.settings.tip_settings.tip_location)},top:function(){return/top/i.test(this.settings.tip_settings.tip_location)},right:function(){return/right/i.test(this.settings.tip_settings.tip_location)},left:function(){return/left/i.test(this.settings.tip_settings.tip_location)},corners:function(c){var d=a(b),e=d.height()/2,f=Math.ceil(this.settings.$target.offset().top-e+this.settings.$next_tip.outerHeight()),g=d.width()+d.scrollLeft(),h=d.height()+f,i=d.height()+d.scrollTop(),j=d.scrollTop();return j>f&&(j=0>f?0:f),h>i&&(i=h),[c.offset().top<j,g<c.offset().left+c.outerWidth(),i<c.offset().top+c.outerHeight(),d.scrollLeft()>c.offset().left]},visible:function(a){for(var b=a.length;b--;)if(a[b])return!1;return!0},nub_position:function(a,b,c){a.addClass("auto"===b?c:b)},startTimer:function(){this.settings.$li.length?this.settings.automate=setTimeout(function(){this.hide(),this.show(),this.startTimer()}.bind(this),this.settings.timer):clearTimeout(this.settings.automate)},end:function(){this.settings.cookie_monster&&a.cookie(this.settings.cookie_name,"ridden",{expires:this.settings.cookie_expires,domain:this.settings.cookie_domain}),this.settings.timer>0&&clearTimeout(this.settings.automate),this.settings.modal&&this.settings.expose&&this.un_expose(),this.settings.$next_tip.data("closed",!0),a(".joyride-modal-bg").hide(),this.settings.$current_tip.hide(),this.settings.post_step_callback(this.settings.$li.index(),this.settings.$current_tip),this.settings.post_ride_callback(this.settings.$li.index(),this.settings.$current_tip),a(".joyride-tip-guide").remove()},off:function(){a(this.scope).off(".joyride"),a(b).off(".joyride"),a(".joyride-close-tip, .joyride-next-tip, .joyride-modal-bg").off(".joyride"),a(".joyride-tip-guide, .joyride-modal-bg").remove(),clearTimeout(this.settings.automate),this.settings={}},reflow:function(){}}}(jQuery,this,this.document),function(a,b){"use strict";Foundation.libs["magellan-expedition"]={name:"magellan-expedition",version:"5.1.1",settings:{active_class:"active",threshold:0,destination_threshold:20,throttle_delay:30},init:function(a,b,c){Foundation.inherit(this,"throttle"),this.bindings(b,c)},events:function(){var c=this,d=c.S,e=c.settings;c.set_expedition_position(),d(c.scope).off(".magellan").on("click.fndtn.magellan","["+c.add_namespace("data-magellan-arrival")+'] a[href^="#"]',function(d){d.preventDefault();var e=a(this).closest("["+c.attr_name()+"]"),f=(e.data("magellan-expedition-init"),this.hash.split("#").join("")),g=a("a[name="+f+"]");0===g.length&&(g=a("#"+f));var h=g.offset().top;"fixed"===e.css("position")&&(h-=e.outerHeight()),a("html, body").stop().animate({scrollTop:h},700,"swing",function(){b.location.hash="#"+f})}).on("scroll.fndtn.magellan",c.throttle(this.check_for_arrivals.bind(this),e.throttle_delay)).on("resize.fndtn.magellan",c.throttle(this.set_expedition_position.bind(this),e.throttle_delay))},check_for_arrivals:function(){var a=this;a.update_arrivals(),a.update_expedition_positions()},set_expedition_position:function(){var b=this;a("["+this.attr_name()+"=fixed]",b.scope).each(function(){var c,d=a(this),e=d.attr("styles");d.attr("style",""),c=d.offset().top,d.data(b.data_attr("magellan-top-offset"),c),d.attr("style",e)})},update_expedition_positions:function(){var c=this,d=a(b).scrollTop();a("["+this.attr_name()+"=fixed]",c.scope).each(function(){var b=a(this),e=b.data("magellan-top-offset");if(d>=e){var f=b.prev("["+c.add_namespace("data-magellan-expedition-clone")+"]");0===f.length&&(f=b.clone(),f.removeAttr(c.attr_name()),f.attr(c.add_namespace("data-magellan-expedition-clone"),""),b.before(f)),b.css({position:"fixed",top:0})}else b.prev("["+c.add_namespace("data-magellan-expedition-clone")+"]").remove(),b.attr("style","")})},update_arrivals:function(){var c=this,d=a(b).scrollTop();a("["+this.attr_name()+"]",c.scope).each(function(){var b=a(this),e=e=b.data(c.attr_name(!0)+"-init"),f=c.offsets(b,d),g=b.find("["+c.add_namespace("data-magellan-arrival")+"]"),h=!1;f.each(function(a,d){if(d.viewport_offset>=d.top_offset){var f=b.find("["+c.add_namespace("data-magellan-arrival")+"]");return f.not(d.arrival).removeClass(e.active_class),d.arrival.addClass(e.active_class),h=!0,!0}}),h||g.removeClass(e.active_class)})},offsets:function(b,c){var d=this,e=b.data(d.attr_name(!0)+"-init"),f=c+e.destination_threshold;return b.find("["+d.add_namespace("data-magellan-arrival")+"]").map(function(){var b=a(this).data(d.data_attr("magellan-arrival")),c=a("["+d.add_namespace("data-magellan-destination")+"="+b+"]");if(c.length>0){var e=c.offset().top;return{destination:c,arrival:a(this),top_offset:e,viewport_offset:f}}}).sort(function(a,b){return a.top_offset<b.top_offset?-1:a.top_offset>b.top_offset?1:0})},data_attr:function(a){return this.namespace.length>0?this.namespace+"-"+a:a},off:function(){this.S(this.scope).off(".magellan"),this.S(b).off(".magellan")},reflow:function(){var b=this;a("["+b.add_namespace("data-magellan-expedition-clone")+"]",b.scope).remove()}}}(jQuery,this,this.document),function(){"use strict";Foundation.libs.offcanvas={name:"offcanvas",version:"5.1.1",settings:{},init:function(){this.events()},events:function(){var a=this.S;a(this.scope).off(".offcanvas").on("click.fndtn.offcanvas",".left-off-canvas-toggle",function(b){b.preventDefault(),a(this).closest(".off-canvas-wrap").toggleClass("move-right")}).on("click.fndtn.offcanvas",".exit-off-canvas",function(b){b.preventDefault(),a(".off-canvas-wrap").removeClass("move-right")}).on("click.fndtn.offcanvas",".right-off-canvas-toggle",function(b){b.preventDefault(),a(this).closest(".off-canvas-wrap").toggleClass("move-left")}).on("click.fndtn.offcanvas",".exit-off-canvas",function(b){b.preventDefault(),a(".off-canvas-wrap").removeClass("move-left")})},reflow:function(){}}}(jQuery,this,this.document),function(a,b,c,d){"use strict";var e=function(){},f=function(e,f){if(e.hasClass(f.slides_container_class))return this;var j,k,l,m,n,o,p=this,q=e,r=0,s=!1;p.slides=function(){return q.children(f.slide_selector)},p.slides().first().addClass(f.active_slide_class),p.update_slide_number=function(b){f.slide_number&&(k.find("span:first").text(parseInt(b)+1),k.find("span:last").text(p.slides().length)),f.bullets&&(l.children().removeClass(f.bullets_active_class),a(l.children().get(b)).addClass(f.bullets_active_class))},p.update_active_link=function(b){var c=a('a[data-orbit-link="'+p.slides().eq(b).attr("data-orbit-slide")+'"]');c.siblings().removeClass(f.bullets_active_class),c.addClass(f.bullets_active_class)},p.build_markup=function(){q.wrap('<div class="'+f.container_class+'"></div>'),j=q.parent(),q.addClass(f.slides_container_class),f.navigation_arrows&&(j.append(a('<a href="#"><span></span></a>').addClass(f.prev_class)),j.append(a('<a href="#"><span></span></a>').addClass(f.next_class))),f.timer&&(m=a("<div>").addClass(f.timer_container_class),m.append("<span>"),m.append(a("<div>").addClass(f.timer_progress_class)),m.addClass(f.timer_paused_class),j.append(m)),f.slide_number&&(k=a("<div>").addClass(f.slide_number_class),k.append("<span></span> "+f.slide_number_text+" <span></span>"),j.append(k)),f.bullets&&(l=a("<ol>").addClass(f.bullets_container_class),j.append(l),l.wrap('<div class="orbit-bullets-container"></div>'),p.slides().each(function(b){var c=a("<li>").attr("data-orbit-slide",b);l.append(c)})),f.stack_on_small&&j.addClass(f.stack_on_small_class)},p._goto=function(b,c){if(b===r)return!1;"object"==typeof o&&o.restart();var d=p.slides(),e="next";if(s=!0,r>b&&(e="prev"),b>=d.length){if(!f.circular)return!1;b=0}else if(0>b){if(!f.circular)return!1;b=d.length-1}var g=a(d.get(r)),h=a(d.get(b));g.css("zIndex",2),g.removeClass(f.active_slide_class),h.css("zIndex",4).addClass(f.active_slide_class),q.trigger("before-slide-change.fndtn.orbit"),f.before_slide_change(),p.update_active_link(b);var i=function(){var a=function(){r=b,s=!1,c===!0&&(o=p.create_timer(),o.start()),p.update_slide_number(r),q.trigger("after-slide-change.fndtn.orbit",[{slide_number:r,total_slides:d.length}]),f.after_slide_change(r,d.length)};q.height()!=h.height()&&f.variable_height?q.animate({height:h.height()},250,"linear",a):a()};if(1===d.length)return i(),!1;var j=function(){"next"===e&&n.next(g,h,i),"prev"===e&&n.prev(g,h,i)};h.height()>q.height()&&f.variable_height?q.animate({height:h.height()},250,"linear",j):j()},p.next=function(a){a.stopImmediatePropagation(),a.preventDefault(),p._goto(r+1)},p.prev=function(a){a.stopImmediatePropagation(),a.preventDefault(),p._goto(r-1)},p.link_custom=function(b){b.preventDefault();var c=a(this).attr("data-orbit-link");if("string"==typeof c&&""!=(c=a.trim(c))){var d=j.find("[data-orbit-slide="+c+"]");-1!=d.index()&&p._goto(d.index())}},p.link_bullet=function(){var b=a(this).attr("data-orbit-slide");if("string"==typeof b&&""!=(b=a.trim(b)))if(isNaN(parseInt(b))){var c=j.find("[data-orbit-slide="+b+"]");-1!=c.index()&&p._goto(c.index()+1)}else p._goto(parseInt(b))},p.timer_callback=function(){p._goto(r+1,!0)},p.compute_dimensions=function(){var b=a(p.slides().get(r)),c=b.height();f.variable_height||p.slides().each(function(){a(this).height()>c&&(c=a(this).height())}),q.height(c)},p.create_timer=function(){var a=new g(j.find("."+f.timer_container_class),f,p.timer_callback);return a},p.stop_timer=function(){"object"==typeof o&&o.stop()},p.toggle_timer=function(){var a=j.find("."+f.timer_container_class);a.hasClass(f.timer_paused_class)?("undefined"==typeof o&&(o=p.create_timer()),o.start()):"object"==typeof o&&o.stop()},p.init=function(){p.build_markup(),f.timer&&(o=p.create_timer(),Foundation.utils.image_loaded(this.slides().children("img"),o.start)),n=new i(f,q),"slide"===f.animation&&(n=new h(f,q)),j.on("click","."+f.next_class,p.next),j.on("click","."+f.prev_class,p.prev),j.on("click","[data-orbit-slide]",p.link_bullet),j.on("click",p.toggle_timer),f.swipe&&j.on("touchstart.fndtn.orbit",function(a){a.touches||(a=a.originalEvent);var b={start_page_x:a.touches[0].pageX,start_page_y:a.touches[0].pageY,start_time:(new Date).getTime(),delta_x:0,is_scrolling:d};j.data("swipe-transition",b),a.stopPropagation()}).on("touchmove.fndtn.orbit",function(a){if(a.touches||(a=a.originalEvent),!(a.touches.length>1||a.scale&&1!==a.scale)){var b=j.data("swipe-transition");if("undefined"==typeof b&&(b={}),b.delta_x=a.touches[0].pageX-b.start_page_x,"undefined"==typeof b.is_scrolling&&(b.is_scrolling=!!(b.is_scrolling||Math.abs(b.delta_x)<Math.abs(a.touches[0].pageY-b.start_page_y))),!b.is_scrolling&&!b.active){a.preventDefault();var c=b.delta_x<0?r+1:r-1;b.active=!0,p._goto(c)}}}).on("touchend.fndtn.orbit",function(a){j.data("swipe-transition",{}),a.stopPropagation()}),j.on("mouseenter.fndtn.orbit",function(){f.timer&&f.pause_on_hover&&p.stop_timer()}).on("mouseleave.fndtn.orbit",function(){f.timer&&f.resume_on_mouseout&&o.start()}),a(c).on("click","[data-orbit-link]",p.link_custom),a(b).on("resize",p.compute_dimensions),Foundation.utils.image_loaded(this.slides().children("img"),p.compute_dimensions),Foundation.utils.image_loaded(this.slides().children("img"),function(){j.prev(".preloader").css("display","none"),p.update_slide_number(0),p.update_active_link(0),q.trigger("ready.fndtn.orbit")})},p.init()},g=function(a,b,c){var d,e,f=this,g=b.timer_speed,h=a.find("."+b.timer_progress_class),i=-1;this.update_progress=function(a){var b=h.clone();b.attr("style",""),b.css("width",a+"%"),h.replaceWith(b),h=b},this.restart=function(){clearTimeout(e),a.addClass(b.timer_paused_class),i=-1,f.update_progress(0)},this.start=function(){return a.hasClass(b.timer_paused_class)?(i=-1===i?g:i,a.removeClass(b.timer_paused_class),d=(new Date).getTime(),h.animate({width:"100%"},i,"linear"),e=setTimeout(function(){f.restart(),c()},i),void a.trigger("timer-started.fndtn.orbit")):!0},this.stop=function(){if(a.hasClass(b.timer_paused_class))return!0;clearTimeout(e),a.addClass(b.timer_paused_class);var c=(new Date).getTime();i-=c-d;var h=100-i/g*100;f.update_progress(h),a.trigger("timer-stopped.fndtn.orbit")}},h=function(b){var c=b.animation_speed,d=1===a("html[dir=rtl]").length,e=d?"marginRight":"marginLeft",f={};f[e]="0%",this.next=function(a,b,d){a.animate({marginLeft:"-100%"},c),b.animate(f,c,function(){a.css(e,"100%"),d()})},this.prev=function(a,b,d){a.animate({marginLeft:"100%"},c),b.css(e,"-100%"),b.animate(f,c,function(){a.css(e,"100%"),d()})}},i=function(b){{var c=b.animation_speed;1===a("html[dir=rtl]").length}this.next=function(a,b,d){b.css({margin:"0%",opacity:"0.01"}),b.animate({opacity:"1"},c,"linear",function(){a.css("margin","100%"),d()})},this.prev=function(a,b,d){b.css({margin:"0%",opacity:"0.01"}),b.animate({opacity:"1"},c,"linear",function(){a.css("margin","100%"),d()})}};Foundation.libs=Foundation.libs||{},Foundation.libs.orbit={name:"orbit",version:"5.1.1",settings:{animation:"slide",timer_speed:1e4,pause_on_hover:!0,resume_on_mouseout:!1,animation_speed:500,stack_on_small:!1,navigation_arrows:!0,slide_number:!0,slide_number_text:"of",container_class:"orbit-container",stack_on_small_class:"orbit-stack-on-small",next_class:"orbit-next",prev_class:"orbit-prev",timer_container_class:"orbit-timer",timer_paused_class:"paused",timer_progress_class:"orbit-progress",slides_container_class:"orbit-slides-container",slide_selector:"*",bullets_container_class:"orbit-bullets",bullets_active_class:"active",slide_number_class:"orbit-slide-number",caption_class:"orbit-caption",active_slide_class:"active",orbit_transition_class:"orbit-transitioning",bullets:!0,circular:!0,timer:!0,variable_height:!1,swipe:!0,before_slide_change:e,after_slide_change:e},init:function(a,b,c){this.bindings(b,c)},events:function(a){var b=new f(this.S(a),this.S(a).data("orbit-init"));this.S(a).data(self.name+"-instance",b)},reflow:function(){var a=this;if(a.S(a.scope).is("[data-orbit]")){var b=a.S(a.scope),c=b.data(a.name+"-instance");c.compute_dimensions()}else a.S("[data-orbit]",a.scope).each(function(b,c){var d=a.S(c),e=(a.data_options(d),d.data(a.name+"-instance"));e.compute_dimensions()})}}}(jQuery,this,this.document),function(a,b,c,d){"use strict";Foundation.libs.reveal={name:"reveal",version:"5.1.1",locked:!1,settings:{animation:"fadeAndPop",animation_speed:250,close_on_background_click:!0,close_on_esc:!0,dismiss_modal_class:"close-reveal-modal",bg_class:"reveal-modal-bg",open:function(){},opened:function(){},close:function(){},closed:function(){},bg:a(".reveal-modal-bg"),css:{open:{opacity:0,visibility:"visible",display:"block"},close:{opacity:1,visibility:"hidden",display:"none"}}},init:function(b,c,d){a.extend(!0,this.settings,c,d),this.bindings(c,d)},events:function(){var a=this,b=a.S;return b(this.scope).off(".reveal").on("click.fndtn.reveal","["+this.add_namespace("data-reveal-id")+"]",function(c){if(c.preventDefault(),!a.locked){var d=b(this),e=d.data(a.data_attr("reveal-ajax"));if(a.locked=!0,"undefined"==typeof e)a.open.call(a,d);else{var f=e===!0?d.attr("href"):e;a.open.call(a,d,{url:f})}}}),b(c).on("click.fndtn.reveal",this.close_targets(),function(c){if(c.preventDefault(),!a.locked){var d=b("["+a.attr_name()+"].open").data(a.attr_name(!0)+"-init"),e=b(c.target)[0]===b("."+d.bg_class)[0];if(e&&!d.close_on_background_click)return;a.locked=!0,a.close.call(a,e?b("["+a.attr_name()+"].open"):b(this).closest("["+a.attr_name()+"]"))}}),b("["+a.attr_name()+"]",this.scope).length>0?b(this.scope).on("open.fndtn.reveal",this.settings.open).on("opened.fndtn.reveal",this.settings.opened).on("opened.fndtn.reveal",this.open_video).on("close.fndtn.reveal",this.settings.close).on("closed.fndtn.reveal",this.settings.closed).on("closed.fndtn.reveal",this.close_video):b(this.scope).on("open.fndtn.reveal","["+a.attr_name()+"]",this.settings.open).on("opened.fndtn.reveal","["+a.attr_name()+"]",this.settings.opened).on("opened.fndtn.reveal","["+a.attr_name()+"]",this.open_video).on("close.fndtn.reveal","["+a.attr_name()+"]",this.settings.close).on("closed.fndtn.reveal","["+a.attr_name()+"]",this.settings.closed).on("closed.fndtn.reveal","["+a.attr_name()+"]",this.close_video),!0},key_up_on:function(){var a=this;return a.S("body").off("keyup.fndtn.reveal").on("keyup.fndtn.reveal",function(b){var c=a.S("["+a.attr_name()+"].open"),d=c.data(a.attr_name(!0)+"-init");d&&27===b.which&&d.close_on_esc&&!a.locked&&a.close.call(a,c)}),!0},key_up_off:function(){return this.S("body").off("keyup.fndtn.reveal"),!0},open:function(b,c){var d=this;if(b)if("undefined"!=typeof b.selector)var e=d.S("#"+b.data(d.data_attr("reveal-id")));else{var e=d.S(this.scope);c=b}else var e=d.S(this.scope);var f=e.data(d.attr_name(!0)+"-init");if(!e.hasClass("open")){var g=d.S("["+d.attr_name()+"].open");if("undefined"==typeof e.data("css-top")&&e.data("css-top",parseInt(e.css("top"),10)).data("offset",this.cache_offset(e)),this.key_up_on(e),e.trigger("open"),g.length<1&&this.toggle_bg(e),"string"==typeof c&&(c={url:c}),"undefined"!=typeof c&&c.url){var h="undefined"!=typeof c.success?c.success:null;a.extend(c,{success:function(b,c,i){if(a.isFunction(h)&&h(b,c,i),e.html(b),d.S(e).foundation("section","reflow"),g.length>0){var j=g.data(d.attr_name(!0));d.hide(g,j.css.close)}d.show(e,f.css.open)}}),a.ajax(c)}else{if(g.length>0){var i=g.data(d.attr_name(!0)+"-init");this.hide(g,i.css.close)}this.show(e,f.css.open)}}},close:function(a){var a=a&&a.length?a:this.S(this.scope),b=this.S("["+this.attr_name()+"].open"),c=a.data(this.attr_name(!0)+"-init");b.length>0&&(this.locked=!0,this.key_up_off(a),a.trigger("close"),this.toggle_bg(a),this.hide(b,c.css.close,c))},close_targets:function(){var a="."+this.settings.dismiss_modal_class;return this.settings.close_on_background_click?a+", ."+this.settings.bg_class:a},toggle_bg:function(b){b.data(this.attr_name(!0));0===this.S("."+this.settings.bg_class).length&&(this.settings.bg=a("<div />",{"class":this.settings.bg_class}).appendTo("body")),this.settings.bg.filter(":visible").length>0?this.hide(this.settings.bg):this.show(this.settings.bg)},show:function(c,d){if(d){var e=c.data(this.attr_name(!0)+"-init");if(0===c.parent("body").length){var f=c.wrap('<div style="display: none;" />').parent(),g=this.settings.rootElement||"body";c.on("closed.fndtn.reveal.wrapped",function(){c.detach().appendTo(f),c.unwrap().unbind("closed.fndtn.reveal.wrapped")}),c.detach().appendTo(g)}if(/pop/i.test(e.animation)){d.top=a(b).scrollTop()-c.data("offset")+"px";var h={top:a(b).scrollTop()+c.data("css-top")+"px",opacity:1};return setTimeout(function(){return c.css(d).animate(h,e.animation_speed,"linear",function(){this.locked=!1,c.trigger("opened")}.bind(this)).addClass("open")}.bind(this),e.animation_speed/2)}if(/fade/i.test(e.animation)){var h={opacity:1};return setTimeout(function(){return c.css(d).animate(h,e.animation_speed,"linear",function(){this.locked=!1,c.trigger("opened")}.bind(this)).addClass("open")}.bind(this),e.animation_speed/2)}return c.css(d).show().css({opacity:1}).addClass("open").trigger("opened")}var e=this.settings;return/fade/i.test(e.animation)?c.fadeIn(e.animation_speed/2):(this.locked=!1,c.show())},hide:function(c,d){if(d){var e=c.data(this.attr_name(!0)+"-init");if(/pop/i.test(e.animation)){var f={top:-a(b).scrollTop()-c.data("offset")+"px",opacity:0};return setTimeout(function(){return c.animate(f,e.animation_speed,"linear",function(){this.locked=!1,c.css(d).trigger("closed")}.bind(this)).removeClass("open")}.bind(this),e.animation_speed/2)}if(/fade/i.test(e.animation)){var f={opacity:0};return setTimeout(function(){return c.animate(f,e.animation_speed,"linear",function(){this.locked=!1,c.css(d).trigger("closed")}.bind(this)).removeClass("open")}.bind(this),e.animation_speed/2)}return c.hide().css(d).removeClass("open").trigger("closed")}var e=this.settings;return/fade/i.test(e.animation)?c.fadeOut(e.animation_speed/2):c.hide()},close_video:function(b){var c=a(".flex-video",b.target),d=a("iframe",c);d.length>0&&(d.attr("data-src",d[0].src),d.attr("src","about:blank"),c.hide())},open_video:function(b){var c=a(".flex-video",b.target),e=c.find("iframe");if(e.length>0){var f=e.attr("data-src");if("string"==typeof f)e[0].src=e.attr("data-src");else{var g=e[0].src;e[0].src=d,e[0].src=g}c.show()}},data_attr:function(a){return this.namespace.length>0?this.namespace+"-"+a:a},cache_offset:function(a){var b=a.show().height()+parseInt(a.css("top"),10);return a.hide(),b},off:function(){a(this.scope).off(".fndtn.reveal")},reflow:function(){}}
+}(jQuery,this,this.document),function(){"use strict";Foundation.libs.tab={name:"tab",version:"5.1.1",settings:{active_class:"active",callback:function(){}},init:function(a,b,c){this.bindings(b,c)},events:function(){var a=this,b=this.S;b(this.scope).off(".tab").on("click.fndtn.tab","["+this.attr_name()+"] > dd > a",function(c){c.preventDefault(),c.stopPropagation();var d=b(this).parent(),e=d.closest("["+a.attr_name()+"]"),f=b("#"+this.href.split("#")[1]),g=d.siblings(),h=e.data(a.attr_name(!0)+"-init");b(this).data(a.data_attr("tab-content"))&&(f=b("#"+b(this).data(a.data_attr("tab-content")).split("#")[1])),d.addClass(h.active_class).triggerHandler("opened"),g.removeClass(h.active_class),f.siblings().removeClass(h.active_class).end().addClass(h.active_class),h.callback(d),e.triggerHandler("toggled",[d])})},data_attr:function(a){return this.namespace.length>0?this.namespace+"-"+a:a},off:function(){},reflow:function(){}}}(jQuery,this,this.document),function(a,b,c){"use strict";Foundation.libs.tooltip={name:"tooltip",version:"5.1.1",settings:{additional_inheritable_classes:[],tooltip_class:".tooltip",append_to:"body",touch_close_text:"Tap To Close",disable_for_touch:!1,hover_delay:200,tip_template:function(a,b){return'<span data-selector="'+a+'" class="'+Foundation.libs.tooltip.settings.tooltip_class.substring(1)+'">'+b+'<span class="nub"></span></span>'}},cache:{},init:function(a,b,c){Foundation.inherit(this,"random_str"),this.bindings(b,c)},events:function(){var b=this,d=b.S;Modernizr.touch?d(c).off(".tooltip").on("click.fndtn.tooltip touchstart.fndtn.tooltip touchend.fndtn.tooltip","["+this.attr_name()+"]:not(a)",function(c){var e=a.extend({},b.settings,b.data_options(d(this)));e.disable_for_touch||(c.preventDefault(),d(e.tooltip_class).hide(),b.showOrCreateTip(d(this)))}).on("click.fndtn.tooltip touchstart.fndtn.tooltip touchend.fndtn.tooltip",this.settings.tooltip_class,function(a){a.preventDefault(),d(this).fadeOut(150)}):d(c).off(".tooltip").on("mouseenter.fndtn.tooltip mouseleave.fndtn.tooltip","["+this.attr_name()+"]",function(a){var c=d(this);/enter|over/i.test(a.type)?this.timer=setTimeout(function(){b.showOrCreateTip(c)}.bind(this),b.settings.hover_delay):("mouseout"===a.type||"mouseleave"===a.type)&&(clearTimeout(this.timer),b.hide(c))})},showOrCreateTip:function(a){var b=this.getTip(a);return b&&b.length>0?this.show(a):this.create(a)},getTip:function(a){var b=this.selector(a),c=null;return b&&(c=this.S('span[data-selector="'+b+'"]'+this.settings.tooltip_class)),"object"==typeof c?c:!1},selector:function(a){var b=a.attr("id"),c=a.attr(this.attr_name())||a.attr("data-selector");return(b&&b.length<1||!b)&&"string"!=typeof c&&(c="tooltip"+this.random_str(6),a.attr("data-selector",c)),b&&b.length>0?b:c},create:function(b){var c=a(this.settings.tip_template(this.selector(b),a("<div></div>").html(b.attr("title")).html())),d=this.inheritable_classes(b);c.addClass(d).appendTo(this.settings.append_to),Modernizr.touch&&c.append('<span class="tap-to-close">'+this.settings.touch_close_text+"</span>"),b.removeAttr("title").attr("title",""),this.show(b)},reposition:function(a,b,c){var d,e,f,g,h;if(b.css("visibility","hidden").show(),d=a.data("width"),e=b.children(".nub"),f=e.outerHeight(),g=e.outerHeight(),b.css(this.small()?{width:"100%"}:{width:d?d:"auto"}),h=function(a,b,c,d,e){return a.css({top:b?b:"auto",bottom:d?d:"auto",left:e?e:"auto",right:c?c:"auto"}).end()},h(b,a.offset().top+a.outerHeight()+10,"auto","auto",a.offset().left),this.small())h(b,a.offset().top+a.outerHeight()+10,"auto","auto",12.5,this.S(this.scope).width()),b.addClass("tip-override"),h(e,-f,"auto","auto",a.offset().left+10);else{var i=a.offset().left;Foundation.rtl&&(i=a.offset().left+a.outerWidth()-b.outerWidth()),h(b,a.offset().top+a.outerHeight()+10,"auto","auto",i),b.removeClass("tip-override"),e.removeAttr("style"),c&&c.indexOf("tip-top")>-1?h(b,a.offset().top-b.outerHeight()-10,"auto","auto",i).removeClass("tip-override"):c&&c.indexOf("tip-left")>-1?h(b,a.offset().top+a.outerHeight()/2-b.outerHeight()/2,"auto","auto",a.offset().left-b.outerWidth()-f).removeClass("tip-override"):c&&c.indexOf("tip-right")>-1&&h(b,a.offset().top+a.outerHeight()/2-b.outerHeight()/2,"auto","auto",a.offset().left+a.outerWidth()+f).removeClass("tip-override")}b.css("visibility","visible").hide()},small:function(){return matchMedia(Foundation.media_queries.small).matches},inheritable_classes:function(b){var c=["tip-top","tip-left","tip-bottom","tip-right","radius","round"].concat(this.settings.additional_inheritable_classes),d=b.attr("class"),e=d?a.map(d.split(" "),function(b){return-1!==a.inArray(b,c)?b:void 0}).join(" "):"";return a.trim(e)},show:function(a){var b=this.getTip(a);return this.reposition(a,b,a.attr("class")),b.fadeIn(150)},hide:function(a){var b=this.getTip(a);return b.fadeOut(150)},reload:function(){var b=a(this);return b.data("fndtn-tooltips")?b.foundationTooltips("destroy").foundationTooltips("init"):b.foundationTooltips("init")},off:function(){this.S(this.scope).off(".fndtn.tooltip"),this.S(this.settings.tooltip_class).each(function(b){a("["+this.attr_name()+"]").get(b).attr("title",a(this).text())}).remove()},reflow:function(){}}}(jQuery,this,this.document),function(a,b,c){"use strict";Foundation.libs.topbar={name:"topbar",version:"5.1.1",settings:{index:0,sticky_class:"sticky",custom_back_text:!0,back_text:"Back",is_hover:!0,mobile_show_parent_link:!1,scrolltop:!0},init:function(b,c,d){Foundation.inherit(this,"add_custom_rule register_media throttle");var e=this;e.register_media("topbar","foundation-mq-topbar"),this.bindings(c,d),e.S("["+this.attr_name()+"]",this.scope).each(function(){{var b=e.S(this),c=b.data(e.attr_name(!0)+"-init");e.S("section",this),a("> ul",this).first()}b.data("index",0);var d=b.parent();d.hasClass("fixed")||d.hasClass(c.sticky_class)?(e.settings.sticky_class=c.sticky_class,e.settings.sticky_topbar=b,b.data("height",d.outerHeight()),b.data("stickyoffset",d.offset().top)):b.data("height",b.outerHeight()),c.assembled||e.assemble(b),c.is_hover?e.S(".has-dropdown",b).addClass("not-click"):e.S(".has-dropdown",b).removeClass("not-click"),e.add_custom_rule(".f-topbar-fixed { padding-top: "+b.data("height")+"px }"),d.hasClass("fixed")&&e.S("body").addClass("f-topbar-fixed")})},toggle:function(c){var d=this;if(c)var e=d.S(c).closest("["+this.attr_name()+"]");else var e=d.S("["+this.attr_name()+"]");var f=e.data(this.attr_name(!0)+"-init"),g=d.S("section, .section",e);d.breakpoint()&&(d.rtl?(g.css({right:"0%"}),a(">.name",g).css({right:"100%"})):(g.css({left:"0%"}),a(">.name",g).css({left:"100%"})),d.S("li.moved",g).removeClass("moved"),e.data("index",0),e.toggleClass("expanded").css("height","")),f.scrolltop?e.hasClass("expanded")?e.parent().hasClass("fixed")&&(f.scrolltop?(e.parent().removeClass("fixed"),e.addClass("fixed"),d.S("body").removeClass("f-topbar-fixed"),b.scrollTo(0,0)):e.parent().removeClass("expanded")):e.hasClass("fixed")&&(e.parent().addClass("fixed"),e.removeClass("fixed"),d.S("body").addClass("f-topbar-fixed")):(e.parent().hasClass(d.settings.sticky_class)&&e.parent().addClass("fixed"),e.parent().hasClass("fixed")&&(e.hasClass("expanded")?(e.addClass("fixed"),e.parent().addClass("expanded"),d.S("body").addClass("f-topbar-fixed")):(e.removeClass("fixed"),e.parent().removeClass("expanded"),d.update_sticky_positioning())))},timer:null,events:function(){var a=this,c=this.S;c(this.scope).off(".topbar").on("click.fndtn.topbar","["+this.attr_name()+"] .toggle-topbar",function(b){b.preventDefault(),a.toggle(this)}).on("click.fndtn.topbar","["+this.attr_name()+"] li.has-dropdown",function(b){var d=c(this),e=c(b.target),f=d.closest("["+a.attr_name()+"]"),g=f.data(a.attr_name(!0)+"-init");return e.data("revealId")?void a.toggle():void(a.breakpoint()||(!g.is_hover||Modernizr.touch)&&(b.stopImmediatePropagation(),d.hasClass("hover")?(d.removeClass("hover").find("li").removeClass("hover"),d.parents("li.hover").removeClass("hover")):(d.addClass("hover"),"A"===e[0].nodeName&&e.parent().hasClass("has-dropdown")&&b.preventDefault())))}).on("click.fndtn.topbar","["+this.attr_name()+"] .has-dropdown>a",function(b){if(a.breakpoint()){b.preventDefault();var d=c(this),e=d.closest("["+a.attr_name()+"]"),f=e.find("section, .section"),g=(d.next(".dropdown").outerHeight(),d.closest("li"));e.data("index",e.data("index")+1),g.addClass("moved"),a.rtl?(f.css({right:-(100*e.data("index"))+"%"}),f.find(">.name").css({right:100*e.data("index")+"%"})):(f.css({left:-(100*e.data("index"))+"%"}),f.find(">.name").css({left:100*e.data("index")+"%"})),e.css("height",d.siblings("ul").outerHeight(!0)+e.data("height"))}}),c(b).off(".topbar").on("resize.fndtn.topbar",a.throttle(function(){a.resize.call(a)},50)).trigger("resize"),c("body").off(".topbar").on("click.fndtn.topbar touchstart.fndtn.topbar",function(b){var d=c(b.target).closest("li").closest("li.hover");d.length>0||c("["+a.attr_name()+"] li").removeClass("hover")}),c(this.scope).on("click.fndtn.topbar","["+this.attr_name()+"] .has-dropdown .back",function(b){b.preventDefault();var d=c(this),e=d.closest("["+a.attr_name()+"]"),f=e.find("section, .section"),g=(e.data(a.attr_name(!0)+"-init"),d.closest("li.moved")),h=g.parent();e.data("index",e.data("index")-1),a.rtl?(f.css({right:-(100*e.data("index"))+"%"}),f.find(">.name").css({right:100*e.data("index")+"%"})):(f.css({left:-(100*e.data("index"))+"%"}),f.find(">.name").css({left:100*e.data("index")+"%"})),0===e.data("index")?e.css("height",""):e.css("height",h.outerHeight(!0)+e.data("height")),setTimeout(function(){g.removeClass("moved")},300)})},resize:function(){var a=this;a.S("["+this.attr_name()+"]").each(function(){var b,d=a.S(this),e=(d.data(a.attr_name(!0)+"-init"),d.parent("."+a.settings.sticky_class));if(!a.breakpoint()){var f=d.hasClass("expanded");d.css("height","").removeClass("expanded").find("li").removeClass("hover"),f&&a.toggle(d)}e.length>0&&(e.hasClass("fixed")?(e.removeClass("fixed"),b=e.offset().top,a.S(c.body).hasClass("f-topbar-fixed")&&(b-=d.data("height")),d.data("stickyoffset",b),e.addClass("fixed")):(b=e.offset().top,d.data("stickyoffset",b)))})},breakpoint:function(){return!matchMedia(Foundation.media_queries.topbar).matches},assemble:function(b){{var c=this,d=b.data(this.attr_name(!0)+"-init"),e=c.S("section",b);a("> ul",b).first()}e.detach(),c.S(".has-dropdown>a",e).each(function(){var b=c.S(this),e=b.siblings(".dropdown"),f=b.attr("href");if(!e.find(".title.back").length){if(d.mobile_show_parent_link&&f&&f.length>1)var g=a('<li class="title back js-generated"><h5><a href="javascript:void(0)"></a></h5></li><li><a class="parent-link js-generated" href="'+f+'">'+b.text()+"</a></li>");else var g=a('<li class="title back js-generated"><h5><a href="javascript:void(0)"></a></h5></li>');a("h5>a",g).html(1==d.custom_back_text?d.back_text:"« "+b.html()),e.prepend(g)}}),e.appendTo(b),this.sticky(),this.assembled(b)},assembled:function(b){b.data(this.attr_name(!0),a.extend({},b.data(this.attr_name(!0)),{assembled:!0}))},height:function(b){var c=0,d=this;return a("> li",b).each(function(){c+=d.S(this).outerHeight(!0)}),c},sticky:function(){var a=(this.S(b),this);this.S(b).on("scroll",function(){a.update_sticky_positioning()})},update_sticky_positioning:function(){var a="."+this.settings.sticky_class,c=this.S(b),d=this;if(d.S(a).length>0){var e=this.settings.sticky_topbar.data("stickyoffset");d.S(a).hasClass("expanded")||(c.scrollTop()>e?d.S(a).hasClass("fixed")||(d.S(a).addClass("fixed"),d.S("body").addClass("f-topbar-fixed")):c.scrollTop()<=e&&d.S(a).hasClass("fixed")&&(d.S(a).removeClass("fixed"),d.S("body").removeClass("f-topbar-fixed")))}},off:function(){this.S(this.scope).off(".fndtn.topbar"),this.S(b).off(".fndtn.topbar")},reflow:function(){}}}(jQuery,this,this.document);
\ No newline at end of file
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.abide = {
+ name : 'abide',
+
+ version : '5.1.1',
+
+ settings : {
+ live_validate : true,
+ focus_on_invalid : true,
+ error_labels: true, // labels with a for="inputId" will recieve an `error` class
+ timeout : 1000,
+ patterns : {
+ alpha: /^[a-zA-Z]+$/,
+ alpha_numeric : /^[a-zA-Z0-9]+$/,
+ integer: /^\d+$/,
+ number: /-?(?:\d+|\d{1,3}(?:,\d{3})+)?(?:\.\d+)?/,
+
+ // generic password: upper-case, lower-case, number/special character, and min 8 characters
+ password : /(?=^.{8,}$)((?=.*\d)|(?=.*\W+))(?![.\n])(?=.*[A-Z])(?=.*[a-z]).*$/,
+
+ // amex, visa, diners
+ card : /^(?:4[0-9]{12}(?:[0-9]{3})?|5[1-5][0-9]{14}|6(?:011|5[0-9][0-9])[0-9]{12}|3[47][0-9]{13}|3(?:0[0-5]|[68][0-9])[0-9]{11}|(?:2131|1800|35\d{3})\d{11})$/,
+ cvv : /^([0-9]){3,4}$/,
+
+ // http://www.whatwg.org/specs/web-apps/current-work/multipage/states-of-the-type-attribute.html#valid-e-mail-address
+ email : /^[a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*$/,
+
+ url: /(https?|ftp|file|ssh):\/\/(((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:)*@)?(((\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5])\.(\d|[1-9]\d|1\d\d|2[0-4]\d|25[0-5]))|((([a-zA-Z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-zA-Z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-zA-Z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-zA-Z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-zA-Z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-zA-Z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?)(:\d*)?)(\/((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)+(\/(([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)*)*)?)?(\?((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|[\uE000-\uF8FF]|\/|\?)*)?(\#((([a-zA-Z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(%[\da-f]{2})|[!\$&'\(\)\*\+,;=]|:|@)|\/|\?)*)?/,
+ // abc.de
+ domain: /^([a-zA-Z0-9]([a-zA-Z0-9\-]{0,61}[a-zA-Z0-9])?\.)+[a-zA-Z]{2,6}$/,
+
+ datetime: /([0-2][0-9]{3})\-([0-1][0-9])\-([0-3][0-9])T([0-5][0-9])\:([0-5][0-9])\:([0-5][0-9])(Z|([\-\+]([0-1][0-9])\:00))/,
+ // YYYY-MM-DD
+ date: /(?:19|20)[0-9]{2}-(?:(?:0[1-9]|1[0-2])-(?:0[1-9]|1[0-9]|2[0-9])|(?:(?!02)(?:0[1-9]|1[0-2])-(?:30))|(?:(?:0[13578]|1[02])-31))/,
+ // HH:MM:SS
+ time : /(0[0-9]|1[0-9]|2[0-3])(:[0-5][0-9]){2}/,
+ dateISO: /\d{4}[\/\-]\d{1,2}[\/\-]\d{1,2}/,
+ // MM/DD/YYYY
+ month_day_year : /(0[1-9]|1[012])[- \/.](0[1-9]|[12][0-9]|3[01])[- \/.](19|20)\d\d/,
+
+ // #FFF or #FFFFFF
+ color: /^#?([a-fA-F0-9]{6}|[a-fA-F0-9]{3})$/
+ }
+ },
+
+ timer : null,
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ },
+
+ events : function (scope) {
+ var self = this,
+ form = self.S(scope).attr('novalidate', 'novalidate'),
+ settings = form.data(this.attr_name(true) + '-init');
+
+ this.invalid_attr = this.add_namespace('data-invalid');
+
+ form
+ .off('.abide')
+ .on('submit.fndtn.abide validate.fndtn.abide', function (e) {
+ var is_ajax = /ajax/i.test(self.S(this).attr(self.attr_name()));
+ return self.validate(self.S(this).find('input, textarea, select').get(), e, is_ajax);
+ })
+ .on('reset', function() {
+ return self.reset($(this));
+ })
+ .find('input, textarea, select')
+ .off('.abide')
+ .on('blur.fndtn.abide change.fndtn.abide', function (e) {
+ self.validate([this], e);
+ })
+ .on('keydown.fndtn.abide', function (e) {
+ var settings = $(this).closest('form').data('abide-init');
+ if (settings.live_validate === true) {
+ clearTimeout(self.timer);
+ self.timer = setTimeout(function () {
+ self.validate([this], e);
+ }.bind(this), settings.timeout);
+ }
+ });
+ },
+
+ reset : function (form) {
+ form.removeAttr(this.invalid_attr);
+ $(this.invalid_attr, form).removeAttr(this.invalid_attr);
+ $('.error', form).not('small').removeClass('error');
+ },
+
+ validate : function (els, e, is_ajax) {
+ var validations = this.parse_patterns(els),
+ validation_count = validations.length,
+ form = this.S(els[0]).closest('form'),
+ submit_event = /submit/.test(e.type);
+
+ // Has to count up to make sure the focus gets applied to the top error
+ for (var i=0; i < validation_count; i++) {
+ if (!validations[i] && (submit_event || is_ajax)) {
+ if (this.settings.focus_on_invalid) els[i].focus();
+ form.trigger('invalid');
+ this.S(els[i]).closest('form').attr(this.invalid_attr, '');
+ return false;
+ }
+ }
+
+ if (submit_event || is_ajax) {
+ form.trigger('valid');
+ }
+
+ form.removeAttr(this.invalid_attr);
+
+ if (is_ajax) return false;
+
+ return true;
+ },
+
+ parse_patterns : function (els) {
+ var i = els.length,
+ el_patterns = [];
+
+ while (i--) {
+ el_patterns.push(this.pattern(els[i]));
+ }
+
+ return this.check_validation_and_apply_styles(el_patterns);
+ },
+
+ pattern : function (el) {
+ var type = el.getAttribute('type'),
+ required = typeof el.getAttribute('required') === 'string';
+
+ var pattern = el.getAttribute('pattern') || '';
+
+ if (this.settings.patterns.hasOwnProperty(pattern) && pattern.length > 0) {
+ return [el, this.settings.patterns[pattern], required];
+ } else if (pattern.length > 0) {
+ return [el, new RegExp(pattern), required];
+ }
+
+ if (this.settings.patterns.hasOwnProperty(type)) {
+ return [el, this.settings.patterns[type], required];
+ }
+
+ pattern = /.*/;
+
+ return [el, pattern, required];
+ },
+
+ check_validation_and_apply_styles : function (el_patterns) {
+ var i = el_patterns.length,
+ validations = [];
+
+ while (i--) {
+ var el = el_patterns[i][0],
+ required = el_patterns[i][2],
+ value = el.value,
+ direct_parent = this.S(el).parent(),
+ is_equal = el.getAttribute(this.add_namespace('data-equalto')),
+ is_radio = el.type === "radio",
+ is_checkbox = el.type === "checkbox",
+ label = this.S('label[for="' + el.getAttribute('id') + '"]'),
+ valid_length = (required) ? (el.value.length > 0) : true;
+
+ var parent;
+
+ if (!direct_parent.is('label')) {
+ parent = direct_parent;
+ } else {
+ parent = direct_parent.parent();
+ }
+
+ if (is_radio && required) {
+ validations.push(this.valid_radio(el, required));
+ } else if (is_checkbox && required) {
+ validations.push(this.valid_checkbox(el, required));
+ } else if (is_equal && required) {
+ validations.push(this.valid_equal(el, required, parent));
+ } else {
+
+ if (el_patterns[i][1].test(value) && valid_length ||
+ !required && el.value.length < 1) {
+ this.S(el).removeAttr(this.invalid_attr);
+ parent.removeClass('error');
+ if (label.length > 0 && this.settings.error_labels) label.removeClass('error');
+
+ validations.push(true);
+ $(el).triggerHandler('valid');
+ } else {
+ this.S(el).attr(this.invalid_attr, '');
+ parent.addClass('error');
+ if (label.length > 0 && this.settings.error_labels) label.addClass('error');
+
+ validations.push(false);
+ $(el).triggerHandler('invalid');
+ }
+ }
+ }
+
+ return validations;
+ },
+
+ valid_checkbox : function(el, required) {
+ var el = this.S(el),
+ valid = (el.is(':checked') || !required);
+
+ if (valid) {
+ el.removeAttr(this.invalid_attr).parent().removeClass('error');
+ } else {
+ el.attr(this.invalid_attr, '').parent().addClass('error');
+ }
+
+ return valid;
+ },
+
+ valid_radio : function (el, required) {
+ var name = el.getAttribute('name'),
+ group = document.getElementsByName(name),
+ count = group.length,
+ valid = false;
+
+ // Has to count up to make sure the focus gets applied to the top error
+ for (var i=0; i < count; i++) {
+ if (group[i].checked) valid = true;
+ }
+
+ // Has to count up to make sure the focus gets applied to the top error
+ for (var i=0; i < count; i++) {
+ if (valid) {
+ this.S(group[i]).removeAttr(this.invalid_attr).parent().removeClass('error');
+ } else {
+ this.S(group[i]).attr(this.invalid_attr, '').parent().addClass('error');
+ }
+ }
+
+ return valid;
+ },
+
+ valid_equal: function(el, required, parent) {
+ var from = document.getElementById(el.getAttribute(this.add_namespace('data-equalto'))).value,
+ to = el.value,
+ valid = (from === to);
+
+ if (valid) {
+ this.S(el).removeAttr(this.invalid_attr);
+ parent.removeClass('error');
+ } else {
+ this.S(el).attr(this.invalid_attr, '');
+ parent.addClass('error');
+ }
+
+ return valid;
+ }
+ };
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.accordion = {
+ name : 'accordion',
+
+ version : '5.1.1',
+
+ settings : {
+ active_class: 'active',
+ toggleable: true
+ },
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this;
+ var S = this.S;
+ S(this.scope)
+ .off('.fndtn.accordion')
+ .on('click.fndtn.accordion', '[' + this.attr_name() + '] > dd > a', function (e) {
+ var accordion = S(this).closest('[' + self.attr_name() + ']'),
+ target = S('#' + this.href.split('#')[1]),
+ siblings = S('dd > .content', accordion),
+ aunts = $('> dd', accordion),
+ settings = accordion.data(self.attr_name(true) + '-init'),
+ active_content = S('dd > .content.' + settings.active_class, accordion),
+ active_parent = S('dd.' + settings.active_class, accordion);
+
+ e.preventDefault();
+
+ if (active_content[0] == target[0] && settings.toggleable) {
+ active_parent.toggleClass(settings.active_class, false);
+ return target.toggleClass(settings.active_class, false);
+ }
+
+ siblings.removeClass(settings.active_class);
+ aunts.removeClass(settings.active_class);
+ target.addClass(settings.active_class).parent().addClass(settings.active_class);
+ });
+ },
+
+ off : function () {},
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.alert = {
+ name : 'alert',
+
+ version : '5.1.1',
+
+ settings : {
+ animation: 'fadeOut',
+ speed: 300, // fade out speed
+ callback: function (){}
+ },
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this,
+ S = this.S;
+
+ $(this.scope).off('.alert').on('click.fndtn.alert', '[' + this.attr_name() + '] a.close', function (e) {
+ var alertBox = S(this).closest('[' + self.attr_name() + ']'),
+ settings = alertBox.data(self.attr_name(true) + '-init') || self.settings;
+
+ e.preventDefault();
+ alertBox[settings.animation](settings.speed, function () {
+ S(this).trigger('closed').remove();
+ settings.callback();
+ });
+ });
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.clearing = {
+ name : 'clearing',
+
+ version: '5.1.1',
+
+ settings : {
+ templates : {
+ viewing : '<a href="#" class="clearing-close">×</a>' +
+ '<div class="visible-img" style="display: none"><div class="clearing-touch-label"></div><img src="data:image/gif;base64,R0lGODlhAQABAAD/ACwAAAAAAQABAAACADs%3D" alt="" />' +
+ '<p class="clearing-caption"></p><a href="#" class="clearing-main-prev"><span></span></a>' +
+ '<a href="#" class="clearing-main-next"><span></span></a></div>'
+ },
+
+ // comma delimited list of selectors that, on click, will close clearing,
+ // add 'div.clearing-blackout, div.visible-img' to close on background click
+ close_selectors : '.clearing-close',
+
+ touch_label : '← Swipe to Advance →',
+
+ // event initializers and locks
+ init : false,
+ locked : false
+ },
+
+ init : function (scope, method, options) {
+ var self = this;
+ Foundation.inherit(this, 'throttle image_loaded');
+
+ this.bindings(method, options);
+
+ if (self.S(this.scope).is('[' + this.attr_name() + ']')) {
+ this.assemble(self.S('li', this.scope));
+ } else {
+ self.S('[' + this.attr_name() + ']', this.scope).each(function () {
+ self.assemble(self.S('li', this));
+ });
+ }
+ },
+
+ events : function (scope) {
+ var self = this,
+ S = self.S;
+
+ S(this.scope)
+ .off('.clearing')
+ .on('click.fndtn.clearing', 'ul[' + this.attr_name() + '] li',
+ function (e, current, target) {
+ var current = current || S(this),
+ target = target || current,
+ next = current.next('li'),
+ settings = current.closest('[' + self.attr_name() + ']').data(self.attr_name(true) + '-init'),
+ image = S(e.target);
+
+ e.preventDefault();
+
+ if (!settings) {
+ self.init();
+ settings = current.closest('[' + self.attr_name() + ']').data(self.attr_name(true) + '-init');
+ }
+
+ // if clearing is open and the current image is
+ // clicked, go to the next image in sequence
+ if (target.hasClass('visible') &&
+ current[0] === target[0] &&
+ next.length > 0 && self.is_open(current)) {
+ target = next;
+ image = S('img', target);
+ }
+
+ // set current and target to the clicked li if not otherwise defined.
+ self.open(image, current, target);
+ self.update_paddles(target);
+ })
+
+ .on('click.fndtn.clearing', '.clearing-main-next',
+ function (e) { self.nav(e, 'next') })
+ .on('click.fndtn.clearing', '.clearing-main-prev',
+ function (e) { self.nav(e, 'prev') })
+ .on('click.fndtn.clearing', this.settings.close_selectors,
+ function (e) { Foundation.libs.clearing.close(e, this) })
+ .on('keydown.fndtn.clearing',
+ function (e) { self.keydown(e) });
+
+ S(window).off('.clearing').on('resize.fndtn.clearing',
+ function () { self.resize() });
+
+ this.swipe_events(scope);
+ },
+
+ swipe_events : function (scope) {
+ var self = this,
+ S = self.S;
+
+ S(this.scope)
+ .on('touchstart.fndtn.clearing', '.visible-img', function(e) {
+ if (!e.touches) { e = e.originalEvent; }
+ var data = {
+ start_page_x: e.touches[0].pageX,
+ start_page_y: e.touches[0].pageY,
+ start_time: (new Date()).getTime(),
+ delta_x: 0,
+ is_scrolling: undefined
+ };
+
+ S(this).data('swipe-transition', data);
+ e.stopPropagation();
+ })
+ .on('touchmove.fndtn.clearing', '.visible-img', function(e) {
+ if (!e.touches) { e = e.originalEvent; }
+ // Ignore pinch/zoom events
+ if(e.touches.length > 1 || e.scale && e.scale !== 1) return;
+
+ var data = S(this).data('swipe-transition');
+
+ if (typeof data === 'undefined') {
+ data = {};
+ }
+
+ data.delta_x = e.touches[0].pageX - data.start_page_x;
+
+ if ( typeof data.is_scrolling === 'undefined') {
+ data.is_scrolling = !!( data.is_scrolling || Math.abs(data.delta_x) < Math.abs(e.touches[0].pageY - data.start_page_y) );
+ }
+
+ if (!data.is_scrolling && !data.active) {
+ e.preventDefault();
+ var direction = (data.delta_x < 0) ? 'next' : 'prev';
+ data.active = true;
+ self.nav(e, direction);
+ }
+ })
+ .on('touchend.fndtn.clearing', '.visible-img', function(e) {
+ S(this).data('swipe-transition', {});
+ e.stopPropagation();
+ });
+ },
+
+ assemble : function ($li) {
+ var $el = $li.parent();
+
+ if ($el.parent().hasClass('carousel')) return;
+ $el.after('<div id="foundationClearingHolder"></div>');
+
+ var holder = this.S('#foundationClearingHolder'),
+ settings = $el.data(this.attr_name(true) + '-init'),
+ grid = $el.detach(),
+ data = {
+ grid: '<div class="carousel">' + grid[0].outerHTML + '</div>',
+ viewing: settings.templates.viewing
+ },
+ wrapper = '<div class="clearing-assembled"><div>' + data.viewing +
+ data.grid + '</div></div>',
+ touch_label = this.settings.touch_label;
+
+ if (Modernizr.touch) {
+ wrapper = $(wrapper).find('.clearing-touch-label').html(touch_label).end();
+ }
+
+ holder.after(wrapper).remove();
+ },
+
+ open : function ($image, current, target) {
+ var self = this,
+ root = target.closest('.clearing-assembled'),
+ container = self.S('div', root).first(),
+ visible_image = self.S('.visible-img', container),
+ image = self.S('img', visible_image).not($image),
+ label = self.S('.clearing-touch-label', container);
+
+ if (!this.locked()) {
+ // set the image to the selected thumbnail
+ image
+ .attr('src', this.load($image))
+ .css('visibility', 'hidden');
+
+ this.image_loaded(image, function () {
+ image.css('visibility', 'visible');
+ // toggle the gallery
+ root.addClass('clearing-blackout');
+ container.addClass('clearing-container');
+ visible_image.show();
+ this.fix_height(target)
+ .caption(self.S('.clearing-caption', visible_image), $image)
+ .center_and_label(image,label)
+ .shift(current, target, function () {
+ target.siblings().removeClass('visible');
+ target.addClass('visible');
+ });
+ }.bind(this));
+ }
+ },
+
+ close : function (e, el) {
+ e.preventDefault();
+
+ var root = (function (target) {
+ if (/blackout/.test(target.selector)) {
+ return target;
+ } else {
+ return target.closest('.clearing-blackout');
+ }
+ }($(el))), container, visible_image;
+
+ if (el === e.target && root) {
+ container = $('div', root).first();
+ visible_image = $('.visible-img', container);
+ this.settings.prev_index = 0;
+ $('ul[' + this.attr_name() + ']', root)
+ .attr('style', '').closest('.clearing-blackout')
+ .removeClass('clearing-blackout');
+ container.removeClass('clearing-container');
+ visible_image.hide();
+ }
+
+ return false;
+ },
+
+ is_open : function (current) {
+ return current.parent().prop('style').length > 0;
+ },
+
+ keydown : function (e) {
+ var clearing = $('ul[' + this.attr_name() + ']', '.clearing-blackout'),
+ NEXT_KEY = this.rtl ? 37 : 39,
+ PREV_KEY = this.rtl ? 39 : 37,
+ ESC_KEY = 27;
+
+ if (e.which === NEXT_KEY) this.go(clearing, 'next');
+ if (e.which === PREV_KEY) this.go(clearing, 'prev');
+ if (e.which === ESC_KEY) this.S('a.clearing-close').trigger('click');
+ },
+
+ nav : function (e, direction) {
+ var clearing = $('ul[' + this.attr_name() + ']', '.clearing-blackout');
+
+ e.preventDefault();
+ this.go(clearing, direction);
+ },
+
+ resize : function () {
+ var image = $('img', '.clearing-blackout .visible-img'),
+ label = $('.clearing-touch-label', '.clearing-blackout');
+
+ if (image.length) {
+ this.center_and_label(image, label);
+ }
+ },
+
+ // visual adjustments
+ fix_height : function (target) {
+ var lis = target.parent().children(),
+ self = this;
+
+ lis.each(function () {
+ var li = self.S(this),
+ image = li.find('img');
+
+ if (li.height() > image.outerHeight()) {
+ li.addClass('fix-height');
+ }
+ })
+ .closest('ul')
+ .width(lis.length * 100 + '%');
+
+ return this;
+ },
+
+ update_paddles : function (target) {
+ var visible_image = target
+ .closest('.carousel')
+ .siblings('.visible-img');
+
+ if (target.next().length > 0) {
+ this.S('.clearing-main-next', visible_image)
+ .removeClass('disabled');
+ } else {
+ this.S('.clearing-main-next', visible_image)
+ .addClass('disabled');
+ }
+
+ if (target.prev().length > 0) {
+ this.S('.clearing-main-prev', visible_image)
+ .removeClass('disabled');
+ } else {
+ this.S('.clearing-main-prev', visible_image)
+ .addClass('disabled');
+ }
+ },
+
+ center_and_label : function (target, label) {
+ if (!this.rtl) {
+ target.css({
+ marginLeft : -(target.outerWidth() / 2),
+ marginTop : -(target.outerHeight() / 2)
+ });
+ label.css({
+ marginLeft : -(label.outerWidth() / 2),
+ marginTop : -(target.outerHeight() / 2)-label.outerHeight()-10
+ });
+ } else {
+ target.css({
+ marginRight : -(target.outerWidth() / 2),
+ marginTop : -(target.outerHeight() / 2),
+ left: 'auto',
+ right: '50%'
+ });
+ label.css({
+ marginRight : -(label.outerWidth() / 2),
+ marginTop : -(target.outerHeight() / 2)-label.outerHeight()-10,
+ left: 'auto',
+ right: '50%'
+ });
+ }
+ return this;
+ },
+
+ // image loading and preloading
+
+ load : function ($image) {
+ if ($image[0].nodeName === "A") {
+ var href = $image.attr('href');
+ } else {
+ var href = $image.parent().attr('href');
+ }
+
+ this.preload($image);
+
+ if (href) return href;
+ return $image.attr('src');
+ },
+
+ preload : function ($image) {
+ this
+ .img($image.closest('li').next())
+ .img($image.closest('li').prev());
+ },
+
+ img : function (img) {
+ if (img.length) {
+ var new_img = new Image(),
+ new_a = this.S('a', img);
+
+ if (new_a.length) {
+ new_img.src = new_a.attr('href');
+ } else {
+ new_img.src = this.S('img', img).attr('src');
+ }
+ }
+ return this;
+ },
+
+ // image caption
+
+ caption : function (container, $image) {
+ var caption = $image.data('caption');
+
+ if (caption) {
+ container
+ .html(caption)
+ .show();
+ } else {
+ container
+ .text('')
+ .hide();
+ }
+ return this;
+ },
+
+ // directional methods
+
+ go : function ($ul, direction) {
+ var current = this.S('.visible', $ul),
+ target = current[direction]();
+
+ if (target.length) {
+ this.S('img', target)
+ .trigger('click', [current, target]);
+ }
+ },
+
+ shift : function (current, target, callback) {
+ var clearing = target.parent(),
+ old_index = this.settings.prev_index || target.index(),
+ direction = this.direction(clearing, current, target),
+ dir = this.rtl ? 'right' : 'left',
+ left = parseInt(clearing.css('left'), 10),
+ width = target.outerWidth(),
+ skip_shift;
+
+ var dir_obj = {};
+
+ // we use jQuery animate instead of CSS transitions because we
+ // need a callback to unlock the next animation
+ // needs support for RTL **
+ if (target.index() !== old_index && !/skip/.test(direction)){
+ if (/left/.test(direction)) {
+ this.lock();
+ dir_obj[dir] = left + width;
+ clearing.animate(dir_obj, 300, this.unlock());
+ } else if (/right/.test(direction)) {
+ this.lock();
+ dir_obj[dir] = left - width;
+ clearing.animate(dir_obj, 300, this.unlock());
+ }
+ } else if (/skip/.test(direction)) {
+ // the target image is not adjacent to the current image, so
+ // do we scroll right or not
+ skip_shift = target.index() - this.settings.up_count;
+ this.lock();
+
+ if (skip_shift > 0) {
+ dir_obj[dir] = -(skip_shift * width);
+ clearing.animate(dir_obj, 300, this.unlock());
+ } else {
+ dir_obj[dir] = 0;
+ clearing.animate(dir_obj, 300, this.unlock());
+ }
+ }
+
+ callback();
+ },
+
+ direction : function ($el, current, target) {
+ var lis = this.S('li', $el),
+ li_width = lis.outerWidth() + (lis.outerWidth() / 4),
+ up_count = Math.floor(this.S('.clearing-container').outerWidth() / li_width) - 1,
+ target_index = lis.index(target),
+ response;
+
+ this.settings.up_count = up_count;
+
+ if (this.adjacent(this.settings.prev_index, target_index)) {
+ if ((target_index > up_count)
+ && target_index > this.settings.prev_index) {
+ response = 'right';
+ } else if ((target_index > up_count - 1)
+ && target_index <= this.settings.prev_index) {
+ response = 'left';
+ } else {
+ response = false;
+ }
+ } else {
+ response = 'skip';
+ }
+
+ this.settings.prev_index = target_index;
+
+ return response;
+ },
+
+ adjacent : function (current_index, target_index) {
+ for (var i = target_index + 1; i >= target_index - 1; i--) {
+ if (i === current_index) return true;
+ }
+ return false;
+ },
+
+ // lock management
+
+ lock : function () {
+ this.settings.locked = true;
+ },
+
+ unlock : function () {
+ this.settings.locked = false;
+ },
+
+ locked : function () {
+ return this.settings.locked;
+ },
+
+ off : function () {
+ this.S(this.scope).off('.fndtn.clearing');
+ this.S(window).off('.fndtn.clearing');
+ },
+
+ reflow : function () {
+ this.init();
+ }
+ };
+
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.dropdown = {
+ name : 'dropdown',
+
+ version : '5.1.1',
+
+ settings : {
+ active_class: 'open',
+ is_hover: false,
+ opened: function(){},
+ closed: function(){}
+ },
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'throttle');
+
+ this.bindings(method, options);
+ },
+
+ events : function (scope) {
+ var self = this,
+ S = self.S;
+
+ S(this.scope)
+ .off('.dropdown')
+ .on('click.fndtn.dropdown', '[' + this.attr_name() + ']', function (e) {
+ var settings = S(this).data(self.attr_name(true) + '-init') || self.settings;
+ e.preventDefault();
+ if (!settings.is_hover || Modernizr.touch) self.toggle(S(this));
+ })
+ .on('mouseenter.fndtn.dropdown', '[' + this.attr_name() + '], [' + this.attr_name() + '-content]', function (e) {
+ var $this = S(this);
+ clearTimeout(self.timeout);
+
+ if ($this.data(self.data_attr())) {
+ var dropdown = S('#' + $this.data(self.data_attr())),
+ target = $this;
+ } else {
+ var dropdown = $this;
+ target = S("[" + self.attr_name() + "='" + dropdown.attr('id') + "']");
+ }
+
+ var settings = target.data(self.attr_name(true) + '-init') || self.settings;
+
+ if(S(e.target).data(self.data_attr()) && settings.is_hover) {
+ self.closeall.call(self);
+ }
+
+ if (settings.is_hover) self.open.apply(self, [dropdown, target]);
+ })
+ .on('mouseleave.fndtn.dropdown', '[' + this.attr_name() + '], [' + this.attr_name() + '-content]', function (e) {
+ var $this = S(this);
+ self.timeout = setTimeout(function () {
+ if ($this.data(self.data_attr())) {
+ var settings = $this.data(self.data_attr(true) + '-init') || self.settings;
+ if (settings.is_hover) self.close.call(self, S('#' + $this.data(self.data_attr())));
+ } else {
+ var target = S('[' + self.attr_name() + '="' + S(this).attr('id') + '"]'),
+ settings = target.data(self.attr_name(true) + '-init') || self.settings;
+ if (settings.is_hover) self.close.call(self, $this);
+ }
+ }.bind(this), 150);
+ })
+ .on('click.fndtn.dropdown', function (e) {
+ var parent = S(e.target).closest('[' + self.attr_name() + '-content]');
+
+ if (S(e.target).data(self.data_attr()) || S(e.target).parent().data(self.data_attr())) {
+ return;
+ }
+ if (!(S(e.target).data('revealId')) &&
+ (parent.length > 0 && (S(e.target).is('[' + self.attr_name() + '-content]') ||
+ $.contains(parent.first()[0], e.target)))) {
+ e.stopPropagation();
+ return;
+ }
+
+ self.close.call(self, S('[' + self.attr_name() + '-content]'));
+ })
+ .on('opened.fndtn.dropdown', '[' + self.attr_name() + '-content]', function () {
+ self.settings.opened.call(this);
+ })
+ .on('closed.fndtn.dropdown', '[' + self.attr_name() + '-content]', function () {
+ self.settings.closed.call(this);
+ });
+
+ S(window)
+ .off('.dropdown')
+ .on('resize.fndtn.dropdown', self.throttle(function () {
+ self.resize.call(self);
+ }, 50)).trigger('resize');
+ },
+
+ close: function (dropdown) {
+ var self = this;
+ dropdown.each(function () {
+ if (self.S(this).hasClass(self.settings.active_class)) {
+ self.S(this)
+ .css(Foundation.rtl ? 'right':'left', '-99999px')
+ .removeClass(self.settings.active_class);
+ self.S(this).trigger('closed');
+ }
+ });
+ },
+
+ closeall: function() {
+ var self = this;
+ $.each(self.S('[' + this.attr_name() + '-content]'), function() {
+ self.close.call(self, self.S(this))
+ });
+ },
+
+ open: function (dropdown, target) {
+ this
+ .css(dropdown
+ .addClass(this.settings.active_class), target);
+ dropdown.trigger('opened');
+ },
+
+ data_attr: function () {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + this.name;
+ }
+
+ return this.name;
+ },
+
+ toggle : function (target) {
+ var dropdown = this.S('#' + target.data(this.data_attr()));
+ if (dropdown.length === 0) {
+ // No dropdown found, not continuing
+ return;
+ }
+
+ this.close.call(this, this.S('[' + this.attr_name() + '-content]').not(dropdown));
+
+ if (dropdown.hasClass(this.settings.active_class)) {
+ this.close.call(this, dropdown);
+ } else {
+ this.close.call(this, this.S('[' + this.attr_name() + '-content]'))
+ this.open.call(this, dropdown, target);
+ }
+ },
+
+ resize : function () {
+ var dropdown = this.S('[' + this.attr_name() + '-content].open'),
+ target = this.S("[" + this.attr_name() + "='" + dropdown.attr('id') + "']");
+
+ if (dropdown.length && target.length) {
+ this.css(dropdown, target);
+ }
+ },
+
+ css : function (dropdown, target) {
+ var offset_parent = dropdown.offsetParent(),
+ position = target.offset();
+
+ position.top -= offset_parent.offset().top;
+ position.left -= offset_parent.offset().left;
+
+ if (this.small()) {
+ dropdown.css({
+ position : 'absolute',
+ width: '95%',
+ 'max-width': 'none',
+ top: position.top + target.outerHeight()
+ });
+ dropdown.css(Foundation.rtl ? 'right':'left', '2.5%');
+ } else {
+ if (!Foundation.rtl && this.S(window).width() > dropdown.outerWidth() + target.offset().left) {
+ var left = position.left;
+ if (dropdown.hasClass('right')) {
+ dropdown.removeClass('right');
+ }
+ } else {
+ if (!dropdown.hasClass('right')) {
+ dropdown.addClass('right');
+ }
+ var left = position.left - (dropdown.outerWidth() - target.outerWidth());
+ }
+
+ dropdown.attr('style', '').css({
+ position : 'absolute',
+ top: position.top + target.outerHeight(),
+ left: left
+ });
+ }
+
+ return dropdown;
+ },
+
+ small : function () {
+ return matchMedia(Foundation.media_queries.small).matches &&
+ !matchMedia(Foundation.media_queries.medium).matches;
+ },
+
+ off: function () {
+ this.S(this.scope).off('.fndtn.dropdown');
+ this.S('html, body').off('.fndtn.dropdown');
+ this.S(window).off('.fndtn.dropdown');
+ this.S('[data-dropdown-content]').off('.fndtn.dropdown');
+ this.settings.init = false;
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.equalizer = {
+ name : 'equalizer',
+
+ version : '5.1.1',
+
+ settings : {
+ use_tallest: true,
+ before_height_change: $.noop,
+ after_height_change: $.noop
+ },
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ this.reflow();
+ },
+
+ events : function () {
+ this.S(window).off('.equalizer').on('resize.fndtn.equalizer', function(e){
+ this.reflow();
+ }.bind(this));
+ },
+
+ equalize: function(equalizer) {
+ var isStacked = false,
+ vals = equalizer.find('[' + this.attr_name() + '-watch]'),
+ firstTopOffset = vals.first().offset().top,
+ settings = equalizer.data(this.attr_name(true)+'-init');
+
+ if (vals.length === 0) return;
+ settings.before_height_change();
+ equalizer.trigger('before-height-change');
+ vals.height('inherit');
+ vals.each(function(){
+ var el = $(this);
+ if (el.offset().top !== firstTopOffset) {
+ isStacked = true;
+ }
+ });
+ if (isStacked) return;
+
+ var heights = vals.map(function(){ return $(this).outerHeight() });
+ if (settings.use_tallest) {
+ var max = Math.max.apply(null, heights);
+ vals.height(max);
+ } else {
+ var min = Math.min.apply(null, heights);
+ vals.height(min);
+ }
+ settings.after_height_change();
+ equalizer.trigger('after-height-change');
+ },
+
+ reflow : function () {
+ var self = this;
+
+ this.S('[' + this.attr_name() + ']', this.scope).each(function(){
+ self.equalize($(this));
+ });
+ }
+ };
+}(jQuery, this, this.document));
\ No newline at end of file
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.interchange = {
+ name : 'interchange',
+
+ version : '5.1.1',
+
+ cache : {},
+
+ images_loaded : false,
+ nodes_loaded : false,
+
+ settings : {
+ load_attr : 'interchange',
+
+ named_queries : {
+ 'default' : 'only screen',
+ small : Foundation.media_queries.small,
+ medium : Foundation.media_queries.medium,
+ large : Foundation.media_queries.large,
+ xlarge : Foundation.media_queries.xlarge,
+ xxlarge: Foundation.media_queries.xxlarge,
+ landscape : 'only screen and (orientation: landscape)',
+ portrait : 'only screen and (orientation: portrait)',
+ retina : 'only screen and (-webkit-min-device-pixel-ratio: 2),' +
+ 'only screen and (min--moz-device-pixel-ratio: 2),' +
+ 'only screen and (-o-min-device-pixel-ratio: 2/1),' +
+ 'only screen and (min-device-pixel-ratio: 2),' +
+ 'only screen and (min-resolution: 192dpi),' +
+ 'only screen and (min-resolution: 2dppx)'
+ },
+
+ directives : {
+ replace: function (el, path, trigger) {
+ // The trigger argument, if called within the directive, fires
+ // an event named after the directive on the element, passing
+ // any parameters along to the event that you pass to trigger.
+ //
+ // ex. trigger(), trigger([a, b, c]), or trigger(a, b, c)
+ //
+ // This allows you to bind a callback like so:
+ // $('#interchangeContainer').on('replace', function (e, a, b, c) {
+ // console.log($(this).html(), a, b, c);
+ // });
+
+ if (/IMG/.test(el[0].nodeName)) {
+ var orig_path = el[0].src;
+
+ if (new RegExp(path, 'i').test(orig_path)) return;
+
+ el[0].src = path;
+
+ return trigger(el[0].src);
+ }
+ var last_path = el.data(this.data_attr + '-last-path');
+
+ if (last_path == path) return;
+
+ return $.get(path, function (response) {
+ el.html(response);
+ el.data(this.data_attr + '-last-path', path);
+ trigger();
+ });
+
+ }
+ }
+ },
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'throttle random_str');
+
+ this.data_attr = this.set_data_attr();
+ $.extend(true, this.settings, method, options);
+
+ this.bindings(method, options);
+ this.load('images');
+ this.load('nodes');
+ },
+
+ events : function () {
+ var self = this;
+
+ $(window)
+ .off('.interchange')
+ .on('resize.fndtn.interchange', self.throttle(function () {
+ self.resize();
+ }, 50));
+
+ return this;
+ },
+
+ resize : function () {
+ var cache = this.cache;
+
+ if(!this.images_loaded || !this.nodes_loaded) {
+ setTimeout($.proxy(this.resize, this), 50);
+ return;
+ }
+
+ for (var uuid in cache) {
+ if (cache.hasOwnProperty(uuid)) {
+ var passed = this.results(uuid, cache[uuid]);
+
+ if (passed) {
+ this.settings.directives[passed
+ .scenario[1]].call(this, passed.el, passed.scenario[0], function () {
+ if (arguments[0] instanceof Array) {
+ var args = arguments[0];
+ } else {
+ var args = Array.prototype.slice.call(arguments, 0);
+ }
+
+ passed.el.trigger(passed.scenario[1], args);
+ });
+ }
+ }
+ }
+
+ },
+
+ results : function (uuid, scenarios) {
+ var count = scenarios.length;
+
+ if (count > 0) {
+ var el = this.S('[' + this.add_namespace('data-uuid') + '="' + uuid + '"]');
+
+ while (count--) {
+ var mq, rule = scenarios[count][2];
+ if (this.settings.named_queries.hasOwnProperty(rule)) {
+ mq = matchMedia(this.settings.named_queries[rule]);
+ } else {
+ mq = matchMedia(rule);
+ }
+ if (mq.matches) {
+ return {el: el, scenario: scenarios[count]};
+ }
+ }
+ }
+
+ return false;
+ },
+
+ load : function (type, force_update) {
+ if (typeof this['cached_' + type] === 'undefined' || force_update) {
+ this['update_' + type]();
+ }
+
+ return this['cached_' + type];
+ },
+
+ update_images : function () {
+ var images = this.S('img[' + this.data_attr + ']'),
+ count = images.length,
+ i = count,
+ loaded_count = 0,
+ data_attr = this.data_attr;
+
+ this.cache = {};
+ this.cached_images = [];
+ this.images_loaded = (count === 0);
+
+ while (i--) {
+ loaded_count++;
+ if (images[i]) {
+ var str = images[i].getAttribute(data_attr) || '';
+
+ if (str.length > 0) {
+ this.cached_images.push(images[i]);
+ }
+ }
+
+ if (loaded_count === count) {
+ this.images_loaded = true;
+ this.enhance('images');
+ }
+ }
+
+ return this;
+ },
+
+ update_nodes : function () {
+ var nodes = this.S('[' + this.data_attr + ']').not('img'),
+ count = nodes.length,
+ i = count,
+ loaded_count = 0,
+ data_attr = this.data_attr;
+
+ this.cached_nodes = [];
+ // Set nodes_loaded to true if there are no nodes
+ // this.nodes_loaded = false;
+ this.nodes_loaded = (count === 0);
+
+
+ while (i--) {
+ loaded_count++;
+ var str = nodes[i].getAttribute(data_attr) || '';
+
+ if (str.length > 0) {
+ this.cached_nodes.push(nodes[i]);
+ }
+
+ if(loaded_count === count) {
+ this.nodes_loaded = true;
+ this.enhance('nodes');
+ }
+ }
+
+ return this;
+ },
+
+ enhance : function (type) {
+ var i = this['cached_' + type].length;
+
+ while (i--) {
+ this.object($(this['cached_' + type][i]));
+ }
+
+ return $(window).trigger('resize');
+ },
+
+ parse_params : function (path, directive, mq) {
+ return [this.trim(path), this.convert_directive(directive), this.trim(mq)];
+ },
+
+ convert_directive : function (directive) {
+ var trimmed = this.trim(directive);
+
+ if (trimmed.length > 0) {
+ return trimmed;
+ }
+
+ return 'replace';
+ },
+
+ object : function(el) {
+ var raw_arr = this.parse_data_attr(el),
+ scenarios = [],
+ i = raw_arr.length;
+
+ if (i > 0) {
+ while (i--) {
+ var split = raw_arr[i].split(/\((.*?)(\))$/);
+
+ if (split.length > 1) {
+ var cached_split = split[0].split(','),
+ params = this.parse_params(cached_split[0],
+ cached_split[1], split[1]);
+
+ scenarios.push(params);
+ }
+ }
+ }
+
+ return this.store(el, scenarios);
+ },
+
+ uuid : function (separator) {
+ var delim = separator || "-",
+ self = this;
+
+ function S4() {
+ return self.random_str(6);
+ }
+
+ return (S4() + S4() + delim + S4() + delim + S4()
+ + delim + S4() + delim + S4() + S4() + S4());
+ },
+
+ store : function (el, scenarios) {
+ var uuid = this.uuid(),
+ current_uuid = el.data(this.add_namespace('uuid', true));
+
+ if (this.cache[current_uuid]) return this.cache[current_uuid];
+
+ el.attr(this.add_namespace('data-uuid'), uuid);
+
+ return this.cache[uuid] = scenarios;
+ },
+
+ trim : function(str) {
+ if (typeof str === 'string') {
+ return $.trim(str);
+ }
+
+ return str;
+ },
+
+ set_data_attr: function (init) {
+ if (init) {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + this.settings.load_attr;
+ }
+
+ return this.settings.load_attr;
+ }
+
+ if (this.namespace.length > 0) {
+ return 'data-' + this.namespace + '-' + this.settings.load_attr;
+ }
+
+ return 'data-' + this.settings.load_attr;
+ },
+
+ parse_data_attr : function (el) {
+ var raw = el.attr(this.attr_name()).split(/\[(.*?)\]/),
+ i = raw.length,
+ output = [];
+
+ while (i--) {
+ if (raw[i].replace(/[\W\d]+/, '').length > 4) {
+ output.push(raw[i]);
+ }
+ }
+
+ return output;
+ },
+
+ reflow : function () {
+ this.load('images', true);
+ this.load('nodes', true);
+ }
+
+ };
+
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ var Modernizr = Modernizr || false;
+
+ Foundation.libs.joyride = {
+ name : 'joyride',
+
+ version : '5.1.1',
+
+ defaults : {
+ expose : false, // turn on or off the expose feature
+ modal : true, // Whether to cover page with modal during the tour
+ tip_location : 'bottom', // 'top' or 'bottom' in relation to parent
+ nub_position : 'auto', // override on a per tooltip bases
+ scroll_speed : 1500, // Page scrolling speed in milliseconds, 0 = no scroll animation
+ scroll_animation : 'linear', // supports 'swing' and 'linear', extend with jQuery UI.
+ timer : 0, // 0 = no timer , all other numbers = timer in milliseconds
+ start_timer_on_click : true, // true or false - true requires clicking the first button start the timer
+ start_offset : 0, // the index of the tooltip you want to start on (index of the li)
+ next_button : true, // true or false to control whether a next button is used
+ tip_animation : 'fade', // 'pop' or 'fade' in each tip
+ pause_after : [], // array of indexes where to pause the tour after
+ exposed : [], // array of expose elements
+ tip_animation_fade_speed : 300, // when tipAnimation = 'fade' this is speed in milliseconds for the transition
+ cookie_monster : false, // true or false to control whether cookies are used
+ cookie_name : 'joyride', // Name the cookie you'll use
+ cookie_domain : false, // Will this cookie be attached to a domain, ie. '.notableapp.com'
+ cookie_expires : 365, // set when you would like the cookie to expire.
+ tip_container : 'body', // Where will the tip be attached
+ tip_location_patterns : {
+ top: ['bottom'],
+ bottom: [], // bottom should not need to be repositioned
+ left: ['right', 'top', 'bottom'],
+ right: ['left', 'top', 'bottom']
+ },
+ post_ride_callback : function (){}, // A method to call once the tour closes (canceled or complete)
+ post_step_callback : function (){}, // A method to call after each step
+ pre_step_callback : function (){}, // A method to call before each step
+ pre_ride_callback : function (){}, // A method to call before the tour starts (passed index, tip, and cloned exposed element)
+ post_expose_callback : function (){}, // A method to call after an element has been exposed
+ template : { // HTML segments for tip layout
+ link : '<a href="#close" class="joyride-close-tip">×</a>',
+ timer : '<div class="joyride-timer-indicator-wrap"><span class="joyride-timer-indicator"></span></div>',
+ tip : '<div class="joyride-tip-guide"><span class="joyride-nub"></span></div>',
+ wrapper : '<div class="joyride-content-wrapper"></div>',
+ button : '<a href="#" class="small button joyride-next-tip"></a>',
+ modal : '<div class="joyride-modal-bg"></div>',
+ expose : '<div class="joyride-expose-wrapper"></div>',
+ expose_cover: '<div class="joyride-expose-cover"></div>'
+ },
+ expose_add_class : '' // One or more space-separated class names to be added to exposed element
+ },
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'throttle random_str');
+
+ this.settings = this.defaults;
+
+ this.bindings(method, options)
+ },
+
+ events : function () {
+ var self = this;
+
+ $(this.scope)
+ .off('.joyride')
+ .on('click.fndtn.joyride', '.joyride-next-tip, .joyride-modal-bg', function (e) {
+ e.preventDefault();
+
+ if (this.settings.$li.next().length < 1) {
+ this.end();
+ } else if (this.settings.timer > 0) {
+ clearTimeout(this.settings.automate);
+ this.hide();
+ this.show();
+ this.startTimer();
+ } else {
+ this.hide();
+ this.show();
+ }
+
+ }.bind(this))
+
+ .on('click.fndtn.joyride', '.joyride-close-tip', function (e) {
+ e.preventDefault();
+ this.end();
+ }.bind(this));
+
+ $(window)
+ .off('.joyride')
+ .on('resize.fndtn.joyride', self.throttle(function () {
+ if ($('[' + self.attr_name() + ']').length > 0 && self.settings.$next_tip) {
+ if (self.settings.exposed.length > 0) {
+ var $els = $(self.settings.exposed);
+
+ $els.each(function () {
+ var $this = $(this);
+ self.un_expose($this);
+ self.expose($this);
+ });
+ }
+
+ if (self.is_phone()) {
+ self.pos_phone();
+ } else {
+ self.pos_default(false, true);
+ }
+ }
+ }, 100));
+ },
+
+ start : function () {
+ var self = this,
+ $this = $('[' + this.attr_name() + ']', this.scope),
+ integer_settings = ['timer', 'scrollSpeed', 'startOffset', 'tipAnimationFadeSpeed', 'cookieExpires'],
+ int_settings_count = integer_settings.length;
+
+ if (!$this.length > 0) return;
+
+ if (!this.settings.init) this.events();
+
+ this.settings = $this.data(this.attr_name(true) + '-init');
+
+ // non configureable settings
+ this.settings.$content_el = $this;
+ this.settings.$body = $(this.settings.tip_container);
+ this.settings.body_offset = $(this.settings.tip_container).position();
+ this.settings.$tip_content = this.settings.$content_el.find('> li');
+ this.settings.paused = false;
+ this.settings.attempts = 0;
+
+ // can we create cookies?
+ if (typeof $.cookie !== 'function') {
+ this.settings.cookie_monster = false;
+ }
+
+ // generate the tips and insert into dom.
+ if (!this.settings.cookie_monster || this.settings.cookie_monster && !$.cookie(this.settings.cookie_name)) {
+ this.settings.$tip_content.each(function (index) {
+ var $this = $(this);
+ this.settings = $.extend({}, self.defaults, self.data_options($this))
+
+ // Make sure that settings parsed from data_options are integers where necessary
+ var i = int_settings_count;
+ while (i--) {
+ self.settings[integer_settings[i]] = parseInt(self.settings[integer_settings[i]], 10);
+ }
+ self.create({$li : $this, index : index});
+ });
+
+ // show first tip
+ if (!this.settings.start_timer_on_click && this.settings.timer > 0) {
+ this.show('init');
+ this.startTimer();
+ } else {
+ this.show('init');
+ }
+
+ }
+ },
+
+ resume : function () {
+ this.set_li();
+ this.show();
+ },
+
+ tip_template : function (opts) {
+ var $blank, content;
+
+ opts.tip_class = opts.tip_class || '';
+
+ $blank = $(this.settings.template.tip).addClass(opts.tip_class);
+ content = $.trim($(opts.li).html()) +
+ this.button_text(opts.button_text) +
+ this.settings.template.link +
+ this.timer_instance(opts.index);
+
+ $blank.append($(this.settings.template.wrapper));
+ $blank.first().attr(this.add_namespace('data-index'), opts.index);
+ $('.joyride-content-wrapper', $blank).append(content);
+
+ return $blank[0];
+ },
+
+ timer_instance : function (index) {
+ var txt;
+
+ if ((index === 0 && this.settings.start_timer_on_click && this.settings.timer > 0) || this.settings.timer === 0) {
+ txt = '';
+ } else {
+ txt = $(this.settings.template.timer)[0].outerHTML;
+ }
+ return txt;
+ },
+
+ button_text : function (txt) {
+ if (this.settings.next_button) {
+ txt = $.trim(txt) || 'Next';
+ txt = $(this.settings.template.button).append(txt)[0].outerHTML;
+ } else {
+ txt = '';
+ }
+ return txt;
+ },
+
+ create : function (opts) {
+ console.log(opts.$li)
+ var buttonText = opts.$li.attr(this.add_namespace('data-button'))
+ || opts.$li.attr(this.add_namespace('data-text')),
+ tipClass = opts.$li.attr('class'),
+ $tip_content = $(this.tip_template({
+ tip_class : tipClass,
+ index : opts.index,
+ button_text : buttonText,
+ li : opts.$li
+ }));
+
+ $(this.settings.tip_container).append($tip_content);
+ },
+
+ show : function (init) {
+ var $timer = null;
+
+ // are we paused?
+ if (this.settings.$li === undefined
+ || ($.inArray(this.settings.$li.index(), this.settings.pause_after) === -1)) {
+
+ // don't go to the next li if the tour was paused
+ if (this.settings.paused) {
+ this.settings.paused = false;
+ } else {
+ this.set_li(init);
+ }
+
+ this.settings.attempts = 0;
+
+ if (this.settings.$li.length && this.settings.$target.length > 0) {
+ if (init) { //run when we first start
+ this.settings.pre_ride_callback(this.settings.$li.index(), this.settings.$next_tip);
+ if (this.settings.modal) {
+ this.show_modal();
+ }
+ }
+
+ this.settings.pre_step_callback(this.settings.$li.index(), this.settings.$next_tip);
+
+ if (this.settings.modal && this.settings.expose) {
+ this.expose();
+ }
+
+ this.settings.tip_settings = $.extend({}, this.settings, this.data_options(this.settings.$li));
+
+ this.settings.timer = parseInt(this.settings.timer, 10);
+
+ this.settings.tip_settings.tip_location_pattern = this.settings.tip_location_patterns[this.settings.tip_settings.tip_location];
+
+ // scroll if not modal
+ if (!/body/i.test(this.settings.$target.selector)) {
+ this.scroll_to();
+ }
+
+ if (this.is_phone()) {
+ this.pos_phone(true);
+ } else {
+ this.pos_default(true);
+ }
+
+ $timer = this.settings.$next_tip.find('.joyride-timer-indicator');
+
+ if (/pop/i.test(this.settings.tip_animation)) {
+
+ $timer.width(0);
+
+ if (this.settings.timer > 0) {
+
+ this.settings.$next_tip.show();
+
+ setTimeout(function () {
+ $timer.animate({
+ width: $timer.parent().width()
+ }, this.settings.timer, 'linear');
+ }.bind(this), this.settings.tip_animation_fade_speed);
+
+ } else {
+ this.settings.$next_tip.show();
+
+ }
+
+
+ } else if (/fade/i.test(this.settings.tip_animation)) {
+
+ $timer.width(0);
+
+ if (this.settings.timer > 0) {
+
+ this.settings.$next_tip
+ .fadeIn(this.settings.tip_animation_fade_speed)
+ .show();
+
+ setTimeout(function () {
+ $timer.animate({
+ width: $timer.parent().width()
+ }, this.settings.timer, 'linear');
+ }.bind(this), this.settings.tip_animation_fadeSpeed);
+
+ } else {
+ this.settings.$next_tip.fadeIn(this.settings.tip_animation_fade_speed);
+ }
+ }
+
+ this.settings.$current_tip = this.settings.$next_tip;
+
+ // skip non-existant targets
+ } else if (this.settings.$li && this.settings.$target.length < 1) {
+
+ this.show();
+
+ } else {
+
+ this.end();
+
+ }
+ } else {
+
+ this.settings.paused = true;
+
+ }
+
+ },
+
+ is_phone : function () {
+ return matchMedia(Foundation.media_queries.small).matches &&
+ !matchMedia(Foundation.media_queries.medium).matches;
+ },
+
+ hide : function () {
+ if (this.settings.modal && this.settings.expose) {
+ this.un_expose();
+ }
+
+ if (!this.settings.modal) {
+ $('.joyride-modal-bg').hide();
+ }
+
+ // Prevent scroll bouncing...wait to remove from layout
+ this.settings.$current_tip.css('visibility', 'hidden');
+ setTimeout($.proxy(function() {
+ this.hide();
+ this.css('visibility', 'visible');
+ }, this.settings.$current_tip), 0);
+ this.settings.post_step_callback(this.settings.$li.index(),
+ this.settings.$current_tip);
+ },
+
+ set_li : function (init) {
+ if (init) {
+ this.settings.$li = this.settings.$tip_content.eq(this.settings.start_offset);
+ this.set_next_tip();
+ this.settings.$current_tip = this.settings.$next_tip;
+ } else {
+ this.settings.$li = this.settings.$li.next();
+ this.set_next_tip();
+ }
+
+ this.set_target();
+ },
+
+ set_next_tip : function () {
+ this.settings.$next_tip = $(".joyride-tip-guide").eq(this.settings.$li.index());
+ this.settings.$next_tip.data('closed', '');
+ },
+
+ set_target : function () {
+ console.log(this.add_namespace('data-class'))
+ var cl = this.settings.$li.attr(this.add_namespace('data-class')),
+ id = this.settings.$li.attr(this.add_namespace('data-id')),
+ $sel = function () {
+ if (id) {
+ return $(document.getElementById(id));
+ } else if (cl) {
+ return $('.' + cl).first();
+ } else {
+ return $('body');
+ }
+ };
+
+ console.log(cl, id)
+
+ this.settings.$target = $sel();
+ },
+
+ scroll_to : function () {
+ var window_half, tipOffset;
+
+ window_half = $(window).height() / 2;
+ tipOffset = Math.ceil(this.settings.$target.offset().top - window_half + this.settings.$next_tip.outerHeight());
+
+ if (tipOffset != 0) {
+ $('html, body').animate({
+ scrollTop: tipOffset
+ }, this.settings.scroll_speed, 'swing');
+ }
+ },
+
+ paused : function () {
+ return ($.inArray((this.settings.$li.index() + 1), this.settings.pause_after) === -1);
+ },
+
+ restart : function () {
+ this.hide();
+ this.settings.$li = undefined;
+ this.show('init');
+ },
+
+ pos_default : function (init, resizing) {
+ var half_fold = Math.ceil($(window).height() / 2),
+ tip_position = this.settings.$next_tip.offset(),
+ $nub = this.settings.$next_tip.find('.joyride-nub'),
+ nub_width = Math.ceil($nub.outerWidth() / 2),
+ nub_height = Math.ceil($nub.outerHeight() / 2),
+ toggle = init || false;
+
+ // tip must not be "display: none" to calculate position
+ if (toggle) {
+ this.settings.$next_tip.css('visibility', 'hidden');
+ this.settings.$next_tip.show();
+ }
+
+ if (typeof resizing === 'undefined') {
+ resizing = false;
+ }
+
+ if (!/body/i.test(this.settings.$target.selector)) {
+ if (this.bottom()) {
+ if (this.rtl) {
+ this.settings.$next_tip.css({
+ top: (this.settings.$target.offset().top + nub_height + this.settings.$target.outerHeight()),
+ left: this.settings.$target.offset().left + this.settings.$target.outerWidth() - this.settings.$next_tip.outerWidth()});
+ } else {
+ this.settings.$next_tip.css({
+ top: (this.settings.$target.offset().top + nub_height + this.settings.$target.outerHeight()),
+ left: this.settings.$target.offset().left});
+ }
+
+ this.nub_position($nub, this.settings.tip_settings.nub_position, 'top');
+
+ } else if (this.top()) {
+ if (this.rtl) {
+ this.settings.$next_tip.css({
+ top: (this.settings.$target.offset().top - this.settings.$next_tip.outerHeight() - nub_height),
+ left: this.settings.$target.offset().left + this.settings.$target.outerWidth() - this.settings.$next_tip.outerWidth()});
+ } else {
+ this.settings.$next_tip.css({
+ top: (this.settings.$target.offset().top - this.settings.$next_tip.outerHeight() - nub_height),
+ left: this.settings.$target.offset().left});
+ }
+
+ this.nub_position($nub, this.settings.tip_settings.nub_position, 'bottom');
+
+ } else if (this.right()) {
+
+ this.settings.$next_tip.css({
+ top: this.settings.$target.offset().top,
+ left: (this.outerWidth(this.settings.$target) + this.settings.$target.offset().left + nub_width)});
+
+ this.nub_position($nub, this.settings.tip_settings.nub_position, 'left');
+
+ } else if (this.left()) {
+
+ this.settings.$next_tip.css({
+ top: this.settings.$target.offset().top,
+ left: (this.settings.$target.offset().left - this.outerWidth(this.settings.$next_tip) - nub_width)});
+
+ this.nub_position($nub, this.settings.tip_settings.nub_position, 'right');
+
+ }
+
+ if (!this.visible(this.corners(this.settings.$next_tip)) && this.settings.attempts < this.settings.tip_settings.tip_location_pattern.length) {
+
+ $nub.removeClass('bottom')
+ .removeClass('top')
+ .removeClass('right')
+ .removeClass('left');
+
+ this.settings.tip_settings.tip_location = this.settings.tip_settings.tip_location_pattern[this.settings.attempts];
+
+ this.settings.attempts++;
+
+ this.pos_default();
+
+ }
+
+ } else if (this.settings.$li.length) {
+
+ this.pos_modal($nub);
+
+ }
+
+ if (toggle) {
+ this.settings.$next_tip.hide();
+ this.settings.$next_tip.css('visibility', 'visible');
+ }
+
+ },
+
+ pos_phone : function (init) {
+ var tip_height = this.settings.$next_tip.outerHeight(),
+ tip_offset = this.settings.$next_tip.offset(),
+ target_height = this.settings.$target.outerHeight(),
+ $nub = $('.joyride-nub', this.settings.$next_tip),
+ nub_height = Math.ceil($nub.outerHeight() / 2),
+ toggle = init || false;
+
+ $nub.removeClass('bottom')
+ .removeClass('top')
+ .removeClass('right')
+ .removeClass('left');
+
+ if (toggle) {
+ this.settings.$next_tip.css('visibility', 'hidden');
+ this.settings.$next_tip.show();
+ }
+
+ if (!/body/i.test(this.settings.$target.selector)) {
+
+ if (this.top()) {
+
+ this.settings.$next_tip.offset({top: this.settings.$target.offset().top - tip_height - nub_height});
+ $nub.addClass('bottom');
+
+ } else {
+
+ this.settings.$next_tip.offset({top: this.settings.$target.offset().top + target_height + nub_height});
+ $nub.addClass('top');
+
+ }
+
+ } else if (this.settings.$li.length) {
+ this.pos_modal($nub);
+ }
+
+ if (toggle) {
+ this.settings.$next_tip.hide();
+ this.settings.$next_tip.css('visibility', 'visible');
+ }
+ },
+
+ pos_modal : function ($nub) {
+ this.center();
+ $nub.hide();
+
+ this.show_modal();
+ },
+
+ show_modal : function () {
+ if (!this.settings.$next_tip.data('closed')) {
+ var joyridemodalbg = $('.joyride-modal-bg');
+ if (joyridemodalbg.length < 1) {
+ $('body').append(this.settings.template.modal).show();
+ }
+
+ if (/pop/i.test(this.settings.tip_animation)) {
+ joyridemodalbg.show();
+ } else {
+ joyridemodalbg.fadeIn(this.settings.tip_animation_fade_speed);
+ }
+ }
+ },
+
+ expose : function () {
+ var expose,
+ exposeCover,
+ el,
+ origCSS,
+ origClasses,
+ randId = 'expose-' + this.random_str(6);
+
+ if (arguments.length > 0 && arguments[0] instanceof $) {
+ el = arguments[0];
+ } else if(this.settings.$target && !/body/i.test(this.settings.$target.selector)){
+ el = this.settings.$target;
+ } else {
+ return false;
+ }
+
+ if(el.length < 1){
+ if(window.console){
+ console.error('element not valid', el);
+ }
+ return false;
+ }
+
+ expose = $(this.settings.template.expose);
+ this.settings.$body.append(expose);
+ expose.css({
+ top: el.offset().top,
+ left: el.offset().left,
+ width: el.outerWidth(true),
+ height: el.outerHeight(true)
+ });
+
+ exposeCover = $(this.settings.template.expose_cover);
+
+ origCSS = {
+ zIndex: el.css('z-index'),
+ position: el.css('position')
+ };
+
+ origClasses = el.attr('class') == null ? '' : el.attr('class');
+
+ el.css('z-index',parseInt(expose.css('z-index'))+1);
+
+ if (origCSS.position == 'static') {
+ el.css('position','relative');
+ }
+
+ el.data('expose-css',origCSS);
+ el.data('orig-class', origClasses);
+ el.attr('class', origClasses + ' ' + this.settings.expose_add_class);
+
+ exposeCover.css({
+ top: el.offset().top,
+ left: el.offset().left,
+ width: el.outerWidth(true),
+ height: el.outerHeight(true)
+ });
+
+ if (this.settings.modal) this.show_modal();
+
+ this.settings.$body.append(exposeCover);
+ expose.addClass(randId);
+ exposeCover.addClass(randId);
+ el.data('expose', randId);
+ this.settings.post_expose_callback(this.settings.$li.index(), this.settings.$next_tip, el);
+ this.add_exposed(el);
+ },
+
+ un_expose : function () {
+ var exposeId,
+ el,
+ expose ,
+ origCSS,
+ origClasses,
+ clearAll = false;
+
+ if (arguments.length > 0 && arguments[0] instanceof $) {
+ el = arguments[0];
+ } else if(this.settings.$target && !/body/i.test(this.settings.$target.selector)){
+ el = this.settings.$target;
+ } else {
+ return false;
+ }
+
+ if(el.length < 1){
+ if (window.console) {
+ console.error('element not valid', el);
+ }
+ return false;
+ }
+
+ exposeId = el.data('expose');
+ expose = $('.' + exposeId);
+
+ if (arguments.length > 1) {
+ clearAll = arguments[1];
+ }
+
+ if (clearAll === true) {
+ $('.joyride-expose-wrapper,.joyride-expose-cover').remove();
+ } else {
+ expose.remove();
+ }
+
+ origCSS = el.data('expose-css');
+
+ if (origCSS.zIndex == 'auto') {
+ el.css('z-index', '');
+ } else {
+ el.css('z-index', origCSS.zIndex);
+ }
+
+ if (origCSS.position != el.css('position')) {
+ if(origCSS.position == 'static') {// this is default, no need to set it.
+ el.css('position', '');
+ } else {
+ el.css('position', origCSS.position);
+ }
+ }
+
+ origClasses = el.data('orig-class');
+ el.attr('class', origClasses);
+ el.removeData('orig-classes');
+
+ el.removeData('expose');
+ el.removeData('expose-z-index');
+ this.remove_exposed(el);
+ },
+
+ add_exposed: function(el){
+ this.settings.exposed = this.settings.exposed || [];
+ if (el instanceof $ || typeof el === 'object') {
+ this.settings.exposed.push(el[0]);
+ } else if (typeof el == 'string') {
+ this.settings.exposed.push(el);
+ }
+ },
+
+ remove_exposed: function(el){
+ var search, i;
+ if (el instanceof $) {
+ search = el[0]
+ } else if (typeof el == 'string'){
+ search = el;
+ }
+
+ this.settings.exposed = this.settings.exposed || [];
+ i = this.settings.exposed.length;
+
+ while (i--) {
+ if (this.settings.exposed[i] == search) {
+ this.settings.exposed.splice(i, 1);
+ return;
+ }
+ }
+ },
+
+ center : function () {
+ var $w = $(window);
+
+ this.settings.$next_tip.css({
+ top : ((($w.height() - this.settings.$next_tip.outerHeight()) / 2) + $w.scrollTop()),
+ left : ((($w.width() - this.settings.$next_tip.outerWidth()) / 2) + $w.scrollLeft())
+ });
+
+ return true;
+ },
+
+ bottom : function () {
+ return /bottom/i.test(this.settings.tip_settings.tip_location);
+ },
+
+ top : function () {
+ return /top/i.test(this.settings.tip_settings.tip_location);
+ },
+
+ right : function () {
+ return /right/i.test(this.settings.tip_settings.tip_location);
+ },
+
+ left : function () {
+ return /left/i.test(this.settings.tip_settings.tip_location);
+ },
+
+ corners : function (el) {
+ var w = $(window),
+ window_half = w.height() / 2,
+ //using this to calculate since scroll may not have finished yet.
+ tipOffset = Math.ceil(this.settings.$target.offset().top - window_half + this.settings.$next_tip.outerHeight()),
+ right = w.width() + w.scrollLeft(),
+ offsetBottom = w.height() + tipOffset,
+ bottom = w.height() + w.scrollTop(),
+ top = w.scrollTop();
+
+ if (tipOffset < top) {
+ if (tipOffset < 0) {
+ top = 0;
+ } else {
+ top = tipOffset;
+ }
+ }
+
+ if (offsetBottom > bottom) {
+ bottom = offsetBottom;
+ }
+
+ return [
+ el.offset().top < top,
+ right < el.offset().left + el.outerWidth(),
+ bottom < el.offset().top + el.outerHeight(),
+ w.scrollLeft() > el.offset().left
+ ];
+ },
+
+ visible : function (hidden_corners) {
+ var i = hidden_corners.length;
+
+ while (i--) {
+ if (hidden_corners[i]) return false;
+ }
+
+ return true;
+ },
+
+ nub_position : function (nub, pos, def) {
+ if (pos === 'auto') {
+ nub.addClass(def);
+ } else {
+ nub.addClass(pos);
+ }
+ },
+
+ startTimer : function () {
+ if (this.settings.$li.length) {
+ this.settings.automate = setTimeout(function () {
+ this.hide();
+ this.show();
+ this.startTimer();
+ }.bind(this), this.settings.timer);
+ } else {
+ clearTimeout(this.settings.automate);
+ }
+ },
+
+ end : function () {
+ if (this.settings.cookie_monster) {
+ $.cookie(this.settings.cookie_name, 'ridden', { expires: this.settings.cookie_expires, domain: this.settings.cookie_domain });
+ }
+
+ if (this.settings.timer > 0) {
+ clearTimeout(this.settings.automate);
+ }
+
+ if (this.settings.modal && this.settings.expose) {
+ this.un_expose();
+ }
+
+ this.settings.$next_tip.data('closed', true);
+
+ $('.joyride-modal-bg').hide();
+ this.settings.$current_tip.hide();
+ this.settings.post_step_callback(this.settings.$li.index(), this.settings.$current_tip);
+ this.settings.post_ride_callback(this.settings.$li.index(), this.settings.$current_tip);
+ $('.joyride-tip-guide').remove();
+ },
+
+ off : function () {
+ $(this.scope).off('.joyride');
+ $(window).off('.joyride');
+ $('.joyride-close-tip, .joyride-next-tip, .joyride-modal-bg').off('.joyride');
+ $('.joyride-tip-guide, .joyride-modal-bg').remove();
+ clearTimeout(this.settings.automate);
+ this.settings = {};
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+/*
+ * Foundation Responsive Library
+ * http://foundation.zurb.com
+ * Copyright 2014, ZURB
+ * Free to use under the MIT license.
+ * http://www.opensource.org/licenses/mit-license.php
+*/
+
+(function ($, window, document, undefined) {
+ 'use strict';
+
+ var header_helpers = function (class_array) {
+ var i = class_array.length;
+
+ while (i--) {
+ if($('head').has('.' + class_array[i]).length === 0) {
+ $('head').append('<meta class="' + class_array[i] + '">');
+ }
+ }
+ };
+
+ header_helpers([
+ 'foundation-mq-small',
+ 'foundation-mq-medium',
+ 'foundation-mq-large',
+ 'foundation-mq-xlarge',
+ 'foundation-mq-xxlarge',
+ 'foundation-data-attribute-namespace']);
+
+ // Enable FastClick if present
+
+ $(function() {
+ if(typeof FastClick !== 'undefined') {
+ // Don't attach to body if undefined
+ if (typeof document.body !== 'undefined') {
+ FastClick.attach(document.body);
+ }
+ }
+ });
+
+ // private Fast Selector wrapper,
+ // returns jQuery object. Only use where
+ // getElementById is not available.
+ var S = function (selector, context) {
+ if (typeof selector === 'string') {
+ if (context) {
+ var cont;
+ if (context.jquery) {
+ cont = context[0];
+ } else {
+ cont = context;
+ }
+ return $(cont.querySelectorAll(selector));
+ }
+
+ return $(document.querySelectorAll(selector));
+ }
+
+ return $(selector, context);
+ };
+
+ // Namespace functions.
+
+ var attr_name = function (init) {
+ var arr = [];
+ if (!init) arr.push('data');
+ if (this.namespace.length > 0) arr.push(this.namespace);
+ arr.push(this.name);
+
+ return arr.join('-');
+ };
+
+ var header_helpers = function (class_array) {
+ var i = class_array.length;
+
+ while (i--) {
+ if($('head').has('.' + class_array[i]).length === 0) {
+ $('head').append('<meta class="' + class_array[i] + '">');
+ }
+ }
+ };
+
+ var add_namespace = function (str) {
+ var parts = str.split('-'),
+ i = parts.length,
+ arr = [];
+
+ while(i--) {
+ if (i !== 0) {
+ arr.push(parts[i]);
+ } else {
+ if (this.namespace.length > 0) {
+ arr.push(this.namespace, parts[i]);
+ } else {
+ arr.push(parts[i]);
+ }
+ }
+ }
+
+ return arr.reverse().join('-');
+ };
+
+ // Event binding and data-options updating.
+
+ var bindings = function (method, options) {
+ var self = this,
+ should_bind_events = !S(this).data(this.attr_name(true));
+
+ if (typeof method === 'string') {
+ return this[method].call(this, options);
+ }
+
+ if (S(this.scope).is('[' + this.attr_name() +']')) {
+ S(this.scope).data(this.attr_name(true) + '-init', $.extend({}, this.settings, (options || method), this.data_options(S(this.scope))));
+
+ if (should_bind_events) {
+ this.events(this.scope);
+ }
+
+ } else {
+ S('[' + this.attr_name() +']', this.scope).each(function () {
+ var should_bind_events = !S(this).data(self.attr_name(true) + '-init');
+
+ S(this).data(self.attr_name(true) + '-init', $.extend({}, self.settings, (options || method), self.data_options(S(this))));
+
+ if (should_bind_events) {
+ self.events(this);
+ }
+ });
+ }
+ };
+
+ var single_image_loaded = function (image, callback) {
+ function loaded () {
+ callback(image[0]);
+ }
+
+ function bindLoad () {
+ this.one('load', loaded);
+
+ if (/MSIE (\d+\.\d+);/.test(navigator.userAgent)) {
+ var src = this.attr( 'src' ),
+ param = src.match( /\?/ ) ? '&' : '?';
+
+ param += 'random=' + (new Date()).getTime();
+ this.attr('src', src + param);
+ }
+ }
+
+ if (!image.attr('src')) {
+ loaded();
+ return;
+ }
+
+ if (image[0].complete || image[0].readyState === 4) {
+ loaded();
+ } else {
+ bindLoad.call(image);
+ }
+ }
+
+ /*
+ https://github.com/paulirish/matchMedia.js
+ */
+
+ window.matchMedia = window.matchMedia || (function( doc, undefined ) {
+
+ "use strict";
+
+ var bool,
+ docElem = doc.documentElement,
+ refNode = docElem.firstElementChild || docElem.firstChild,
+ // fakeBody required for <FF4 when executed in <head>
+ fakeBody = doc.createElement( "body" ),
+ div = doc.createElement( "div" );
+
+ div.id = "mq-test-1";
+ div.style.cssText = "position:absolute;top:-100em";
+ fakeBody.style.background = "none";
+ fakeBody.appendChild(div);
+
+ return function(q){
+
+ div.innerHTML = "­<style media=\"" + q + "\"> #mq-test-1 { width: 42px; }</style>";
+
+ docElem.insertBefore( fakeBody, refNode );
+ bool = div.offsetWidth === 42;
+ docElem.removeChild( fakeBody );
+
+ return {
+ matches: bool,
+ media: q
+ };
+
+ };
+
+ }( document ));
+
+ /*
+ * jquery.requestAnimationFrame
+ * https://github.com/gnarf37/jquery-requestAnimationFrame
+ * Requires jQuery 1.8+
+ *
+ * Copyright (c) 2012 Corey Frang
+ * Licensed under the MIT license.
+ */
+
+ (function( $ ) {
+
+ // requestAnimationFrame polyfill adapted from Erik Möller
+ // fixes from Paul Irish and Tino Zijdel
+ // http://paulirish.com/2011/requestanimationframe-for-smart-animating/
+ // http://my.opera.com/emoller/blog/2011/12/20/requestanimationframe-for-smart-er-animating
+
+
+ var animating,
+ lastTime = 0,
+ vendors = ['webkit', 'moz'],
+ requestAnimationFrame = window.requestAnimationFrame,
+ cancelAnimationFrame = window.cancelAnimationFrame;
+
+ for(; lastTime < vendors.length && !requestAnimationFrame; lastTime++) {
+ requestAnimationFrame = window[ vendors[lastTime] + "RequestAnimationFrame" ];
+ cancelAnimationFrame = cancelAnimationFrame ||
+ window[ vendors[lastTime] + "CancelAnimationFrame" ] ||
+ window[ vendors[lastTime] + "CancelRequestAnimationFrame" ];
+ }
+
+ function raf() {
+ if ( animating ) {
+ requestAnimationFrame( raf );
+ jQuery.fx.tick();
+ }
+ }
+
+ if ( requestAnimationFrame ) {
+ // use rAF
+ window.requestAnimationFrame = requestAnimationFrame;
+ window.cancelAnimationFrame = cancelAnimationFrame;
+ jQuery.fx.timer = function( timer ) {
+ if ( timer() && jQuery.timers.push( timer ) && !animating ) {
+ animating = true;
+ raf();
+ }
+ };
+
+ jQuery.fx.stop = function() {
+ animating = false;
+ };
+ } else {
+ // polyfill
+ window.requestAnimationFrame = function( callback, element ) {
+ var currTime = new Date().getTime(),
+ timeToCall = Math.max( 0, 16 - ( currTime - lastTime ) ),
+ id = window.setTimeout( function() {
+ callback( currTime + timeToCall );
+ }, timeToCall );
+ lastTime = currTime + timeToCall;
+ return id;
+ };
+
+ window.cancelAnimationFrame = function(id) {
+ clearTimeout(id);
+ };
+
+ }
+
+ }( jQuery ));
+
+
+ function removeQuotes (string) {
+ if (typeof string === 'string' || string instanceof String) {
+ string = string.replace(/^['\\/"]+|(;\s?})+|['\\/"]+$/g, '');
+ }
+
+ return string;
+ }
+
+ window.Foundation = {
+ name : 'Foundation',
+
+ version : '5.1.1',
+
+ media_queries : {
+ small : S('.foundation-mq-small').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, ''),
+ medium : S('.foundation-mq-medium').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, ''),
+ large : S('.foundation-mq-large').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, ''),
+ xlarge: S('.foundation-mq-xlarge').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, ''),
+ xxlarge: S('.foundation-mq-xxlarge').css('font-family').replace(/^[\/\\'"]+|(;\s?})+|[\/\\'"]+$/g, '')
+ },
+
+ stylesheet : $('<style></style>').appendTo('head')[0].sheet,
+
+ global: {
+ namespace: ''
+ },
+
+ init : function (scope, libraries, method, options, response) {
+ var library_arr,
+ args = [scope, method, options, response],
+ responses = [];
+
+ // check RTL
+ this.rtl = /rtl/i.test(S('html').attr('dir'));
+
+ // set foundation global scope
+ this.scope = scope || this.scope;
+
+ this.set_namespace();
+
+ if (libraries && typeof libraries === 'string' && !/reflow/i.test(libraries)) {
+ if (this.libs.hasOwnProperty(libraries)) {
+ responses.push(this.init_lib(libraries, args));
+ }
+ } else {
+ for (var lib in this.libs) {
+ responses.push(this.init_lib(lib, libraries));
+ }
+ }
+
+ return scope;
+ },
+
+ init_lib : function (lib, args) {
+ if (this.libs.hasOwnProperty(lib)) {
+ this.patch(this.libs[lib]);
+
+ if (args && args.hasOwnProperty(lib)) {
+ return this.libs[lib].init.apply(this.libs[lib], [this.scope, args[lib]]);
+ }
+
+ args = args instanceof Array ? args : Array(args); // PATCH: added this line
+ return this.libs[lib].init.apply(this.libs[lib], args);
+ }
+
+ return function () {};
+ },
+
+ patch : function (lib) {
+ lib.scope = this.scope;
+ lib.namespace = this.global.namespace;
+ lib.rtl = this.rtl;
+ lib['data_options'] = this.utils.data_options;
+ lib['attr_name'] = attr_name;
+ lib['add_namespace'] = add_namespace;
+ lib['bindings'] = bindings;
+ lib['S'] = this.utils.S;
+ },
+
+ inherit : function (scope, methods) {
+ var methods_arr = methods.split(' '),
+ i = methods_arr.length;
+
+ while (i--) {
+ if (this.utils.hasOwnProperty(methods_arr[i])) {
+ scope[methods_arr[i]] = this.utils[methods_arr[i]];
+ }
+ }
+ },
+
+ set_namespace: function () {
+ var namespace = $('.foundation-data-attribute-namespace').css('font-family');
+
+ if (/false/i.test(namespace)) return;
+
+ this.global.namespace = namespace;
+ },
+
+ libs : {},
+
+ // methods that can be inherited in libraries
+ utils : {
+
+ // Description:
+ // Fast Selector wrapper returns jQuery object. Only use where getElementById
+ // is not available.
+ //
+ // Arguments:
+ // Selector (String): CSS selector describing the element(s) to be
+ // returned as a jQuery object.
+ //
+ // Scope (String): CSS selector describing the area to be searched. Default
+ // is document.
+ //
+ // Returns:
+ // Element (jQuery Object): jQuery object containing elements matching the
+ // selector within the scope.
+ S : S,
+
+ // Description:
+ // Executes a function a max of once every n milliseconds
+ //
+ // Arguments:
+ // Func (Function): Function to be throttled.
+ //
+ // Delay (Integer): Function execution threshold in milliseconds.
+ //
+ // Returns:
+ // Lazy_function (Function): Function with throttling applied.
+ throttle : function(func, delay) {
+ var timer = null;
+
+ return function () {
+ var context = this, args = arguments;
+
+ clearTimeout(timer);
+ timer = setTimeout(function () {
+ func.apply(context, args);
+ }, delay);
+ };
+ },
+
+ // Description:
+ // Executes a function when it stops being invoked for n seconds
+ // Modified version of _.debounce() http://underscorejs.org
+ //
+ // Arguments:
+ // Func (Function): Function to be debounced.
+ //
+ // Delay (Integer): Function execution threshold in milliseconds.
+ //
+ // Immediate (Bool): Whether the function should be called at the beginning
+ // of the delay instead of the end. Default is false.
+ //
+ // Returns:
+ // Lazy_function (Function): Function with debouncing applied.
+ debounce : function(func, delay, immediate) {
+ var timeout, result;
+ return function() {
+ var context = this, args = arguments;
+ var later = function() {
+ timeout = null;
+ if (!immediate) result = func.apply(context, args);
+ };
+ var callNow = immediate && !timeout;
+ clearTimeout(timeout);
+ timeout = setTimeout(later, delay);
+ if (callNow) result = func.apply(context, args);
+ return result;
+ };
+ },
+
+ // Description:
+ // Parses data-options attribute
+ //
+ // Arguments:
+ // El (jQuery Object): Element to be parsed.
+ //
+ // Returns:
+ // Options (Javascript Object): Contents of the element's data-options
+ // attribute.
+ data_options : function (el) {
+ var opts = {}, ii, p, opts_arr,
+ data_options = function (el) {
+ var namespace = Foundation.global.namespace;
+
+ if (namespace.length > 0) {
+ return el.data(namespace + '-options');
+ }
+
+ return el.data('options');
+ };
+
+ var cached_options = data_options(el);
+
+ if (typeof cached_options === 'object') {
+ return cached_options;
+ }
+
+ opts_arr = (cached_options || ':').split(';'),
+ ii = opts_arr.length;
+
+ function isNumber (o) {
+ return ! isNaN (o-0) && o !== null && o !== "" && o !== false && o !== true;
+ }
+
+ function trim(str) {
+ if (typeof str === 'string') return $.trim(str);
+ return str;
+ }
+
+ while (ii--) {
+ p = opts_arr[ii].split(':');
+
+ if (/true/i.test(p[1])) p[1] = true;
+ if (/false/i.test(p[1])) p[1] = false;
+ if (isNumber(p[1])) p[1] = parseInt(p[1], 10);
+
+ if (p.length === 2 && p[0].length > 0) {
+ opts[trim(p[0])] = trim(p[1]);
+ }
+ }
+
+ return opts;
+ },
+
+ // Description:
+ // Adds JS-recognizable media queries
+ //
+ // Arguments:
+ // Media (String): Key string for the media query to be stored as in
+ // Foundation.media_queries
+ //
+ // Class (String): Class name for the generated <meta> tag
+ register_media : function(media, media_class) {
+ if(Foundation.media_queries[media] === undefined) {
+ $('head').append('<meta class="' + media_class + '">');
+ Foundation.media_queries[media] = removeQuotes($('.' + media_class).css('font-family'));
+ }
+ },
+
+ // Description:
+ // Add custom CSS within a JS-defined media query
+ //
+ // Arguments:
+ // Rule (String): CSS rule to be appended to the document.
+ //
+ // Media (String): Optional media query string for the CSS rule to be
+ // nested under.
+ add_custom_rule : function(rule, media) {
+ if(media === undefined) {
+ Foundation.stylesheet.insertRule(rule, Foundation.stylesheet.cssRules.length);
+ } else {
+ var query = Foundation.media_queries[media];
+ if(query !== undefined) {
+ Foundation.stylesheet.insertRule('@media ' +
+ Foundation.media_queries[media] + '{ ' + rule + ' }');
+ }
+ }
+ },
+
+ // Description:
+ // Performs a callback function when an image is fully loaded
+ //
+ // Arguments:
+ // Image (jQuery Object): Image(s) to check if loaded.
+ //
+ // Callback (Function): Fundation to execute when image is fully loaded.
+ image_loaded : function (images, callback) {
+ var self = this,
+ unloaded = images.length;
+
+ images.each(function(){
+ single_image_loaded(self.S(this),function(){
+ unloaded -= 1;
+ if(unloaded == 0){
+ callback(images);
+ }
+ });
+ });
+ },
+
+ // Description:
+ // Returns a random, alphanumeric string
+ //
+ // Arguments:
+ // Length (Integer): Length of string to be generated. Defaults to random
+ // integer.
+ //
+ // Returns:
+ // Rand (String): Pseudo-random, alphanumeric string.
+ random_str : function (length) {
+ var chars = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz'.split('');
+
+ if (!length) {
+ length = Math.floor(Math.random() * chars.length);
+ }
+
+ var str = '';
+ while (length--) {
+ str += chars[Math.floor(Math.random() * chars.length)];
+ }
+ return str;
+ }
+ }
+ };
+
+ $.fn.foundation = function () {
+ var args = Array.prototype.slice.call(arguments, 0);
+
+ return this.each(function () {
+ Foundation.init.apply(Foundation, [this].concat(args));
+ return this;
+ });
+ };
+
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs['magellan-expedition'] = {
+ name : 'magellan-expedition',
+
+ version : '5.1.1',
+
+ settings : {
+ active_class: 'active',
+ threshold: 0, // pixels from the top of the expedition for it to become fixes
+ destination_threshold: 20, // pixels from the top of destination for it to be considered active
+ throttle_delay: 30 // calculation throttling to increase framerate
+ },
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'throttle');
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this,
+ S = self.S,
+ settings = self.settings;
+
+ // initialize expedition offset
+ self.set_expedition_position();
+
+
+ S(self.scope)
+ .off('.magellan')
+ .on('click.fndtn.magellan', '[' + self.add_namespace('data-magellan-arrival') + '] a[href^="#"]', function (e) {
+ e.preventDefault();
+ var expedition = $(this).closest('[' + self.attr_name() + ']'),
+ settings = expedition.data('magellan-expedition-init');
+
+ var hash = this.hash.split('#').join(''),
+ target = $('a[name='+hash+']');
+ if (target.length === 0) target = $('#'+hash);
+
+ // Account for expedition height if fixed position
+ var scroll_top = target.offset().top;
+ if (expedition.css('position') === 'fixed') {
+ scroll_top = scroll_top - expedition.outerHeight();
+ }
+
+ $('html, body').stop().animate({
+ 'scrollTop': scroll_top
+ }, 700, 'swing', function () {
+ window.location.hash = '#'+hash;
+ });
+ })
+ .on('scroll.fndtn.magellan', self.throttle(this.check_for_arrivals.bind(this), settings.throttle_delay))
+ .on('resize.fndtn.magellan', self.throttle(this.set_expedition_position.bind(this), settings.throttle_delay));
+ },
+
+ check_for_arrivals : function() {
+ var self = this;
+ self.update_arrivals();
+ self.update_expedition_positions();
+ },
+
+ set_expedition_position : function() {
+ var self = this;
+ $('[' + this.attr_name() + '=fixed]', self.scope).each(function(idx, el) {
+ var expedition = $(this),
+ styles = expedition.attr('styles'), // save styles
+ top_offset;
+
+ expedition.attr('style', '');
+ top_offset = expedition.offset().top;
+
+ expedition.data(self.data_attr('magellan-top-offset'), top_offset);
+ expedition.attr('style', styles);
+ });
+ },
+
+ update_expedition_positions : function() {
+ var self = this,
+ window_top_offset = $(window).scrollTop();
+
+ $('[' + this.attr_name() + '=fixed]', self.scope).each(function() {
+ var expedition = $(this),
+ top_offset = expedition.data('magellan-top-offset');
+
+ if (window_top_offset >= top_offset) {
+ // Placeholder allows height calculations to be consistent even when
+ // appearing to switch between fixed/non-fixed placement
+ var placeholder = expedition.prev('[' + self.add_namespace('data-magellan-expedition-clone') + ']');
+ if (placeholder.length === 0) {
+ placeholder = expedition.clone();
+ placeholder.removeAttr(self.attr_name());
+ placeholder.attr(self.add_namespace('data-magellan-expedition-clone'),'');
+ expedition.before(placeholder);
+ }
+ expedition.css({position:'fixed', top: 0});
+ } else {
+ expedition.prev('[' + self.add_namespace('data-magellan-expedition-clone') + ']').remove();
+ expedition.attr('style','');
+ }
+ });
+ },
+
+ update_arrivals : function() {
+ var self = this,
+ window_top_offset = $(window).scrollTop();
+
+ $('[' + this.attr_name() + ']', self.scope).each(function() {
+ var expedition = $(this),
+ settings = settings = expedition.data(self.attr_name(true) + '-init'),
+ offsets = self.offsets(expedition, window_top_offset),
+ arrivals = expedition.find('[' + self.add_namespace('data-magellan-arrival') + ']'),
+ active_item = false;
+ offsets.each(function(idx, item) {
+ if (item.viewport_offset >= item.top_offset) {
+ var arrivals = expedition.find('[' + self.add_namespace('data-magellan-arrival') + ']');
+ arrivals.not(item.arrival).removeClass(settings.active_class);
+ item.arrival.addClass(settings.active_class);
+ active_item = true;
+ return true;
+ }
+ });
+
+ if (!active_item) arrivals.removeClass(settings.active_class);
+ });
+ },
+
+ offsets : function(expedition, window_offset) {
+ var self = this,
+ settings = expedition.data(self.attr_name(true) + '-init'),
+ viewport_offset = (window_offset + settings.destination_threshold);
+
+ return expedition.find('[' + self.add_namespace('data-magellan-arrival') + ']').map(function(idx, el) {
+ var name = $(this).data(self.data_attr('magellan-arrival')),
+ dest = $('[' + self.add_namespace('data-magellan-destination') + '=' + name + ']');
+ if (dest.length > 0) {
+ var top_offset = dest.offset().top;
+ return {
+ destination : dest,
+ arrival : $(this),
+ top_offset : top_offset,
+ viewport_offset : viewport_offset
+ }
+ }
+ }).sort(function(a, b) {
+ if (a.top_offset < b.top_offset) return -1;
+ if (a.top_offset > b.top_offset) return 1;
+ return 0;
+ });
+ },
+
+ data_attr: function (str) {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + str;
+ }
+
+ return str;
+ },
+
+ off : function () {
+ this.S(this.scope).off('.magellan');
+ this.S(window).off('.magellan');
+ },
+
+ reflow : function () {
+ var self = this;
+ // remove placeholder expeditions used for height calculation purposes
+ $('[' + self.add_namespace('data-magellan-expedition-clone') + ']', self.scope).remove();
+ }
+ };
+}(jQuery, this, this.document));
\ No newline at end of file
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.offcanvas = {
+ name : 'offcanvas',
+
+ version : '5.1.1',
+
+ settings : {},
+
+ init : function (scope, method, options) {
+ this.events();
+ },
+
+ events : function () {
+ var S = this.S;
+
+ S(this.scope).off('.offcanvas')
+ .on('click.fndtn.offcanvas', '.left-off-canvas-toggle', function (e) {
+ e.preventDefault();
+ S(this).closest('.off-canvas-wrap').toggleClass('move-right');
+ })
+ .on('click.fndtn.offcanvas', '.exit-off-canvas', function (e) {
+ e.preventDefault();
+ S(".off-canvas-wrap").removeClass("move-right");
+ })
+ .on('click.fndtn.offcanvas', '.right-off-canvas-toggle', function (e) {
+ e.preventDefault();
+ S(this).closest(".off-canvas-wrap").toggleClass("move-left");
+ })
+ .on('click.fndtn.offcanvas', '.exit-off-canvas', function (e) {
+ e.preventDefault();
+ S(".off-canvas-wrap").removeClass("move-left");
+ });
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ var noop = function() {};
+
+ var Orbit = function(el, settings) {
+ // Don't reinitialize plugin
+ if (el.hasClass(settings.slides_container_class)) {
+ return this;
+ }
+
+ var self = this,
+ container,
+ slides_container = el,
+ number_container,
+ bullets_container,
+ timer_container,
+ idx = 0,
+ animate,
+ timer,
+ locked = false,
+ adjust_height_after = false;
+
+
+ self.slides = function() {
+ return slides_container.children(settings.slide_selector);
+ };
+
+ self.slides().first().addClass(settings.active_slide_class);
+
+ self.update_slide_number = function(index) {
+ if (settings.slide_number) {
+ number_container.find('span:first').text(parseInt(index)+1);
+ number_container.find('span:last').text(self.slides().length);
+ }
+ if (settings.bullets) {
+ bullets_container.children().removeClass(settings.bullets_active_class);
+ $(bullets_container.children().get(index)).addClass(settings.bullets_active_class);
+ }
+ };
+
+ self.update_active_link = function(index) {
+ var link = $('a[data-orbit-link="'+self.slides().eq(index).attr('data-orbit-slide')+'"]');
+ link.siblings().removeClass(settings.bullets_active_class);
+ link.addClass(settings.bullets_active_class);
+ };
+
+ self.build_markup = function() {
+ slides_container.wrap('<div class="'+settings.container_class+'"></div>');
+ container = slides_container.parent();
+ slides_container.addClass(settings.slides_container_class);
+
+ if (settings.navigation_arrows) {
+ container.append($('<a href="#"><span></span></a>').addClass(settings.prev_class));
+ container.append($('<a href="#"><span></span></a>').addClass(settings.next_class));
+ }
+
+ if (settings.timer) {
+ timer_container = $('<div>').addClass(settings.timer_container_class);
+ timer_container.append('<span>');
+ timer_container.append($('<div>').addClass(settings.timer_progress_class));
+ timer_container.addClass(settings.timer_paused_class);
+ container.append(timer_container);
+ }
+
+ if (settings.slide_number) {
+ number_container = $('<div>').addClass(settings.slide_number_class);
+ number_container.append('<span></span> ' + settings.slide_number_text + ' <span></span>');
+ container.append(number_container);
+ }
+
+ if (settings.bullets) {
+ bullets_container = $('<ol>').addClass(settings.bullets_container_class);
+ container.append(bullets_container);
+ bullets_container.wrap('<div class="orbit-bullets-container"></div>');
+ self.slides().each(function(idx, el) {
+ var bullet = $('<li>').attr('data-orbit-slide', idx);
+ bullets_container.append(bullet);
+ });
+ }
+
+ if (settings.stack_on_small) {
+ container.addClass(settings.stack_on_small_class);
+ }
+ };
+
+ self._goto = function(next_idx, start_timer) {
+ // if (locked) {return false;}
+ if (next_idx === idx) {return false;}
+ if (typeof timer === 'object') {timer.restart();}
+ var slides = self.slides();
+
+ var dir = 'next';
+ locked = true;
+ if (next_idx < idx) {dir = 'prev';}
+ if (next_idx >= slides.length) {
+ if (!settings.circular) return false;
+ next_idx = 0;
+ } else if (next_idx < 0) {
+ if (!settings.circular) return false;
+ next_idx = slides.length - 1;
+ }
+
+ var current = $(slides.get(idx));
+ var next = $(slides.get(next_idx));
+
+ current.css('zIndex', 2);
+ current.removeClass(settings.active_slide_class);
+ next.css('zIndex', 4).addClass(settings.active_slide_class);
+
+ slides_container.trigger('before-slide-change.fndtn.orbit');
+ settings.before_slide_change();
+ self.update_active_link(next_idx);
+
+ var callback = function() {
+ var unlock = function() {
+ idx = next_idx;
+ locked = false;
+ if (start_timer === true) {timer = self.create_timer(); timer.start();}
+ self.update_slide_number(idx);
+ slides_container.trigger('after-slide-change.fndtn.orbit',[{slide_number: idx, total_slides: slides.length}]);
+ settings.after_slide_change(idx, slides.length);
+ };
+ if (slides_container.height() != next.height() && settings.variable_height) {
+ slides_container.animate({'height': next.height()}, 250, 'linear', unlock);
+ } else {
+ unlock();
+ }
+ };
+
+ if (slides.length === 1) {callback(); return false;}
+
+ var start_animation = function() {
+ if (dir === 'next') {animate.next(current, next, callback);}
+ if (dir === 'prev') {animate.prev(current, next, callback);}
+ };
+
+ if (next.height() > slides_container.height() && settings.variable_height) {
+ slides_container.animate({'height': next.height()}, 250, 'linear', start_animation);
+ } else {
+ start_animation();
+ }
+ };
+
+ self.next = function(e) {
+ e.stopImmediatePropagation();
+ e.preventDefault();
+ self._goto(idx + 1);
+ };
+
+ self.prev = function(e) {
+ e.stopImmediatePropagation();
+ e.preventDefault();
+ self._goto(idx - 1);
+ };
+
+ self.link_custom = function(e) {
+ e.preventDefault();
+ var link = $(this).attr('data-orbit-link');
+ if ((typeof link === 'string') && (link = $.trim(link)) != "") {
+ var slide = container.find('[data-orbit-slide='+link+']');
+ if (slide.index() != -1) {self._goto(slide.index());}
+ }
+ };
+
+ self.link_bullet = function(e) {
+ var index = $(this).attr('data-orbit-slide');
+ if ((typeof index === 'string') && (index = $.trim(index)) != "") {
+ if(isNaN(parseInt(index)))
+ {
+ var slide = container.find('[data-orbit-slide='+index+']');
+ if (slide.index() != -1) {self._goto(slide.index() + 1);}
+ }
+ else
+ {
+ self._goto(parseInt(index));
+ }
+ }
+
+ }
+
+ self.timer_callback = function() {
+ self._goto(idx + 1, true);
+ }
+
+ self.compute_dimensions = function() {
+ var current = $(self.slides().get(idx));
+ var h = current.height();
+ if (!settings.variable_height) {
+ self.slides().each(function(){
+ if ($(this).height() > h) { h = $(this).height(); }
+ });
+ }
+ slides_container.height(h);
+ };
+
+ self.create_timer = function() {
+ var t = new Timer(
+ container.find('.'+settings.timer_container_class),
+ settings,
+ self.timer_callback
+ );
+ return t;
+ };
+
+ self.stop_timer = function() {
+ if (typeof timer === 'object') timer.stop();
+ };
+
+ self.toggle_timer = function() {
+ var t = container.find('.'+settings.timer_container_class);
+ if (t.hasClass(settings.timer_paused_class)) {
+ if (typeof timer === 'undefined') {timer = self.create_timer();}
+ timer.start();
+ }
+ else {
+ if (typeof timer === 'object') {timer.stop();}
+ }
+ };
+
+ self.init = function() {
+ self.build_markup();
+ if (settings.timer) {
+ timer = self.create_timer();
+ Foundation.utils.image_loaded(this.slides().children('img'), timer.start);
+ }
+ animate = new FadeAnimation(settings, slides_container);
+ if (settings.animation === 'slide')
+ animate = new SlideAnimation(settings, slides_container);
+ container.on('click', '.'+settings.next_class, self.next);
+ container.on('click', '.'+settings.prev_class, self.prev);
+ container.on('click', '[data-orbit-slide]', self.link_bullet);
+ container.on('click', self.toggle_timer);
+ if (settings.swipe) {
+ container.on('touchstart.fndtn.orbit', function(e) {
+ if (!e.touches) {e = e.originalEvent;}
+ var data = {
+ start_page_x: e.touches[0].pageX,
+ start_page_y: e.touches[0].pageY,
+ start_time: (new Date()).getTime(),
+ delta_x: 0,
+ is_scrolling: undefined
+ };
+ container.data('swipe-transition', data);
+ e.stopPropagation();
+ })
+ .on('touchmove.fndtn.orbit', function(e) {
+ if (!e.touches) { e = e.originalEvent; }
+ // Ignore pinch/zoom events
+ if(e.touches.length > 1 || e.scale && e.scale !== 1) return;
+
+ var data = container.data('swipe-transition');
+ if (typeof data === 'undefined') {data = {};}
+
+ data.delta_x = e.touches[0].pageX - data.start_page_x;
+
+ if ( typeof data.is_scrolling === 'undefined') {
+ data.is_scrolling = !!( data.is_scrolling || Math.abs(data.delta_x) < Math.abs(e.touches[0].pageY - data.start_page_y) );
+ }
+
+ if (!data.is_scrolling && !data.active) {
+ e.preventDefault();
+ var direction = (data.delta_x < 0) ? (idx+1) : (idx-1);
+ data.active = true;
+ self._goto(direction);
+ }
+ })
+ .on('touchend.fndtn.orbit', function(e) {
+ container.data('swipe-transition', {});
+ e.stopPropagation();
+ })
+ }
+ container.on('mouseenter.fndtn.orbit', function(e) {
+ if (settings.timer && settings.pause_on_hover) {
+ self.stop_timer();
+ }
+ })
+ .on('mouseleave.fndtn.orbit', function(e) {
+ if (settings.timer && settings.resume_on_mouseout) {
+ timer.start();
+ }
+ });
+
+ $(document).on('click', '[data-orbit-link]', self.link_custom);
+ $(window).on('resize', self.compute_dimensions);
+ Foundation.utils.image_loaded(this.slides().children('img'), self.compute_dimensions);
+ Foundation.utils.image_loaded(this.slides().children('img'), function() {
+ container.prev('.preloader').css('display', 'none');
+ self.update_slide_number(0);
+ self.update_active_link(0);
+ slides_container.trigger('ready.fndtn.orbit');
+ });
+ };
+
+ self.init();
+ };
+
+ var Timer = function(el, settings, callback) {
+ var self = this,
+ duration = settings.timer_speed,
+ progress = el.find('.'+settings.timer_progress_class),
+ start,
+ timeout,
+ left = -1;
+
+ this.update_progress = function(w) {
+ var new_progress = progress.clone();
+ new_progress.attr('style', '');
+ new_progress.css('width', w+'%');
+ progress.replaceWith(new_progress);
+ progress = new_progress;
+ };
+
+ this.restart = function() {
+ clearTimeout(timeout);
+ el.addClass(settings.timer_paused_class);
+ left = -1;
+ self.update_progress(0);
+ };
+
+ this.start = function() {
+ if (!el.hasClass(settings.timer_paused_class)) {return true;}
+ left = (left === -1) ? duration : left;
+ el.removeClass(settings.timer_paused_class);
+ start = new Date().getTime();
+ progress.animate({'width': '100%'}, left, 'linear');
+ timeout = setTimeout(function() {
+ self.restart();
+ callback();
+ }, left);
+ el.trigger('timer-started.fndtn.orbit')
+ };
+
+ this.stop = function() {
+ if (el.hasClass(settings.timer_paused_class)) {return true;}
+ clearTimeout(timeout);
+ el.addClass(settings.timer_paused_class);
+ var end = new Date().getTime();
+ left = left - (end - start);
+ var w = 100 - ((left / duration) * 100);
+ self.update_progress(w);
+ el.trigger('timer-stopped.fndtn.orbit');
+ };
+ };
+
+ var SlideAnimation = function(settings, container) {
+ var duration = settings.animation_speed;
+ var is_rtl = ($('html[dir=rtl]').length === 1);
+ var margin = is_rtl ? 'marginRight' : 'marginLeft';
+ var animMargin = {};
+ animMargin[margin] = '0%';
+
+ this.next = function(current, next, callback) {
+ current.animate({marginLeft:'-100%'}, duration);
+ next.animate(animMargin, duration, function() {
+ current.css(margin, '100%');
+ callback();
+ });
+ };
+
+ this.prev = function(current, prev, callback) {
+ current.animate({marginLeft:'100%'}, duration);
+ prev.css(margin, '-100%');
+ prev.animate(animMargin, duration, function() {
+ current.css(margin, '100%');
+ callback();
+ });
+ };
+ };
+
+ var FadeAnimation = function(settings, container) {
+ var duration = settings.animation_speed;
+ var is_rtl = ($('html[dir=rtl]').length === 1);
+ var margin = is_rtl ? 'marginRight' : 'marginLeft';
+
+ this.next = function(current, next, callback) {
+ next.css({'margin':'0%', 'opacity':'0.01'});
+ next.animate({'opacity':'1'}, duration, 'linear', function() {
+ current.css('margin', '100%');
+ callback();
+ });
+ };
+
+ this.prev = function(current, prev, callback) {
+ prev.css({'margin':'0%', 'opacity':'0.01'});
+ prev.animate({'opacity':'1'}, duration, 'linear', function() {
+ current.css('margin', '100%');
+ callback();
+ });
+ };
+ };
+
+
+ Foundation.libs = Foundation.libs || {};
+
+ Foundation.libs.orbit = {
+ name: 'orbit',
+
+ version: '5.1.1',
+
+ settings: {
+ animation: 'slide',
+ timer_speed: 10000,
+ pause_on_hover: true,
+ resume_on_mouseout: false,
+ animation_speed: 500,
+ stack_on_small: false,
+ navigation_arrows: true,
+ slide_number: true,
+ slide_number_text: 'of',
+ container_class: 'orbit-container',
+ stack_on_small_class: 'orbit-stack-on-small',
+ next_class: 'orbit-next',
+ prev_class: 'orbit-prev',
+ timer_container_class: 'orbit-timer',
+ timer_paused_class: 'paused',
+ timer_progress_class: 'orbit-progress',
+ slides_container_class: 'orbit-slides-container',
+ slide_selector: '*',
+ bullets_container_class: 'orbit-bullets',
+ bullets_active_class: 'active',
+ slide_number_class: 'orbit-slide-number',
+ caption_class: 'orbit-caption',
+ active_slide_class: 'active',
+ orbit_transition_class: 'orbit-transitioning',
+ bullets: true,
+ circular: true,
+ timer: true,
+ variable_height: false,
+ swipe: true,
+ before_slide_change: noop,
+ after_slide_change: noop
+ },
+
+ init : function (scope, method, options) {
+ var self = this;
+ this.bindings(method, options);
+ },
+
+ events : function (instance) {
+ var orbit_instance = new Orbit(this.S(instance), this.S(instance).data('orbit-init'));
+ this.S(instance).data(self.name + '-instance', orbit_instance);
+ },
+
+ reflow : function () {
+ var self = this;
+
+ if (self.S(self.scope).is('[data-orbit]')) {
+ var $el = self.S(self.scope);
+ var instance = $el.data(self.name + '-instance');
+ instance.compute_dimensions();
+ } else {
+ self.S('[data-orbit]', self.scope).each(function(idx, el) {
+ var $el = self.S(el);
+ var opts = self.data_options($el);
+ var instance = $el.data(self.name + '-instance');
+ instance.compute_dimensions();
+ });
+ }
+ }
+ };
+
+
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.reveal = {
+ name : 'reveal',
+
+ version : '5.1.1',
+
+ locked : false,
+
+ settings : {
+ animation: 'fadeAndPop',
+ animation_speed: 250,
+ close_on_background_click: true,
+ close_on_esc: true,
+ dismiss_modal_class: 'close-reveal-modal',
+ bg_class: 'reveal-modal-bg',
+ open: function(){},
+ opened: function(){},
+ close: function(){},
+ closed: function(){},
+ bg : $('.reveal-modal-bg'),
+ css : {
+ open : {
+ 'opacity': 0,
+ 'visibility': 'visible',
+ 'display' : 'block'
+ },
+ close : {
+ 'opacity': 1,
+ 'visibility': 'hidden',
+ 'display': 'none'
+ }
+ }
+ },
+
+ init : function (scope, method, options) {
+ $.extend(true, this.settings, method, options);
+ this.bindings(method, options);
+ },
+
+ events : function (scope) {
+ var self = this,
+ S = self.S;
+
+ S(this.scope)
+ .off('.reveal')
+ .on('click.fndtn.reveal', '[' + this.add_namespace('data-reveal-id') + ']', function (e) {
+ e.preventDefault();
+
+ if (!self.locked) {
+ var element = S(this),
+ ajax = element.data(self.data_attr('reveal-ajax'));
+
+ self.locked = true;
+
+ if (typeof ajax === 'undefined') {
+ self.open.call(self, element);
+ } else {
+ var url = ajax === true ? element.attr('href') : ajax;
+
+ self.open.call(self, element, {url: url});
+ }
+ }
+ });
+
+ S(document)
+ .on('click.fndtn.reveal', this.close_targets(), function (e) {
+
+ e.preventDefault();
+
+ if (!self.locked) {
+ var settings = S('[' + self.attr_name() + '].open').data(self.attr_name(true) + '-init'),
+ bg_clicked = S(e.target)[0] === S('.' + settings.bg_class)[0];
+
+ if (bg_clicked && !settings.close_on_background_click) {
+ return;
+ }
+
+ self.locked = true;
+ self.close.call(self, bg_clicked ? S('[' + self.attr_name() + '].open') : S(this).closest('[' + self.attr_name() + ']'));
+ }
+ });
+
+ if(S('[' + self.attr_name() + ']', this.scope).length > 0) {
+ S(this.scope)
+ // .off('.reveal')
+ .on('open.fndtn.reveal', this.settings.open)
+ .on('opened.fndtn.reveal', this.settings.opened)
+ .on('opened.fndtn.reveal', this.open_video)
+ .on('close.fndtn.reveal', this.settings.close)
+ .on('closed.fndtn.reveal', this.settings.closed)
+ .on('closed.fndtn.reveal', this.close_video);
+ } else {
+ S(this.scope)
+ // .off('.reveal')
+ .on('open.fndtn.reveal', '[' + self.attr_name() + ']', this.settings.open)
+ .on('opened.fndtn.reveal', '[' + self.attr_name() + ']', this.settings.opened)
+ .on('opened.fndtn.reveal', '[' + self.attr_name() + ']', this.open_video)
+ .on('close.fndtn.reveal', '[' + self.attr_name() + ']', this.settings.close)
+ .on('closed.fndtn.reveal', '[' + self.attr_name() + ']', this.settings.closed)
+ .on('closed.fndtn.reveal', '[' + self.attr_name() + ']', this.close_video);
+ }
+
+ return true;
+ },
+
+ // PATCH #3: turning on key up capture only when a reveal window is open
+ key_up_on : function (scope) {
+ var self = this;
+
+ // PATCH #1: fixing multiple keyup event trigger from single key press
+ self.S('body').off('keyup.fndtn.reveal').on('keyup.fndtn.reveal', function ( event ) {
+ var open_modal = self.S('[' + self.attr_name() + '].open'),
+ settings = open_modal.data(self.attr_name(true) + '-init');
+ // PATCH #2: making sure that the close event can be called only while unlocked,
+ // so that multiple keyup.fndtn.reveal events don't prevent clean closing of the reveal window.
+ if ( settings && event.which === 27 && settings.close_on_esc && !self.locked) { // 27 is the keycode for the Escape key
+ self.close.call(self, open_modal);
+ }
+ });
+
+ return true;
+ },
+
+ // PATCH #3: turning on key up capture only when a reveal window is open
+ key_up_off : function (scope) {
+ this.S('body').off('keyup.fndtn.reveal');
+ return true;
+ },
+
+ open : function (target, ajax_settings) {
+ var self = this;
+ if (target) {
+ if (typeof target.selector !== 'undefined') {
+ var modal = self.S('#' + target.data(self.data_attr('reveal-id')));
+ } else {
+ var modal = self.S(this.scope);
+
+ ajax_settings = target;
+ }
+ } else {
+ var modal = self.S(this.scope);
+ }
+
+ var settings = modal.data(self.attr_name(true) + '-init');
+
+ if (!modal.hasClass('open')) {
+ var open_modal = self.S('[' + self.attr_name() + '].open');
+
+ if (typeof modal.data('css-top') === 'undefined') {
+ modal.data('css-top', parseInt(modal.css('top'), 10))
+ .data('offset', this.cache_offset(modal));
+ }
+
+ this.key_up_on(modal); // PATCH #3: turning on key up capture only when a reveal window is open
+ modal.trigger('open');
+
+ if (open_modal.length < 1) {
+ this.toggle_bg(modal);
+ }
+
+ if (typeof ajax_settings === 'string') {
+ ajax_settings = {
+ url: ajax_settings
+ };
+ }
+
+ if (typeof ajax_settings === 'undefined' || !ajax_settings.url) {
+ if (open_modal.length > 0) {
+ var open_modal_settings = open_modal.data(self.attr_name(true) + '-init');
+ this.hide(open_modal, open_modal_settings.css.close);
+ }
+
+ this.show(modal, settings.css.open);
+ } else {
+ var old_success = typeof ajax_settings.success !== 'undefined' ? ajax_settings.success : null;
+
+ $.extend(ajax_settings, {
+ success: function (data, textStatus, jqXHR) {
+ if ( $.isFunction(old_success) ) {
+ old_success(data, textStatus, jqXHR);
+ }
+
+ modal.html(data);
+ self.S(modal).foundation('section', 'reflow');
+
+ if (open_modal.length > 0) {
+ var open_modal_settings = open_modal.data(self.attr_name(true));
+ self.hide(open_modal, open_modal_settings.css.close);
+ }
+ self.show(modal, settings.css.open);
+ }
+ });
+
+ $.ajax(ajax_settings);
+ }
+ }
+ },
+
+ close : function (modal) {
+ var modal = modal && modal.length ? modal : this.S(this.scope),
+ open_modals = this.S('[' + this.attr_name() + '].open'),
+ settings = modal.data(this.attr_name(true) + '-init');
+
+ if (open_modals.length > 0) {
+ this.locked = true;
+ this.key_up_off(modal); // PATCH #3: turning on key up capture only when a reveal window is open
+ modal.trigger('close');
+ this.toggle_bg(modal);
+ this.hide(open_modals, settings.css.close, settings);
+ }
+ },
+
+ close_targets : function () {
+ var base = '.' + this.settings.dismiss_modal_class;
+
+ if (this.settings.close_on_background_click) {
+ return base + ', .' + this.settings.bg_class;
+ }
+
+ return base;
+ },
+
+ toggle_bg : function (modal) {
+ var settings = modal.data(this.attr_name(true));
+
+ if (this.S('.' + this.settings.bg_class).length === 0) {
+ this.settings.bg = $('<div />', {'class': this.settings.bg_class})
+ .appendTo('body');
+ }
+
+ if (this.settings.bg.filter(':visible').length > 0) {
+ this.hide(this.settings.bg);
+ } else {
+ this.show(this.settings.bg);
+ }
+ },
+
+ show : function (el, css) {
+ // is modal
+ if (css) {
+ var settings = el.data(this.attr_name(true) + '-init');
+ if (el.parent('body').length === 0) {
+ var placeholder = el.wrap('<div style="display: none;" />').parent(),
+ rootElement = this.settings.rootElement || 'body';
+
+ el.on('closed.fndtn.reveal.wrapped', function() {
+ el.detach().appendTo(placeholder);
+ el.unwrap().unbind('closed.fndtn.reveal.wrapped');
+ });
+
+ el.detach().appendTo(rootElement);
+ }
+
+ if (/pop/i.test(settings.animation)) {
+ css.top = $(window).scrollTop() - el.data('offset') + 'px';
+ var end_css = {
+ top: $(window).scrollTop() + el.data('css-top') + 'px',
+ opacity: 1
+ };
+
+ return setTimeout(function () {
+ return el
+ .css(css)
+ .animate(end_css, settings.animation_speed, 'linear', function () {
+ this.locked = false;
+ el.trigger('opened');
+ }.bind(this))
+ .addClass('open');
+ }.bind(this), settings.animation_speed / 2);
+ }
+
+ if (/fade/i.test(settings.animation)) {
+ var end_css = {opacity: 1};
+
+ return setTimeout(function () {
+ return el
+ .css(css)
+ .animate(end_css, settings.animation_speed, 'linear', function () {
+ this.locked = false;
+ el.trigger('opened');
+ }.bind(this))
+ .addClass('open');
+ }.bind(this), settings.animation_speed / 2);
+ }
+
+ return el.css(css).show().css({opacity: 1}).addClass('open').trigger('opened');
+ }
+
+ var settings = this.settings;
+
+ // should we animate the background?
+ if (/fade/i.test(settings.animation)) {
+ return el.fadeIn(settings.animation_speed / 2);
+ }
+
+ this.locked = false;
+
+ return el.show();
+ },
+
+ hide : function (el, css) {
+ // is modal
+ if (css) {
+ var settings = el.data(this.attr_name(true) + '-init');
+ if (/pop/i.test(settings.animation)) {
+ var end_css = {
+ top: - $(window).scrollTop() - el.data('offset') + 'px',
+ opacity: 0
+ };
+
+ return setTimeout(function () {
+ return el
+ .animate(end_css, settings.animation_speed, 'linear', function () {
+ this.locked = false;
+ el.css(css).trigger('closed');
+ }.bind(this))
+ .removeClass('open');
+ }.bind(this), settings.animation_speed / 2);
+ }
+
+ if (/fade/i.test(settings.animation)) {
+ var end_css = {opacity: 0};
+
+ return setTimeout(function () {
+ return el
+ .animate(end_css, settings.animation_speed, 'linear', function () {
+ this.locked = false;
+ el.css(css).trigger('closed');
+ }.bind(this))
+ .removeClass('open');
+ }.bind(this), settings.animation_speed / 2);
+ }
+
+ return el.hide().css(css).removeClass('open').trigger('closed');
+ }
+
+ var settings = this.settings;
+
+ // should we animate the background?
+ if (/fade/i.test(settings.animation)) {
+ return el.fadeOut(settings.animation_speed / 2);
+ }
+
+ return el.hide();
+ },
+
+ close_video : function (e) {
+ var video = $('.flex-video', e.target),
+ iframe = $('iframe', video);
+
+ if (iframe.length > 0) {
+ iframe.attr('data-src', iframe[0].src);
+ iframe.attr('src', 'about:blank');
+ video.hide();
+ }
+ },
+
+ open_video : function (e) {
+ var video = $('.flex-video', e.target),
+ iframe = video.find('iframe');
+
+ if (iframe.length > 0) {
+ var data_src = iframe.attr('data-src');
+ if (typeof data_src === 'string') {
+ iframe[0].src = iframe.attr('data-src');
+ } else {
+ var src = iframe[0].src;
+ iframe[0].src = undefined;
+ iframe[0].src = src;
+ }
+ video.show();
+ }
+ },
+
+ data_attr: function (str) {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + str;
+ }
+
+ return str;
+ },
+
+ cache_offset : function (modal) {
+ var offset = modal.show().height() + parseInt(modal.css('top'), 10);
+
+ modal.hide();
+
+ return offset;
+ },
+
+ off : function () {
+ $(this.scope).off('.fndtn.reveal');
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+/*jslint unparam: true, browser: true, indent: 2 */
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.tab = {
+ name : 'tab',
+
+ version : '5.1.1',
+
+ settings : {
+ active_class: 'active',
+ callback : function () {}
+ },
+
+ init : function (scope, method, options) {
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this,
+ S = this.S;
+
+ S(this.scope).off('.tab').on('click.fndtn.tab', '[' + this.attr_name() + '] > dd > a', function (e) {
+ e.preventDefault();
+ e.stopPropagation();
+
+ var tab = S(this).parent(),
+ tabs = tab.closest('[' + self.attr_name() + ']'),
+ target = S('#' + this.href.split('#')[1]),
+ siblings = tab.siblings(),
+ settings = tabs.data(self.attr_name(true) + '-init');
+
+ // allow usage of data-tab-content attribute instead of href
+ if (S(this).data(self.data_attr('tab-content'))) {
+ target = S('#' + S(this).data(self.data_attr('tab-content')).split('#')[1]);
+ }
+
+ tab.addClass(settings.active_class).triggerHandler('opened');
+ siblings.removeClass(settings.active_class);
+ target.siblings().removeClass(settings.active_class).end().addClass(settings.active_class);
+ settings.callback(tab);
+ tabs.triggerHandler('toggled', [tab]);
+ });
+ },
+
+ data_attr: function (str) {
+ if (this.namespace.length > 0) {
+ return this.namespace + '-' + str;
+ }
+
+ return str;
+ },
+
+ off : function () {},
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.tooltip = {
+ name : 'tooltip',
+
+ version : '5.1.1',
+
+ settings : {
+ additional_inheritable_classes : [],
+ tooltip_class : '.tooltip',
+ append_to: 'body',
+ touch_close_text: 'Tap To Close',
+ disable_for_touch: false,
+ hover_delay: 200,
+ tip_template : function (selector, content) {
+ return '<span data-selector="' + selector + '" class="'
+ + Foundation.libs.tooltip.settings.tooltip_class.substring(1)
+ + '">' + content + '<span class="nub"></span></span>';
+ }
+ },
+
+ cache : {},
+
+ init : function (scope, method, options) {
+ Foundation.inherit(this, 'random_str');
+ this.bindings(method, options);
+ },
+
+ events : function () {
+ var self = this,
+ S = self.S;
+
+ if (Modernizr.touch) {
+ S(document)
+ .off('.tooltip')
+ .on('click.fndtn.tooltip touchstart.fndtn.tooltip touchend.fndtn.tooltip',
+ '[' + this.attr_name() + ']:not(a)', function (e) {
+ var settings = $.extend({}, self.settings, self.data_options(S(this)));
+ if (!settings.disable_for_touch) {
+ e.preventDefault();
+ S(settings.tooltip_class).hide();
+ self.showOrCreateTip(S(this));
+ }
+ })
+ .on('click.fndtn.tooltip touchstart.fndtn.tooltip touchend.fndtn.tooltip',
+ this.settings.tooltip_class, function (e) {
+ e.preventDefault();
+ S(this).fadeOut(150);
+ });
+ } else {
+ S(document)
+ .off('.tooltip')
+ .on('mouseenter.fndtn.tooltip mouseleave.fndtn.tooltip',
+ '[' + this.attr_name() + ']', function (e) {
+ var $this = S(this);
+
+ if (/enter|over/i.test(e.type)) {
+ this.timer = setTimeout(function () {
+ var tip = self.showOrCreateTip($this);
+ }.bind(this), self.settings.hover_delay);
+ } else if (e.type === 'mouseout' || e.type === 'mouseleave') {
+ clearTimeout(this.timer);
+ self.hide($this);
+ }
+ });
+ }
+ },
+
+ showOrCreateTip : function ($target) {
+ var $tip = this.getTip($target);
+
+ if ($tip && $tip.length > 0) {
+ return this.show($target);
+ }
+
+ return this.create($target);
+ },
+
+ getTip : function ($target) {
+ var selector = this.selector($target),
+ tip = null;
+
+ if (selector) {
+ tip = this.S('span[data-selector="' + selector + '"]' + this.settings.tooltip_class);
+ }
+
+ return (typeof tip === 'object') ? tip : false;
+ },
+
+ selector : function ($target) {
+ var id = $target.attr('id'),
+ dataSelector = $target.attr(this.attr_name()) || $target.attr('data-selector');
+
+ if ((id && id.length < 1 || !id) && typeof dataSelector != 'string') {
+ dataSelector = 'tooltip' + this.random_str(6);
+ $target.attr('data-selector', dataSelector);
+ }
+
+ return (id && id.length > 0) ? id : dataSelector;
+ },
+
+ create : function ($target) {
+ var $tip = $(this.settings.tip_template(this.selector($target), $('<div></div>').html($target.attr('title')).html())),
+ classes = this.inheritable_classes($target);
+
+ $tip.addClass(classes).appendTo(this.settings.append_to);
+ if (Modernizr.touch) {
+ $tip.append('<span class="tap-to-close">'+this.settings.touch_close_text+'</span>');
+ }
+ $target.removeAttr('title').attr('title','');
+ this.show($target);
+ },
+
+ reposition : function (target, tip, classes) {
+ var width, nub, nubHeight, nubWidth, column, objPos;
+
+ tip.css('visibility', 'hidden').show();
+
+ width = target.data('width');
+ nub = tip.children('.nub');
+ nubHeight = nub.outerHeight();
+ nubWidth = nub.outerHeight();
+
+ if(this.small()) {
+ tip.css({'width' : '100%' });
+ } else {
+ tip.css({'width' : (width) ? width : 'auto'});
+ }
+
+ objPos = function (obj, top, right, bottom, left, width) {
+ return obj.css({
+ 'top' : (top) ? top : 'auto',
+ 'bottom' : (bottom) ? bottom : 'auto',
+ 'left' : (left) ? left : 'auto',
+ 'right' : (right) ? right : 'auto'
+ }).end();
+ };
+
+ objPos(tip, (target.offset().top + target.outerHeight() + 10), 'auto', 'auto', target.offset().left);
+
+ if (this.small()) {
+ objPos(tip, (target.offset().top + target.outerHeight() + 10), 'auto', 'auto', 12.5, this.S(this.scope).width());
+ tip.addClass('tip-override');
+ objPos(nub, -nubHeight, 'auto', 'auto', target.offset().left + 10);
+ } else {
+ var left = target.offset().left;
+ if (Foundation.rtl) {
+ left = target.offset().left + target.outerWidth() - tip.outerWidth();
+ }
+
+ objPos(tip, (target.offset().top + target.outerHeight() + 10), 'auto', 'auto', left);
+ tip.removeClass('tip-override');
+ nub.removeAttr( 'style' );
+ if (classes && classes.indexOf('tip-top') > -1) {
+ objPos(tip, (target.offset().top - tip.outerHeight() - 10), 'auto', 'auto', left)
+ .removeClass('tip-override');
+ } else if (classes && classes.indexOf('tip-left') > -1) {
+ objPos(tip, (target.offset().top + (target.outerHeight() / 2) - (tip.outerHeight() / 2)), 'auto', 'auto', (target.offset().left - tip.outerWidth() - nubHeight))
+ .removeClass('tip-override');
+ } else if (classes && classes.indexOf('tip-right') > -1) {
+ objPos(tip, (target.offset().top + (target.outerHeight() / 2) - (tip.outerHeight() / 2)), 'auto', 'auto', (target.offset().left + target.outerWidth() + nubHeight))
+ .removeClass('tip-override');
+ }
+ }
+
+ tip.css('visibility', 'visible').hide();
+ },
+
+ small : function () {
+ return matchMedia(Foundation.media_queries.small).matches;
+ },
+
+ inheritable_classes : function (target) {
+ var inheritables = ['tip-top', 'tip-left', 'tip-bottom', 'tip-right', 'radius', 'round'].concat(this.settings.additional_inheritable_classes),
+ classes = target.attr('class'),
+ filtered = classes ? $.map(classes.split(' '), function (el, i) {
+ if ($.inArray(el, inheritables) !== -1) {
+ return el;
+ }
+ }).join(' ') : '';
+
+ return $.trim(filtered);
+ },
+
+ show : function ($target) {
+ var $tip = this.getTip($target);
+
+ this.reposition($target, $tip, $target.attr('class'));
+ return $tip.fadeIn(150);
+ },
+
+ hide : function ($target) {
+ var $tip = this.getTip($target);
+
+ return $tip.fadeOut(150);
+ },
+
+ // deprecate reload
+ reload : function () {
+ var $self = $(this);
+
+ return ($self.data('fndtn-tooltips')) ? $self.foundationTooltips('destroy').foundationTooltips('init') : $self.foundationTooltips('init');
+ },
+
+ off : function () {
+ this.S(this.scope).off('.fndtn.tooltip');
+ this.S(this.settings.tooltip_class).each(function (i) {
+ $('[' + this.attr_name() + ']').get(i).attr('title', $(this).text());
+ }).remove();
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+;(function ($, window, document, undefined) {
+ 'use strict';
+
+ Foundation.libs.topbar = {
+ name : 'topbar',
+
+ version: '5.1.1',
+
+ settings : {
+ index : 0,
+ sticky_class : 'sticky',
+ custom_back_text: true,
+ back_text: 'Back',
+ is_hover: true,
+ mobile_show_parent_link: false,
+ scrolltop : true // jump to top when sticky nav menu toggle is clicked
+ },
+
+ init : function (section, method, options) {
+ Foundation.inherit(this, 'add_custom_rule register_media throttle');
+ var self = this;
+
+ self.register_media('topbar', 'foundation-mq-topbar');
+
+ this.bindings(method, options);
+
+ self.S('[' + this.attr_name() + ']', this.scope).each(function () {
+ var topbar = self.S(this),
+ settings = topbar.data(self.attr_name(true) + '-init'),
+ section = self.S('section', this),
+ titlebar = $('> ul', this).first();
+
+ topbar.data('index', 0);
+
+ var topbarContainer = topbar.parent();
+ if(topbarContainer.hasClass('fixed') || topbarContainer.hasClass(settings.sticky_class)) {
+ self.settings.sticky_class = settings.sticky_class;
+ self.settings.sticky_topbar = topbar;
+ topbar.data('height', topbarContainer.outerHeight());
+ topbar.data('stickyoffset', topbarContainer.offset().top);
+ } else {
+ topbar.data('height', topbar.outerHeight());
+ }
+
+ if (!settings.assembled) self.assemble(topbar);
+
+ if (settings.is_hover) {
+ self.S('.has-dropdown', topbar).addClass('not-click');
+ } else {
+ self.S('.has-dropdown', topbar).removeClass('not-click');
+ }
+
+ // Pad body when sticky (scrolled) or fixed.
+ self.add_custom_rule('.f-topbar-fixed { padding-top: ' + topbar.data('height') + 'px }');
+
+ if (topbarContainer.hasClass('fixed')) {
+ self.S('body').addClass('f-topbar-fixed');
+ }
+ });
+
+ },
+
+ toggle: function (toggleEl) {
+ var self = this;
+
+ if (toggleEl) {
+ var topbar = self.S(toggleEl).closest('[' + this.attr_name() + ']');
+ } else {
+ var topbar = self.S('[' + this.attr_name() + ']');
+ }
+
+ var settings = topbar.data(this.attr_name(true) + '-init');
+
+ var section = self.S('section, .section', topbar);
+
+ if (self.breakpoint()) {
+ if (!self.rtl) {
+ section.css({left: '0%'});
+ $('>.name', section).css({left: '100%'});
+ } else {
+ section.css({right: '0%'});
+ $('>.name', section).css({right: '100%'});
+ }
+
+ self.S('li.moved', section).removeClass('moved');
+ topbar.data('index', 0);
+
+ topbar
+ .toggleClass('expanded')
+ .css('height', '');
+ }
+
+ if (settings.scrolltop) {
+ if (!topbar.hasClass('expanded')) {
+ if (topbar.hasClass('fixed')) {
+ topbar.parent().addClass('fixed');
+ topbar.removeClass('fixed');
+ self.S('body').addClass('f-topbar-fixed');
+ }
+ } else if (topbar.parent().hasClass('fixed')) {
+ if (settings.scrolltop) {
+ topbar.parent().removeClass('fixed');
+ topbar.addClass('fixed');
+ self.S('body').removeClass('f-topbar-fixed');
+
+ window.scrollTo(0,0);
+ } else {
+ topbar.parent().removeClass('expanded');
+ }
+ }
+ } else {
+ if(topbar.parent().hasClass(self.settings.sticky_class)) {
+ topbar.parent().addClass('fixed');
+ }
+
+ if(topbar.parent().hasClass('fixed')) {
+ if (!topbar.hasClass('expanded')) {
+ topbar.removeClass('fixed');
+ topbar.parent().removeClass('expanded');
+ self.update_sticky_positioning();
+ } else {
+ topbar.addClass('fixed');
+ topbar.parent().addClass('expanded');
+ self.S('body').addClass('f-topbar-fixed');
+ }
+ }
+ }
+ },
+
+ timer : null,
+
+ events : function (bar) {
+ var self = this,
+ S = this.S;
+
+ S(this.scope)
+ .off('.topbar')
+ .on('click.fndtn.topbar', '[' + this.attr_name() + '] .toggle-topbar', function (e) {
+ e.preventDefault();
+ self.toggle(this);
+ })
+ .on('click.fndtn.topbar', '[' + this.attr_name() + '] li.has-dropdown', function (e) {
+ var li = S(this),
+ target = S(e.target),
+ topbar = li.closest('[' + self.attr_name() + ']'),
+ settings = topbar.data(self.attr_name(true) + '-init');
+
+ if(target.data('revealId')) {
+ self.toggle();
+ return;
+ }
+
+ if (self.breakpoint()) return;
+ if (settings.is_hover && !Modernizr.touch) return;
+
+ e.stopImmediatePropagation();
+
+ if (li.hasClass('hover')) {
+ li
+ .removeClass('hover')
+ .find('li')
+ .removeClass('hover');
+
+ li.parents('li.hover')
+ .removeClass('hover');
+ } else {
+ li.addClass('hover');
+
+ if (target[0].nodeName === 'A' && target.parent().hasClass('has-dropdown')) {
+ e.preventDefault();
+ }
+ }
+ })
+ .on('click.fndtn.topbar', '[' + this.attr_name() + '] .has-dropdown>a', function (e) {
+ if (self.breakpoint()) {
+
+ e.preventDefault();
+
+ var $this = S(this),
+ topbar = $this.closest('[' + self.attr_name() + ']'),
+ section = topbar.find('section, .section'),
+ dropdownHeight = $this.next('.dropdown').outerHeight(),
+ $selectedLi = $this.closest('li');
+
+ topbar.data('index', topbar.data('index') + 1);
+ $selectedLi.addClass('moved');
+
+ if (!self.rtl) {
+ section.css({left: -(100 * topbar.data('index')) + '%'});
+ section.find('>.name').css({left: 100 * topbar.data('index') + '%'});
+ } else {
+ section.css({right: -(100 * topbar.data('index')) + '%'});
+ section.find('>.name').css({right: 100 * topbar.data('index') + '%'});
+ }
+
+ topbar.css('height', $this.siblings('ul').outerHeight(true) + topbar.data('height'));
+ }
+ });
+
+ S(window).off('.topbar').on('resize.fndtn.topbar', self.throttle(function () {
+ self.resize.call(self);
+ }, 50)).trigger('resize');
+
+ S('body').off('.topbar').on('click.fndtn.topbar touchstart.fndtn.topbar', function (e) {
+ var parent = S(e.target).closest('li').closest('li.hover');
+
+ if (parent.length > 0) {
+ return;
+ }
+
+ S('[' + self.attr_name() + '] li').removeClass('hover');
+ });
+
+ // Go up a level on Click
+ S(this.scope).on('click.fndtn.topbar', '[' + this.attr_name() + '] .has-dropdown .back', function (e) {
+ e.preventDefault();
+
+ var $this = S(this),
+ topbar = $this.closest('[' + self.attr_name() + ']'),
+ section = topbar.find('section, .section'),
+ settings = topbar.data(self.attr_name(true) + '-init'),
+ $movedLi = $this.closest('li.moved'),
+ $previousLevelUl = $movedLi.parent();
+
+ topbar.data('index', topbar.data('index') - 1);
+
+ if (!self.rtl) {
+ section.css({left: -(100 * topbar.data('index')) + '%'});
+ section.find('>.name').css({left: 100 * topbar.data('index') + '%'});
+ } else {
+ section.css({right: -(100 * topbar.data('index')) + '%'});
+ section.find('>.name').css({right: 100 * topbar.data('index') + '%'});
+ }
+
+ if (topbar.data('index') === 0) {
+ topbar.css('height', '');
+ } else {
+ topbar.css('height', $previousLevelUl.outerHeight(true) + topbar.data('height'));
+ }
+
+ setTimeout(function () {
+ $movedLi.removeClass('moved');
+ }, 300);
+ });
+ },
+
+ resize : function () {
+ var self = this;
+ self.S('[' + this.attr_name() + ']').each(function () {
+ var topbar = self.S(this),
+ settings = topbar.data(self.attr_name(true) + '-init');
+
+ var stickyContainer = topbar.parent('.' + self.settings.sticky_class);
+ var stickyOffset;
+
+ if (!self.breakpoint()) {
+ var doToggle = topbar.hasClass('expanded');
+ topbar
+ .css('height', '')
+ .removeClass('expanded')
+ .find('li')
+ .removeClass('hover');
+
+ if(doToggle) {
+ self.toggle(topbar);
+ }
+ }
+
+ if(stickyContainer.length > 0) {
+ if(stickyContainer.hasClass('fixed')) {
+ // Remove the fixed to allow for correct calculation of the offset.
+ stickyContainer.removeClass('fixed');
+
+ stickyOffset = stickyContainer.offset().top;
+ if(self.S(document.body).hasClass('f-topbar-fixed')) {
+ stickyOffset -= topbar.data('height');
+ }
+
+ topbar.data('stickyoffset', stickyOffset);
+ stickyContainer.addClass('fixed');
+ } else {
+ stickyOffset = stickyContainer.offset().top;
+ topbar.data('stickyoffset', stickyOffset);
+ }
+ }
+
+ });
+ },
+
+ breakpoint : function () {
+ return !matchMedia(Foundation.media_queries['topbar']).matches;
+ },
+
+ assemble : function (topbar) {
+ var self = this,
+ settings = topbar.data(this.attr_name(true) + '-init'),
+ section = self.S('section', topbar),
+ titlebar = $('> ul', topbar).first();
+
+ // Pull element out of the DOM for manipulation
+ section.detach();
+
+ self.S('.has-dropdown>a', section).each(function () {
+ var $link = self.S(this),
+ $dropdown = $link.siblings('.dropdown'),
+ url = $link.attr('href');
+
+ if (!$dropdown.find('.title.back').length) {
+ if (settings.mobile_show_parent_link && url && url.length > 1) {
+ var $titleLi = $('<li class="title back js-generated"><h5><a href="javascript:void(0)"></a></h5></li><li><a class="parent-link js-generated" href="' + url + '">' + $link.text() +'</a></li>');
+ } else {
+ var $titleLi = $('<li class="title back js-generated"><h5><a href="javascript:void(0)"></a></h5></li>');
+ }
+
+ // Copy link to subnav
+ if (settings.custom_back_text == true) {
+ $('h5>a', $titleLi).html(settings.back_text);
+ } else {
+ $('h5>a', $titleLi).html('« ' + $link.html());
+ }
+ $dropdown.prepend($titleLi);
+ }
+ });
+
+ // Put element back in the DOM
+ section.appendTo(topbar);
+
+ // check for sticky
+ this.sticky();
+
+ this.assembled(topbar);
+ },
+
+ assembled : function (topbar) {
+ topbar.data(this.attr_name(true), $.extend({}, topbar.data(this.attr_name(true)), {assembled: true}));
+ },
+
+ height : function (ul) {
+ var total = 0,
+ self = this;
+
+ $('> li', ul).each(function () { total += self.S(this).outerHeight(true); });
+
+ return total;
+ },
+
+ sticky : function () {
+ var $window = this.S(window),
+ self = this;
+
+ this.S(window).on('scroll', function() {
+ self.update_sticky_positioning();
+ });
+ },
+
+ update_sticky_positioning: function() {
+ var klass = '.' + this.settings.sticky_class,
+ $window = this.S(window),
+ self = this;
+
+
+ if (self.S(klass).length > 0) {
+ var distance = this.settings.sticky_topbar.data('stickyoffset');
+ if (!self.S(klass).hasClass('expanded')) {
+ if ($window.scrollTop() > (distance)) {
+ if (!self.S(klass).hasClass('fixed')) {
+ self.S(klass).addClass('fixed');
+ self.S('body').addClass('f-topbar-fixed');
+ }
+ } else if ($window.scrollTop() <= distance) {
+ if (self.S(klass).hasClass('fixed')) {
+ self.S(klass).removeClass('fixed');
+ self.S('body').removeClass('f-topbar-fixed');
+ }
+ }
+ }
+ }
+ },
+
+ off : function () {
+ this.S(this.scope).off('.fndtn.topbar');
+ this.S(window).off('.fndtn.topbar');
+ },
+
+ reflow : function () {}
+ };
+}(jQuery, this, this.document));
--- /dev/null
+/**
+ * @preserve FastClick: polyfill to remove click delays on browsers with touch UIs.
+ *
+ * @version 0.6.11
+ * @codingstandard ftlabs-jsv2
+ * @copyright The Financial Times Limited [All Rights Reserved]
+ * @license MIT License (see LICENSE.txt)
+ */
+function FastClick(a){"use strict";var b,c=this;if(this.trackingClick=!1,this.trackingClickStart=0,this.targetElement=null,this.touchStartX=0,this.touchStartY=0,this.lastTouchIdentifier=0,this.touchBoundary=10,this.layer=a,!a||!a.nodeType)throw new TypeError("Layer must be a document node");this.onClick=function(){return FastClick.prototype.onClick.apply(c,arguments)},this.onMouse=function(){return FastClick.prototype.onMouse.apply(c,arguments)},this.onTouchStart=function(){return FastClick.prototype.onTouchStart.apply(c,arguments)},this.onTouchMove=function(){return FastClick.prototype.onTouchMove.apply(c,arguments)},this.onTouchEnd=function(){return FastClick.prototype.onTouchEnd.apply(c,arguments)},this.onTouchCancel=function(){return FastClick.prototype.onTouchCancel.apply(c,arguments)},FastClick.notNeeded(a)||(this.deviceIsAndroid&&(a.addEventListener("mouseover",this.onMouse,!0),a.addEventListener("mousedown",this.onMouse,!0),a.addEventListener("mouseup",this.onMouse,!0)),a.addEventListener("click",this.onClick,!0),a.addEventListener("touchstart",this.onTouchStart,!1),a.addEventListener("touchmove",this.onTouchMove,!1),a.addEventListener("touchend",this.onTouchEnd,!1),a.addEventListener("touchcancel",this.onTouchCancel,!1),Event.prototype.stopImmediatePropagation||(a.removeEventListener=function(b,c,d){var e=Node.prototype.removeEventListener;"click"===b?e.call(a,b,c.hijacked||c,d):e.call(a,b,c,d)},a.addEventListener=function(b,c,d){var e=Node.prototype.addEventListener;"click"===b?e.call(a,b,c.hijacked||(c.hijacked=function(a){a.propagationStopped||c(a)}),d):e.call(a,b,c,d)}),"function"==typeof a.onclick&&(b=a.onclick,a.addEventListener("click",function(a){b(a)},!1),a.onclick=null))}FastClick.prototype.deviceIsAndroid=navigator.userAgent.indexOf("Android")>0,FastClick.prototype.deviceIsIOS=/iP(ad|hone|od)/.test(navigator.userAgent),FastClick.prototype.deviceIsIOS4=FastClick.prototype.deviceIsIOS&&/OS 4_\d(_\d)?/.test(navigator.userAgent),FastClick.prototype.deviceIsIOSWithBadTarget=FastClick.prototype.deviceIsIOS&&/OS ([6-9]|\d{2})_\d/.test(navigator.userAgent),FastClick.prototype.needsClick=function(a){"use strict";switch(a.nodeName.toLowerCase()){case"button":case"select":case"textarea":if(a.disabled)return!0;break;case"input":if(this.deviceIsIOS&&"file"===a.type||a.disabled)return!0;break;case"label":case"video":return!0}return/\bneedsclick\b/.test(a.className)},FastClick.prototype.needsFocus=function(a){"use strict";switch(a.nodeName.toLowerCase()){case"textarea":return!0;case"select":return!this.deviceIsAndroid;case"input":switch(a.type){case"button":case"checkbox":case"file":case"image":case"radio":case"submit":return!1}return!a.disabled&&!a.readOnly;default:return/\bneedsfocus\b/.test(a.className)}},FastClick.prototype.sendClick=function(a,b){"use strict";var c,d;document.activeElement&&document.activeElement!==a&&document.activeElement.blur(),d=b.changedTouches[0],c=document.createEvent("MouseEvents"),c.initMouseEvent(this.determineEventType(a),!0,!0,window,1,d.screenX,d.screenY,d.clientX,d.clientY,!1,!1,!1,!1,0,null),c.forwardedTouchEvent=!0,a.dispatchEvent(c)},FastClick.prototype.determineEventType=function(a){"use strict";return this.deviceIsAndroid&&"select"===a.tagName.toLowerCase()?"mousedown":"click"},FastClick.prototype.focus=function(a){"use strict";var b;this.deviceIsIOS&&a.setSelectionRange&&0!==a.type.indexOf("date")&&"time"!==a.type?(b=a.value.length,a.setSelectionRange(b,b)):a.focus()},FastClick.prototype.updateScrollParent=function(a){"use strict";var b,c;if(b=a.fastClickScrollParent,!b||!b.contains(a)){c=a;do{if(c.scrollHeight>c.offsetHeight){b=c,a.fastClickScrollParent=c;break}c=c.parentElement}while(c)}b&&(b.fastClickLastScrollTop=b.scrollTop)},FastClick.prototype.getTargetElementFromEventTarget=function(a){"use strict";return a.nodeType===Node.TEXT_NODE?a.parentNode:a},FastClick.prototype.onTouchStart=function(a){"use strict";var b,c,d;if(a.targetTouches.length>1)return!0;if(b=this.getTargetElementFromEventTarget(a.target),c=a.targetTouches[0],this.deviceIsIOS){if(d=window.getSelection(),d.rangeCount&&!d.isCollapsed)return!0;if(!this.deviceIsIOS4){if(c.identifier===this.lastTouchIdentifier)return a.preventDefault(),!1;this.lastTouchIdentifier=c.identifier,this.updateScrollParent(b)}}return this.trackingClick=!0,this.trackingClickStart=a.timeStamp,this.targetElement=b,this.touchStartX=c.pageX,this.touchStartY=c.pageY,a.timeStamp-this.lastClickTime<200&&a.preventDefault(),!0},FastClick.prototype.touchHasMoved=function(a){"use strict";var b=a.changedTouches[0],c=this.touchBoundary;return Math.abs(b.pageX-this.touchStartX)>c||Math.abs(b.pageY-this.touchStartY)>c?!0:!1},FastClick.prototype.onTouchMove=function(a){"use strict";return this.trackingClick?((this.targetElement!==this.getTargetElementFromEventTarget(a.target)||this.touchHasMoved(a))&&(this.trackingClick=!1,this.targetElement=null),!0):!0},FastClick.prototype.findControl=function(a){"use strict";return void 0!==a.control?a.control:a.htmlFor?document.getElementById(a.htmlFor):a.querySelector("button, input:not([type=hidden]), keygen, meter, output, progress, select, textarea")},FastClick.prototype.onTouchEnd=function(a){"use strict";var b,c,d,e,f,g=this.targetElement;if(!this.trackingClick)return!0;if(a.timeStamp-this.lastClickTime<200)return this.cancelNextClick=!0,!0;if(this.cancelNextClick=!1,this.lastClickTime=a.timeStamp,c=this.trackingClickStart,this.trackingClick=!1,this.trackingClickStart=0,this.deviceIsIOSWithBadTarget&&(f=a.changedTouches[0],g=document.elementFromPoint(f.pageX-window.pageXOffset,f.pageY-window.pageYOffset)||g,g.fastClickScrollParent=this.targetElement.fastClickScrollParent),d=g.tagName.toLowerCase(),"label"===d){if(b=this.findControl(g)){if(this.focus(g),this.deviceIsAndroid)return!1;g=b}}else if(this.needsFocus(g))return a.timeStamp-c>100||this.deviceIsIOS&&window.top!==window&&"input"===d?(this.targetElement=null,!1):(this.focus(g),this.deviceIsIOS4&&"select"===d||(this.targetElement=null,a.preventDefault()),!1);return this.deviceIsIOS&&!this.deviceIsIOS4&&(e=g.fastClickScrollParent,e&&e.fastClickLastScrollTop!==e.scrollTop)?!0:(this.needsClick(g)||(a.preventDefault(),this.sendClick(g,a)),!1)},FastClick.prototype.onTouchCancel=function(){"use strict";this.trackingClick=!1,this.targetElement=null},FastClick.prototype.onMouse=function(a){"use strict";return this.targetElement?a.forwardedTouchEvent?!0:a.cancelable?!this.needsClick(this.targetElement)||this.cancelNextClick?(a.stopImmediatePropagation?a.stopImmediatePropagation():a.propagationStopped=!0,a.stopPropagation(),a.preventDefault(),!1):!0:!0:!0},FastClick.prototype.onClick=function(a){"use strict";var b;return this.trackingClick?(this.targetElement=null,this.trackingClick=!1,!0):"submit"===a.target.type&&0===a.detail?!0:(b=this.onMouse(a),b||(this.targetElement=null),b)},FastClick.prototype.destroy=function(){"use strict";var a=this.layer;this.deviceIsAndroid&&(a.removeEventListener("mouseover",this.onMouse,!0),a.removeEventListener("mousedown",this.onMouse,!0),a.removeEventListener("mouseup",this.onMouse,!0)),a.removeEventListener("click",this.onClick,!0),a.removeEventListener("touchstart",this.onTouchStart,!1),a.removeEventListener("touchmove",this.onTouchMove,!1),a.removeEventListener("touchend",this.onTouchEnd,!1),a.removeEventListener("touchcancel",this.onTouchCancel,!1)},FastClick.notNeeded=function(a){"use strict";var b,c;if("undefined"==typeof window.ontouchstart)return!0;if(c=+(/Chrome\/([0-9]+)/.exec(navigator.userAgent)||[,0])[1]){if(!FastClick.prototype.deviceIsAndroid)return!0;if(b=document.querySelector("meta[name=viewport]")){if(-1!==b.content.indexOf("user-scalable=no"))return!0;if(c>31&&window.innerWidth<=window.screen.width)return!0}}return"none"===a.style.msTouchAction?!0:!1},FastClick.attach=function(a){"use strict";return new FastClick(a)},"undefined"!=typeof define&&define.amd?define(function(){"use strict";return FastClick}):"undefined"!=typeof module&&module.exports?(module.exports=FastClick.attach,module.exports.FastClick=FastClick):window.FastClick=FastClick;
\ No newline at end of file
--- /dev/null
+/*!
+ * jQuery Cookie Plugin v1.4.0
+ * https://github.com/carhartl/jquery-cookie
+ *
+ * Copyright 2013 Klaus Hartl
+ * Released under the MIT license
+ */
+!function(a){"function"==typeof define&&define.amd?define(["jquery"],a):a(jQuery)}(function(a){function b(a){return h.raw?a:encodeURIComponent(a)}function c(a){return h.raw?a:decodeURIComponent(a)}function d(a){return b(h.json?JSON.stringify(a):String(a))}function e(a){0===a.indexOf('"')&&(a=a.slice(1,-1).replace(/\\"/g,'"').replace(/\\\\/g,"\\"));try{a=decodeURIComponent(a.replace(g," "))}catch(b){return}try{return h.json?JSON.parse(a):a}catch(b){}}function f(b,c){var d=h.raw?b:e(b);return a.isFunction(c)?c(d):d}var g=/\+/g,h=a.cookie=function(e,g,i){if(void 0!==g&&!a.isFunction(g)){if(i=a.extend({},h.defaults,i),"number"==typeof i.expires){var j=i.expires,k=i.expires=new Date;k.setDate(k.getDate()+j)}return document.cookie=[b(e),"=",d(g),i.expires?"; expires="+i.expires.toUTCString():"",i.path?"; path="+i.path:"",i.domain?"; domain="+i.domain:"",i.secure?"; secure":""].join("")}for(var l=e?void 0:{},m=document.cookie?document.cookie.split("; "):[],n=0,o=m.length;o>n;n++){var p=m[n].split("="),q=c(p.shift()),r=p.join("=");if(e&&e===q){l=f(r,g);break}e||void 0===(r=f(r))||(l[q]=r)}return l};h.defaults={},a.removeCookie=function(b,c){return void 0!==a.cookie(b)?(a.cookie(b,"",a.extend({},c,{expires:-1})),!0):!1}});
\ No newline at end of file
--- /dev/null
+/*!
+ * jQuery JavaScript Library v2.1.0
+ * http://jquery.com/
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ *
+ * Copyright 2005, 2014 jQuery Foundation, Inc. and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: 2014-01-23T21:10Z
+ */
+!function(a,b){"object"==typeof module&&"object"==typeof module.exports?module.exports=a.document?b(a,!0):function(a){if(!a.document)throw new Error("jQuery requires a window with a document");return b(a)}:b(a)}("undefined"!=typeof window?window:this,function(a,b){function c(a){var b=a.length,c=ab.type(a);return"function"===c||ab.isWindow(a)?!1:1===a.nodeType&&b?!0:"array"===c||0===b||"number"==typeof b&&b>0&&b-1 in a}function d(a,b,c){if(ab.isFunction(b))return ab.grep(a,function(a,d){return!!b.call(a,d,a)!==c});if(b.nodeType)return ab.grep(a,function(a){return a===b!==c});if("string"==typeof b){if(hb.test(b))return ab.filter(b,a,c);b=ab.filter(b,a)}return ab.grep(a,function(a){return U.call(b,a)>=0!==c})}function e(a,b){for(;(a=a[b])&&1!==a.nodeType;);return a}function f(a){var b=ob[a]={};return ab.each(a.match(nb)||[],function(a,c){b[c]=!0}),b}function g(){$.removeEventListener("DOMContentLoaded",g,!1),a.removeEventListener("load",g,!1),ab.ready()}function h(){Object.defineProperty(this.cache={},0,{get:function(){return{}}}),this.expando=ab.expando+Math.random()}function i(a,b,c){var d;if(void 0===c&&1===a.nodeType)if(d="data-"+b.replace(ub,"-$1").toLowerCase(),c=a.getAttribute(d),"string"==typeof c){try{c="true"===c?!0:"false"===c?!1:"null"===c?null:+c+""===c?+c:tb.test(c)?ab.parseJSON(c):c}catch(e){}sb.set(a,b,c)}else c=void 0;return c}function j(){return!0}function k(){return!1}function l(){try{return $.activeElement}catch(a){}}function m(a,b){return ab.nodeName(a,"table")&&ab.nodeName(11!==b.nodeType?b:b.firstChild,"tr")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function n(a){return a.type=(null!==a.getAttribute("type"))+"/"+a.type,a}function o(a){var b=Kb.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function p(a,b){for(var c=0,d=a.length;d>c;c++)rb.set(a[c],"globalEval",!b||rb.get(b[c],"globalEval"))}function q(a,b){var c,d,e,f,g,h,i,j;if(1===b.nodeType){if(rb.hasData(a)&&(f=rb.access(a),g=rb.set(b,f),j=f.events)){delete g.handle,g.events={};for(e in j)for(c=0,d=j[e].length;d>c;c++)ab.event.add(b,e,j[e][c])}sb.hasData(a)&&(h=sb.access(a),i=ab.extend({},h),sb.set(b,i))}}function r(a,b){var c=a.getElementsByTagName?a.getElementsByTagName(b||"*"):a.querySelectorAll?a.querySelectorAll(b||"*"):[];return void 0===b||b&&ab.nodeName(a,b)?ab.merge([a],c):c}function s(a,b){var c=b.nodeName.toLowerCase();"input"===c&&yb.test(a.type)?b.checked=a.checked:("input"===c||"textarea"===c)&&(b.defaultValue=a.defaultValue)}function t(b,c){var d=ab(c.createElement(b)).appendTo(c.body),e=a.getDefaultComputedStyle?a.getDefaultComputedStyle(d[0]).display:ab.css(d[0],"display");return d.detach(),e}function u(a){var b=$,c=Ob[a];return c||(c=t(a,b),"none"!==c&&c||(Nb=(Nb||ab("<iframe frameborder='0' width='0' height='0'/>")).appendTo(b.documentElement),b=Nb[0].contentDocument,b.write(),b.close(),c=t(a,b),Nb.detach()),Ob[a]=c),c}function v(a,b,c){var d,e,f,g,h=a.style;return c=c||Rb(a),c&&(g=c.getPropertyValue(b)||c[b]),c&&(""!==g||ab.contains(a.ownerDocument,a)||(g=ab.style(a,b)),Qb.test(g)&&Pb.test(b)&&(d=h.width,e=h.minWidth,f=h.maxWidth,h.minWidth=h.maxWidth=h.width=g,g=c.width,h.width=d,h.minWidth=e,h.maxWidth=f)),void 0!==g?g+"":g}function w(a,b){return{get:function(){return a()?void delete this.get:(this.get=b).apply(this,arguments)}}}function x(a,b){if(b in a)return b;for(var c=b[0].toUpperCase()+b.slice(1),d=b,e=Xb.length;e--;)if(b=Xb[e]+c,b in a)return b;return d}function y(a,b,c){var d=Tb.exec(b);return d?Math.max(0,d[1]-(c||0))+(d[2]||"px"):b}function z(a,b,c,d,e){for(var f=c===(d?"border":"content")?4:"width"===b?1:0,g=0;4>f;f+=2)"margin"===c&&(g+=ab.css(a,c+wb[f],!0,e)),d?("content"===c&&(g-=ab.css(a,"padding"+wb[f],!0,e)),"margin"!==c&&(g-=ab.css(a,"border"+wb[f]+"Width",!0,e))):(g+=ab.css(a,"padding"+wb[f],!0,e),"padding"!==c&&(g+=ab.css(a,"border"+wb[f]+"Width",!0,e)));return g}function A(a,b,c){var d=!0,e="width"===b?a.offsetWidth:a.offsetHeight,f=Rb(a),g="border-box"===ab.css(a,"boxSizing",!1,f);if(0>=e||null==e){if(e=v(a,b,f),(0>e||null==e)&&(e=a.style[b]),Qb.test(e))return e;d=g&&(Z.boxSizingReliable()||e===a.style[b]),e=parseFloat(e)||0}return e+z(a,b,c||(g?"border":"content"),d,f)+"px"}function B(a,b){for(var c,d,e,f=[],g=0,h=a.length;h>g;g++)d=a[g],d.style&&(f[g]=rb.get(d,"olddisplay"),c=d.style.display,b?(f[g]||"none"!==c||(d.style.display=""),""===d.style.display&&xb(d)&&(f[g]=rb.access(d,"olddisplay",u(d.nodeName)))):f[g]||(e=xb(d),(c&&"none"!==c||!e)&&rb.set(d,"olddisplay",e?c:ab.css(d,"display"))));for(g=0;h>g;g++)d=a[g],d.style&&(b&&"none"!==d.style.display&&""!==d.style.display||(d.style.display=b?f[g]||"":"none"));return a}function C(a,b,c,d,e){return new C.prototype.init(a,b,c,d,e)}function D(){return setTimeout(function(){Yb=void 0}),Yb=ab.now()}function E(a,b){var c,d=0,e={height:a};for(b=b?1:0;4>d;d+=2-b)c=wb[d],e["margin"+c]=e["padding"+c]=a;return b&&(e.opacity=e.width=a),e}function F(a,b,c){for(var d,e=(cc[b]||[]).concat(cc["*"]),f=0,g=e.length;g>f;f++)if(d=e[f].call(c,b,a))return d}function G(a,b,c){var d,e,f,g,h,i,j,k=this,l={},m=a.style,n=a.nodeType&&xb(a),o=rb.get(a,"fxshow");c.queue||(h=ab._queueHooks(a,"fx"),null==h.unqueued&&(h.unqueued=0,i=h.empty.fire,h.empty.fire=function(){h.unqueued||i()}),h.unqueued++,k.always(function(){k.always(function(){h.unqueued--,ab.queue(a,"fx").length||h.empty.fire()})})),1===a.nodeType&&("height"in b||"width"in b)&&(c.overflow=[m.overflow,m.overflowX,m.overflowY],j=ab.css(a,"display"),"none"===j&&(j=u(a.nodeName)),"inline"===j&&"none"===ab.css(a,"float")&&(m.display="inline-block")),c.overflow&&(m.overflow="hidden",k.always(function(){m.overflow=c.overflow[0],m.overflowX=c.overflow[1],m.overflowY=c.overflow[2]}));for(d in b)if(e=b[d],$b.exec(e)){if(delete b[d],f=f||"toggle"===e,e===(n?"hide":"show")){if("show"!==e||!o||void 0===o[d])continue;n=!0}l[d]=o&&o[d]||ab.style(a,d)}if(!ab.isEmptyObject(l)){o?"hidden"in o&&(n=o.hidden):o=rb.access(a,"fxshow",{}),f&&(o.hidden=!n),n?ab(a).show():k.done(function(){ab(a).hide()}),k.done(function(){var b;rb.remove(a,"fxshow");for(b in l)ab.style(a,b,l[b])});for(d in l)g=F(n?o[d]:0,d,k),d in o||(o[d]=g.start,n&&(g.end=g.start,g.start="width"===d||"height"===d?1:0))}}function H(a,b){var c,d,e,f,g;for(c in a)if(d=ab.camelCase(c),e=b[d],f=a[c],ab.isArray(f)&&(e=f[1],f=a[c]=f[0]),c!==d&&(a[d]=f,delete a[c]),g=ab.cssHooks[d],g&&"expand"in g){f=g.expand(f),delete a[d];for(c in f)c in a||(a[c]=f[c],b[c]=e)}else b[d]=e}function I(a,b,c){var d,e,f=0,g=bc.length,h=ab.Deferred().always(function(){delete i.elem}),i=function(){if(e)return!1;for(var b=Yb||D(),c=Math.max(0,j.startTime+j.duration-b),d=c/j.duration||0,f=1-d,g=0,i=j.tweens.length;i>g;g++)j.tweens[g].run(f);return h.notifyWith(a,[j,f,c]),1>f&&i?c:(h.resolveWith(a,[j]),!1)},j=h.promise({elem:a,props:ab.extend({},b),opts:ab.extend(!0,{specialEasing:{}},c),originalProperties:b,originalOptions:c,startTime:Yb||D(),duration:c.duration,tweens:[],createTween:function(b,c){var d=ab.Tween(a,j.opts,b,c,j.opts.specialEasing[b]||j.opts.easing);return j.tweens.push(d),d},stop:function(b){var c=0,d=b?j.tweens.length:0;if(e)return this;for(e=!0;d>c;c++)j.tweens[c].run(1);return b?h.resolveWith(a,[j,b]):h.rejectWith(a,[j,b]),this}}),k=j.props;for(H(k,j.opts.specialEasing);g>f;f++)if(d=bc[f].call(j,a,k,j.opts))return d;return ab.map(k,F,j),ab.isFunction(j.opts.start)&&j.opts.start.call(a,j),ab.fx.timer(ab.extend(i,{elem:a,anim:j,queue:j.opts.queue})),j.progress(j.opts.progress).done(j.opts.done,j.opts.complete).fail(j.opts.fail).always(j.opts.always)}function J(a){return function(b,c){"string"!=typeof b&&(c=b,b="*");var d,e=0,f=b.toLowerCase().match(nb)||[];if(ab.isFunction(c))for(;d=f[e++];)"+"===d[0]?(d=d.slice(1)||"*",(a[d]=a[d]||[]).unshift(c)):(a[d]=a[d]||[]).push(c)}}function K(a,b,c,d){function e(h){var i;return f[h]=!0,ab.each(a[h]||[],function(a,h){var j=h(b,c,d);return"string"!=typeof j||g||f[j]?g?!(i=j):void 0:(b.dataTypes.unshift(j),e(j),!1)}),i}var f={},g=a===vc;return e(b.dataTypes[0])||!f["*"]&&e("*")}function L(a,b){var c,d,e=ab.ajaxSettings.flatOptions||{};for(c in b)void 0!==b[c]&&((e[c]?a:d||(d={}))[c]=b[c]);return d&&ab.extend(!0,a,d),a}function M(a,b,c){for(var d,e,f,g,h=a.contents,i=a.dataTypes;"*"===i[0];)i.shift(),void 0===d&&(d=a.mimeType||b.getResponseHeader("Content-Type"));if(d)for(e in h)if(h[e]&&h[e].test(d)){i.unshift(e);break}if(i[0]in c)f=i[0];else{for(e in c){if(!i[0]||a.converters[e+" "+i[0]]){f=e;break}g||(g=e)}f=f||g}return f?(f!==i[0]&&i.unshift(f),c[f]):void 0}function N(a,b,c,d){var e,f,g,h,i,j={},k=a.dataTypes.slice();if(k[1])for(g in a.converters)j[g.toLowerCase()]=a.converters[g];for(f=k.shift();f;)if(a.responseFields[f]&&(c[a.responseFields[f]]=b),!i&&d&&a.dataFilter&&(b=a.dataFilter(b,a.dataType)),i=f,f=k.shift())if("*"===f)f=i;else if("*"!==i&&i!==f){if(g=j[i+" "+f]||j["* "+f],!g)for(e in j)if(h=e.split(" "),h[1]===f&&(g=j[i+" "+h[0]]||j["* "+h[0]])){g===!0?g=j[e]:j[e]!==!0&&(f=h[0],k.unshift(h[1]));break}if(g!==!0)if(g&&a["throws"])b=g(b);else try{b=g(b)}catch(l){return{state:"parsererror",error:g?l:"No conversion from "+i+" to "+f}}}return{state:"success",data:b}}function O(a,b,c,d){var e;if(ab.isArray(b))ab.each(b,function(b,e){c||zc.test(a)?d(a,e):O(a+"["+("object"==typeof e?b:"")+"]",e,c,d)});else if(c||"object"!==ab.type(b))d(a,b);else for(e in b)O(a+"["+e+"]",b[e],c,d)}function P(a){return ab.isWindow(a)?a:9===a.nodeType&&a.defaultView}var Q=[],R=Q.slice,S=Q.concat,T=Q.push,U=Q.indexOf,V={},W=V.toString,X=V.hasOwnProperty,Y="".trim,Z={},$=a.document,_="2.1.0",ab=function(a,b){return new ab.fn.init(a,b)},bb=/^-ms-/,cb=/-([\da-z])/gi,db=function(a,b){return b.toUpperCase()};ab.fn=ab.prototype={jquery:_,constructor:ab,selector:"",length:0,toArray:function(){return R.call(this)},get:function(a){return null!=a?0>a?this[a+this.length]:this[a]:R.call(this)},pushStack:function(a){var b=ab.merge(this.constructor(),a);return b.prevObject=this,b.context=this.context,b},each:function(a,b){return ab.each(this,a,b)},map:function(a){return this.pushStack(ab.map(this,function(b,c){return a.call(b,c,b)}))},slice:function(){return this.pushStack(R.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(a){var b=this.length,c=+a+(0>a?b:0);return this.pushStack(c>=0&&b>c?[this[c]]:[])},end:function(){return this.prevObject||this.constructor(null)},push:T,sort:Q.sort,splice:Q.splice},ab.extend=ab.fn.extend=function(){var a,b,c,d,e,f,g=arguments[0]||{},h=1,i=arguments.length,j=!1;for("boolean"==typeof g&&(j=g,g=arguments[h]||{},h++),"object"==typeof g||ab.isFunction(g)||(g={}),h===i&&(g=this,h--);i>h;h++)if(null!=(a=arguments[h]))for(b in a)c=g[b],d=a[b],g!==d&&(j&&d&&(ab.isPlainObject(d)||(e=ab.isArray(d)))?(e?(e=!1,f=c&&ab.isArray(c)?c:[]):f=c&&ab.isPlainObject(c)?c:{},g[b]=ab.extend(j,f,d)):void 0!==d&&(g[b]=d));return g},ab.extend({expando:"jQuery"+(_+Math.random()).replace(/\D/g,""),isReady:!0,error:function(a){throw new Error(a)},noop:function(){},isFunction:function(a){return"function"===ab.type(a)},isArray:Array.isArray,isWindow:function(a){return null!=a&&a===a.window},isNumeric:function(a){return a-parseFloat(a)>=0},isPlainObject:function(a){if("object"!==ab.type(a)||a.nodeType||ab.isWindow(a))return!1;try{if(a.constructor&&!X.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(b){return!1}return!0},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},type:function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?V[W.call(a)]||"object":typeof a},globalEval:function(a){var b,c=eval;a=ab.trim(a),a&&(1===a.indexOf("use strict")?(b=$.createElement("script"),b.text=a,$.head.appendChild(b).parentNode.removeChild(b)):c(a))},camelCase:function(a){return a.replace(bb,"ms-").replace(cb,db)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()},each:function(a,b,d){var e,f=0,g=a.length,h=c(a);if(d){if(h)for(;g>f&&(e=b.apply(a[f],d),e!==!1);f++);else for(f in a)if(e=b.apply(a[f],d),e===!1)break}else if(h)for(;g>f&&(e=b.call(a[f],f,a[f]),e!==!1);f++);else for(f in a)if(e=b.call(a[f],f,a[f]),e===!1)break;return a},trim:function(a){return null==a?"":Y.call(a)},makeArray:function(a,b){var d=b||[];return null!=a&&(c(Object(a))?ab.merge(d,"string"==typeof a?[a]:a):T.call(d,a)),d},inArray:function(a,b,c){return null==b?-1:U.call(b,a,c)},merge:function(a,b){for(var c=+b.length,d=0,e=a.length;c>d;d++)a[e++]=b[d];return a.length=e,a},grep:function(a,b,c){for(var d,e=[],f=0,g=a.length,h=!c;g>f;f++)d=!b(a[f],f),d!==h&&e.push(a[f]);return e},map:function(a,b,d){var e,f=0,g=a.length,h=c(a),i=[];if(h)for(;g>f;f++)e=b(a[f],f,d),null!=e&&i.push(e);else for(f in a)e=b(a[f],f,d),null!=e&&i.push(e);return S.apply([],i)},guid:1,proxy:function(a,b){var c,d,e;return"string"==typeof b&&(c=a[b],b=a,a=c),ab.isFunction(a)?(d=R.call(arguments,2),e=function(){return a.apply(b||this,d.concat(R.call(arguments)))},e.guid=a.guid=a.guid||ab.guid++,e):void 0},now:Date.now,support:Z}),ab.each("Boolean Number String Function Array Date RegExp Object Error".split(" "),function(a,b){V["[object "+b+"]"]=b.toLowerCase()});var eb=/*!
+ * Sizzle CSS Selector Engine v1.10.16
+ * http://sizzlejs.com/
+ *
+ * Copyright 2013 jQuery Foundation, Inc. and other contributors
+ * Released under the MIT license
+ * http://jquery.org/license
+ *
+ * Date: 2014-01-13
+ */
+function(a){function b(a,b,c,d){var e,f,g,h,i,j,l,o,p,q;if((b?b.ownerDocument||b:O)!==G&&F(b),b=b||G,c=c||[],!a||"string"!=typeof a)return c;if(1!==(h=b.nodeType)&&9!==h)return[];if(I&&!d){if(e=sb.exec(a))if(g=e[1]){if(9===h){if(f=b.getElementById(g),!f||!f.parentNode)return c;if(f.id===g)return c.push(f),c}else if(b.ownerDocument&&(f=b.ownerDocument.getElementById(g))&&M(b,f)&&f.id===g)return c.push(f),c}else{if(e[2])return _.apply(c,b.getElementsByTagName(a)),c;if((g=e[3])&&x.getElementsByClassName&&b.getElementsByClassName)return _.apply(c,b.getElementsByClassName(g)),c}if(x.qsa&&(!J||!J.test(a))){if(o=l=N,p=b,q=9===h&&a,1===h&&"object"!==b.nodeName.toLowerCase()){for(j=m(a),(l=b.getAttribute("id"))?o=l.replace(ub,"\\$&"):b.setAttribute("id",o),o="[id='"+o+"'] ",i=j.length;i--;)j[i]=o+n(j[i]);p=tb.test(a)&&k(b.parentNode)||b,q=j.join(",")}if(q)try{return _.apply(c,p.querySelectorAll(q)),c}catch(r){}finally{l||b.removeAttribute("id")}}}return v(a.replace(ib,"$1"),b,c,d)}function c(){function a(c,d){return b.push(c+" ")>y.cacheLength&&delete a[b.shift()],a[c+" "]=d}var b=[];return a}function d(a){return a[N]=!0,a}function e(a){var b=G.createElement("div");try{return!!a(b)}catch(c){return!1}finally{b.parentNode&&b.parentNode.removeChild(b),b=null}}function f(a,b){for(var c=a.split("|"),d=a.length;d--;)y.attrHandle[c[d]]=b}function g(a,b){var c=b&&a,d=c&&1===a.nodeType&&1===b.nodeType&&(~b.sourceIndex||W)-(~a.sourceIndex||W);if(d)return d;if(c)for(;c=c.nextSibling;)if(c===b)return-1;return a?1:-1}function h(a){return function(b){var c=b.nodeName.toLowerCase();return"input"===c&&b.type===a}}function i(a){return function(b){var c=b.nodeName.toLowerCase();return("input"===c||"button"===c)&&b.type===a}}function j(a){return d(function(b){return b=+b,d(function(c,d){for(var e,f=a([],c.length,b),g=f.length;g--;)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function k(a){return a&&typeof a.getElementsByTagName!==V&&a}function l(){}function m(a,c){var d,e,f,g,h,i,j,k=S[a+" "];if(k)return c?0:k.slice(0);for(h=a,i=[],j=y.preFilter;h;){(!d||(e=jb.exec(h)))&&(e&&(h=h.slice(e[0].length)||h),i.push(f=[])),d=!1,(e=kb.exec(h))&&(d=e.shift(),f.push({value:d,type:e[0].replace(ib," ")}),h=h.slice(d.length));for(g in y.filter)!(e=ob[g].exec(h))||j[g]&&!(e=j[g](e))||(d=e.shift(),f.push({value:d,type:g,matches:e}),h=h.slice(d.length));if(!d)break}return c?h.length:h?b.error(a):S(a,i).slice(0)}function n(a){for(var b=0,c=a.length,d="";c>b;b++)d+=a[b].value;return d}function o(a,b,c){var d=b.dir,e=c&&"parentNode"===d,f=Q++;return b.first?function(b,c,f){for(;b=b[d];)if(1===b.nodeType||e)return a(b,c,f)}:function(b,c,g){var h,i,j=[P,f];if(g){for(;b=b[d];)if((1===b.nodeType||e)&&a(b,c,g))return!0}else for(;b=b[d];)if(1===b.nodeType||e){if(i=b[N]||(b[N]={}),(h=i[d])&&h[0]===P&&h[1]===f)return j[2]=h[2];if(i[d]=j,j[2]=a(b,c,g))return!0}}}function p(a){return a.length>1?function(b,c,d){for(var e=a.length;e--;)if(!a[e](b,c,d))return!1;return!0}:a[0]}function q(a,b,c,d,e){for(var f,g=[],h=0,i=a.length,j=null!=b;i>h;h++)(f=a[h])&&(!c||c(f,d,e))&&(g.push(f),j&&b.push(h));return g}function r(a,b,c,e,f,g){return e&&!e[N]&&(e=r(e)),f&&!f[N]&&(f=r(f,g)),d(function(d,g,h,i){var j,k,l,m=[],n=[],o=g.length,p=d||u(b||"*",h.nodeType?[h]:h,[]),r=!a||!d&&b?p:q(p,m,a,h,i),s=c?f||(d?a:o||e)?[]:g:r;if(c&&c(r,s,h,i),e)for(j=q(s,n),e(j,[],h,i),k=j.length;k--;)(l=j[k])&&(s[n[k]]=!(r[n[k]]=l));if(d){if(f||a){if(f){for(j=[],k=s.length;k--;)(l=s[k])&&j.push(r[k]=l);f(null,s=[],j,i)}for(k=s.length;k--;)(l=s[k])&&(j=f?bb.call(d,l):m[k])>-1&&(d[j]=!(g[j]=l))}}else s=q(s===g?s.splice(o,s.length):s),f?f(null,g,s,i):_.apply(g,s)})}function s(a){for(var b,c,d,e=a.length,f=y.relative[a[0].type],g=f||y.relative[" "],h=f?1:0,i=o(function(a){return a===b},g,!0),j=o(function(a){return bb.call(b,a)>-1},g,!0),k=[function(a,c,d){return!f&&(d||c!==C)||((b=c).nodeType?i(a,c,d):j(a,c,d))}];e>h;h++)if(c=y.relative[a[h].type])k=[o(p(k),c)];else{if(c=y.filter[a[h].type].apply(null,a[h].matches),c[N]){for(d=++h;e>d&&!y.relative[a[d].type];d++);return r(h>1&&p(k),h>1&&n(a.slice(0,h-1).concat({value:" "===a[h-2].type?"*":""})).replace(ib,"$1"),c,d>h&&s(a.slice(h,d)),e>d&&s(a=a.slice(d)),e>d&&n(a))}k.push(c)}return p(k)}function t(a,c){var e=c.length>0,f=a.length>0,g=function(d,g,h,i,j){var k,l,m,n=0,o="0",p=d&&[],r=[],s=C,t=d||f&&y.find.TAG("*",j),u=P+=null==s?1:Math.random()||.1,v=t.length;for(j&&(C=g!==G&&g);o!==v&&null!=(k=t[o]);o++){if(f&&k){for(l=0;m=a[l++];)if(m(k,g,h)){i.push(k);break}j&&(P=u)}e&&((k=!m&&k)&&n--,d&&p.push(k))}if(n+=o,e&&o!==n){for(l=0;m=c[l++];)m(p,r,g,h);if(d){if(n>0)for(;o--;)p[o]||r[o]||(r[o]=Z.call(i));r=q(r)}_.apply(i,r),j&&!d&&r.length>0&&n+c.length>1&&b.uniqueSort(i)}return j&&(P=u,C=s),p};return e?d(g):g}function u(a,c,d){for(var e=0,f=c.length;f>e;e++)b(a,c[e],d);return d}function v(a,b,c,d){var e,f,g,h,i,j=m(a);if(!d&&1===j.length){if(f=j[0]=j[0].slice(0),f.length>2&&"ID"===(g=f[0]).type&&x.getById&&9===b.nodeType&&I&&y.relative[f[1].type]){if(b=(y.find.ID(g.matches[0].replace(vb,wb),b)||[])[0],!b)return c;a=a.slice(f.shift().value.length)}for(e=ob.needsContext.test(a)?0:f.length;e--&&(g=f[e],!y.relative[h=g.type]);)if((i=y.find[h])&&(d=i(g.matches[0].replace(vb,wb),tb.test(f[0].type)&&k(b.parentNode)||b))){if(f.splice(e,1),a=d.length&&n(f),!a)return _.apply(c,d),c;break}}return B(a,j)(d,b,!I,c,tb.test(a)&&k(b.parentNode)||b),c}var w,x,y,z,A,B,C,D,E,F,G,H,I,J,K,L,M,N="sizzle"+-new Date,O=a.document,P=0,Q=0,R=c(),S=c(),T=c(),U=function(a,b){return a===b&&(E=!0),0},V="undefined",W=1<<31,X={}.hasOwnProperty,Y=[],Z=Y.pop,$=Y.push,_=Y.push,ab=Y.slice,bb=Y.indexOf||function(a){for(var b=0,c=this.length;c>b;b++)if(this[b]===a)return b;return-1},cb="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",db="[\\x20\\t\\r\\n\\f]",eb="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",fb=eb.replace("w","w#"),gb="\\["+db+"*("+eb+")"+db+"*(?:([*^$|!~]?=)"+db+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+fb+")|)|)"+db+"*\\]",hb=":("+eb+")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|"+gb.replace(3,8)+")*)|.*)\\)|)",ib=new RegExp("^"+db+"+|((?:^|[^\\\\])(?:\\\\.)*)"+db+"+$","g"),jb=new RegExp("^"+db+"*,"+db+"*"),kb=new RegExp("^"+db+"*([>+~]|"+db+")"+db+"*"),lb=new RegExp("="+db+"*([^\\]'\"]*?)"+db+"*\\]","g"),mb=new RegExp(hb),nb=new RegExp("^"+fb+"$"),ob={ID:new RegExp("^#("+eb+")"),CLASS:new RegExp("^\\.("+eb+")"),TAG:new RegExp("^("+eb.replace("w","w*")+")"),ATTR:new RegExp("^"+gb),PSEUDO:new RegExp("^"+hb),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+db+"*(even|odd|(([+-]|)(\\d*)n|)"+db+"*(?:([+-]|)"+db+"*(\\d+)|))"+db+"*\\)|)","i"),bool:new RegExp("^(?:"+cb+")$","i"),needsContext:new RegExp("^"+db+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+db+"*((?:-\\d)?\\d*)"+db+"*\\)|)(?=[^-]|$)","i")},pb=/^(?:input|select|textarea|button)$/i,qb=/^h\d$/i,rb=/^[^{]+\{\s*\[native \w/,sb=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,tb=/[+~]/,ub=/'|\\/g,vb=new RegExp("\\\\([\\da-f]{1,6}"+db+"?|("+db+")|.)","ig"),wb=function(a,b,c){var d="0x"+b-65536;return d!==d||c?b:0>d?String.fromCharCode(d+65536):String.fromCharCode(d>>10|55296,1023&d|56320)};try{_.apply(Y=ab.call(O.childNodes),O.childNodes),Y[O.childNodes.length].nodeType}catch(xb){_={apply:Y.length?function(a,b){$.apply(a,ab.call(b))}:function(a,b){for(var c=a.length,d=0;a[c++]=b[d++];);a.length=c-1}}}x=b.support={},A=b.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return b?"HTML"!==b.nodeName:!1},F=b.setDocument=function(a){var b,c=a?a.ownerDocument||a:O,d=c.defaultView;return c!==G&&9===c.nodeType&&c.documentElement?(G=c,H=c.documentElement,I=!A(c),d&&d!==d.top&&(d.addEventListener?d.addEventListener("unload",function(){F()},!1):d.attachEvent&&d.attachEvent("onunload",function(){F()})),x.attributes=e(function(a){return a.className="i",!a.getAttribute("className")}),x.getElementsByTagName=e(function(a){return a.appendChild(c.createComment("")),!a.getElementsByTagName("*").length}),x.getElementsByClassName=rb.test(c.getElementsByClassName)&&e(function(a){return a.innerHTML="<div class='a'></div><div class='a i'></div>",a.firstChild.className="i",2===a.getElementsByClassName("i").length}),x.getById=e(function(a){return H.appendChild(a).id=N,!c.getElementsByName||!c.getElementsByName(N).length}),x.getById?(y.find.ID=function(a,b){if(typeof b.getElementById!==V&&I){var c=b.getElementById(a);return c&&c.parentNode?[c]:[]}},y.filter.ID=function(a){var b=a.replace(vb,wb);return function(a){return a.getAttribute("id")===b}}):(delete y.find.ID,y.filter.ID=function(a){var b=a.replace(vb,wb);return function(a){var c=typeof a.getAttributeNode!==V&&a.getAttributeNode("id");return c&&c.value===b}}),y.find.TAG=x.getElementsByTagName?function(a,b){return typeof b.getElementsByTagName!==V?b.getElementsByTagName(a):void 0}:function(a,b){var c,d=[],e=0,f=b.getElementsByTagName(a);if("*"===a){for(;c=f[e++];)1===c.nodeType&&d.push(c);return d}return f},y.find.CLASS=x.getElementsByClassName&&function(a,b){return typeof b.getElementsByClassName!==V&&I?b.getElementsByClassName(a):void 0},K=[],J=[],(x.qsa=rb.test(c.querySelectorAll))&&(e(function(a){a.innerHTML="<select t=''><option selected=''></option></select>",a.querySelectorAll("[t^='']").length&&J.push("[*^$]="+db+"*(?:''|\"\")"),a.querySelectorAll("[selected]").length||J.push("\\["+db+"*(?:value|"+cb+")"),a.querySelectorAll(":checked").length||J.push(":checked")}),e(function(a){var b=c.createElement("input");b.setAttribute("type","hidden"),a.appendChild(b).setAttribute("name","D"),a.querySelectorAll("[name=d]").length&&J.push("name"+db+"*[*^$|!~]?="),a.querySelectorAll(":enabled").length||J.push(":enabled",":disabled"),a.querySelectorAll("*,:x"),J.push(",.*:")})),(x.matchesSelector=rb.test(L=H.webkitMatchesSelector||H.mozMatchesSelector||H.oMatchesSelector||H.msMatchesSelector))&&e(function(a){x.disconnectedMatch=L.call(a,"div"),L.call(a,"[s!='']:x"),K.push("!=",hb)}),J=J.length&&new RegExp(J.join("|")),K=K.length&&new RegExp(K.join("|")),b=rb.test(H.compareDocumentPosition),M=b||rb.test(H.contains)?function(a,b){var c=9===a.nodeType?a.documentElement:a,d=b&&b.parentNode;return a===d||!(!d||1!==d.nodeType||!(c.contains?c.contains(d):a.compareDocumentPosition&&16&a.compareDocumentPosition(d)))}:function(a,b){if(b)for(;b=b.parentNode;)if(b===a)return!0;return!1},U=b?function(a,b){if(a===b)return E=!0,0;var d=!a.compareDocumentPosition-!b.compareDocumentPosition;return d?d:(d=(a.ownerDocument||a)===(b.ownerDocument||b)?a.compareDocumentPosition(b):1,1&d||!x.sortDetached&&b.compareDocumentPosition(a)===d?a===c||a.ownerDocument===O&&M(O,a)?-1:b===c||b.ownerDocument===O&&M(O,b)?1:D?bb.call(D,a)-bb.call(D,b):0:4&d?-1:1)}:function(a,b){if(a===b)return E=!0,0;var d,e=0,f=a.parentNode,h=b.parentNode,i=[a],j=[b];if(!f||!h)return a===c?-1:b===c?1:f?-1:h?1:D?bb.call(D,a)-bb.call(D,b):0;if(f===h)return g(a,b);for(d=a;d=d.parentNode;)i.unshift(d);for(d=b;d=d.parentNode;)j.unshift(d);for(;i[e]===j[e];)e++;return e?g(i[e],j[e]):i[e]===O?-1:j[e]===O?1:0},c):G},b.matches=function(a,c){return b(a,null,null,c)},b.matchesSelector=function(a,c){if((a.ownerDocument||a)!==G&&F(a),c=c.replace(lb,"='$1']"),!(!x.matchesSelector||!I||K&&K.test(c)||J&&J.test(c)))try{var d=L.call(a,c);if(d||x.disconnectedMatch||a.document&&11!==a.document.nodeType)return d}catch(e){}return b(c,G,null,[a]).length>0},b.contains=function(a,b){return(a.ownerDocument||a)!==G&&F(a),M(a,b)},b.attr=function(a,b){(a.ownerDocument||a)!==G&&F(a);var c=y.attrHandle[b.toLowerCase()],d=c&&X.call(y.attrHandle,b.toLowerCase())?c(a,b,!I):void 0;return void 0!==d?d:x.attributes||!I?a.getAttribute(b):(d=a.getAttributeNode(b))&&d.specified?d.value:null},b.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)},b.uniqueSort=function(a){var b,c=[],d=0,e=0;if(E=!x.detectDuplicates,D=!x.sortStable&&a.slice(0),a.sort(U),E){for(;b=a[e++];)b===a[e]&&(d=c.push(e));for(;d--;)a.splice(c[d],1)}return D=null,a},z=b.getText=function(a){var b,c="",d=0,e=a.nodeType;if(e){if(1===e||9===e||11===e){if("string"==typeof a.textContent)return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=z(a)}else if(3===e||4===e)return a.nodeValue}else for(;b=a[d++];)c+=z(b);return c},y=b.selectors={cacheLength:50,createPseudo:d,match:ob,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(vb,wb),a[3]=(a[4]||a[5]||"").replace(vb,wb),"~="===a[2]&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),"nth"===a[1].slice(0,3)?(a[3]||b.error(a[0]),a[4]=+(a[4]?a[5]+(a[6]||1):2*("even"===a[3]||"odd"===a[3])),a[5]=+(a[7]+a[8]||"odd"===a[3])):a[3]&&b.error(a[0]),a},PSEUDO:function(a){var b,c=!a[5]&&a[2];return ob.CHILD.test(a[0])?null:(a[3]&&void 0!==a[4]?a[2]=a[4]:c&&mb.test(c)&&(b=m(c,!0))&&(b=c.indexOf(")",c.length-b)-c.length)&&(a[0]=a[0].slice(0,b),a[2]=c.slice(0,b)),a.slice(0,3))}},filter:{TAG:function(a){var b=a.replace(vb,wb).toLowerCase();return"*"===a?function(){return!0}:function(a){return a.nodeName&&a.nodeName.toLowerCase()===b}},CLASS:function(a){var b=R[a+" "];return b||(b=new RegExp("(^|"+db+")"+a+"("+db+"|$)"))&&R(a,function(a){return b.test("string"==typeof a.className&&a.className||typeof a.getAttribute!==V&&a.getAttribute("class")||"")})},ATTR:function(a,c,d){return function(e){var f=b.attr(e,a);return null==f?"!="===c:c?(f+="","="===c?f===d:"!="===c?f!==d:"^="===c?d&&0===f.indexOf(d):"*="===c?d&&f.indexOf(d)>-1:"$="===c?d&&f.slice(-d.length)===d:"~="===c?(" "+f+" ").indexOf(d)>-1:"|="===c?f===d||f.slice(0,d.length+1)===d+"-":!1):!0}},CHILD:function(a,b,c,d,e){var f="nth"!==a.slice(0,3),g="last"!==a.slice(-4),h="of-type"===b;return 1===d&&0===e?function(a){return!!a.parentNode}:function(b,c,i){var j,k,l,m,n,o,p=f!==g?"nextSibling":"previousSibling",q=b.parentNode,r=h&&b.nodeName.toLowerCase(),s=!i&&!h;if(q){if(f){for(;p;){for(l=b;l=l[p];)if(h?l.nodeName.toLowerCase()===r:1===l.nodeType)return!1;o=p="only"===a&&!o&&"nextSibling"}return!0}if(o=[g?q.firstChild:q.lastChild],g&&s){for(k=q[N]||(q[N]={}),j=k[a]||[],n=j[0]===P&&j[1],m=j[0]===P&&j[2],l=n&&q.childNodes[n];l=++n&&l&&l[p]||(m=n=0)||o.pop();)if(1===l.nodeType&&++m&&l===b){k[a]=[P,n,m];break}}else if(s&&(j=(b[N]||(b[N]={}))[a])&&j[0]===P)m=j[1];else for(;(l=++n&&l&&l[p]||(m=n=0)||o.pop())&&((h?l.nodeName.toLowerCase()!==r:1!==l.nodeType)||!++m||(s&&((l[N]||(l[N]={}))[a]=[P,m]),l!==b)););return m-=e,m===d||m%d===0&&m/d>=0}}},PSEUDO:function(a,c){var e,f=y.pseudos[a]||y.setFilters[a.toLowerCase()]||b.error("unsupported pseudo: "+a);return f[N]?f(c):f.length>1?(e=[a,a,"",c],y.setFilters.hasOwnProperty(a.toLowerCase())?d(function(a,b){for(var d,e=f(a,c),g=e.length;g--;)d=bb.call(a,e[g]),a[d]=!(b[d]=e[g])}):function(a){return f(a,0,e)}):f}},pseudos:{not:d(function(a){var b=[],c=[],e=B(a.replace(ib,"$1"));return e[N]?d(function(a,b,c,d){for(var f,g=e(a,null,d,[]),h=a.length;h--;)(f=g[h])&&(a[h]=!(b[h]=f))}):function(a,d,f){return b[0]=a,e(b,null,f,c),!c.pop()}}),has:d(function(a){return function(c){return b(a,c).length>0}}),contains:d(function(a){return function(b){return(b.textContent||b.innerText||z(b)).indexOf(a)>-1}}),lang:d(function(a){return nb.test(a||"")||b.error("unsupported lang: "+a),a=a.replace(vb,wb).toLowerCase(),function(b){var c;do if(c=I?b.lang:b.getAttribute("xml:lang")||b.getAttribute("lang"))return c=c.toLowerCase(),c===a||0===c.indexOf(a+"-");while((b=b.parentNode)&&1===b.nodeType);return!1}}),target:function(b){var c=a.location&&a.location.hash;return c&&c.slice(1)===b.id},root:function(a){return a===H},focus:function(a){return a===G.activeElement&&(!G.hasFocus||G.hasFocus())&&!!(a.type||a.href||~a.tabIndex)},enabled:function(a){return a.disabled===!1},disabled:function(a){return a.disabled===!0},checked:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&!!a.checked||"option"===b&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},empty:function(a){for(a=a.firstChild;a;a=a.nextSibling)if(a.nodeType<6)return!1;return!0},parent:function(a){return!y.pseudos.empty(a)},header:function(a){return qb.test(a.nodeName)},input:function(a){return pb.test(a.nodeName)},button:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&"button"===a.type||"button"===b},text:function(a){var b;return"input"===a.nodeName.toLowerCase()&&"text"===a.type&&(null==(b=a.getAttribute("type"))||"text"===b.toLowerCase())},first:j(function(){return[0]}),last:j(function(a,b){return[b-1]}),eq:j(function(a,b,c){return[0>c?c+b:c]}),even:j(function(a,b){for(var c=0;b>c;c+=2)a.push(c);return a}),odd:j(function(a,b){for(var c=1;b>c;c+=2)a.push(c);return a}),lt:j(function(a,b,c){for(var d=0>c?c+b:c;--d>=0;)a.push(d);return a}),gt:j(function(a,b,c){for(var d=0>c?c+b:c;++d<b;)a.push(d);return a})}},y.pseudos.nth=y.pseudos.eq;for(w in{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})y.pseudos[w]=h(w);for(w in{submit:!0,reset:!0})y.pseudos[w]=i(w);return l.prototype=y.filters=y.pseudos,y.setFilters=new l,B=b.compile=function(a,b){var c,d=[],e=[],f=T[a+" "];if(!f){for(b||(b=m(a)),c=b.length;c--;)f=s(b[c]),f[N]?d.push(f):e.push(f);f=T(a,t(e,d))}return f},x.sortStable=N.split("").sort(U).join("")===N,x.detectDuplicates=!!E,F(),x.sortDetached=e(function(a){return 1&a.compareDocumentPosition(G.createElement("div"))}),e(function(a){return a.innerHTML="<a href='#'></a>","#"===a.firstChild.getAttribute("href")})||f("type|href|height|width",function(a,b,c){return c?void 0:a.getAttribute(b,"type"===b.toLowerCase()?1:2)}),x.attributes&&e(function(a){return a.innerHTML="<input/>",a.firstChild.setAttribute("value",""),""===a.firstChild.getAttribute("value")})||f("value",function(a,b,c){return c||"input"!==a.nodeName.toLowerCase()?void 0:a.defaultValue}),e(function(a){return null==a.getAttribute("disabled")})||f(cb,function(a,b,c){var d;return c?void 0:a[b]===!0?b.toLowerCase():(d=a.getAttributeNode(b))&&d.specified?d.value:null}),b}(a);ab.find=eb,ab.expr=eb.selectors,ab.expr[":"]=ab.expr.pseudos,ab.unique=eb.uniqueSort,ab.text=eb.getText,ab.isXMLDoc=eb.isXML,ab.contains=eb.contains;var fb=ab.expr.match.needsContext,gb=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,hb=/^.[^:#\[\.,]*$/;ab.filter=function(a,b,c){var d=b[0];return c&&(a=":not("+a+")"),1===b.length&&1===d.nodeType?ab.find.matchesSelector(d,a)?[d]:[]:ab.find.matches(a,ab.grep(b,function(a){return 1===a.nodeType}))},ab.fn.extend({find:function(a){var b,c=this.length,d=[],e=this;if("string"!=typeof a)return this.pushStack(ab(a).filter(function(){for(b=0;c>b;b++)if(ab.contains(e[b],this))return!0}));for(b=0;c>b;b++)ab.find(a,e[b],d);return d=this.pushStack(c>1?ab.unique(d):d),d.selector=this.selector?this.selector+" "+a:a,d},filter:function(a){return this.pushStack(d(this,a||[],!1))},not:function(a){return this.pushStack(d(this,a||[],!0))},is:function(a){return!!d(this,"string"==typeof a&&fb.test(a)?ab(a):a||[],!1).length}});var ib,jb=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,kb=ab.fn.init=function(a,b){var c,d;if(!a)return this;if("string"==typeof a){if(c="<"===a[0]&&">"===a[a.length-1]&&a.length>=3?[null,a,null]:jb.exec(a),!c||!c[1]&&b)return!b||b.jquery?(b||ib).find(a):this.constructor(b).find(a);if(c[1]){if(b=b instanceof ab?b[0]:b,ab.merge(this,ab.parseHTML(c[1],b&&b.nodeType?b.ownerDocument||b:$,!0)),gb.test(c[1])&&ab.isPlainObject(b))for(c in b)ab.isFunction(this[c])?this[c](b[c]):this.attr(c,b[c]);return this}return d=$.getElementById(c[2]),d&&d.parentNode&&(this.length=1,this[0]=d),this.context=$,this.selector=a,this}return a.nodeType?(this.context=this[0]=a,this.length=1,this):ab.isFunction(a)?"undefined"!=typeof ib.ready?ib.ready(a):a(ab):(void 0!==a.selector&&(this.selector=a.selector,this.context=a.context),ab.makeArray(a,this))};kb.prototype=ab.fn,ib=ab($);var lb=/^(?:parents|prev(?:Until|All))/,mb={children:!0,contents:!0,next:!0,prev:!0};ab.extend({dir:function(a,b,c){for(var d=[],e=void 0!==c;(a=a[b])&&9!==a.nodeType;)if(1===a.nodeType){if(e&&ab(a).is(c))break;d.push(a)}return d},sibling:function(a,b){for(var c=[];a;a=a.nextSibling)1===a.nodeType&&a!==b&&c.push(a);return c}}),ab.fn.extend({has:function(a){var b=ab(a,this),c=b.length;return this.filter(function(){for(var a=0;c>a;a++)if(ab.contains(this,b[a]))return!0})},closest:function(a,b){for(var c,d=0,e=this.length,f=[],g=fb.test(a)||"string"!=typeof a?ab(a,b||this.context):0;e>d;d++)for(c=this[d];c&&c!==b;c=c.parentNode)if(c.nodeType<11&&(g?g.index(c)>-1:1===c.nodeType&&ab.find.matchesSelector(c,a))){f.push(c);break}return this.pushStack(f.length>1?ab.unique(f):f)},index:function(a){return a?"string"==typeof a?U.call(ab(a),this[0]):U.call(this,a.jquery?a[0]:a):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(a,b){return this.pushStack(ab.unique(ab.merge(this.get(),ab(a,b))))},addBack:function(a){return this.add(null==a?this.prevObject:this.prevObject.filter(a))}}),ab.each({parent:function(a){var b=a.parentNode;return b&&11!==b.nodeType?b:null},parents:function(a){return ab.dir(a,"parentNode")},parentsUntil:function(a,b,c){return ab.dir(a,"parentNode",c)},next:function(a){return e(a,"nextSibling")},prev:function(a){return e(a,"previousSibling")},nextAll:function(a){return ab.dir(a,"nextSibling")},prevAll:function(a){return ab.dir(a,"previousSibling")},nextUntil:function(a,b,c){return ab.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return ab.dir(a,"previousSibling",c)},siblings:function(a){return ab.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return ab.sibling(a.firstChild)},contents:function(a){return a.contentDocument||ab.merge([],a.childNodes)}},function(a,b){ab.fn[a]=function(c,d){var e=ab.map(this,b,c);return"Until"!==a.slice(-5)&&(d=c),d&&"string"==typeof d&&(e=ab.filter(d,e)),this.length>1&&(mb[a]||ab.unique(e),lb.test(a)&&e.reverse()),this.pushStack(e)}});var nb=/\S+/g,ob={};ab.Callbacks=function(a){a="string"==typeof a?ob[a]||f(a):ab.extend({},a);var b,c,d,e,g,h,i=[],j=!a.once&&[],k=function(f){for(b=a.memory&&f,c=!0,h=e||0,e=0,g=i.length,d=!0;i&&g>h;h++)if(i[h].apply(f[0],f[1])===!1&&a.stopOnFalse){b=!1;break}d=!1,i&&(j?j.length&&k(j.shift()):b?i=[]:l.disable())},l={add:function(){if(i){var c=i.length;!function f(b){ab.each(b,function(b,c){var d=ab.type(c);"function"===d?a.unique&&l.has(c)||i.push(c):c&&c.length&&"string"!==d&&f(c)})}(arguments),d?g=i.length:b&&(e=c,k(b))}return this},remove:function(){return i&&ab.each(arguments,function(a,b){for(var c;(c=ab.inArray(b,i,c))>-1;)i.splice(c,1),d&&(g>=c&&g--,h>=c&&h--)}),this},has:function(a){return a?ab.inArray(a,i)>-1:!(!i||!i.length)},empty:function(){return i=[],g=0,this},disable:function(){return i=j=b=void 0,this},disabled:function(){return!i},lock:function(){return j=void 0,b||l.disable(),this},locked:function(){return!j},fireWith:function(a,b){return!i||c&&!j||(b=b||[],b=[a,b.slice?b.slice():b],d?j.push(b):k(b)),this},fire:function(){return l.fireWith(this,arguments),this},fired:function(){return!!c}};return l},ab.extend({Deferred:function(a){var b=[["resolve","done",ab.Callbacks("once memory"),"resolved"],["reject","fail",ab.Callbacks("once memory"),"rejected"],["notify","progress",ab.Callbacks("memory")]],c="pending",d={state:function(){return c},always:function(){return e.done(arguments).fail(arguments),this},then:function(){var a=arguments;return ab.Deferred(function(c){ab.each(b,function(b,f){var g=ab.isFunction(a[b])&&a[b];e[f[1]](function(){var a=g&&g.apply(this,arguments);a&&ab.isFunction(a.promise)?a.promise().done(c.resolve).fail(c.reject).progress(c.notify):c[f[0]+"With"](this===d?c.promise():this,g?[a]:arguments)})}),a=null}).promise()},promise:function(a){return null!=a?ab.extend(a,d):d}},e={};return d.pipe=d.then,ab.each(b,function(a,f){var g=f[2],h=f[3];d[f[1]]=g.add,h&&g.add(function(){c=h},b[1^a][2].disable,b[2][2].lock),e[f[0]]=function(){return e[f[0]+"With"](this===e?d:this,arguments),this},e[f[0]+"With"]=g.fireWith}),d.promise(e),a&&a.call(e,e),e},when:function(a){var b,c,d,e=0,f=R.call(arguments),g=f.length,h=1!==g||a&&ab.isFunction(a.promise)?g:0,i=1===h?a:ab.Deferred(),j=function(a,c,d){return function(e){c[a]=this,d[a]=arguments.length>1?R.call(arguments):e,d===b?i.notifyWith(c,d):--h||i.resolveWith(c,d)}};if(g>1)for(b=new Array(g),c=new Array(g),d=new Array(g);g>e;e++)f[e]&&ab.isFunction(f[e].promise)?f[e].promise().done(j(e,d,f)).fail(i.reject).progress(j(e,c,b)):--h;return h||i.resolveWith(d,f),i.promise()}});var pb;ab.fn.ready=function(a){return ab.ready.promise().done(a),this},ab.extend({isReady:!1,readyWait:1,holdReady:function(a){a?ab.readyWait++:ab.ready(!0)},ready:function(a){(a===!0?--ab.readyWait:ab.isReady)||(ab.isReady=!0,a!==!0&&--ab.readyWait>0||(pb.resolveWith($,[ab]),ab.fn.trigger&&ab($).trigger("ready").off("ready")))}}),ab.ready.promise=function(b){return pb||(pb=ab.Deferred(),"complete"===$.readyState?setTimeout(ab.ready):($.addEventListener("DOMContentLoaded",g,!1),a.addEventListener("load",g,!1))),pb.promise(b)},ab.ready.promise();var qb=ab.access=function(a,b,c,d,e,f,g){var h=0,i=a.length,j=null==c;if("object"===ab.type(c)){e=!0;for(h in c)ab.access(a,b,h,c[h],!0,f,g)}else if(void 0!==d&&(e=!0,ab.isFunction(d)||(g=!0),j&&(g?(b.call(a,d),b=null):(j=b,b=function(a,b,c){return j.call(ab(a),c)})),b))for(;i>h;h++)b(a[h],c,g?d:d.call(a[h],h,b(a[h],c)));return e?a:j?b.call(a):i?b(a[0],c):f};ab.acceptData=function(a){return 1===a.nodeType||9===a.nodeType||!+a.nodeType},h.uid=1,h.accepts=ab.acceptData,h.prototype={key:function(a){if(!h.accepts(a))return 0;var b={},c=a[this.expando];if(!c){c=h.uid++;try{b[this.expando]={value:c},Object.defineProperties(a,b)}catch(d){b[this.expando]=c,ab.extend(a,b)}}return this.cache[c]||(this.cache[c]={}),c},set:function(a,b,c){var d,e=this.key(a),f=this.cache[e];if("string"==typeof b)f[b]=c;else if(ab.isEmptyObject(f))ab.extend(this.cache[e],b);else for(d in b)f[d]=b[d];return f},get:function(a,b){var c=this.cache[this.key(a)];return void 0===b?c:c[b]},access:function(a,b,c){var d;return void 0===b||b&&"string"==typeof b&&void 0===c?(d=this.get(a,b),void 0!==d?d:this.get(a,ab.camelCase(b))):(this.set(a,b,c),void 0!==c?c:b)},remove:function(a,b){var c,d,e,f=this.key(a),g=this.cache[f];if(void 0===b)this.cache[f]={};else{ab.isArray(b)?d=b.concat(b.map(ab.camelCase)):(e=ab.camelCase(b),b in g?d=[b,e]:(d=e,d=d in g?[d]:d.match(nb)||[])),c=d.length;for(;c--;)delete g[d[c]]}},hasData:function(a){return!ab.isEmptyObject(this.cache[a[this.expando]]||{})},discard:function(a){a[this.expando]&&delete this.cache[a[this.expando]]}};var rb=new h,sb=new h,tb=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,ub=/([A-Z])/g;ab.extend({hasData:function(a){return sb.hasData(a)||rb.hasData(a)},data:function(a,b,c){return sb.access(a,b,c)},removeData:function(a,b){sb.remove(a,b)},_data:function(a,b,c){return rb.access(a,b,c)},_removeData:function(a,b){rb.remove(a,b)}}),ab.fn.extend({data:function(a,b){var c,d,e,f=this[0],g=f&&f.attributes;if(void 0===a){if(this.length&&(e=sb.get(f),1===f.nodeType&&!rb.get(f,"hasDataAttrs"))){for(c=g.length;c--;)d=g[c].name,0===d.indexOf("data-")&&(d=ab.camelCase(d.slice(5)),i(f,d,e[d]));rb.set(f,"hasDataAttrs",!0)}return e}return"object"==typeof a?this.each(function(){sb.set(this,a)}):qb(this,function(b){var c,d=ab.camelCase(a);if(f&&void 0===b){if(c=sb.get(f,a),void 0!==c)return c;if(c=sb.get(f,d),void 0!==c)return c;if(c=i(f,d,void 0),void 0!==c)return c}else this.each(function(){var c=sb.get(this,d);sb.set(this,d,b),-1!==a.indexOf("-")&&void 0!==c&&sb.set(this,a,b)})},null,b,arguments.length>1,null,!0)},removeData:function(a){return this.each(function(){sb.remove(this,a)})}}),ab.extend({queue:function(a,b,c){var d;return a?(b=(b||"fx")+"queue",d=rb.get(a,b),c&&(!d||ab.isArray(c)?d=rb.access(a,b,ab.makeArray(c)):d.push(c)),d||[]):void 0},dequeue:function(a,b){b=b||"fx";var c=ab.queue(a,b),d=c.length,e=c.shift(),f=ab._queueHooks(a,b),g=function(){ab.dequeue(a,b)};"inprogress"===e&&(e=c.shift(),d--),e&&("fx"===b&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return rb.get(a,c)||rb.access(a,c,{empty:ab.Callbacks("once memory").add(function(){rb.remove(a,[b+"queue",c])})})}}),ab.fn.extend({queue:function(a,b){var c=2;return"string"!=typeof a&&(b=a,a="fx",c--),arguments.length<c?ab.queue(this[0],a):void 0===b?this:this.each(function(){var c=ab.queue(this,a,b);ab._queueHooks(this,a),"fx"===a&&"inprogress"!==c[0]&&ab.dequeue(this,a)})},dequeue:function(a){return this.each(function(){ab.dequeue(this,a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,b){var c,d=1,e=ab.Deferred(),f=this,g=this.length,h=function(){--d||e.resolveWith(f,[f])};for("string"!=typeof a&&(b=a,a=void 0),a=a||"fx";g--;)c=rb.get(f[g],a+"queueHooks"),c&&c.empty&&(d++,c.empty.add(h));return h(),e.promise(b)}});var vb=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,wb=["Top","Right","Bottom","Left"],xb=function(a,b){return a=b||a,"none"===ab.css(a,"display")||!ab.contains(a.ownerDocument,a)},yb=/^(?:checkbox|radio)$/i;!function(){var a=$.createDocumentFragment(),b=a.appendChild($.createElement("div"));b.innerHTML="<input type='radio' checked='checked' name='t'/>",Z.checkClone=b.cloneNode(!0).cloneNode(!0).lastChild.checked,b.innerHTML="<textarea>x</textarea>",Z.noCloneChecked=!!b.cloneNode(!0).lastChild.defaultValue}();var zb="undefined";Z.focusinBubbles="onfocusin"in a;var Ab=/^key/,Bb=/^(?:mouse|contextmenu)|click/,Cb=/^(?:focusinfocus|focusoutblur)$/,Db=/^([^.]*)(?:\.(.+)|)$/;ab.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,n,o,p,q=rb.get(a);if(q)for(c.handler&&(f=c,c=f.handler,e=f.selector),c.guid||(c.guid=ab.guid++),(i=q.events)||(i=q.events={}),(g=q.handle)||(g=q.handle=function(b){return typeof ab!==zb&&ab.event.triggered!==b.type?ab.event.dispatch.apply(a,arguments):void 0}),b=(b||"").match(nb)||[""],j=b.length;j--;)h=Db.exec(b[j])||[],n=p=h[1],o=(h[2]||"").split(".").sort(),n&&(l=ab.event.special[n]||{},n=(e?l.delegateType:l.bindType)||n,l=ab.event.special[n]||{},k=ab.extend({type:n,origType:p,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&ab.expr.match.needsContext.test(e),namespace:o.join(".")},f),(m=i[n])||(m=i[n]=[],m.delegateCount=0,l.setup&&l.setup.call(a,d,o,g)!==!1||a.addEventListener&&a.addEventListener(n,g,!1)),l.add&&(l.add.call(a,k),k.handler.guid||(k.handler.guid=c.guid)),e?m.splice(m.delegateCount++,0,k):m.push(k),ab.event.global[n]=!0)},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,n,o,p,q=rb.hasData(a)&&rb.get(a);if(q&&(i=q.events)){for(b=(b||"").match(nb)||[""],j=b.length;j--;)if(h=Db.exec(b[j])||[],n=p=h[1],o=(h[2]||"").split(".").sort(),n){for(l=ab.event.special[n]||{},n=(d?l.delegateType:l.bindType)||n,m=i[n]||[],h=h[2]&&new RegExp("(^|\\.)"+o.join("\\.(?:.*\\.|)")+"(\\.|$)"),g=f=m.length;f--;)k=m[f],!e&&p!==k.origType||c&&c.guid!==k.guid||h&&!h.test(k.namespace)||d&&d!==k.selector&&("**"!==d||!k.selector)||(m.splice(f,1),k.selector&&m.delegateCount--,l.remove&&l.remove.call(a,k));g&&!m.length&&(l.teardown&&l.teardown.call(a,o,q.handle)!==!1||ab.removeEvent(a,n,q.handle),delete i[n])}else for(n in i)ab.event.remove(a,n+b[j],c,d,!0);ab.isEmptyObject(i)&&(delete q.handle,rb.remove(a,"events"))}},trigger:function(b,c,d,e){var f,g,h,i,j,k,l,m=[d||$],n=X.call(b,"type")?b.type:b,o=X.call(b,"namespace")?b.namespace.split("."):[];if(g=h=d=d||$,3!==d.nodeType&&8!==d.nodeType&&!Cb.test(n+ab.event.triggered)&&(n.indexOf(".")>=0&&(o=n.split("."),n=o.shift(),o.sort()),j=n.indexOf(":")<0&&"on"+n,b=b[ab.expando]?b:new ab.Event(n,"object"==typeof b&&b),b.isTrigger=e?2:3,b.namespace=o.join("."),b.namespace_re=b.namespace?new RegExp("(^|\\.)"+o.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,b.result=void 0,b.target||(b.target=d),c=null==c?[b]:ab.makeArray(c,[b]),l=ab.event.special[n]||{},e||!l.trigger||l.trigger.apply(d,c)!==!1)){if(!e&&!l.noBubble&&!ab.isWindow(d)){for(i=l.delegateType||n,Cb.test(i+n)||(g=g.parentNode);g;g=g.parentNode)m.push(g),h=g;
+h===(d.ownerDocument||$)&&m.push(h.defaultView||h.parentWindow||a)}for(f=0;(g=m[f++])&&!b.isPropagationStopped();)b.type=f>1?i:l.bindType||n,k=(rb.get(g,"events")||{})[b.type]&&rb.get(g,"handle"),k&&k.apply(g,c),k=j&&g[j],k&&k.apply&&ab.acceptData(g)&&(b.result=k.apply(g,c),b.result===!1&&b.preventDefault());return b.type=n,e||b.isDefaultPrevented()||l._default&&l._default.apply(m.pop(),c)!==!1||!ab.acceptData(d)||j&&ab.isFunction(d[n])&&!ab.isWindow(d)&&(h=d[j],h&&(d[j]=null),ab.event.triggered=n,d[n](),ab.event.triggered=void 0,h&&(d[j]=h)),b.result}},dispatch:function(a){a=ab.event.fix(a);var b,c,d,e,f,g=[],h=R.call(arguments),i=(rb.get(this,"events")||{})[a.type]||[],j=ab.event.special[a.type]||{};if(h[0]=a,a.delegateTarget=this,!j.preDispatch||j.preDispatch.call(this,a)!==!1){for(g=ab.event.handlers.call(this,a,i),b=0;(e=g[b++])&&!a.isPropagationStopped();)for(a.currentTarget=e.elem,c=0;(f=e.handlers[c++])&&!a.isImmediatePropagationStopped();)(!a.namespace_re||a.namespace_re.test(f.namespace))&&(a.handleObj=f,a.data=f.data,d=((ab.event.special[f.origType]||{}).handle||f.handler).apply(e.elem,h),void 0!==d&&(a.result=d)===!1&&(a.preventDefault(),a.stopPropagation()));return j.postDispatch&&j.postDispatch.call(this,a),a.result}},handlers:function(a,b){var c,d,e,f,g=[],h=b.delegateCount,i=a.target;if(h&&i.nodeType&&(!a.button||"click"!==a.type))for(;i!==this;i=i.parentNode||this)if(i.disabled!==!0||"click"!==a.type){for(d=[],c=0;h>c;c++)f=b[c],e=f.selector+" ",void 0===d[e]&&(d[e]=f.needsContext?ab(e,this).index(i)>=0:ab.find(e,this,null,[i]).length),d[e]&&d.push(f);d.length&&g.push({elem:i,handlers:d})}return h<b.length&&g.push({elem:this,handlers:b.slice(h)}),g},props:"altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){return null==a.which&&(a.which=null!=b.charCode?b.charCode:b.keyCode),a}},mouseHooks:{props:"button buttons clientX clientY offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,b){var c,d,e,f=b.button;return null==a.pageX&&null!=b.clientX&&(c=a.target.ownerDocument||$,d=c.documentElement,e=c.body,a.pageX=b.clientX+(d&&d.scrollLeft||e&&e.scrollLeft||0)-(d&&d.clientLeft||e&&e.clientLeft||0),a.pageY=b.clientY+(d&&d.scrollTop||e&&e.scrollTop||0)-(d&&d.clientTop||e&&e.clientTop||0)),a.which||void 0===f||(a.which=1&f?1:2&f?3:4&f?2:0),a}},fix:function(a){if(a[ab.expando])return a;var b,c,d,e=a.type,f=a,g=this.fixHooks[e];for(g||(this.fixHooks[e]=g=Bb.test(e)?this.mouseHooks:Ab.test(e)?this.keyHooks:{}),d=g.props?this.props.concat(g.props):this.props,a=new ab.Event(f),b=d.length;b--;)c=d[b],a[c]=f[c];return a.target||(a.target=$),3===a.target.nodeType&&(a.target=a.target.parentNode),g.filter?g.filter(a,f):a},special:{load:{noBubble:!0},focus:{trigger:function(){return this!==l()&&this.focus?(this.focus(),!1):void 0},delegateType:"focusin"},blur:{trigger:function(){return this===l()&&this.blur?(this.blur(),!1):void 0},delegateType:"focusout"},click:{trigger:function(){return"checkbox"===this.type&&this.click&&ab.nodeName(this,"input")?(this.click(),!1):void 0},_default:function(a){return ab.nodeName(a.target,"a")}},beforeunload:{postDispatch:function(a){void 0!==a.result&&(a.originalEvent.returnValue=a.result)}}},simulate:function(a,b,c,d){var e=ab.extend(new ab.Event,c,{type:a,isSimulated:!0,originalEvent:{}});d?ab.event.trigger(e,null,b):ab.event.dispatch.call(b,e),e.isDefaultPrevented()&&c.preventDefault()}},ab.removeEvent=function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c,!1)},ab.Event=function(a,b){return this instanceof ab.Event?(a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||void 0===a.defaultPrevented&&a.getPreventDefault&&a.getPreventDefault()?j:k):this.type=a,b&&ab.extend(this,b),this.timeStamp=a&&a.timeStamp||ab.now(),void(this[ab.expando]=!0)):new ab.Event(a,b)},ab.Event.prototype={isDefaultPrevented:k,isPropagationStopped:k,isImmediatePropagationStopped:k,preventDefault:function(){var a=this.originalEvent;this.isDefaultPrevented=j,a&&a.preventDefault&&a.preventDefault()},stopPropagation:function(){var a=this.originalEvent;this.isPropagationStopped=j,a&&a.stopPropagation&&a.stopPropagation()},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=j,this.stopPropagation()}},ab.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){ab.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c,d=this,e=a.relatedTarget,f=a.handleObj;return(!e||e!==d&&!ab.contains(d,e))&&(a.type=f.origType,c=f.handler.apply(this,arguments),a.type=b),c}}}),Z.focusinBubbles||ab.each({focus:"focusin",blur:"focusout"},function(a,b){var c=function(a){ab.event.simulate(b,a.target,ab.event.fix(a),!0)};ab.event.special[b]={setup:function(){var d=this.ownerDocument||this,e=rb.access(d,b);e||d.addEventListener(a,c,!0),rb.access(d,b,(e||0)+1)},teardown:function(){var d=this.ownerDocument||this,e=rb.access(d,b)-1;e?rb.access(d,b,e):(d.removeEventListener(a,c,!0),rb.remove(d,b))}}}),ab.fn.extend({on:function(a,b,c,d,e){var f,g;if("object"==typeof a){"string"!=typeof b&&(c=c||b,b=void 0);for(g in a)this.on(g,b,c,a[g],e);return this}if(null==c&&null==d?(d=b,c=b=void 0):null==d&&("string"==typeof b?(d=c,c=void 0):(d=c,c=b,b=void 0)),d===!1)d=k;else if(!d)return this;return 1===e&&(f=d,d=function(a){return ab().off(a),f.apply(this,arguments)},d.guid=f.guid||(f.guid=ab.guid++)),this.each(function(){ab.event.add(this,a,d,c,b)})},one:function(a,b,c,d){return this.on(a,b,c,d,1)},off:function(a,b,c){var d,e;if(a&&a.preventDefault&&a.handleObj)return d=a.handleObj,ab(a.delegateTarget).off(d.namespace?d.origType+"."+d.namespace:d.origType,d.selector,d.handler),this;if("object"==typeof a){for(e in a)this.off(e,b,a[e]);return this}return(b===!1||"function"==typeof b)&&(c=b,b=void 0),c===!1&&(c=k),this.each(function(){ab.event.remove(this,a,c,b)})},trigger:function(a,b){return this.each(function(){ab.event.trigger(a,b,this)})},triggerHandler:function(a,b){var c=this[0];return c?ab.event.trigger(a,b,c,!0):void 0}});var Eb=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,Fb=/<([\w:]+)/,Gb=/<|&#?\w+;/,Hb=/<(?:script|style|link)/i,Ib=/checked\s*(?:[^=]|=\s*.checked.)/i,Jb=/^$|\/(?:java|ecma)script/i,Kb=/^true\/(.*)/,Lb=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,Mb={option:[1,"<select multiple='multiple'>","</select>"],thead:[1,"<table>","</table>"],col:[2,"<table><colgroup>","</colgroup></table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:[0,"",""]};Mb.optgroup=Mb.option,Mb.tbody=Mb.tfoot=Mb.colgroup=Mb.caption=Mb.thead,Mb.th=Mb.td,ab.extend({clone:function(a,b,c){var d,e,f,g,h=a.cloneNode(!0),i=ab.contains(a.ownerDocument,a);if(!(Z.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||ab.isXMLDoc(a)))for(g=r(h),f=r(a),d=0,e=f.length;e>d;d++)s(f[d],g[d]);if(b)if(c)for(f=f||r(a),g=g||r(h),d=0,e=f.length;e>d;d++)q(f[d],g[d]);else q(a,h);return g=r(h,"script"),g.length>0&&p(g,!i&&r(a,"script")),h},buildFragment:function(a,b,c,d){for(var e,f,g,h,i,j,k=b.createDocumentFragment(),l=[],m=0,n=a.length;n>m;m++)if(e=a[m],e||0===e)if("object"===ab.type(e))ab.merge(l,e.nodeType?[e]:e);else if(Gb.test(e)){for(f=f||k.appendChild(b.createElement("div")),g=(Fb.exec(e)||["",""])[1].toLowerCase(),h=Mb[g]||Mb._default,f.innerHTML=h[1]+e.replace(Eb,"<$1></$2>")+h[2],j=h[0];j--;)f=f.lastChild;ab.merge(l,f.childNodes),f=k.firstChild,f.textContent=""}else l.push(b.createTextNode(e));for(k.textContent="",m=0;e=l[m++];)if((!d||-1===ab.inArray(e,d))&&(i=ab.contains(e.ownerDocument,e),f=r(k.appendChild(e),"script"),i&&p(f),c))for(j=0;e=f[j++];)Jb.test(e.type||"")&&c.push(e);return k},cleanData:function(a){for(var b,c,d,e,f,g,h=ab.event.special,i=0;void 0!==(c=a[i]);i++){if(ab.acceptData(c)&&(f=c[rb.expando],f&&(b=rb.cache[f]))){if(d=Object.keys(b.events||{}),d.length)for(g=0;void 0!==(e=d[g]);g++)h[e]?ab.event.remove(c,e):ab.removeEvent(c,e,b.handle);rb.cache[f]&&delete rb.cache[f]}delete sb.cache[c[sb.expando]]}}}),ab.fn.extend({text:function(a){return qb(this,function(a){return void 0===a?ab.text(this):this.empty().each(function(){(1===this.nodeType||11===this.nodeType||9===this.nodeType)&&(this.textContent=a)})},null,a,arguments.length)},append:function(){return this.domManip(arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=m(this,a);b.appendChild(a)}})},prepend:function(){return this.domManip(arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=m(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return this.domManip(arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return this.domManip(arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},remove:function(a,b){for(var c,d=a?ab.filter(a,this):this,e=0;null!=(c=d[e]);e++)b||1!==c.nodeType||ab.cleanData(r(c)),c.parentNode&&(b&&ab.contains(c.ownerDocument,c)&&p(r(c,"script")),c.parentNode.removeChild(c));return this},empty:function(){for(var a,b=0;null!=(a=this[b]);b++)1===a.nodeType&&(ab.cleanData(r(a,!1)),a.textContent="");return this},clone:function(a,b){return a=null==a?!1:a,b=null==b?a:b,this.map(function(){return ab.clone(this,a,b)})},html:function(a){return qb(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a&&1===b.nodeType)return b.innerHTML;if("string"==typeof a&&!Hb.test(a)&&!Mb[(Fb.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Eb,"<$1></$2>");try{for(;d>c;c++)b=this[c]||{},1===b.nodeType&&(ab.cleanData(r(b,!1)),b.innerHTML=a);b=0}catch(e){}}b&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(){var a=arguments[0];return this.domManip(arguments,function(b){a=this.parentNode,ab.cleanData(r(this)),a&&a.replaceChild(b,this)}),a&&(a.length||a.nodeType)?this:this.remove()},detach:function(a){return this.remove(a,!0)},domManip:function(a,b){a=S.apply([],a);var c,d,e,f,g,h,i=0,j=this.length,k=this,l=j-1,m=a[0],p=ab.isFunction(m);if(p||j>1&&"string"==typeof m&&!Z.checkClone&&Ib.test(m))return this.each(function(c){var d=k.eq(c);p&&(a[0]=m.call(this,c,d.html())),d.domManip(a,b)});if(j&&(c=ab.buildFragment(a,this[0].ownerDocument,!1,this),d=c.firstChild,1===c.childNodes.length&&(c=d),d)){for(e=ab.map(r(c,"script"),n),f=e.length;j>i;i++)g=c,i!==l&&(g=ab.clone(g,!0,!0),f&&ab.merge(e,r(g,"script"))),b.call(this[i],g,i);if(f)for(h=e[e.length-1].ownerDocument,ab.map(e,o),i=0;f>i;i++)g=e[i],Jb.test(g.type||"")&&!rb.access(g,"globalEval")&&ab.contains(h,g)&&(g.src?ab._evalUrl&&ab._evalUrl(g.src):ab.globalEval(g.textContent.replace(Lb,"")))}return this}}),ab.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){ab.fn[a]=function(a){for(var c,d=[],e=ab(a),f=e.length-1,g=0;f>=g;g++)c=g===f?this:this.clone(!0),ab(e[g])[b](c),T.apply(d,c.get());return this.pushStack(d)}});var Nb,Ob={},Pb=/^margin/,Qb=new RegExp("^("+vb+")(?!px)[a-z%]+$","i"),Rb=function(a){return a.ownerDocument.defaultView.getComputedStyle(a,null)};!function(){function b(){h.style.cssText="-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%",f.appendChild(g);var b=a.getComputedStyle(h,null);c="1%"!==b.top,d="4px"===b.width,f.removeChild(g)}var c,d,e="padding:0;margin:0;border:0;display:block;-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box",f=$.documentElement,g=$.createElement("div"),h=$.createElement("div");h.style.backgroundClip="content-box",h.cloneNode(!0).style.backgroundClip="",Z.clearCloneStyle="content-box"===h.style.backgroundClip,g.style.cssText="border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px",g.appendChild(h),a.getComputedStyle&&ab.extend(Z,{pixelPosition:function(){return b(),c},boxSizingReliable:function(){return null==d&&b(),d},reliableMarginRight:function(){var b,c=h.appendChild($.createElement("div"));return c.style.cssText=h.style.cssText=e,c.style.marginRight=c.style.width="0",h.style.width="1px",f.appendChild(g),b=!parseFloat(a.getComputedStyle(c,null).marginRight),f.removeChild(g),h.innerHTML="",b}})}(),ab.swap=function(a,b,c,d){var e,f,g={};for(f in b)g[f]=a.style[f],a.style[f]=b[f];e=c.apply(a,d||[]);for(f in b)a.style[f]=g[f];return e};var Sb=/^(none|table(?!-c[ea]).+)/,Tb=new RegExp("^("+vb+")(.*)$","i"),Ub=new RegExp("^([+-])=("+vb+")","i"),Vb={position:"absolute",visibility:"hidden",display:"block"},Wb={letterSpacing:0,fontWeight:400},Xb=["Webkit","O","Moz","ms"];ab.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=v(a,"opacity");return""===c?"1":c}}}},cssNumber:{columnCount:!0,fillOpacity:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":"cssFloat"},style:function(a,b,c,d){if(a&&3!==a.nodeType&&8!==a.nodeType&&a.style){var e,f,g,h=ab.camelCase(b),i=a.style;return b=ab.cssProps[h]||(ab.cssProps[h]=x(i,h)),g=ab.cssHooks[b]||ab.cssHooks[h],void 0===c?g&&"get"in g&&void 0!==(e=g.get(a,!1,d))?e:i[b]:(f=typeof c,"string"===f&&(e=Ub.exec(c))&&(c=(e[1]+1)*e[2]+parseFloat(ab.css(a,b)),f="number"),null!=c&&c===c&&("number"!==f||ab.cssNumber[h]||(c+="px"),Z.clearCloneStyle||""!==c||0!==b.indexOf("background")||(i[b]="inherit"),g&&"set"in g&&void 0===(c=g.set(a,c,d))||(i[b]="",i[b]=c)),void 0)}},css:function(a,b,c,d){var e,f,g,h=ab.camelCase(b);return b=ab.cssProps[h]||(ab.cssProps[h]=x(a.style,h)),g=ab.cssHooks[b]||ab.cssHooks[h],g&&"get"in g&&(e=g.get(a,!0,c)),void 0===e&&(e=v(a,b,d)),"normal"===e&&b in Wb&&(e=Wb[b]),""===c||c?(f=parseFloat(e),c===!0||ab.isNumeric(f)?f||0:e):e}}),ab.each(["height","width"],function(a,b){ab.cssHooks[b]={get:function(a,c,d){return c?0===a.offsetWidth&&Sb.test(ab.css(a,"display"))?ab.swap(a,Vb,function(){return A(a,b,d)}):A(a,b,d):void 0},set:function(a,c,d){var e=d&&Rb(a);return y(a,c,d?z(a,b,d,"border-box"===ab.css(a,"boxSizing",!1,e),e):0)}}}),ab.cssHooks.marginRight=w(Z.reliableMarginRight,function(a,b){return b?ab.swap(a,{display:"inline-block"},v,[a,"marginRight"]):void 0}),ab.each({margin:"",padding:"",border:"Width"},function(a,b){ab.cssHooks[a+b]={expand:function(c){for(var d=0,e={},f="string"==typeof c?c.split(" "):[c];4>d;d++)e[a+wb[d]+b]=f[d]||f[d-2]||f[0];return e}},Pb.test(a)||(ab.cssHooks[a+b].set=y)}),ab.fn.extend({css:function(a,b){return qb(this,function(a,b,c){var d,e,f={},g=0;if(ab.isArray(b)){for(d=Rb(a),e=b.length;e>g;g++)f[b[g]]=ab.css(a,b[g],!1,d);return f}return void 0!==c?ab.style(a,b,c):ab.css(a,b)},a,b,arguments.length>1)},show:function(){return B(this,!0)},hide:function(){return B(this)},toggle:function(a){return"boolean"==typeof a?a?this.show():this.hide():this.each(function(){xb(this)?ab(this).show():ab(this).hide()})}}),ab.Tween=C,C.prototype={constructor:C,init:function(a,b,c,d,e,f){this.elem=a,this.prop=c,this.easing=e||"swing",this.options=b,this.start=this.now=this.cur(),this.end=d,this.unit=f||(ab.cssNumber[c]?"":"px")},cur:function(){var a=C.propHooks[this.prop];return a&&a.get?a.get(this):C.propHooks._default.get(this)},run:function(a){var b,c=C.propHooks[this.prop];return this.pos=b=this.options.duration?ab.easing[this.easing](a,this.options.duration*a,0,1,this.options.duration):a,this.now=(this.end-this.start)*b+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),c&&c.set?c.set(this):C.propHooks._default.set(this),this}},C.prototype.init.prototype=C.prototype,C.propHooks={_default:{get:function(a){var b;return null==a.elem[a.prop]||a.elem.style&&null!=a.elem.style[a.prop]?(b=ab.css(a.elem,a.prop,""),b&&"auto"!==b?b:0):a.elem[a.prop]},set:function(a){ab.fx.step[a.prop]?ab.fx.step[a.prop](a):a.elem.style&&(null!=a.elem.style[ab.cssProps[a.prop]]||ab.cssHooks[a.prop])?ab.style(a.elem,a.prop,a.now+a.unit):a.elem[a.prop]=a.now}}},C.propHooks.scrollTop=C.propHooks.scrollLeft={set:function(a){a.elem.nodeType&&a.elem.parentNode&&(a.elem[a.prop]=a.now)}},ab.easing={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2}},ab.fx=C.prototype.init,ab.fx.step={};var Yb,Zb,$b=/^(?:toggle|show|hide)$/,_b=new RegExp("^(?:([+-])=|)("+vb+")([a-z%]*)$","i"),ac=/queueHooks$/,bc=[G],cc={"*":[function(a,b){var c=this.createTween(a,b),d=c.cur(),e=_b.exec(b),f=e&&e[3]||(ab.cssNumber[a]?"":"px"),g=(ab.cssNumber[a]||"px"!==f&&+d)&&_b.exec(ab.css(c.elem,a)),h=1,i=20;if(g&&g[3]!==f){f=f||g[3],e=e||[],g=+d||1;do h=h||".5",g/=h,ab.style(c.elem,a,g+f);while(h!==(h=c.cur()/d)&&1!==h&&--i)}return e&&(g=c.start=+g||+d||0,c.unit=f,c.end=e[1]?g+(e[1]+1)*e[2]:+e[2]),c}]};ab.Animation=ab.extend(I,{tweener:function(a,b){ab.isFunction(a)?(b=a,a=["*"]):a=a.split(" ");for(var c,d=0,e=a.length;e>d;d++)c=a[d],cc[c]=cc[c]||[],cc[c].unshift(b)},prefilter:function(a,b){b?bc.unshift(a):bc.push(a)}}),ab.speed=function(a,b,c){var d=a&&"object"==typeof a?ab.extend({},a):{complete:c||!c&&b||ab.isFunction(a)&&a,duration:a,easing:c&&b||b&&!ab.isFunction(b)&&b};return d.duration=ab.fx.off?0:"number"==typeof d.duration?d.duration:d.duration in ab.fx.speeds?ab.fx.speeds[d.duration]:ab.fx.speeds._default,(null==d.queue||d.queue===!0)&&(d.queue="fx"),d.old=d.complete,d.complete=function(){ab.isFunction(d.old)&&d.old.call(this),d.queue&&ab.dequeue(this,d.queue)},d},ab.fn.extend({fadeTo:function(a,b,c,d){return this.filter(xb).css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=ab.isEmptyObject(a),f=ab.speed(b,c,d),g=function(){var b=I(this,ab.extend({},a),f);(e||rb.get(this,"finish"))&&b.stop(!0)};return g.finish=g,e||f.queue===!1?this.each(g):this.queue(f.queue,g)},stop:function(a,b,c){var d=function(a){var b=a.stop;delete a.stop,b(c)};return"string"!=typeof a&&(c=b,b=a,a=void 0),b&&a!==!1&&this.queue(a||"fx",[]),this.each(function(){var b=!0,e=null!=a&&a+"queueHooks",f=ab.timers,g=rb.get(this);if(e)g[e]&&g[e].stop&&d(g[e]);else for(e in g)g[e]&&g[e].stop&&ac.test(e)&&d(g[e]);for(e=f.length;e--;)f[e].elem!==this||null!=a&&f[e].queue!==a||(f[e].anim.stop(c),b=!1,f.splice(e,1));(b||!c)&&ab.dequeue(this,a)})},finish:function(a){return a!==!1&&(a=a||"fx"),this.each(function(){var b,c=rb.get(this),d=c[a+"queue"],e=c[a+"queueHooks"],f=ab.timers,g=d?d.length:0;for(c.finish=!0,ab.queue(this,a,[]),e&&e.stop&&e.stop.call(this,!0),b=f.length;b--;)f[b].elem===this&&f[b].queue===a&&(f[b].anim.stop(!0),f.splice(b,1));for(b=0;g>b;b++)d[b]&&d[b].finish&&d[b].finish.call(this);delete c.finish})}}),ab.each(["toggle","show","hide"],function(a,b){var c=ab.fn[b];ab.fn[b]=function(a,d,e){return null==a||"boolean"==typeof a?c.apply(this,arguments):this.animate(E(b,!0),a,d,e)}}),ab.each({slideDown:E("show"),slideUp:E("hide"),slideToggle:E("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){ab.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),ab.timers=[],ab.fx.tick=function(){var a,b=0,c=ab.timers;for(Yb=ab.now();b<c.length;b++)a=c[b],a()||c[b]!==a||c.splice(b--,1);c.length||ab.fx.stop(),Yb=void 0},ab.fx.timer=function(a){ab.timers.push(a),a()?ab.fx.start():ab.timers.pop()},ab.fx.interval=13,ab.fx.start=function(){Zb||(Zb=setInterval(ab.fx.tick,ab.fx.interval))},ab.fx.stop=function(){clearInterval(Zb),Zb=null},ab.fx.speeds={slow:600,fast:200,_default:400},ab.fn.delay=function(a,b){return a=ab.fx?ab.fx.speeds[a]||a:a,b=b||"fx",this.queue(b,function(b,c){var d=setTimeout(b,a);c.stop=function(){clearTimeout(d)}})},function(){var a=$.createElement("input"),b=$.createElement("select"),c=b.appendChild($.createElement("option"));a.type="checkbox",Z.checkOn=""!==a.value,Z.optSelected=c.selected,b.disabled=!0,Z.optDisabled=!c.disabled,a=$.createElement("input"),a.value="t",a.type="radio",Z.radioValue="t"===a.value}();var dc,ec,fc=ab.expr.attrHandle;ab.fn.extend({attr:function(a,b){return qb(this,ab.attr,a,b,arguments.length>1)},removeAttr:function(a){return this.each(function(){ab.removeAttr(this,a)})}}),ab.extend({attr:function(a,b,c){var d,e,f=a.nodeType;if(a&&3!==f&&8!==f&&2!==f)return typeof a.getAttribute===zb?ab.prop(a,b,c):(1===f&&ab.isXMLDoc(a)||(b=b.toLowerCase(),d=ab.attrHooks[b]||(ab.expr.match.bool.test(b)?ec:dc)),void 0===c?d&&"get"in d&&null!==(e=d.get(a,b))?e:(e=ab.find.attr(a,b),null==e?void 0:e):null!==c?d&&"set"in d&&void 0!==(e=d.set(a,c,b))?e:(a.setAttribute(b,c+""),c):void ab.removeAttr(a,b))},removeAttr:function(a,b){var c,d,e=0,f=b&&b.match(nb);if(f&&1===a.nodeType)for(;c=f[e++];)d=ab.propFix[c]||c,ab.expr.match.bool.test(c)&&(a[d]=!1),a.removeAttribute(c)},attrHooks:{type:{set:function(a,b){if(!Z.radioValue&&"radio"===b&&ab.nodeName(a,"input")){var c=a.value;return a.setAttribute("type",b),c&&(a.value=c),b}}}}}),ec={set:function(a,b,c){return b===!1?ab.removeAttr(a,c):a.setAttribute(c,c),c}},ab.each(ab.expr.match.bool.source.match(/\w+/g),function(a,b){var c=fc[b]||ab.find.attr;fc[b]=function(a,b,d){var e,f;return d||(f=fc[b],fc[b]=e,e=null!=c(a,b,d)?b.toLowerCase():null,fc[b]=f),e}});var gc=/^(?:input|select|textarea|button)$/i;ab.fn.extend({prop:function(a,b){return qb(this,ab.prop,a,b,arguments.length>1)},removeProp:function(a){return this.each(function(){delete this[ab.propFix[a]||a]})}}),ab.extend({propFix:{"for":"htmlFor","class":"className"},prop:function(a,b,c){var d,e,f,g=a.nodeType;if(a&&3!==g&&8!==g&&2!==g)return f=1!==g||!ab.isXMLDoc(a),f&&(b=ab.propFix[b]||b,e=ab.propHooks[b]),void 0!==c?e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:a[b]=c:e&&"get"in e&&null!==(d=e.get(a,b))?d:a[b]},propHooks:{tabIndex:{get:function(a){return a.hasAttribute("tabindex")||gc.test(a.nodeName)||a.href?a.tabIndex:-1}}}}),Z.optSelected||(ab.propHooks.selected={get:function(a){var b=a.parentNode;return b&&b.parentNode&&b.parentNode.selectedIndex,null}}),ab.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){ab.propFix[this.toLowerCase()]=this});var hc=/[\t\r\n\f]/g;ab.fn.extend({addClass:function(a){var b,c,d,e,f,g,h="string"==typeof a&&a,i=0,j=this.length;if(ab.isFunction(a))return this.each(function(b){ab(this).addClass(a.call(this,b,this.className))});if(h)for(b=(a||"").match(nb)||[];j>i;i++)if(c=this[i],d=1===c.nodeType&&(c.className?(" "+c.className+" ").replace(hc," "):" ")){for(f=0;e=b[f++];)d.indexOf(" "+e+" ")<0&&(d+=e+" ");g=ab.trim(d),c.className!==g&&(c.className=g)}return this},removeClass:function(a){var b,c,d,e,f,g,h=0===arguments.length||"string"==typeof a&&a,i=0,j=this.length;if(ab.isFunction(a))return this.each(function(b){ab(this).removeClass(a.call(this,b,this.className))});if(h)for(b=(a||"").match(nb)||[];j>i;i++)if(c=this[i],d=1===c.nodeType&&(c.className?(" "+c.className+" ").replace(hc," "):"")){for(f=0;e=b[f++];)for(;d.indexOf(" "+e+" ")>=0;)d=d.replace(" "+e+" "," ");g=a?ab.trim(d):"",c.className!==g&&(c.className=g)}return this},toggleClass:function(a,b){var c=typeof a;return"boolean"==typeof b&&"string"===c?b?this.addClass(a):this.removeClass(a):this.each(ab.isFunction(a)?function(c){ab(this).toggleClass(a.call(this,c,this.className,b),b)}:function(){if("string"===c)for(var b,d=0,e=ab(this),f=a.match(nb)||[];b=f[d++];)e.hasClass(b)?e.removeClass(b):e.addClass(b);else(c===zb||"boolean"===c)&&(this.className&&rb.set(this,"__className__",this.className),this.className=this.className||a===!1?"":rb.get(this,"__className__")||"")})},hasClass:function(a){for(var b=" "+a+" ",c=0,d=this.length;d>c;c++)if(1===this[c].nodeType&&(" "+this[c].className+" ").replace(hc," ").indexOf(b)>=0)return!0;return!1}});var ic=/\r/g;ab.fn.extend({val:function(a){var b,c,d,e=this[0];{if(arguments.length)return d=ab.isFunction(a),this.each(function(c){var e;1===this.nodeType&&(e=d?a.call(this,c,ab(this).val()):a,null==e?e="":"number"==typeof e?e+="":ab.isArray(e)&&(e=ab.map(e,function(a){return null==a?"":a+""})),b=ab.valHooks[this.type]||ab.valHooks[this.nodeName.toLowerCase()],b&&"set"in b&&void 0!==b.set(this,e,"value")||(this.value=e))});if(e)return b=ab.valHooks[e.type]||ab.valHooks[e.nodeName.toLowerCase()],b&&"get"in b&&void 0!==(c=b.get(e,"value"))?c:(c=e.value,"string"==typeof c?c.replace(ic,""):null==c?"":c)}}}),ab.extend({valHooks:{select:{get:function(a){for(var b,c,d=a.options,e=a.selectedIndex,f="select-one"===a.type||0>e,g=f?null:[],h=f?e+1:d.length,i=0>e?h:f?e:0;h>i;i++)if(c=d[i],!(!c.selected&&i!==e||(Z.optDisabled?c.disabled:null!==c.getAttribute("disabled"))||c.parentNode.disabled&&ab.nodeName(c.parentNode,"optgroup"))){if(b=ab(c).val(),f)return b;g.push(b)}return g},set:function(a,b){for(var c,d,e=a.options,f=ab.makeArray(b),g=e.length;g--;)d=e[g],(d.selected=ab.inArray(ab(d).val(),f)>=0)&&(c=!0);return c||(a.selectedIndex=-1),f}}}}),ab.each(["radio","checkbox"],function(){ab.valHooks[this]={set:function(a,b){return ab.isArray(b)?a.checked=ab.inArray(ab(a).val(),b)>=0:void 0}},Z.checkOn||(ab.valHooks[this].get=function(a){return null===a.getAttribute("value")?"on":a.value})}),ab.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){ab.fn[b]=function(a,c){return arguments.length>0?this.on(b,null,a,c):this.trigger(b)}}),ab.fn.extend({hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)},bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return 1===arguments.length?this.off(a,"**"):this.off(b,a||"**",c)}});var jc=ab.now(),kc=/\?/;ab.parseJSON=function(a){return JSON.parse(a+"")},ab.parseXML=function(a){var b,c;if(!a||"string"!=typeof a)return null;try{c=new DOMParser,b=c.parseFromString(a,"text/xml")}catch(d){b=void 0}return(!b||b.getElementsByTagName("parsererror").length)&&ab.error("Invalid XML: "+a),b};var lc,mc,nc=/#.*$/,oc=/([?&])_=[^&]*/,pc=/^(.*?):[ \t]*([^\r\n]*)$/gm,qc=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,rc=/^(?:GET|HEAD)$/,sc=/^\/\//,tc=/^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/,uc={},vc={},wc="*/".concat("*");try{mc=location.href}catch(xc){mc=$.createElement("a"),mc.href="",mc=mc.href}lc=tc.exec(mc.toLowerCase())||[],ab.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:mc,type:"GET",isLocal:qc.test(lc[1]),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":wc,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":ab.parseJSON,"text xml":ab.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(a,b){return b?L(L(a,ab.ajaxSettings),b):L(ab.ajaxSettings,a)},ajaxPrefilter:J(uc),ajaxTransport:J(vc),ajax:function(a,b){function c(a,b,c,g){var i,k,r,s,u,w=b;2!==t&&(t=2,h&&clearTimeout(h),d=void 0,f=g||"",v.readyState=a>0?4:0,i=a>=200&&300>a||304===a,c&&(s=M(l,v,c)),s=N(l,s,v,i),i?(l.ifModified&&(u=v.getResponseHeader("Last-Modified"),u&&(ab.lastModified[e]=u),u=v.getResponseHeader("etag"),u&&(ab.etag[e]=u)),204===a||"HEAD"===l.type?w="nocontent":304===a?w="notmodified":(w=s.state,k=s.data,r=s.error,i=!r)):(r=w,(a||!w)&&(w="error",0>a&&(a=0))),v.status=a,v.statusText=(b||w)+"",i?o.resolveWith(m,[k,w,v]):o.rejectWith(m,[v,w,r]),v.statusCode(q),q=void 0,j&&n.trigger(i?"ajaxSuccess":"ajaxError",[v,l,i?k:r]),p.fireWith(m,[v,w]),j&&(n.trigger("ajaxComplete",[v,l]),--ab.active||ab.event.trigger("ajaxStop")))}"object"==typeof a&&(b=a,a=void 0),b=b||{};var d,e,f,g,h,i,j,k,l=ab.ajaxSetup({},b),m=l.context||l,n=l.context&&(m.nodeType||m.jquery)?ab(m):ab.event,o=ab.Deferred(),p=ab.Callbacks("once memory"),q=l.statusCode||{},r={},s={},t=0,u="canceled",v={readyState:0,getResponseHeader:function(a){var b;if(2===t){if(!g)for(g={};b=pc.exec(f);)g[b[1].toLowerCase()]=b[2];b=g[a.toLowerCase()]}return null==b?null:b},getAllResponseHeaders:function(){return 2===t?f:null},setRequestHeader:function(a,b){var c=a.toLowerCase();return t||(a=s[c]=s[c]||a,r[a]=b),this},overrideMimeType:function(a){return t||(l.mimeType=a),this},statusCode:function(a){var b;if(a)if(2>t)for(b in a)q[b]=[q[b],a[b]];else v.always(a[v.status]);return this},abort:function(a){var b=a||u;return d&&d.abort(b),c(0,b),this}};if(o.promise(v).complete=p.add,v.success=v.done,v.error=v.fail,l.url=((a||l.url||mc)+"").replace(nc,"").replace(sc,lc[1]+"//"),l.type=b.method||b.type||l.method||l.type,l.dataTypes=ab.trim(l.dataType||"*").toLowerCase().match(nb)||[""],null==l.crossDomain&&(i=tc.exec(l.url.toLowerCase()),l.crossDomain=!(!i||i[1]===lc[1]&&i[2]===lc[2]&&(i[3]||("http:"===i[1]?"80":"443"))===(lc[3]||("http:"===lc[1]?"80":"443")))),l.data&&l.processData&&"string"!=typeof l.data&&(l.data=ab.param(l.data,l.traditional)),K(uc,l,b,v),2===t)return v;j=l.global,j&&0===ab.active++&&ab.event.trigger("ajaxStart"),l.type=l.type.toUpperCase(),l.hasContent=!rc.test(l.type),e=l.url,l.hasContent||(l.data&&(e=l.url+=(kc.test(e)?"&":"?")+l.data,delete l.data),l.cache===!1&&(l.url=oc.test(e)?e.replace(oc,"$1_="+jc++):e+(kc.test(e)?"&":"?")+"_="+jc++)),l.ifModified&&(ab.lastModified[e]&&v.setRequestHeader("If-Modified-Since",ab.lastModified[e]),ab.etag[e]&&v.setRequestHeader("If-None-Match",ab.etag[e])),(l.data&&l.hasContent&&l.contentType!==!1||b.contentType)&&v.setRequestHeader("Content-Type",l.contentType),v.setRequestHeader("Accept",l.dataTypes[0]&&l.accepts[l.dataTypes[0]]?l.accepts[l.dataTypes[0]]+("*"!==l.dataTypes[0]?", "+wc+"; q=0.01":""):l.accepts["*"]);for(k in l.headers)v.setRequestHeader(k,l.headers[k]);if(l.beforeSend&&(l.beforeSend.call(m,v,l)===!1||2===t))return v.abort();u="abort";for(k in{success:1,error:1,complete:1})v[k](l[k]);if(d=K(vc,l,b,v)){v.readyState=1,j&&n.trigger("ajaxSend",[v,l]),l.async&&l.timeout>0&&(h=setTimeout(function(){v.abort("timeout")},l.timeout));try{t=1,d.send(r,c)}catch(w){if(!(2>t))throw w;c(-1,w)}}else c(-1,"No Transport");return v},getJSON:function(a,b,c){return ab.get(a,b,c,"json")},getScript:function(a,b){return ab.get(a,void 0,b,"script")}}),ab.each(["get","post"],function(a,b){ab[b]=function(a,c,d,e){return ab.isFunction(c)&&(e=e||d,d=c,c=void 0),ab.ajax({url:a,type:b,dataType:e,data:c,success:d})}}),ab.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(a,b){ab.fn[b]=function(a){return this.on(b,a)}}),ab._evalUrl=function(a){return ab.ajax({url:a,type:"GET",dataType:"script",async:!1,global:!1,"throws":!0})},ab.fn.extend({wrapAll:function(a){var b;return ab.isFunction(a)?this.each(function(b){ab(this).wrapAll(a.call(this,b))}):(this[0]&&(b=ab(a,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){for(var a=this;a.firstElementChild;)a=a.firstElementChild;return a}).append(this)),this)},wrapInner:function(a){return this.each(ab.isFunction(a)?function(b){ab(this).wrapInner(a.call(this,b))}:function(){var b=ab(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=ab.isFunction(a);return this.each(function(c){ab(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){ab.nodeName(this,"body")||ab(this).replaceWith(this.childNodes)}).end()}}),ab.expr.filters.hidden=function(a){return a.offsetWidth<=0&&a.offsetHeight<=0},ab.expr.filters.visible=function(a){return!ab.expr.filters.hidden(a)};var yc=/%20/g,zc=/\[\]$/,Ac=/\r?\n/g,Bc=/^(?:submit|button|image|reset|file)$/i,Cc=/^(?:input|select|textarea|keygen)/i;ab.param=function(a,b){var c,d=[],e=function(a,b){b=ab.isFunction(b)?b():null==b?"":b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)
+};if(void 0===b&&(b=ab.ajaxSettings&&ab.ajaxSettings.traditional),ab.isArray(a)||a.jquery&&!ab.isPlainObject(a))ab.each(a,function(){e(this.name,this.value)});else for(c in a)O(c,a[c],b,e);return d.join("&").replace(yc,"+")},ab.fn.extend({serialize:function(){return ab.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var a=ab.prop(this,"elements");return a?ab.makeArray(a):this}).filter(function(){var a=this.type;return this.name&&!ab(this).is(":disabled")&&Cc.test(this.nodeName)&&!Bc.test(a)&&(this.checked||!yb.test(a))}).map(function(a,b){var c=ab(this).val();return null==c?null:ab.isArray(c)?ab.map(c,function(a){return{name:b.name,value:a.replace(Ac,"\r\n")}}):{name:b.name,value:c.replace(Ac,"\r\n")}}).get()}}),ab.ajaxSettings.xhr=function(){try{return new XMLHttpRequest}catch(a){}};var Dc=0,Ec={},Fc={0:200,1223:204},Gc=ab.ajaxSettings.xhr();a.ActiveXObject&&ab(a).on("unload",function(){for(var a in Ec)Ec[a]()}),Z.cors=!!Gc&&"withCredentials"in Gc,Z.ajax=Gc=!!Gc,ab.ajaxTransport(function(a){var b;return Z.cors||Gc&&!a.crossDomain?{send:function(c,d){var e,f=a.xhr(),g=++Dc;if(f.open(a.type,a.url,a.async,a.username,a.password),a.xhrFields)for(e in a.xhrFields)f[e]=a.xhrFields[e];a.mimeType&&f.overrideMimeType&&f.overrideMimeType(a.mimeType),a.crossDomain||c["X-Requested-With"]||(c["X-Requested-With"]="XMLHttpRequest");for(e in c)f.setRequestHeader(e,c[e]);b=function(a){return function(){b&&(delete Ec[g],b=f.onload=f.onerror=null,"abort"===a?f.abort():"error"===a?d(f.status,f.statusText):d(Fc[f.status]||f.status,f.statusText,"string"==typeof f.responseText?{text:f.responseText}:void 0,f.getAllResponseHeaders()))}},f.onload=b(),f.onerror=b("error"),b=Ec[g]=b("abort"),f.send(a.hasContent&&a.data||null)},abort:function(){b&&b()}}:void 0}),ab.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/(?:java|ecma)script/},converters:{"text script":function(a){return ab.globalEval(a),a}}}),ab.ajaxPrefilter("script",function(a){void 0===a.cache&&(a.cache=!1),a.crossDomain&&(a.type="GET")}),ab.ajaxTransport("script",function(a){if(a.crossDomain){var b,c;return{send:function(d,e){b=ab("<script>").prop({async:!0,charset:a.scriptCharset,src:a.url}).on("load error",c=function(a){b.remove(),c=null,a&&e("error"===a.type?404:200,a.type)}),$.head.appendChild(b[0])},abort:function(){c&&c()}}}});var Hc=[],Ic=/(=)\?(?=&|$)|\?\?/;ab.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var a=Hc.pop()||ab.expando+"_"+jc++;return this[a]=!0,a}}),ab.ajaxPrefilter("json jsonp",function(b,c,d){var e,f,g,h=b.jsonp!==!1&&(Ic.test(b.url)?"url":"string"==typeof b.data&&!(b.contentType||"").indexOf("application/x-www-form-urlencoded")&&Ic.test(b.data)&&"data");return h||"jsonp"===b.dataTypes[0]?(e=b.jsonpCallback=ab.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,h?b[h]=b[h].replace(Ic,"$1"+e):b.jsonp!==!1&&(b.url+=(kc.test(b.url)?"&":"?")+b.jsonp+"="+e),b.converters["script json"]=function(){return g||ab.error(e+" was not called"),g[0]},b.dataTypes[0]="json",f=a[e],a[e]=function(){g=arguments},d.always(function(){a[e]=f,b[e]&&(b.jsonpCallback=c.jsonpCallback,Hc.push(e)),g&&ab.isFunction(f)&&f(g[0]),g=f=void 0}),"script"):void 0}),ab.parseHTML=function(a,b,c){if(!a||"string"!=typeof a)return null;"boolean"==typeof b&&(c=b,b=!1),b=b||$;var d=gb.exec(a),e=!c&&[];return d?[b.createElement(d[1])]:(d=ab.buildFragment([a],b,e),e&&e.length&&ab(e).remove(),ab.merge([],d.childNodes))};var Jc=ab.fn.load;ab.fn.load=function(a,b,c){if("string"!=typeof a&&Jc)return Jc.apply(this,arguments);var d,e,f,g=this,h=a.indexOf(" ");return h>=0&&(d=a.slice(h),a=a.slice(0,h)),ab.isFunction(b)?(c=b,b=void 0):b&&"object"==typeof b&&(e="POST"),g.length>0&&ab.ajax({url:a,type:e,dataType:"html",data:b}).done(function(a){f=arguments,g.html(d?ab("<div>").append(ab.parseHTML(a)).find(d):a)}).complete(c&&function(a,b){g.each(c,f||[a.responseText,b,a])}),this},ab.expr.filters.animated=function(a){return ab.grep(ab.timers,function(b){return a===b.elem}).length};var Kc=a.document.documentElement;ab.offset={setOffset:function(a,b,c){var d,e,f,g,h,i,j,k=ab.css(a,"position"),l=ab(a),m={};"static"===k&&(a.style.position="relative"),h=l.offset(),f=ab.css(a,"top"),i=ab.css(a,"left"),j=("absolute"===k||"fixed"===k)&&(f+i).indexOf("auto")>-1,j?(d=l.position(),g=d.top,e=d.left):(g=parseFloat(f)||0,e=parseFloat(i)||0),ab.isFunction(b)&&(b=b.call(a,c,h)),null!=b.top&&(m.top=b.top-h.top+g),null!=b.left&&(m.left=b.left-h.left+e),"using"in b?b.using.call(a,m):l.css(m)}},ab.fn.extend({offset:function(a){if(arguments.length)return void 0===a?this:this.each(function(b){ab.offset.setOffset(this,a,b)});var b,c,d=this[0],e={top:0,left:0},f=d&&d.ownerDocument;if(f)return b=f.documentElement,ab.contains(b,d)?(typeof d.getBoundingClientRect!==zb&&(e=d.getBoundingClientRect()),c=P(f),{top:e.top+c.pageYOffset-b.clientTop,left:e.left+c.pageXOffset-b.clientLeft}):e},position:function(){if(this[0]){var a,b,c=this[0],d={top:0,left:0};return"fixed"===ab.css(c,"position")?b=c.getBoundingClientRect():(a=this.offsetParent(),b=this.offset(),ab.nodeName(a[0],"html")||(d=a.offset()),d.top+=ab.css(a[0],"borderTopWidth",!0),d.left+=ab.css(a[0],"borderLeftWidth",!0)),{top:b.top-d.top-ab.css(c,"marginTop",!0),left:b.left-d.left-ab.css(c,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){for(var a=this.offsetParent||Kc;a&&!ab.nodeName(a,"html")&&"static"===ab.css(a,"position");)a=a.offsetParent;return a||Kc})}}),ab.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(b,c){var d="pageYOffset"===c;ab.fn[b]=function(e){return qb(this,function(b,e,f){var g=P(b);return void 0===f?g?g[c]:b[e]:void(g?g.scrollTo(d?a.pageXOffset:f,d?f:a.pageYOffset):b[e]=f)},b,e,arguments.length,null)}}),ab.each(["top","left"],function(a,b){ab.cssHooks[b]=w(Z.pixelPosition,function(a,c){return c?(c=v(a,b),Qb.test(c)?ab(a).position()[b]+"px":c):void 0})}),ab.each({Height:"height",Width:"width"},function(a,b){ab.each({padding:"inner"+a,content:b,"":"outer"+a},function(c,d){ab.fn[d]=function(d,e){var f=arguments.length&&(c||"boolean"!=typeof d),g=c||(d===!0||e===!0?"margin":"border");return qb(this,function(b,c,d){var e;return ab.isWindow(b)?b.document.documentElement["client"+a]:9===b.nodeType?(e=b.documentElement,Math.max(b.body["scroll"+a],e["scroll"+a],b.body["offset"+a],e["offset"+a],e["client"+a])):void 0===d?ab.css(b,c,g):ab.style(b,c,d,g)},b,f?d:void 0,f,null)}})}),ab.fn.size=function(){return this.length},ab.fn.andSelf=ab.fn.addBack,"function"==typeof define&&define.amd&&define("jquery",[],function(){return ab});var Lc=a.jQuery,Mc=a.$;return ab.noConflict=function(b){return a.$===ab&&(a.$=Mc),b&&a.jQuery===ab&&(a.jQuery=Lc),ab},typeof b===zb&&(a.jQuery=a.$=ab),ab});
\ No newline at end of file
--- /dev/null
+/*!
+ * Modernizr v2.7.1
+ * www.modernizr.com
+ *
+ * Copyright (c) Faruk Ates, Paul Irish, Alex Sexton
+ * Available under the BSD and MIT licenses: www.modernizr.com/license/
+ */
+window.Modernizr=function(a,b,c){function d(a){t.cssText=a}function e(a,b){return d(x.join(a+";")+(b||""))}function f(a,b){return typeof a===b}function g(a,b){return!!~(""+a).indexOf(b)}function h(a,b){for(var d in a){var e=a[d];if(!g(e,"-")&&t[e]!==c)return"pfx"==b?e:!0}return!1}function i(a,b,d){for(var e in a){var g=b[a[e]];if(g!==c)return d===!1?a[e]:f(g,"function")?g.bind(d||b):g}return!1}function j(a,b,c){var d=a.charAt(0).toUpperCase()+a.slice(1),e=(a+" "+z.join(d+" ")+d).split(" ");return f(b,"string")||f(b,"undefined")?h(e,b):(e=(a+" "+A.join(d+" ")+d).split(" "),i(e,b,c))}function k(){o.input=function(c){for(var d=0,e=c.length;e>d;d++)E[c[d]]=!!(c[d]in u);return E.list&&(E.list=!(!b.createElement("datalist")||!a.HTMLDataListElement)),E}("autocomplete autofocus list placeholder max min multiple pattern required step".split(" ")),o.inputtypes=function(a){for(var d,e,f,g=0,h=a.length;h>g;g++)u.setAttribute("type",e=a[g]),d="text"!==u.type,d&&(u.value=v,u.style.cssText="position:absolute;visibility:hidden;",/^range$/.test(e)&&u.style.WebkitAppearance!==c?(q.appendChild(u),f=b.defaultView,d=f.getComputedStyle&&"textfield"!==f.getComputedStyle(u,null).WebkitAppearance&&0!==u.offsetHeight,q.removeChild(u)):/^(search|tel)$/.test(e)||(d=/^(url|email)$/.test(e)?u.checkValidity&&u.checkValidity()===!1:u.value!=v)),D[a[g]]=!!d;return D}("search tel url email datetime date month week time datetime-local number range color".split(" "))}var l,m,n="2.7.1",o={},p=!0,q=b.documentElement,r="modernizr",s=b.createElement(r),t=s.style,u=b.createElement("input"),v=":)",w={}.toString,x=" -webkit- -moz- -o- -ms- ".split(" "),y="Webkit Moz O ms",z=y.split(" "),A=y.toLowerCase().split(" "),B={svg:"http://www.w3.org/2000/svg"},C={},D={},E={},F=[],G=F.slice,H=function(a,c,d,e){var f,g,h,i,j=b.createElement("div"),k=b.body,l=k||b.createElement("body");if(parseInt(d,10))for(;d--;)h=b.createElement("div"),h.id=e?e[d]:r+(d+1),j.appendChild(h);return f=["­",'<style id="s',r,'">',a,"</style>"].join(""),j.id=r,(k?j:l).innerHTML+=f,l.appendChild(j),k||(l.style.background="",l.style.overflow="hidden",i=q.style.overflow,q.style.overflow="hidden",q.appendChild(l)),g=c(j,a),k?j.parentNode.removeChild(j):(l.parentNode.removeChild(l),q.style.overflow=i),!!g},I=function(b){var c=a.matchMedia||a.msMatchMedia;if(c)return c(b).matches;var d;return H("@media "+b+" { #"+r+" { position: absolute; } }",function(b){d="absolute"==(a.getComputedStyle?getComputedStyle(b,null):b.currentStyle).position}),d},J=function(){function a(a,e){e=e||b.createElement(d[a]||"div"),a="on"+a;var g=a in e;return g||(e.setAttribute||(e=b.createElement("div")),e.setAttribute&&e.removeAttribute&&(e.setAttribute(a,""),g=f(e[a],"function"),f(e[a],"undefined")||(e[a]=c),e.removeAttribute(a))),e=null,g}var d={select:"input",change:"input",submit:"form",reset:"form",error:"img",load:"img",abort:"img"};return a}(),K={}.hasOwnProperty;m=f(K,"undefined")||f(K.call,"undefined")?function(a,b){return b in a&&f(a.constructor.prototype[b],"undefined")}:function(a,b){return K.call(a,b)},Function.prototype.bind||(Function.prototype.bind=function(a){var b=this;if("function"!=typeof b)throw new TypeError;var c=G.call(arguments,1),d=function(){if(this instanceof d){var e=function(){};e.prototype=b.prototype;var f=new e,g=b.apply(f,c.concat(G.call(arguments)));return Object(g)===g?g:f}return b.apply(a,c.concat(G.call(arguments)))};return d}),C.flexbox=function(){return j("flexWrap")},C.flexboxlegacy=function(){return j("boxDirection")},C.canvas=function(){var a=b.createElement("canvas");return!(!a.getContext||!a.getContext("2d"))},C.canvastext=function(){return!(!o.canvas||!f(b.createElement("canvas").getContext("2d").fillText,"function"))},C.webgl=function(){return!!a.WebGLRenderingContext},C.touch=function(){var c;return"ontouchstart"in a||a.DocumentTouch&&b instanceof DocumentTouch?c=!0:H(["@media (",x.join("touch-enabled),("),r,")","{#modernizr{top:9px;position:absolute}}"].join(""),function(a){c=9===a.offsetTop}),c},C.geolocation=function(){return"geolocation"in navigator},C.postmessage=function(){return!!a.postMessage},C.websqldatabase=function(){return!!a.openDatabase},C.indexedDB=function(){return!!j("indexedDB",a)},C.hashchange=function(){return J("hashchange",a)&&(b.documentMode===c||b.documentMode>7)},C.history=function(){return!(!a.history||!history.pushState)},C.draganddrop=function(){var a=b.createElement("div");return"draggable"in a||"ondragstart"in a&&"ondrop"in a},C.websockets=function(){return"WebSocket"in a||"MozWebSocket"in a},C.rgba=function(){return d("background-color:rgba(150,255,150,.5)"),g(t.backgroundColor,"rgba")},C.hsla=function(){return d("background-color:hsla(120,40%,100%,.5)"),g(t.backgroundColor,"rgba")||g(t.backgroundColor,"hsla")},C.multiplebgs=function(){return d("background:url(https://),url(https://),red url(https://)"),/(url\s*\(.*?){3}/.test(t.background)},C.backgroundsize=function(){return j("backgroundSize")},C.borderimage=function(){return j("borderImage")},C.borderradius=function(){return j("borderRadius")},C.boxshadow=function(){return j("boxShadow")},C.textshadow=function(){return""===b.createElement("div").style.textShadow},C.opacity=function(){return e("opacity:.55"),/^0.55$/.test(t.opacity)},C.cssanimations=function(){return j("animationName")},C.csscolumns=function(){return j("columnCount")},C.cssgradients=function(){var a="background-image:",b="gradient(linear,left top,right bottom,from(#9f9),to(white));",c="linear-gradient(left top,#9f9, white);";return d((a+"-webkit- ".split(" ").join(b+a)+x.join(c+a)).slice(0,-a.length)),g(t.backgroundImage,"gradient")},C.cssreflections=function(){return j("boxReflect")},C.csstransforms=function(){return!!j("transform")},C.csstransforms3d=function(){var a=!!j("perspective");return a&&"webkitPerspective"in q.style&&H("@media (transform-3d),(-webkit-transform-3d){#modernizr{left:9px;position:absolute;height:3px;}}",function(b){a=9===b.offsetLeft&&3===b.offsetHeight}),a},C.csstransitions=function(){return j("transition")},C.fontface=function(){var a;return H('@font-face {font-family:"font";src:url("https://")}',function(c,d){var e=b.getElementById("smodernizr"),f=e.sheet||e.styleSheet,g=f?f.cssRules&&f.cssRules[0]?f.cssRules[0].cssText:f.cssText||"":"";a=/src/i.test(g)&&0===g.indexOf(d.split(" ")[0])}),a},C.generatedcontent=function(){var a;return H(["#",r,"{font:0/0 a}#",r,':after{content:"',v,'";visibility:hidden;font:3px/1 a}'].join(""),function(b){a=b.offsetHeight>=3}),a},C.video=function(){var a=b.createElement("video"),c=!1;try{(c=!!a.canPlayType)&&(c=new Boolean(c),c.ogg=a.canPlayType('video/ogg; codecs="theora"').replace(/^no$/,""),c.h264=a.canPlayType('video/mp4; codecs="avc1.42E01E"').replace(/^no$/,""),c.webm=a.canPlayType('video/webm; codecs="vp8, vorbis"').replace(/^no$/,""))}catch(d){}return c},C.audio=function(){var a=b.createElement("audio"),c=!1;try{(c=!!a.canPlayType)&&(c=new Boolean(c),c.ogg=a.canPlayType('audio/ogg; codecs="vorbis"').replace(/^no$/,""),c.mp3=a.canPlayType("audio/mpeg;").replace(/^no$/,""),c.wav=a.canPlayType('audio/wav; codecs="1"').replace(/^no$/,""),c.m4a=(a.canPlayType("audio/x-m4a;")||a.canPlayType("audio/aac;")).replace(/^no$/,""))}catch(d){}return c},C.localstorage=function(){try{return localStorage.setItem(r,r),localStorage.removeItem(r),!0}catch(a){return!1}},C.sessionstorage=function(){try{return sessionStorage.setItem(r,r),sessionStorage.removeItem(r),!0}catch(a){return!1}},C.webworkers=function(){return!!a.Worker},C.applicationcache=function(){return!!a.applicationCache},C.svg=function(){return!!b.createElementNS&&!!b.createElementNS(B.svg,"svg").createSVGRect},C.inlinesvg=function(){var a=b.createElement("div");return a.innerHTML="<svg/>",(a.firstChild&&a.firstChild.namespaceURI)==B.svg},C.smil=function(){return!!b.createElementNS&&/SVGAnimate/.test(w.call(b.createElementNS(B.svg,"animate")))},C.svgclippaths=function(){return!!b.createElementNS&&/SVGClipPath/.test(w.call(b.createElementNS(B.svg,"clipPath")))};for(var L in C)m(C,L)&&(l=L.toLowerCase(),o[l]=C[L](),F.push((o[l]?"":"no-")+l));return o.input||k(),o.addTest=function(a,b){if("object"==typeof a)for(var d in a)m(a,d)&&o.addTest(d,a[d]);else{if(a=a.toLowerCase(),o[a]!==c)return o;b="function"==typeof b?b():b,"undefined"!=typeof p&&p&&(q.className+=" "+(b?"":"no-")+a),o[a]=b}return o},d(""),s=u=null,function(a,b){function c(a,b){var c=a.createElement("p"),d=a.getElementsByTagName("head")[0]||a.documentElement;return c.innerHTML="x<style>"+b+"</style>",d.insertBefore(c.lastChild,d.firstChild)}function d(){var a=s.elements;return"string"==typeof a?a.split(" "):a}function e(a){var b=r[a[p]];return b||(b={},q++,a[p]=q,r[q]=b),b}function f(a,c,d){if(c||(c=b),k)return c.createElement(a);d||(d=e(c));var f;return f=d.cache[a]?d.cache[a].cloneNode():o.test(a)?(d.cache[a]=d.createElem(a)).cloneNode():d.createElem(a),!f.canHaveChildren||n.test(a)||f.tagUrn?f:d.frag.appendChild(f)}function g(a,c){if(a||(a=b),k)return a.createDocumentFragment();c=c||e(a);for(var f=c.frag.cloneNode(),g=0,h=d(),i=h.length;i>g;g++)f.createElement(h[g]);return f}function h(a,b){b.cache||(b.cache={},b.createElem=a.createElement,b.createFrag=a.createDocumentFragment,b.frag=b.createFrag()),a.createElement=function(c){return s.shivMethods?f(c,a,b):b.createElem(c)},a.createDocumentFragment=Function("h,f","return function(){var n=f.cloneNode(),c=n.createElement;h.shivMethods&&("+d().join().replace(/[\w\-]+/g,function(a){return b.createElem(a),b.frag.createElement(a),'c("'+a+'")'})+");return n}")(s,b.frag)}function i(a){a||(a=b);var d=e(a);return!s.shivCSS||j||d.hasCSS||(d.hasCSS=!!c(a,"article,aside,dialog,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}mark{background:#FF0;color:#000}template{display:none}")),k||h(a,d),a}var j,k,l="3.7.0",m=a.html5||{},n=/^<|^(?:button|map|select|textarea|object|iframe|option|optgroup)$/i,o=/^(?:a|b|code|div|fieldset|h1|h2|h3|h4|h5|h6|i|label|li|ol|p|q|span|strong|style|table|tbody|td|th|tr|ul)$/i,p="_html5shiv",q=0,r={};!function(){try{var a=b.createElement("a");a.innerHTML="<xyz></xyz>",j="hidden"in a,k=1==a.childNodes.length||function(){b.createElement("a");var a=b.createDocumentFragment();return"undefined"==typeof a.cloneNode||"undefined"==typeof a.createDocumentFragment||"undefined"==typeof a.createElement}()}catch(c){j=!0,k=!0}}();var s={elements:m.elements||"abbr article aside audio bdi canvas data datalist details dialog figcaption figure footer header hgroup main mark meter nav output progress section summary template time video",version:l,shivCSS:m.shivCSS!==!1,supportsUnknownElements:k,shivMethods:m.shivMethods!==!1,type:"default",shivDocument:i,createElement:f,createDocumentFragment:g};a.html5=s,i(b)}(this,b),o._version=n,o._prefixes=x,o._domPrefixes=A,o._cssomPrefixes=z,o.mq=I,o.hasEvent=J,o.testProp=function(a){return h([a])},o.testAllProps=j,o.testStyles=H,o.prefixed=function(a,b,c){return b?j(a,b,c):j(a,"pfx")},q.className=q.className.replace(/(^|\s)no-js(\s|$)/,"$1$2")+(p?" js "+F.join(" "):""),o}(this,this.document);
\ No newline at end of file
--- /dev/null
+/*! http://mths.be/placeholder v2.0.7 by @mathias */
+!function(a,b,c){function d(a){var b={},d=/^jQuery\d+$/;return c.each(a.attributes,function(a,c){c.specified&&!d.test(c.name)&&(b[c.name]=c.value)}),b}function e(a,d){var e=this,f=c(e);if(e.value==f.attr("placeholder")&&f.hasClass("placeholder"))if(f.data("placeholder-password")){if(f=f.hide().next().show().attr("id",f.removeAttr("id").data("placeholder-id")),a===!0)return f[0].value=d;f.focus()}else e.value="",f.removeClass("placeholder"),e==b.activeElement&&e.select()}function f(){var a,b=this,f=c(b),g=this.id;if(""==b.value){if("password"==b.type){if(!f.data("placeholder-textinput")){try{a=f.clone().attr({type:"text"})}catch(h){a=c("<input>").attr(c.extend(d(this),{type:"text"}))}a.removeAttr("name").data({"placeholder-password":!0,"placeholder-id":g}).bind("focus.placeholder",e),f.data({"placeholder-textinput":a,"placeholder-id":g}).before(a)}f=f.removeAttr("id").hide().prev().attr("id",g).show()}f.addClass("placeholder"),f[0].value=f.attr("placeholder")}else f.removeClass("placeholder")}var g,h,i="placeholder"in b.createElement("input"),j="placeholder"in b.createElement("textarea"),k=c.fn,l=c.valHooks;i&&j?(h=k.placeholder=function(){return this},h.input=h.textarea=!0):(h=k.placeholder=function(){var a=this;return a.filter((i?"textarea":":input")+"[placeholder]").not(".placeholder").bind({"focus.placeholder":e,"blur.placeholder":f}).data("placeholder-enabled",!0).trigger("blur.placeholder"),a},h.input=i,h.textarea=j,g={get:function(a){var b=c(a);return b.data("placeholder-enabled")&&b.hasClass("placeholder")?"":a.value},set:function(a,d){var g=c(a);return g.data("placeholder-enabled")?(""==d?(a.value=d,a!=b.activeElement&&f.call(a)):g.hasClass("placeholder")?e.call(a,!0,d)||(a.value=d):a.value=d,g):a.value=d}},i||(l.input=g),j||(l.textarea=g),c(function(){c(b).delegate("form","submit.placeholder",function(){var a=c(".placeholder",this).each(e);setTimeout(function(){a.each(f)},10)})}),c(a).bind("beforeunload.placeholder",function(){c(".placeholder").each(function(){this.value=""})}))}(this,document,jQuery);
\ No newline at end of file
--- /dev/null
+<?php
+
+/**
+ * Register Menus
+ * http://codex.wordpress.org/Function_Reference/register_nav_menus#Examples
+ */
+register_nav_menus(array(
+ 'top-bar-l' => 'Left Top Bar', // registers the menu in the WordPress admin menu editor
+ 'top-bar-r' => 'Right Top Bar',
+ 'mobile-off-canvas' => 'Mobile'
+));
+
+
+/**
+ * Left top bar
+ * http://codex.wordpress.org/Function_Reference/wp_nav_menu
+ */
+if ( ! function_exists( 'foundationPress_top_bar_l' ) ) {
+ function foundationPress_top_bar_l() {
+ wp_nav_menu(array(
+ 'container' => false, // remove nav container
+ 'container_class' => '', // class of container
+ 'menu' => '', // menu name
+ 'menu_class' => 'top-bar-menu left', // adding custom nav class
+ 'theme_location' => 'top-bar-l', // where it's located in the theme
+ 'before' => '', // before each link <a>
+ 'after' => '', // after each link </a>
+ 'link_before' => '', // before each link text
+ 'link_after' => '', // after each link text
+ 'depth' => 5, // limit the depth of the nav
+ 'fallback_cb' => false, // fallback function (see below)
+ 'walker' => new top_bar_walker()
+ ));
+ }
+}
+
+/**
+ * Right top bar
+ */
+if ( ! function_exists( 'foundationPress_top_bar_r' ) ) {
+ function foundationPress_top_bar_r() {
+ wp_nav_menu(array(
+ 'container' => false, // remove nav container
+ 'container_class' => '', // class of container
+ 'menu' => '', // menu name
+ 'menu_class' => 'top-bar-menu right', // adding custom nav class
+ 'theme_location' => 'top-bar-r', // where it's located in the theme
+ 'before' => '', // before each link <a>
+ 'after' => '', // after each link </a>
+ 'link_before' => '', // before each link text
+ 'link_after' => '', // after each link text
+ 'depth' => 5, // limit the depth of the nav
+ 'fallback_cb' => false, // fallback function (see below)
+ 'walker' => new top_bar_walker()
+ ));
+ }
+}
+
+/**
+ * Mobile off-canvas
+ */
+if ( ! function_exists( 'foundationPress_mobile_off_canvas' ) ) {
+ function foundationPress_mobile_off_canvas() {
+ wp_nav_menu(array(
+ 'container' => false, // remove nav container
+ 'container_class' => '', // class of container
+ 'menu' => '', // menu name
+ 'menu_class' => 'off-canvas-list', // adding custom nav class
+ 'theme_location' => 'mobile-off-canvas', // where it's located in the theme
+ 'before' => '', // before each link <a>
+ 'after' => '', // after each link </a>
+ 'link_before' => '', // before each link text
+ 'link_after' => '', // after each link text
+ 'depth' => 5, // limit the depth of the nav
+ 'fallback_cb' => false, // fallback function (see below)
+ 'walker' => new top_bar_walker()
+ ));
+ }
+}
+
+/**
+ * Add support for buttons in the top-bar menu:
+ * 1) In WordPress admin, go to Apperance -> Menus.
+ * 2) Click 'Screen Options' from the top panel and enable 'CSS CLasses' and 'Link Relationship (XFN)'
+ * 3) On your menu item, type 'has-form' in the CSS-classes field. Type 'button' in the XFN field
+ * 4) Save Menu. Your menu item will now appear as a button in your top-menu
+*/
+if ( ! function_exists( 'add_menuclass') ) {
+ function add_menuclass($ulclass) {
+ $find = array('/<a rel="button"/', '/<a title=".*?" rel="button"/');
+ $replace = array('<a rel="button" class="button"', '<a rel="button" class="button"');
+
+ return preg_replace($find, $replace, $ulclass, 1);
+ }
+ add_filter('wp_nav_menu','add_menuclass');
+}
+
+?>
--- /dev/null
+<?php get_header();?>
+<?php get_sidebar();?>
+
+ <div id="main" class="small-12 medium-9 columns">
+ <br>
+ <div class="breadcrumbs">
+ <?php if(function_exists('bcn_display'))
+ {
+ bcn_display();
+ }?>
+ <br> <br>
+ </div>
+ <div id="toolbox">
+ <?php if(have_posts()) : while(have_posts()): the_post();?>
+ <?php the_content();?>
+ <?php endwhile; else:?>
+ <p><?php _e('Sorry, no posts yet');?></p>
+ <?php endif;?>
+
+ <?php echo "<h1>" . get_the_title() . "</h1>"; ?>
+ <p>Fill out this form to request a reservation or send us an email
+ <a href="mailto:rentals@parrotslanding.com">rentals@parrotslanding.com</a>
+ . Be sure to include the dates, and equipment desired. We would love to hear form you!
+ </p>
+ <?php echo do_shortcode('[contact-form-7 id="48" title="Contact form 1"]');?>
+ </div><!-- /#toolbox -->
+
+
+
+<?php get_footer();?>
--- /dev/null
+/*
+To change this license header, choose License Headers in Project Properties.
+To change this template file, choose Tools | Templates
+and open the template in the editor.
+*/
+/*
+ Created on : Sep 29, 2014, 10:46:06 AM
+ Author : laury
+*/
--- /dev/null
+// Make sure the charset is set appropriately
+@charset "UTF-8";
+
+// Behold, here are all the Foundation components.
+@import
+ "foundation/components/accordion",
+ "foundation/components/alert-boxes",
+ "foundation/components/block-grid",
+ "foundation/components/breadcrumbs",
+ "foundation/components/button-groups",
+ "foundation/components/buttons",
+ "foundation/components/clearing",
+ "foundation/components/dropdown",
+ "foundation/components/dropdown-buttons",
+ "foundation/components/flex-video",
+ "foundation/components/forms",
+ "foundation/components/grid",
+ "foundation/components/inline-lists",
+ "foundation/components/joyride",
+ "foundation/components/keystrokes",
+ "foundation/components/labels",
+ "foundation/components/magellan",
+ "foundation/components/orbit",
+ "foundation/components/pagination",
+ "foundation/components/panels",
+ "foundation/components/pricing-tables",
+ "foundation/components/progress-bars",
+ "foundation/components/reveal",
+ "foundation/components/side-nav",
+ "foundation/components/split-buttons",
+ "foundation/components/sub-nav",
+ "foundation/components/switch",
+ "foundation/components/tables",
+ "foundation/components/tabs",
+ "foundation/components/thumbs",
+ "foundation/components/tooltips",
+ "foundation/components/top-bar",
+ "foundation/components/type",
+ "foundation/components/offcanvas",
+ "foundation/components/visibility";
--- /dev/null
+// This is the default html and body font-size for the base rem value.
+$rem-base: 16px !default;
+
+// IMPORT ONCE
+// We use this to prevent styles from being loaded multiple times for compenents that rely on other components.
+$modules: () !default;
+@mixin exports($name) {
+ @if (index($modules, $name) == false) {
+ $modules: append($modules, $name);
+ @content;
+ }
+}
+
+//
+// @functions
+//
+
+
+// RANGES
+// We use these functions to define ranges for various things, like media queries.
+@function lower-bound($range){
+ @if length($range) <= 0 {
+ @return 0;
+ }
+ @return nth($range,1);
+}
+
+@function upper-bound($range) {
+ @if length($range) < 2 {
+ @return 999999999999;
+ }
+ @return nth($range, 2);
+}
+
+// STRIP UNIT
+// It strips the unit of measure and returns it
+@function strip-unit($num) {
+ @return $num / ($num * 0 + 1);
+}
+
+// CONVERT TO REM
+@function convert-to-rem($value, $base-value: $rem-base) {
+ $value: strip-unit($value) / strip-unit($base-value) * 1rem;
+ @if ($value == 0rem) { $value: 0; } // Turn 0rem into 0
+ @return $value;
+}
+
+@function data($attr) {
+ @if $namespace {
+ @return '[data-' + $namespace + '-' + $attr + ']';
+ }
+
+ @return '[data-' + $attr + ']';
+}
+
+// REM CALC
+
+// New Syntax, allows to optionally calculate on a different base value to counter compounding effect of rem's.
+// Call with 1, 2, 3 or 4 parameters, 'px' is not required but supported:
+//
+// rem-calc(10 20 30px 40);
+//
+// Space delimited, if you want to delimit using comma's, wrap it in another pair of brackets
+//
+// rem-calc((10, 20, 30, 40px));
+//
+// Optionally call with a different base (eg: 8px) to calculate rem.
+//
+// rem-calc(16px 32px 48px, 8px);
+//
+// If you require to comma separate your list
+//
+// rem-calc((16px, 32px, 48), 8px);
+
+@function rem-calc($values, $base-value: $rem-base) {
+ $max: length($values);
+
+ @if $max == 1 { @return convert-to-rem(nth($values, 1), $base-value); }
+
+ $remValues: ();
+ @for $i from 1 through $max {
+ $remValues: append($remValues, convert-to-rem(nth($values, $i), $base-value));
+ }
+ @return $remValues;
+}
+
+// OLD EM CALC
+// Deprecated: We'll drop support for this in 5.1.0, use rem-calc()
+@function emCalc($values){
+ @return rem-calc($values);
+}
+
+// OLD EM CALC
+// Deprecated: We'll drop support for this in 5.1.0, use rem-calc()
+@function em-calc($values){
+ @return rem-calc($values);
+}
\ No newline at end of file
--- /dev/null
+//
+// FOUNDATION SETTINGS
+//
+
+// This is the default html and body font-size for the base rem value.
+// $rem-base: 16px;
+
+// Allows the use of rem-calc() or lower-bound() in your settings
+@import "foundation/functions";
+
+// $experimental: true;
+
+// The default font-size is set to 100% of the browser style sheet (usually 16px)
+// for compatibility with browser-based text zoom or user-set defaults.
+
+// Since the typical default browser font-size is 16px, that makes the calculation for grid size.
+// If you want your base font-size to be different and not have it affect the grid breakpoints,
+// set $rem-base to $base-font-size and make sure $base-font-size is a px value.
+// $base-font-size: 100%;
+
+// The $base-line-height is 100% while $base-font-size is 150%
+// $base-line-height: 150%;
+
+// We use this to control whether or not CSS classes come through in the gem files.
+// $include-html-classes: true;
+// $include-print-styles: true;
+// $include-html-global-classes: $include-html-classes;
+
+// Grid
+
+// $include-html-grid-classes: $include-html-classes;
+// $include-xl-html-grid-classes: false;
+
+// $row-width: rem-calc(1000);
+// $column-gutter: rem-calc(30);
+// $total-columns: 12;
+
+// We use these to control various global styles
+// $body-bg: #fff;
+// $body-font-color: #222;
+// $body-font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif;
+// $body-font-weight: normal;
+// $body-font-style: normal;
+
+// We use this to control font-smoothing
+// $font-smoothing: antialiased;
+
+// We use these to control text direction settings
+// $text-direction: ltr;
+// $opposite-direction: right;
+// $default-float: left;
+
+// We use these as default colors throughout
+// $primary-color: #008CBA;
+// $secondary-color: #e7e7e7;
+// $alert-color: #f04124;
+// $success-color: #43AC6A;
+// $warning-color: #f08a24;
+// $info-color: #a0d3e8;
+
+// We use these to make sure border radius matches unless we want it different.
+// $global-radius: 3px;
+// $global-rounded: 1000px;
+
+// We use these to control inset shadow shiny edges and depressions.
+// $shiny-edge-size: 0 1px 0;
+// $shiny-edge-color: rgba(#fff, .5);
+// $shiny-edge-active-color: rgba(#000, .2);
+
+// Media Query Ranges
+// $small-range: (0em, 40em);
+// $medium-range: (40.063em, 64em);
+// $large-range: (64.063em, 90em);
+// $xlarge-range: (90.063em, 120em);
+// $xxlarge-range: (120.063em);
+
+// $screen: "only screen";
+
+// $landscape: "#{$screen} and (orientation: landscape)";
+// $portrait: "#{$screen} and (orientation: portrait)";
+
+// $small-up: $screen;
+// $small-only: "#{$screen} and (max-width: #{upper-bound($small-range)})";
+
+// $medium-up: "#{$screen} and (min-width:#{lower-bound($medium-range)})";
+// $medium-only: "#{$screen} and (min-width:#{lower-bound($medium-range)}) and (max-width:#{upper-bound($medium-range)})";
+
+// $large-up: "#{$screen} and (min-width:#{lower-bound($large-range)})";
+// $large-only: "#{$screen} and (min-width:#{lower-bound($large-range)}) and (max-width:#{upper-bound($large-range)})";
+
+// $xlarge-up: "#{$screen} and (min-width:#{lower-bound($xlarge-range)})";
+// $xlarge-only: "#{$screen} and (min-width:#{lower-bound($xlarge-range)}) and (max-width:#{upper-bound($xlarge-range)})";
+
+// $xxlarge-up: "#{$screen} and (min-width:#{lower-bound($xxlarge-range)})";
+// $xxlarge-only: "#{$screen} and (min-width:#{lower-bound($xxlarge-range)}) and (max-width:#{upper-bound($xxlarge-range)})";
+
+// Legacy
+// $small: $medium-up;
+// $medium: $medium-up;
+// $large: $large-up;
+
+//We use this as cursors values for enabling the option of having custom cursors in the whole site's stylesheet
+// $cursor-crosshair-value: crosshair;
+// $cursor-default-value: default;
+// $cursor-pointer-value: pointer;
+// $cursor-help-value: help;
+// $cursor-text-value: text;
+
+//
+// TYPOGRAPHY
+//
+
+// $include-html-type-classes: $include-html-classes;
+
+// We use these to control header font styles
+// $header-font-family: $body-font-family;
+// $header-font-weight: 300;
+// $header-font-style: normal;
+// $header-font-color: #222;
+// $header-line-height: 1.4;
+// $header-top-margin: .2rem;
+// $header-bottom-margin: .5rem;
+// $header-text-rendering: optimizeLegibility;
+
+// We use these to control header font sizes
+// $h1-font-size: rem-calc(44);
+// $h2-font-size: rem-calc(37);
+// $h3-font-size: rem-calc(27);
+// $h4-font-size: rem-calc(23);
+// $h5-font-size: rem-calc(18);
+// $h6-font-size: 1rem;
+
+// These control how subheaders are styled.
+// $subheader-line-height: 1.4;
+// $subheader-font-color: scale-color($header-font-color, $lightness: 35%);
+// $subheader-font-weight: 300;
+// $subheader-top-margin: .2rem;
+// $subheader-bottom-margin: .5rem;
+
+// A general <small> styling
+// $small-font-size: 60%;
+// $small-font-color: scale-color($header-font-color, $lightness: 35%);
+
+// We use these to style paragraphs
+// $paragraph-font-family: inherit;
+// $paragraph-font-weight: normal;
+// $paragraph-font-size: 1rem;
+// $paragraph-line-height: 1.6;
+// $paragraph-margin-bottom: rem-calc(20);
+// $paragraph-aside-font-size: rem-calc(14);
+// $paragraph-aside-line-height: 1.35;
+// $paragraph-aside-font-style: italic;
+// $paragraph-text-rendering: optimizeLegibility;
+
+// We use these to style <code> tags
+// $code-color: scale-color($alert-color, $lightness: -27%);
+// $code-font-family: Consolas, 'Liberation Mono', Courier, monospace;
+// $code-font-weight: bold;
+
+// We use these to style anchors
+// $anchor-text-decoration: none;
+// $anchor-font-color: $primary-color;
+// $anchor-font-color-hover: scale-color($primary-color, $lightness: -14%);
+
+// We use these to style the <hr> element
+// $hr-border-width: 1px;
+// $hr-border-style: solid;
+// $hr-border-color: #ddd;
+// $hr-margin: rem-calc(20);
+
+// We use these to style lists
+// $list-style-position: outside;
+// $list-side-margin: 1.1rem;
+// $list-ordered-side-margin: 1.4rem;
+// $list-side-margin-no-bullet: 0;
+// $list-nested-margin: rem-calc(20);
+// $definition-list-header-weight: bold;
+// $definition-list-header-margin-bottom: .3rem;
+// $definition-list-margin-bottom: rem-calc(12);
+
+// We use these to style blockquotes
+// $blockquote-font-color: scale-color($header-font-color, $lightness: 35%);
+// $blockquote-padding: rem-calc(9 20 0 19);
+// $blockquote-border: 1px solid #ddd;
+// $blockquote-cite-font-size: rem-calc(13);
+// $blockquote-cite-font-color: scale-color($header-font-color, $lightness: 23%);
+// $blockquote-cite-link-color: $blockquote-cite-font-color;
+
+// Acronym styles
+// $acronym-underline: 1px dotted #ddd;
+
+// We use these to control padding and margin
+// $microformat-padding: rem-calc(10 12);
+// $microformat-margin: rem-calc(0 0 20 0);
+
+// We use these to control the border styles
+// $microformat-border-width: 1px;
+// $microformat-border-style: solid;
+// $microformat-border-color: #ddd;
+
+// We use these to control full name font styles
+// $microformat-fullname-font-weight: bold;
+// $microformat-fullname-font-size: rem-calc(15);
+
+// We use this to control the summary font styles
+// $microformat-summary-font-weight: bold;
+
+// We use this to control abbr padding
+// $microformat-abbr-padding: rem-calc(0 1);
+
+// We use this to control abbr font styles
+// $microformat-abbr-font-weight: bold;
+// $microformat-abbr-font-decoration: none;
+
+// Accordion
+
+// $include-html-accordion-classes: $include-html-classes;
+
+// $accordion-navigation-padding: rem-calc(16);
+// $accordion-navigation-bg-color: #efefef ;
+// $accordion-navigation-hover-bg-color: scale-color($accordion-navigation-bg-color, $lightness: -5%);
+// $accordion-navigation-active-bg-color: scale-color($accordion-navigation-bg-color, $lightness: -3%);
+// $accordion-navigation-font-color: #222;
+// $accordion-navigation-font-size: rem-calc(16);
+// $accordion-navigation-font-family: $body-font-family;
+
+// $accordion-content-padding: $column-gutter/2;
+// $accordion-content-active-bg-color: #fff;
+
+// Alert Boxes
+
+// $include-html-alert-classes: $include-html-classes;
+
+// We use this to control alert padding.
+// $alert-padding-top: rem-calc(14);
+// $alert-padding-default-float: $alert-padding-top;
+// $alert-padding-opposite-direction: $alert-padding-top + rem-calc(10);
+// $alert-padding-bottom: $alert-padding-top;
+
+// We use these to control text style.
+// $alert-font-weight: normal;
+// $alert-font-size: rem-calc(13);
+// $alert-font-color: #fff;
+// $alert-font-color-alt: scale-color($secondary-color, $lightness: -66%);
+
+// We use this for close hover effect.
+// $alert-function-factor: -14%;
+
+// We use these to control border styles.
+// $alert-border-style: solid;
+// $alert-border-width: 1px;
+// $alert-border-color: scale-color($primary-color, $lightness: $alert-function-factor);
+// $alert-bottom-margin: rem-calc(20);
+
+// We use these to style the close buttons
+// $alert-close-color: #333;
+// $alert-close-top: 50%;
+// $alert-close-position: rem-calc(5);
+// $alert-close-font-size: rem-calc(22);
+// $alert-close-opacity: 0.3;
+// $alert-close-opacity-hover: 0.5;
+// $alert-close-padding: 9px 6px 4px;
+
+// We use this to control border radius
+// $alert-radius: $global-radius;
+
+// Block Grid
+
+// $include-html-grid-classes: $include-html-classes;
+
+// We use this to control the maximum number of block grid elements per row
+// $block-grid-elements: 12;
+// $block-grid-default-spacing: rem-calc(20);
+
+// Enables media queries for block-grid classes. Set to false if writing semantic HTML.
+// $block-grid-media-queries: true;
+
+// Breadcrumbs
+
+// $include-html-nav-classes: $include-html-classes;
+
+// We use this to set the background color for the breadcrumb container.
+// $crumb-bg: scale-color($secondary-color, $lightness: 55%);
+
+// We use these to set the padding around the breadcrumbs.
+// $crumb-padding: rem-calc(9 14 9);
+// $crumb-side-padding: rem-calc(12);
+
+// We use these to control border styles.
+// $crumb-function-factor: -10%;
+// $crumb-border-size: 1px;
+// $crumb-border-style: solid;
+// $crumb-border-color: scale-color($crumb-bg, $lightness: $crumb-function-factor);
+// $crumb-radius: $global-radius;
+
+// We use these to set various text styles for breadcrumbs.
+// $crumb-font-size: rem-calc(11);
+// $crumb-font-color: $primary-color;
+// $crumb-font-color-current: #333;
+// $crumb-font-color-unavailable: #999;
+// $crumb-font-transform: uppercase;
+// $crumb-link-decor: underline;
+
+// We use these to control the slash between breadcrumbs
+// $crumb-slash-color: #aaa;
+// $crumb-slash: "/";
+
+//
+// BUTTONS
+//
+
+// $include-html-button-classes: $include-html-classes;
+
+// We use these to build padding for buttons.
+// $button-tny: rem-calc(10);
+// $button-sml: rem-calc(14);
+// $button-med: rem-calc(16);
+// $button-lrg: rem-calc(18);
+
+// We use this to control the display property.
+// $button-display: inline-block;
+// $button-margin-bottom: rem-calc(20);
+
+// We use these to control button text styles.
+// $button-font-family: $body-font-family;
+// $button-font-color: #fff;
+// $button-font-color-alt: #333;
+// $button-font-tny: rem-calc(11);
+// $button-font-sml: rem-calc(13);
+// $button-font-med: rem-calc(16);
+// $button-font-lrg: rem-calc(20);
+// $button-font-weight: normal;
+// $button-font-align: center;
+
+// We use these to control various hover effects.
+// $button-function-factor: 5%;
+
+// We use these to control button border styles.
+// $button-border-width: 1px;
+// $button-border-style: solid;
+
+// We use this to set the default radius used throughout the core.
+// $button-radius: $global-radius;
+// $button-round: $global-rounded;
+
+// We use this to set default opacity for disabled buttons.
+// $button-disabled-opacity: 0.7;
+
+// Button Groups
+
+// $include-html-button-classes: $include-html-classes;
+
+// Sets the margin for the right side by default, and the left margin if right-to-left direction is used
+// $button-bar-margin-opposite: rem-calc(10);
+// $button-group-border-width: 1px;
+
+// Clearing
+
+// $include-html-clearing-classes: $include-html-classes;
+
+// We use these to set the background colors for parts of Clearing.
+// $clearing-bg: #333;
+// $clearing-caption-bg: $clearing-bg;
+// $clearing-carousel-bg: rgba (51,51,51,0.8);
+// $clearing-img-bg: $clearing-bg;
+
+// We use these to style the close button
+// $clearing-close-color: #ccc;
+// $clearing-close-size: 30px;
+
+// We use these to style the arrows
+// $clearing-arrow-size: 12px;
+// $clearing-arrow-color: $clearing-close-color;
+
+// We use these to style captions
+// $clearing-caption-font-color: #ccc;
+// $clearing-caption-font-size: 0.875em;
+// $clearing-caption-padding: 10px 30px 20px;
+
+// We use these to make the image and carousel height and style
+// $clearing-active-img-height: 85%;
+// $clearing-carousel-height: 120px;
+// $clearing-carousel-thumb-width: 120px;
+// $clearing-carousel-thumb-active-border: 1px solid rgb(255,255,255);
+
+// Dropdown
+
+// $include-html-dropdown-classes: $include-html-classes;
+
+// We use these to controls height and width styles.
+// $f-dropdown-max-width: 200px;
+// $f-dropdown-height: auto;
+// $f-dropdown-max-height: none;
+// $f-dropdown-margin-top: 2px;
+
+// We use this to control the background color
+// $f-dropdown-bg: #fff;
+
+// We use this to set the border styles for dropdowns.
+// $f-dropdown-border-style: solid;
+// $f-dropdown-border-width: 1px;
+// $f-dropdown-border-color: scale-color(#fff, $lightness: -20%);
+
+// We use these to style the triangle pip.
+// $f-dropdown-triangle-size: 6px;
+// $f-dropdown-triangle-color: #fff;
+// $f-dropdown-triangle-side-offset: 10px;
+
+// We use these to control styles for the list elements.
+// $f-dropdown-list-style: none;
+// $f-dropdown-font-color: #555;
+// $f-dropdown-font-size: rem-calc(14);
+// $f-dropdown-list-padding: rem-calc(5, 10);
+// $f-dropdown-line-height: rem-calc(18);
+// $f-dropdown-list-hover-bg: #eeeeee ;
+// $dropdown-mobile-default-float: 0;
+
+// We use this to control the styles for when the dropdown has custom content.
+// $f-dropdown-content-padding: rem-calc(20);
+
+// Dropdown Buttons
+
+// $include-html-button-classes: $include-html-classes;
+
+// We use these to set the color of the pip in dropdown buttons
+// $dropdown-button-pip-color: #fff;
+// $dropdown-button-pip-color-alt: #333;
+
+// $button-pip-tny: rem-calc(6);
+// $button-pip-sml: rem-calc(7);
+// $button-pip-med: rem-calc(9);
+// $button-pip-lrg: rem-calc(11);
+
+// We use these to style tiny dropdown buttons
+// $dropdown-button-padding-tny: $button-pip-tny * 7;
+// $dropdown-button-pip-size-tny: $button-pip-tny;
+// $dropdown-button-pip-opposite-tny: $button-pip-tny * 3;
+// $dropdown-button-pip-top-tny: -$button-pip-tny / 2 + rem-calc(1);
+
+// We use these to style small dropdown buttons
+// $dropdown-button-padding-sml: $button-pip-sml * 7;
+// $dropdown-button-pip-size-sml: $button-pip-sml;
+// $dropdown-button-pip-opposite-sml: $button-pip-sml * 3;
+// $dropdown-button-pip-top-sml: -$button-pip-sml / 2 + rem-calc(1);
+
+// We use these to style medium dropdown buttons
+// $dropdown-button-padding-med: $button-pip-med * 6 + rem-calc(3);
+// $dropdown-button-pip-size-med: $button-pip-med - rem-calc(3);
+// $dropdown-button-pip-opposite-med: $button-pip-med * 2.5;
+// $dropdown-button-pip-top-med: -$button-pip-med / 2 + rem-calc(2);
+
+// We use these to style large dropdown buttons
+// $dropdown-button-padding-lrg: $button-pip-lrg * 5 + rem-calc(3);
+// $dropdown-button-pip-size-lrg: $button-pip-lrg - rem-calc(6);
+// $dropdown-button-pip-opposite-lrg: $button-pip-lrg * 2.5;
+// $dropdown-button-pip-top-lrg: -$button-pip-lrg / 2 + rem-calc(3);
+
+// Flex Video
+
+// $include-html-media-classes: $include-html-classes;
+
+// We use these to control video container padding and margins
+// $flex-video-padding-top: rem-calc(25);
+// $flex-video-padding-bottom: 67.5%;
+// $flex-video-margin-bottom: rem-calc(16);
+
+// We use this to control widescreen bottom padding
+// $flex-video-widescreen-padding-bottom: 57.25%;
+
+// Forms
+
+// $include-html-form-classes: $include-html-classes;
+
+// We use this to set the base for lots of form spacing and positioning styles
+// $form-spacing: rem-calc(16);
+
+// We use these to style the labels in different ways
+// $form-label-pointer: pointer;
+// $form-label-font-size: rem-calc(14);
+// $form-label-font-weight: normal;
+// $form-label-line-height: 1.5;
+// $form-label-font-color: scale-color(#000, $lightness: 30%);
+// $form-label-bottom-margin: 0;
+// $input-font-family: inherit;
+// $input-font-color: rgba(0,0,0,0.75);
+// $input-font-size: rem-calc(14);
+// $input-bg-color: #fff;
+// $input-focus-bg-color: scale-color(#fff, $lightness: -2%);
+// $input-border-color: scale-color(#fff, $lightness: -20%);
+// $input-focus-border-color: scale-color(#fff, $lightness: -40%);
+// $input-border-style: solid;
+// $input-border-width: 1px;
+// $input-border-radius: $global-radius;
+// $input-disabled-bg: #ddd;
+// $input-box-shadow: inset 0 1px 2px rgba(0,0,0,0.1);
+// $input-include-glowing-effect: true;
+
+// We use these to style the fieldset border and spacing.
+// $fieldset-border-style: solid;
+// $fieldset-border-width: 1px;
+// $fieldset-border-color: #ddd;
+// $fieldset-padding: rem-calc(20);
+// $fieldset-margin: rem-calc(18 0);
+
+// We use these to style the legends when you use them
+// $legend-bg: #fff;
+// $legend-font-weight: bold;
+// $legend-padding: rem-calc(0 3);
+
+// We use these to style the prefix and postfix input elements
+// $input-prefix-bg: scale-color(#fff, $lightness: -5%);
+// $input-prefix-border-color: scale-color(#fff, $lightness: -20%);
+// $input-prefix-border-size: 1px;
+// $input-prefix-border-type: solid;
+// $input-prefix-overflow: hidden;
+// $input-prefix-font-color: #333;
+// $input-prefix-font-color-alt: #fff;
+
+// We use these to style the error states for inputs and labels
+// $input-error-message-padding: rem-calc(6 9 9);
+// $input-error-message-top: -1px;
+// $input-error-message-font-size: rem-calc(12);
+// $input-error-message-font-weight: normal;
+// $input-error-message-font-style: italic;
+// $input-error-message-font-color: #fff;
+// $input-error-message-font-color-alt: #333;
+
+// We use this to style the glowing effect of inputs when focused
+// $glowing-effect-fade-time: 0.45s;
+// $glowing-effect-color: $input-focus-border-color;
+
+// Select variables
+// $select-bg-color: #fafafa;
+
+// Inline Lists
+
+// $include-html-inline-list-classes: $include-html-classes;
+
+// We use this to control the margins and padding of the inline list.
+// $inline-list-top-margin: 0;
+// $inline-list-opposite-margin: 0;
+// $inline-list-bottom-margin: rem-calc(17);
+// $inline-list-default-float-margin: rem-calc(-22);
+
+// $inline-list-padding: 0;
+
+// We use this to control the overflow of the inline list.
+// $inline-list-overflow: hidden;
+
+// We use this to control the list items
+// $inline-list-display: block;
+
+// We use this to control any elments within list items
+// $inline-list-children-display: block;
+
+// Joyride
+
+// $include-html-joyride-classes: $include-html-classes;
+
+// Controlling default Joyride styles
+// $joyride-tip-bg: #333;
+// $joyride-tip-default-width: 300px;
+// $joyride-tip-padding: rem-calc(18 20 24);
+// $joyride-tip-border: solid 1px #555;
+// $joyride-tip-radius: 4px;
+// $joyride-tip-position-offset: 22px;
+
+// Here, we're setting the tip dont styles
+// $joyride-tip-font-color: #fff;
+// $joyride-tip-font-size: rem-calc(14);
+// $joyride-tip-header-weight: bold;
+
+// This changes the nub size
+// $joyride-tip-nub-size: 10px;
+
+// This adjusts the styles for the timer when its enabled
+// $joyride-tip-timer-width: 50px;
+// $joyride-tip-timer-height: 3px;
+// $joyride-tip-timer-color: #666;
+
+// This changes up the styles for the close button
+// $joyride-tip-close-color: #777;
+// $joyride-tip-close-size: 24px;
+// $joyride-tip-close-weight: normal;
+
+// When Joyride is filling the screen, we use this style for the bg
+// $joyride-screenfill: rgba(0,0,0,0.5);
+
+// Keystrokes
+
+// $include-html-type-classes: $include-html-classes;
+
+// We use these to control text styles.
+// $keystroke-font: "Consolas", "Menlo", "Courier", monospace;
+// $keystroke-font-size: rem-calc(14);
+// $keystroke-font-color: #222;
+// $keystroke-font-color-alt: #fff;
+// $keystroke-function-factor: -7%;
+
+// We use this to control keystroke padding.
+// $keystroke-padding: rem-calc(2 4 0);
+
+// We use these to control background and border styles.
+// $keystroke-bg: scale-color(#fff, $lightness: $keystroke-function-factor);
+// $keystroke-border-style: solid;
+// $keystroke-border-width: 1px;
+// $keystroke-border-color: scale-color($keystroke-bg, $lightness: $keystroke-function-factor);
+// $keystroke-radius: $global-radius;
+
+// Labels
+
+// $include-html-label-classes: $include-html-classes;
+
+// We use these to style the labels
+// $label-padding: rem-calc(4 8 6);
+// $label-radius: $global-radius;
+
+// We use these to style the label text
+// $label-font-sizing: rem-calc(11);
+// $label-font-weight: normal;
+// $label-font-color: #333;
+// $label-font-color-alt: #fff;
+// $label-font-family: $body-font-family;
+
+// Magellan
+
+// $include-html-magellan-classes: $include-html-classes;
+
+// $magellan-bg: #fff;
+// $magellan-padding: 10px;
+
+// Off-canvas
+
+// $tabbar-bg: #333;
+// $tabbar-height: rem-calc(45);
+// $tabbar-line-height: $tabbar-height;
+// $tabbar-color: #FFF;
+// $tabbar-middle-padding: 0 rem-calc(10);
+
+// Off Canvas Divider Styles
+// $tabbar-right-section-border: solid 1px scale-color($tabbar-bg, $lightness: 13%);
+// $tabbar-left-section-border: solid 1px scale-color($tabbar-bg, $lightness: -50%);
+
+// Off Canvas Tab Bar Headers
+// $tabbar-header-color: #FFF;
+// $tabbar-header-weight: bold;
+// $tabbar-header-line-height: $tabbar-height;
+// $tabbar-header-margin: 0;
+
+// Off Canvas Menu Variables
+// $off-canvas-width: 250px;
+// $off-canvas-bg: #333;
+
+// Off Canvas Menu List Variables
+// $off-canvas-label-padding: 0.3rem rem-calc(15);
+// $off-canvas-label-color: #999;
+// $off-canvas-label-text-transform: uppercase;
+// $off-canvas-label-font-weight: bold;
+// $off-canvas-label-bg: #444;
+// $off-canvas-label-border-top: 1px solid scale-color(#444, $lightness: 14%);
+// $off-canvas-label-border-bottom: none;
+// $off-canvas-label-margin:0;
+// $off-canvas-link-padding: rem-calc(10, 15);
+// $off-canvas-link-color: rgba(#FFF, 0.7);
+// $off-canvas-link-border-bottom: 1px solid scale-color($off-canvas-bg, $lightness: -25%);
+
+// Off Canvas Menu Icon Variables
+// $tabbar-menu-icon-color: #FFF;
+// $tabbar-menu-icon-hover: scale-color($tabbar-menu-icon-color, $lightness: -30%);
+
+// $tabbar-menu-icon-text-indent: rem-calc(35);
+// $tabbar-menu-icon-width: $tabbar-height;
+// $tabbar-menu-icon-height: $tabbar-height;
+// $tabbar-menu-icon-line-height: rem-calc(33);
+// $tabbar-menu-icon-padding: 0;
+
+// $tabbar-hamburger-icon-width: rem-calc(16);
+// $tabbar-hamburger-icon-left: rem-calc(13);
+// $tabbar-hamburger-icon-top: rem-calc(5);
+
+// Off Canvas Back-Link Overlay
+// $off-canvas-overlay-transition: background 300ms ease;
+// $off-canvas-overlay-cursor: pointer;
+// $off-canvas-overlay-box-shadow: -4px 0 4px rgba(#000, 0.5), 4px 0 4px rgba(#000, 0.5);
+// $off-canvas-overlay-background: rgba(#FFF, 0.2);
+// $off-canvas-overlay-background-hover: rgba(#FFF, 0.05);
+
+// Transition Variables
+// $menu-slide: "transform 500ms ease";
+
+// Orbit
+
+// $include-html-orbit-classes: $include-html-classes;
+
+// We use these to control the caption styles
+// $orbit-container-bg: none;
+// $orbit-caption-bg: rgba(51,51,51, 0.8);
+// $orbit-caption-font-color: #fff;
+// $orbit-caption-font-size: rem-calc(14);
+// $orbit-caption-position: "bottom"; // Supported values: "bottom", "under"
+// $orbit-caption-padding: rem-calc(10 14);
+// $orbit-caption-height: auto;
+
+// We use these to control the left/right nav styles
+// $orbit-nav-bg: none;
+// $orbit-nav-bg-hover: rgba(0,0,0,0.3);
+// $orbit-nav-arrow-color: #fff;
+// $orbit-nav-arrow-color-hover: #fff;
+
+// We use these to control the timer styles
+// $orbit-timer-bg: rgba(255,255,255,0.3);
+// $orbit-timer-show-progress-bar: true;
+
+// We use these to control the bullet nav styles
+// $orbit-bullet-nav-color: #ccc;
+// $orbit-bullet-nav-color-active: #999;
+// $orbit-bullet-radius: rem-calc(9);
+
+// We use these to controls the style of slide numbers
+// $orbit-slide-number-bg: rgba(0,0,0,0);
+// $orbit-slide-number-font-color: #fff;
+// $orbit-slide-number-padding: rem-calc(5);
+
+// Graceful Loading Wrapper and preloader
+// $wrapper-class: "slideshow-wrapper";
+// $preloader-class: "preloader";
+
+// Pagination
+
+// $include-html-nav-classes: $include-html-classes;
+
+// We use these to control the pagination container
+// $pagination-height: rem-calc(24);
+// $pagination-margin: rem-calc(-5);
+
+// We use these to set the list-item properties
+// $pagination-li-float: $default-float;
+// $pagination-li-height: rem-calc(24);
+// $pagination-li-font-color: #222;
+// $pagination-li-font-size: rem-calc(14);
+// $pagination-li-margin: rem-calc(5);
+
+// We use these for the pagination anchor links
+// $pagination-link-pad: rem-calc(1 10 1);
+// $pagination-link-font-color: #999;
+// $pagination-link-active-bg: scale-color(#fff, $lightness: -10%);
+
+// We use these for disabled anchor links
+// $pagination-link-unavailable-cursor: default;
+// $pagination-link-unavailable-font-color: #999;
+// $pagination-link-unavailable-bg-active: transparent;
+
+// We use these for currently selected anchor links
+// $pagination-link-current-background: $primary-color;
+// $pagination-link-current-font-color: #fff;
+// $pagination-link-current-font-weight: bold;
+// $pagination-link-current-cursor: default;
+// $pagination-link-current-active-bg: $primary-color;
+
+// Panels
+
+// $include-html-panel-classes: $include-html-classes;
+
+// We use these to control the background and border styles
+// $panel-bg: scale-color(#fff, $lightness: -5%);
+// $panel-border-style: solid;
+// $panel-border-size: 1px;
+
+// We use this % to control how much we darken things on hover
+// $panel-function-factor: -11%;
+// $panel-border-color: scale-color($panel-bg, $lightness: $panel-function-factor);
+
+// We use these to set default inner padding and bottom margin
+// $panel-margin-bottom: rem-calc(20);
+// $panel-padding: rem-calc(20);
+
+// We use these to set default font colors
+// $panel-font-color: #333;
+// $panel-font-color-alt: #fff;
+
+// $panel-header-adjust: true;
+// $callout-panel-link-color: $primary-color;
+
+// Pricing Tables
+
+// $include-html-pricing-classes: $include-html-classes;
+
+// We use this to control the border color
+// $price-table-border: solid 1px #ddd;
+
+// We use this to control the bottom margin of the pricing table
+// $price-table-margin-bottom: rem-calc(20);
+
+// We use these to control the title styles
+// $price-title-bg: #333;
+// $price-title-padding: rem-calc(15 20);
+// $price-title-align: center;
+// $price-title-color: #eee;
+// $price-title-weight: normal;
+// $price-title-size: rem-calc(16);
+// $price-title-font-family: $body-font-family;
+
+// We use these to control the price styles
+// $price-money-bg: #f6f6f6 ;
+// $price-money-padding: rem-calc(15 20);
+// $price-money-align: center;
+// $price-money-color: #333;
+// $price-money-weight: normal;
+// $price-money-size: rem-calc(32);
+// $price-money-font-family: $body-font-family;
+
+
+// We use these to control the description styles
+// $price-bg: #fff;
+// $price-desc-color: #777;
+// $price-desc-padding: rem-calc(15);
+// $price-desc-align: center;
+// $price-desc-font-size: rem-calc(12);
+// $price-desc-weight: normal;
+// $price-desc-line-height: 1.4;
+// $price-desc-bottom-border: dotted 1px #ddd;
+
+// We use these to control the list item styles
+// $price-item-color: #333;
+// $price-item-padding: rem-calc(15);
+// $price-item-align: center;
+// $price-item-font-size: rem-calc(14);
+// $price-item-weight: normal;
+// $price-item-bottom-border: dotted 1px #ddd;
+
+// We use these to control the CTA area styles
+// $price-cta-bg: #fff;
+// $price-cta-align: center;
+// $price-cta-padding: rem-calc(20 20 0);
+
+// Progress Meters
+
+// $include-html-media-classes: $include-html-classes;
+
+// We use this to se the prog bar height
+// $progress-bar-height: rem-calc(25);
+// $progress-bar-color: #f6f6f6 ;
+
+// We use these to control the border styles
+// $progress-bar-border-color: scale-color(#fff, $lightness: -20%);
+// $progress-bar-border-size: 1px;
+// $progress-bar-border-style: solid;
+// $progress-bar-border-radius: $global-radius;
+
+// We use these to control the margin & padding
+// $progress-bar-pad: rem-calc(2);
+// $progress-bar-margin-bottom: rem-calc(10);
+
+// We use these to set the meter colors
+// $progress-meter-color: $primary-color;
+// $progress-meter-secondary-color: $secondary-color;
+// $progress-meter-success-color: $success-color;
+// $progress-meter-alert-color: $alert-color;
+
+// Reveal
+
+// $include-html-reveal-classes: $include-html-classes;
+
+// We use these to control the style of the reveal overlay.
+// $reveal-overlay-bg: rgba(#000, .45);
+// $reveal-overlay-bg-old: #000;
+
+// We use these to control the style of the modal itself.
+// $reveal-modal-bg: #fff;
+// $reveal-position-top: 50px;
+// $reveal-default-width: 80%;
+// $reveal-modal-padding: rem-calc(20);
+// $reveal-box-shadow: 0 0 10px rgba(#000,.4);
+
+// We use these to style the reveal close button
+// $reveal-close-font-size: rem-calc(22);
+// $reveal-close-top: rem-calc(8);
+// $reveal-close-side: rem-calc(11);
+// $reveal-close-color: #aaa;
+// $reveal-close-weight: bold;
+
+// We use these to control the modal border
+// $reveal-border-style: solid;
+// $reveal-border-width: 1px;
+// $reveal-border-color: #666;
+
+// $reveal-modal-class: "reveal-modal";
+// $close-reveal-modal-class: "close-reveal-modal";
+
+// Side Nav
+
+// $include-html-nav-classes: $include-html-classes;
+
+// We use this to control padding.
+// $side-nav-padding: rem-calc(14 0);
+
+// We use these to control list styles.
+// $side-nav-list-type: none;
+// $side-nav-list-position: inside;
+// $side-nav-list-margin: rem-calc(0 0 7 0);
+
+// We use these to control link styles.
+// $side-nav-link-color: $primary-color;
+// $side-nav-link-color-active: scale-color($side-nav-link-color, $lightness: 30%);
+// $side-nav-link-color-hover: scale-color($side-nav-link-color, $lightness: 30%);
+// $side-nav-font-size: rem-calc(14);
+// $side-nav-font-weight: normal;
+// $side-nav-font-family: $body-font-family;
+// $side-nav-active-font-family: $side-nav-font-family;
+
+
+
+// We use these to control border styles
+// $side-nav-divider-size: 1px;
+// $side-nav-divider-style: solid;
+// $side-nav-divider-color: scale-color(#fff, $lightness: -10%);
+
+// Split Buttons
+
+// $include-html-button-classes: $include-html-classes;
+
+// We use these to control different shared styles for Split Buttons
+// $split-button-function-factor: 10%;
+// $split-button-pip-color: #fff;
+// $split-button-pip-color-alt: #333;
+// $split-button-active-bg-tint: rgba(0,0,0,0.1);
+
+// We use these to control tiny split buttons
+// $split-button-padding-tny: $button-pip-tny * 10;
+// $split-button-span-width-tny: $button-pip-tny * 6;
+// $split-button-pip-size-tny: $button-pip-tny;
+// $split-button-pip-top-tny: $button-pip-tny * 2;
+// $split-button-pip-default-float-tny: rem-calc(-6);
+
+// We use these to control small split buttons
+// $split-button-padding-sml: $button-pip-sml * 10;
+// $split-button-span-width-sml: $button-pip-sml * 6;
+// $split-button-pip-size-sml: $button-pip-sml;
+// $split-button-pip-top-sml: $button-pip-sml * 1.5;
+// $split-button-pip-default-float-sml: rem-calc(-6);
+
+// We use these to control medium split buttons
+// $split-button-padding-med: $button-pip-med * 9;
+// $split-button-span-width-med: $button-pip-med * 5.5;
+// $split-button-pip-size-med: $button-pip-med - rem-calc(3);
+// $split-button-pip-top-med: $button-pip-med * 1.5;
+// $split-button-pip-default-float-med: rem-calc(-6);
+
+// We use these to control large split buttons
+// $split-button-padding-lrg: $button-pip-lrg * 8;
+// $split-button-span-width-lrg: $button-pip-lrg * 5;
+// $split-button-pip-size-lrg: $button-pip-lrg - rem-calc(6);
+// $split-button-pip-top-lrg: $button-pip-lrg + rem-calc(5);
+// $split-button-pip-default-float-lrg: rem-calc(-6);
+
+// Sub Nav
+
+// $include-html-nav-classes: $include-html-classes;
+
+// We use these to control margin and padding
+// $sub-nav-list-margin: rem-calc(-4 0 18);
+// $sub-nav-list-padding-top: rem-calc(4);
+
+// We use this to control the definition
+// $sub-nav-font-family: $body-font-family;
+// $sub-nav-font-size: rem-calc(14);
+// $sub-nav-font-color: #999;
+// $sub-nav-font-weight: normal;
+// $sub-nav-text-decoration: none;
+// $sub-nav-border-radius: 3px;
+// $sub-nav-font-color-hover: scale-color($sub-nav-font-color, $lightness: -25%);
+
+
+// We use these to control the active item styles
+
+// $sub-nav-active-font-weight: normal;
+// $sub-nav-active-bg: $primary-color;
+// $sub-nav-active-bg-hover: scale-color($sub-nav-active-bg, $lightness: -14%);
+// $sub-nav-active-color: #fff;
+// $sub-nav-active-padding: rem-calc(3 16);
+// $sub-nav-active-cursor: default;
+
+// $sub-nav-item-divider: "";
+// $sub-nav-item-divider-margin: rem-calc(12);
+
+//
+// SWITCH
+//
+
+// $include-html-form-classes: $include-html-classes;
+
+// Controlling border styles and background colors for the switch container
+// $switch-border-color: scale-color(#fff, $lightness: -20%);
+// $switch-border-style: solid;
+// $switch-border-width: 1px;
+// $switch-bg: #fff;
+
+// We use these to control the switch heights for our default classes
+// $switch-height-tny: 22px;
+// $switch-height-sml: 28px;
+// $switch-height-med: 36px;
+// $switch-height-lrg: 44px;
+// $switch-bottom-margin: rem-calc(20);
+
+// We use these to control default font sizes for our classes.
+// $switch-font-size-tny: 11px;
+// $switch-font-size-sml: 12px;
+// $switch-font-size-med: 14px;
+// $switch-font-size-lrg: 17px;
+// $switch-label-side-padding: 6px;
+
+// We use these to style the switch-paddle
+// $switch-paddle-bg: #fff;
+// $switch-paddle-fade-to-color: scale-color($switch-paddle-bg, $lightness: -10%);
+// $switch-paddle-border-color: scale-color($switch-paddle-bg, $lightness: -35%);
+// $switch-paddle-border-width: 1px;
+// $switch-paddle-border-style: solid;
+// $switch-paddle-transition-speed: .1s;
+// $switch-paddle-transition-ease: ease-out;
+// $switch-positive-color: scale-color($success-color, $lightness: 94%);
+// $switch-negative-color: #f5f5f5;
+
+// Outline Style for tabbing through switches
+// $switch-label-outline: 1px dotted #888;
+
+// Tables
+
+// $include-html-table-classes: $include-html-classes;
+
+// These control the background color for the table and even rows
+// $table-bg: #fff;
+// $table-even-row-bg: #f9f9f9 ;
+
+// These control the table cell border style
+// $table-border-style: solid;
+// $table-border-size: 1px;
+// $table-border-color: #ddd;
+
+// These control the table head styles
+// $table-head-bg: #f5f5f5 ;
+// $table-head-font-size: rem-calc(14);
+// $table-head-font-color: #222;
+// $table-head-font-weight: bold;
+// $table-head-padding: rem-calc(8 10 10);
+
+// These control the row padding and font styles
+// $table-row-padding: rem-calc(9 10);
+// $table-row-font-size: rem-calc(14);
+// $table-row-font-color: #222;
+// $table-line-height: rem-calc(18);
+
+// These are for controlling the display and margin of tables
+// $table-display: table-cell;
+// $table-margin-bottom: rem-calc(20);
+
+//
+// TABS
+//
+
+// $include-html-tabs-classes: $include-html-classes;
+
+// $tabs-navigation-padding: rem-calc(16);
+// $tabs-navigation-bg-color: #efefef ;
+// $tabs-navigation-active-bg-color: #fff;
+// $tabs-navigation-hover-bg-color: scale-color($tabs-navigation-bg-color, $lightness: -6%);
+// $tabs-navigation-font-color: #222;
+// $tabs-navigation-font-size: rem-calc(16);
+// $tabs-navigation-font-family: $body-font-family;
+
+// $tabs-content-margin-bottom: rem-calc(24);
+// $tabs-content-padding: $column-gutter/2;
+
+// $tabs-vertical-navigation-margin-bottom: 1.25rem;
+
+//
+// THUMBNAILS
+//
+
+// $include-html-media-classes: $include-html-classes;
+
+// We use these to control border styles
+// $thumb-border-style: solid;
+// $thumb-border-width: 4px;
+// $thumb-border-color: #fff;
+// $thumb-box-shadow: 0 0 0 1px rgba(#000,.2);
+// $thumb-box-shadow-hover: 0 0 6px 1px rgba($primary-color,0.5);
+
+// Radius and transition speed for thumbs
+// $thumb-radius: $global-radius;
+// $thumb-transition-speed: 200ms;
+
+//
+// TOOLTIPS
+//
+
+// $include-html-tooltip-classes: $include-html-classes;
+
+// $has-tip-border-bottom: dotted 1px #ccc;
+// $has-tip-font-weight: bold;
+// $has-tip-font-color: #333;
+// $has-tip-border-bottom-hover: dotted 1px scale-color($primary-color, $lightness: -55%);
+// $has-tip-font-color-hover: $primary-color;
+// $has-tip-cursor-type: help;
+
+// $tooltip-padding: rem-calc(12);
+// $tooltip-bg: #333;
+// $tooltip-font-size: rem-calc(14);
+// $tooltip-font-weight: normal;
+// $tooltip-font-color: #fff;
+// $tooltip-line-height: 1.3;
+// $tooltip-close-font-size: rem-calc(10);
+// $tooltip-close-font-weight: normal;
+// $tooltip-close-font-color: #777;
+// $tooltip-font-size-sml: rem-calc(14);
+// $tooltip-radius: $global-radius;
+// $tooltip-rounded: $global-rounded;
+// $tooltip-pip-size: 5px;
+
+//
+// TOP BAR
+//
+
+// $include-html-top-bar-classes: $include-html-classes;
+
+// Background color for the top bar
+// $topbar-bg-color: #333;
+// $topbar-bg: $topbar-bg-color;
+
+// Height and margin
+// $topbar-height: 45px;
+// $topbar-margin-bottom: 0;
+
+// Controlling the styles for the title in the top bar
+// $topbar-title-weight: normal;
+// $topbar-title-font-size: rem-calc(17);
+
+// Style the top bar dropdown elements
+// $topbar-dropdown-bg: #333;
+// $topbar-dropdown-link-color: #fff;
+// $topbar-dropdown-link-bg: #333;
+// $topbar-dropdown-link-weight: normal;
+// $topbar-dropdown-toggle-size: 5px;
+// $topbar-dropdown-toggle-color: #fff;
+// $topbar-dropdown-toggle-alpha: 0.4;
+
+// Set the link colors and styles for top-level nav
+// $topbar-link-color: #fff;
+// $topbar-link-color-hover: #fff;
+// $topbar-link-color-active: #fff;
+// $topbar-link-color-active-hover: #fff;
+// $topbar-link-weight: normal;
+// $topbar-link-font-size: rem-calc(13);
+// $topbar-link-hover-lightness: -10%; // Darken by 10%
+// $topbar-link-bg-hover: #272727 ;
+// $topbar-link-bg-active: $primary-color;
+// $topbar-link-bg-active-hover: scale-color($primary-color, $lightness: -14%);
+// $topbar-link-font-family: $body-font-family;
+
+// $topbar-button-font-size: 0.75rem;
+
+// $topbar-dropdown-label-color: #777;
+// $topbar-dropdown-label-text-transform: uppercase;
+// $topbar-dropdown-label-font-weight: bold;
+// $topbar-dropdown-label-font-size: rem-calc(10);
+// $topbar-dropdown-label-bg: #333;
+
+// Top menu icon styles
+// $topbar-menu-link-transform: uppercase;
+// $topbar-menu-link-font-size: rem-calc(13);
+// $topbar-menu-link-weight: bold;
+// $topbar-menu-link-color: #fff;
+// $topbar-menu-icon-color: #fff;
+// $topbar-menu-link-color-toggled: #888;
+// $topbar-menu-icon-color-toggled: #888;
+
+// Transitions and breakpoint styles
+// $topbar-transition-speed: 300ms;
+// Using rem-calc for the below breakpoint causes issues with top bar
+// $topbar-breakpoint: #{upper-bound($medium-range)}; // Change to 9999px for always mobile layout
+// $topbar-media-query: "only screen and (min-width: #{upper-bound($medium-range)})";
+
+// Divider Styles
+// $topbar-divider-border-bottom: solid 1px scale-color($topbar-bg-color, $lightness: 13%);
+// $topbar-divider-border-top: solid 1px scale-color($topbar-bg-color, $lightness: -50%);
+
+// Sticky Class
+// $topbar-sticky-class: ".sticky";
+// $topbar-arrows: true; //Set false to remove the triangle icon from the menu item
+
+//
+// VISIBILITY CLASSES
+//
+
+// $include-html-visibility-classes: $include-html-classes;
--- /dev/null
+@import "global";
+@import "grid";
+
+//
+// @variables
+//
+
+$include-html-accordion-classes: $include-html-classes !default;
+
+$accordion-navigation-padding: rem-calc(16) !default;
+$accordion-navigation-bg-color: #efefef !default;
+$accordion-navigation-hover-bg-color: scale-color($accordion-navigation-bg-color, $lightness: -5%) !default;
+$accordion-navigation-active-bg-color: scale-color($accordion-navigation-bg-color, $lightness: -3%) !default;
+$accordion-navigation-font-color: #222 !default;
+$accordion-navigation-font-size: rem-calc(16) !default;
+$accordion-navigation-font-family: $body-font-family !default;
+
+$accordion-content-padding: $column-gutter/2 !default;
+$accordion-content-active-bg-color: #fff !default;
+
+@include exports("accordion") {
+ @if $include-html-accordion-classes {
+ .accordion {
+ @include clearfix; margin-bottom: 0;
+ dd {
+ display: block;
+ margin-bottom: 0 !important;
+ &.active a { background: $accordion-navigation-active-bg-color; }
+ > a {
+ background: $accordion-navigation-bg-color;
+ color: $accordion-navigation-font-color;
+ padding: $accordion-navigation-padding;
+ display: block;
+ font-family: $accordion-navigation-font-family;
+ font-size: $accordion-navigation-font-size;
+ &:hover { background: $accordion-navigation-hover-bg-color; }
+ }
+ }
+ .content {
+ display: none;
+ padding: $accordion-content-padding;
+ &.active {
+ display: block;
+ background: $accordion-content-active-bg-color;
+ }
+ }
+ }
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// Alert Box Variables
+//
+$include-html-alert-classes: $include-html-classes !default;
+
+// We use this to control alert padding.
+$alert-padding-top: rem-calc(14) !default;
+$alert-padding-default-float: $alert-padding-top !default;
+$alert-padding-opposite-direction: $alert-padding-top + rem-calc(10) !default;
+$alert-padding-bottom: $alert-padding-top !default;
+
+// We use these to control text style.
+$alert-font-weight: normal !default;
+$alert-font-size: rem-calc(13) !default;
+$alert-font-color: #fff !default;
+$alert-font-color-alt: scale-color($secondary-color, $lightness: -66%) !default;
+
+// We use this for close hover effect.
+$alert-function-factor: -14% !default;
+
+// We use these to control border styles.
+$alert-border-style: solid !default;
+$alert-border-width: 1px !default;
+$alert-border-color: scale-color($primary-color, $lightness: $alert-function-factor) !default;
+$alert-bottom-margin: rem-calc(20) !default;
+
+// We use these to style the close buttons
+$alert-close-color: #333 !default;
+$alert-close-top: 50% !default;
+$alert-close-position: rem-calc(4) !default;
+$alert-close-font-size: rem-calc(22) !default;
+$alert-close-opacity: 0.3 !default;
+$alert-close-opacity-hover: 0.5 !default;
+$alert-close-padding: 9px 6px 4px !default;
+
+// We use this to control border radius
+$alert-radius: $global-radius !default;
+
+//
+// Alert Mixins
+//
+
+// We use this mixin to create a default alert base.
+@mixin alert-base {
+ border-style: $alert-border-style;
+ border-width: $alert-border-width;
+ display: block;
+ font-weight: $alert-font-weight;
+ margin-bottom: $alert-bottom-margin;
+ position: relative;
+ padding: $alert-padding-top $alert-padding-opposite-direction $alert-padding-bottom $alert-padding-default-float;
+ font-size: $alert-font-size;
+}
+
+// We use this mixin to add alert styles
+//
+// $bg - The background of the alert. Default: $primary-color.
+@mixin alert-style($bg:$primary-color) {
+
+ // This find the lightness percentage of the background color.
+ $bg-lightness: lightness($bg);
+
+ // We control which background color and border come through.
+ background-color: $bg;
+ border-color: scale-color($bg, $lightness: $alert-function-factor);
+
+ // We control the text color for you based on the background color.
+ @if $bg-lightness > 70% { color: $alert-font-color-alt; }
+ @else { color: $alert-font-color; }
+
+}
+
+// We use this to create the close button.
+@mixin alert-close {
+ font-size: $alert-close-font-size;
+ padding: $alert-close-padding;
+ line-height: 0;
+ position: absolute;
+ top: $alert-close-top;
+ margin-top: -($alert-close-font-size / 2);
+ #{$opposite-direction}: $alert-close-position;
+ color: $alert-close-color;
+ opacity: $alert-close-opacity;
+ &:hover,
+ &:focus { opacity: $alert-close-opacity-hover; }
+}
+
+// We use this to quickly create alerts with a single mixin.
+//
+// $bg - Background of alert. Default: $primary-color.
+// $radius - Radius of alert box. Default: false.
+@mixin alert($bg:$primary-color, $radius:false) {
+ @include alert-base;
+ @include alert-style($bg);
+ @include radius($radius);
+}
+
+@include exports("alert-box") {
+ @if $include-html-alert-classes {
+ .alert-box {
+ @include alert;
+
+ .close { @include alert-close; }
+
+ &.radius { @include radius($alert-radius); }
+ &.round { @include radius($global-rounded); }
+
+ &.success { @include alert-style($success-color); }
+ &.alert { @include alert-style($alert-color); }
+ &.secondary { @include alert-style($secondary-color); }
+ &.warning { @include alert-style($warning-color); }
+ &.info { @include alert-style($info-color); }
+ }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// Block Grid Variables
+//
+$include-html-grid-classes: $include-html-classes !default;
+
+// We use this to control the maximum number of block grid elements per row
+$block-grid-elements: 12 !default;
+$block-grid-default-spacing: rem-calc(20) !default;
+
+// Enables media queries for block-grid classes. Set to false if writing semantic HTML.
+$block-grid-media-queries: true !default;
+
+//
+// Block Grid Mixins
+//
+
+// Create a custom block grid
+//
+// $per-row - # of items to display per row. Default: false.
+// $spacing - # of ems to use as padding on each block item. Default: rem-calc(20).
+// $base-style - Apply a base style to block grid. Default: true.
+@mixin block-grid(
+ $per-row:false,
+ $spacing:$block-grid-default-spacing,
+ $include-spacing:true,
+ $base-style:true) {
+
+ @if $base-style {
+ display: block;
+ padding: 0;
+ margin: 0 (-$spacing/2);
+ @include clearfix;
+
+ &>li {
+ display: block;
+ height: auto;
+ float: $default-float;
+ @if $include-spacing {
+ padding: 0 ($spacing/2) $spacing;
+ }
+ }
+ }
+
+ @if $per-row {
+ &>li {
+ width: 100%/$per-row;
+ @if $include-spacing {
+ padding: 0 ($spacing/2) $spacing;
+ }
+ list-style: none;
+
+ &:nth-of-type(n) { clear: none; }
+ &:nth-of-type(#{$per-row}n+1) { clear: both; }
+ }
+ }
+
+}
+
+// Generate presentational markup for block grid.
+//
+// $size - Name of class to use, i.e. "large" will generate .large-block-grid-1, .large-block-grid-2, etc.
+@mixin block-grid-html-classes($size,$include-spacing) {
+ @for $i from 1 through $block-grid-elements {
+ .#{$size}-block-grid-#{($i)} {
+ @include block-grid($i,$block-grid-default-spacing,$include-spacing,false);
+ }
+ }
+}
+
+@include exports("block-grid") {
+ @if $include-html-grid-classes {
+
+ [class*="block-grid-"] { @include block-grid; }
+
+ @media #{$small-up} {
+ @include block-grid-html-classes($size:small,$include-spacing:false);
+ }
+
+ @media #{$medium-up} {
+ @include block-grid-html-classes($size:medium,$include-spacing:false);
+ }
+
+ @media #{$large-up} {
+ @include block-grid-html-classes($size:large,$include-spacing:false);
+ }
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// Breadcrumb Variables
+//
+$include-html-nav-classes: $include-html-classes !default;
+
+// We use this to set the background color for the breadcrumb container.
+$crumb-bg: scale-color($secondary-color, $lightness: 55%) !default;
+
+// We use these to set the padding around the breadcrumbs.
+$crumb-padding: rem-calc(9 14 9) !default;
+$crumb-side-padding: rem-calc(12) !default;
+
+// We use these to control border styles.
+$crumb-function-factor: -10% !default;
+$crumb-border-size: 1px !default;
+$crumb-border-style: solid !default;
+$crumb-border-color: scale-color($crumb-bg, $lightness: $crumb-function-factor) !default;
+$crumb-radius: $global-radius !default;
+
+// We use these to set various text styles for breadcrumbs.
+$crumb-font-size: rem-calc(11) !default;
+$crumb-font-color: $primary-color !default;
+$crumb-font-color-current: #333 !default;
+$crumb-font-color-unavailable: #999 !default;
+$crumb-font-transform: uppercase !default;
+$crumb-link-decor: underline !default;
+
+// We use these to control the slash between breadcrumbs
+$crumb-slash-color: #aaa !default;
+$crumb-slash: "/" !default;
+
+//
+// Breadcrumb Mixins
+//
+
+// We use this mixin to create a container around our breadcrumbs
+@mixin crumb-container {
+ display: block;
+ padding: $crumb-padding;
+ overflow: hidden;
+ margin-#{$default-float}: 0;
+ list-style: none;
+ border-style: $crumb-border-style;
+ border-width: $crumb-border-size;
+
+ // We control which background color and border come through.
+ background-color: $crumb-bg;
+ border-color: $crumb-border-color;
+}
+
+// We use this mixin to create breadcrumb styles from list items.
+@mixin crumbs {
+
+ // A normal state will make the links look and act like clickable breadcrumbs.
+ margin: 0;
+ float: $default-float;
+ font-size: $crumb-font-size;
+ text-transform: $crumb-font-transform;
+
+ &:hover a, &:focus a { text-decoration: $crumb-link-decor; }
+
+ a,
+ span {
+ text-transform: $crumb-font-transform;
+ color: $crumb-font-color;
+ }
+
+ // Current is for the link of the current page
+ &.current {
+ cursor: $cursor-default-value;
+ color: $crumb-font-color-current;
+ a {
+ cursor: $cursor-default-value;
+ color: $crumb-font-color-current;
+ }
+
+ &:hover, &:hover a,
+ &:focus, &:focus a { text-decoration: none; }
+ }
+
+ // Unavailable removed color and link styles so it looks inactive.
+ &.unavailable {
+ color: $crumb-font-color-unavailable;
+ a { color: $crumb-font-color-unavailable; }
+
+ &:hover,
+ &:hover a,
+ &:focus,
+ a:focus {
+ text-decoration: none;
+ color: $crumb-font-color-unavailable;
+ cursor: $cursor-default-value;
+ }
+ }
+
+ &:before {
+ content: "#{$crumb-slash}";
+ color: $crumb-slash-color;
+ margin: 0 $crumb-side-padding;
+ position: relative;
+ top: 1px;
+ }
+
+ &:first-child:before {
+ content: " ";
+ margin: 0;
+ }
+}
+
+@include exports("breadcrumbs") {
+ @if $include-html-nav-classes {
+ .breadcrumbs {
+ @include crumb-container;
+ @include radius($crumb-radius);
+
+ &>* {
+ @include crumbs;
+ }
+ }
+ }
+}
--- /dev/null
+@import "global";
+@import "buttons";
+
+
+//
+// Button Group Variables
+//
+$include-html-button-classes: $include-html-classes !default;
+
+// Sets the margin for the right side by default, and the left margin if right-to-left direction is used
+$button-bar-margin-opposite: rem-calc(10) !default;
+$button-group-border-width: 1px !default;
+
+//
+// Button Group Mixins
+//
+
+// We use this to add styles for a button group container
+@mixin button-group-container($styles:true, $float:false) {
+ @if $styles {
+ list-style: none;
+ margin: 0;
+ #{$default-float}: 0;
+ @include clearfix();
+ }
+ @if $float {
+ float: #{$default-float};
+ margin-#{$opposite-direction}: $button-bar-margin-opposite;
+ & div { overflow: hidden; }
+ }
+}
+
+// We use this to control styles for button groups
+@mixin button-group-style($radius:false, $even:false, $float:$default-float) {
+
+ > button, .button {
+ border-#{$default-float}: $button-group-border-width solid;
+ border-color: rgba(255, 255, 255, 0.5);
+ }
+
+ &:first-child {
+ button, .button {
+ border-#{$default-float}: 0;
+ }
+ }
+
+ // We use this to control the flow, or remove those styles completely.
+ @if $float {
+ margin: 0;
+ float: $float;
+ // Make sure the first child doesn't get the negative margin.
+ &:first-child { margin-#{$default-float}: 0; }
+ }
+
+ // We use these to control left and right radius on first/last buttons in the group.
+ @if $radius == true {
+ &:first-child,
+ &:first-child > a,
+ &:first-child > button,
+ &:first-child > .button { @include side-radius($default-float, $button-radius); }
+ &:last-child,
+ &:last-child > a,
+ &:last-child > button,
+ &:last-child > .button { @include side-radius($opposite-direction, $button-radius); }
+ }
+ @else if $radius {
+ &:first-child,
+ &:first-child > a,
+ &:first-child > button,
+ &:first-child > .button { @include side-radius($default-float, $radius); }
+ &:last-child,
+ &:last-child > a,
+ &:last-child > button,
+ &:last-child > .button { @include side-radius($opposite-direction, $radius); }
+ }
+
+ // We use this to make the buttons even width across their container
+ @if $even {
+ width: percentage((100/$even) / 100);
+ button, .button { width: 100%; }
+ }
+
+}
+
+@include exports("button-group") {
+ @if $include-html-button-classes {
+ .button-group { @include button-group-container;
+
+ li { @include button-group-style(); }
+
+ &.radius > * { @include button-group-style($radius:$button-radius, $float:null); }
+ &.round > * { @include button-group-style($radius:$button-round, $float:null); }
+
+ @for $i from 2 through 8 {
+ &.even-#{$i} li { @include button-group-style($even:$i, $float:null); }
+ }
+ }
+
+ .button-bar {
+ @include clearfix;
+ .button-group { @include button-group-container($styles:false,$float:true); }
+ }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-button-classes: $include-html-classes !default;
+
+// We use these to build padding for buttons.
+$button-tny: rem-calc(10) !default;
+$button-sml: rem-calc(14) !default;
+$button-med: rem-calc(16) !default;
+$button-lrg: rem-calc(18) !default;
+
+// We use this to control the display property.
+$button-display: inline-block !default;
+$button-margin-bottom: rem-calc(20) !default;
+
+// We use these to control button text styles.
+$button-font-family: $body-font-family !default;
+$button-font-color: #fff !default;
+$button-font-color-alt: #333 !default;
+$button-font-tny: rem-calc(11) !default;
+$button-font-sml: rem-calc(13) !default;
+$button-font-med: rem-calc(16) !default;
+$button-font-lrg: rem-calc(20) !default;
+$button-font-weight: normal !default;
+$button-font-align: center !default;
+
+// We use these to control various hover effects.
+$button-function-factor: -20% !default;
+
+// We use these to control button border styles.
+$button-border-width: 0px !default;
+$button-border-style: solid !default;
+
+// We use this to set the default radius used throughout the core.
+$button-radius: $global-radius !default;
+$button-round: $global-rounded !default;
+
+// We use this to set default opacity for disabled buttons.
+$button-disabled-opacity: 0.7 !default;
+
+
+//
+// @MIXIN
+//
+// We use this mixin to create a default button base.
+//
+// $style - Sets base styles. Can be set to false. Default: true.
+// $display - Used to control display property. Default: $button-display || inline-block
+
+@mixin button-base($style:true, $display:$button-display) {
+ @if $style {
+ border-style: $button-border-style;
+ border-width: $button-border-width;
+ cursor: $cursor-pointer-value;
+ font-family: $button-font-family;
+ font-weight: $button-font-weight;
+ line-height: normal;
+ margin: 0 0 $button-margin-bottom;
+ position: relative;
+ text-decoration: none;
+ text-align: $button-font-align;
+ }
+ @if $display { display: $display; }
+}
+
+// @MIXIN
+//
+// We use this mixin to add button size styles
+//
+// $padding - Used to build padding for buttons Default: $button-med ||= rem-calc(12)
+// $full-width - We can set $full-width:true to remove side padding extend width - Default: false
+// $is-input - <input>'s and <button>'s take on strange padding. We added this to help fix that. Default: false
+
+@mixin button-size($padding:$button-med, $full-width:false, $is-input:false) {
+
+ // We control which padding styles come through,
+ // these can be turned off by setting $padding:false
+ @if $padding {
+ padding-top: $padding;
+ padding-#{$opposite-direction}: $padding * 2;
+ padding-bottom: $padding + rem-calc(1);
+ padding-#{$default-float}: $padding * 2;
+
+ // We control the font-size based on mixin input.
+ @if $padding == $button-med { font-size: $button-font-med; }
+ @else if $padding == $button-tny { font-size: $button-font-tny; }
+ @else if $padding == $button-sml { font-size: $button-font-sml; }
+ @else if $padding == $button-lrg { font-size: $button-font-lrg; }
+/* @else { font-size: $padding - rem-calc(2); } */
+ }
+
+ // We can set $full-width:true to remove side padding extend width.
+ @if $full-width {
+ // We still need to check if $padding is set.
+ @if $padding {
+ padding-top: $padding;
+ padding-bottom: $padding + rem-calc(1);
+ } @else if $padding == false {
+ padding-top:0;
+ padding-bottom:0;
+ }
+ padding-right: 0;
+ padding-left: 0;
+ width: 100%;
+ }
+
+ // <input>'s and <button>'s take on strange padding. We added this to help fix that.
+ @if $is-input == $button-lrg {
+ padding-top: $is-input + rem-calc(.5);
+ padding-bottom: $is-input + rem-calc(.5);
+ -webkit-appearance: none;
+ border: none;
+ font-weight: $button-font-weight !important;
+ }
+ @else if $is-input {
+ padding-top: $is-input + rem-calc(1);
+ padding-bottom: $is-input;
+ -webkit-appearance: none;
+ border: none;
+ font-weight: $button-font-weight !important;
+ }
+}
+
+// @MIXIN
+//
+// We use this mixin to add button color styles
+//
+// $bg - Primary color set in settings file. Default: $primary-color.
+// $radius - If true, set to button radius which is $global-radius || explicitly set radius amount in px (ex. $radius:10px). Default: false
+// $disabled - We can set $disabled:true to create a disabled transparent button. Default: false
+@mixin button-style($bg:$primary-color, $radius:false, $disabled:false) {
+
+ // We control which background styles are used,
+ // these can be removed by setting $bg:false
+ @if $bg {
+ // This find the lightness percentage of the background color.
+ $bg-lightness: lightness($bg);
+
+ background-color: $bg;
+ border-color: scale-color($bg, $lightness: $button-function-factor);
+ &:hover,
+ &:focus { background-color: scale-color($bg, $lightness: $button-function-factor); }
+
+ // We control the text color for you based on the background color.
+ @if $bg-lightness > 70% {
+ color: $button-font-color-alt;
+ &:hover,
+ &:focus { color: $button-font-color-alt; }
+ }
+ @else {
+ color: $button-font-color;
+ &:hover,
+ &:focus { color: $button-font-color; }
+ }
+ }
+
+ // We can set $disabled:true to create a disabled transparent button.
+ @if $disabled {
+ cursor: $cursor-default-value;
+ opacity: $button-disabled-opacity;
+ @if $experimental {
+ -webkit-box-shadow: none;
+ }
+ box-shadow: none;
+ &:hover,
+ &:focus { background-color: $bg; }
+ }
+
+ // We can control how much button radius us used.
+ @if $radius == true { @include radius($button-radius); }
+ @else if $radius { @include radius($radius); }
+
+}
+
+// @MIXIN
+//
+// We use this to quickly create buttons with a single mixin. As @jaredhardy puts it, "the kitchen sink mixin"
+//
+// $padding - Used to build padding for buttons Default: $button-med ||= rem-calc(12)
+// $bg - Primary color set in settings file. Default: $primary-color.
+// $radius - If true, set to button radius which is $global-radius || explicitly set radius amount in px (ex. $radius:10px). Default:false.
+// $full-width - We can set $full-width:true to remove side padding extend width. Default:false.
+// $disabled - We can set $disabled:true to create a disabled transparent button. Default:false.
+// $is-input - <input>'s and <button>'s take on strange padding. We added this to help fix that. Default:false.
+// $is-prefix - Not used? Default:false.
+@mixin button($padding:$button-med, $bg:$primary-color, $radius:false, $full-width:false, $disabled:false, $is-input:false, $is-prefix:false) {
+ @include button-base;
+ @include button-size($padding, $full-width, $is-input);
+ @include button-style($bg, $radius, $disabled);
+}
+
+
+@include exports("button") {
+ @if $include-html-button-classes {
+
+ // Default styles applied outside of media query
+ button, .button {
+ @include button-base;
+ @include button-size;
+ @include button-style;
+
+ @include single-transition(background-color);
+ @include button-size($padding:false, $is-input:$button-med);
+
+ &.secondary { @include button-style($bg:$secondary-color); }
+ &.success { @include button-style($bg:$success-color); }
+ &.alert { @include button-style($bg:$alert-color); }
+
+ &.large { @include button-size($padding:$button-lrg); }
+ &.small { @include button-size($padding:$button-sml); }
+ &.tiny { @include button-size($padding:$button-tny); }
+ &.expand { @include button-size($padding:null,$full-width:true); }
+
+ &.left-align { text-align: left; text-indent: rem-calc(12); }
+ &.right-align { text-align: right; padding-right: rem-calc(12); }
+
+ &.radius { @include button-style($bg:false, $radius:true); }
+ &.round { @include button-style($bg:false, $radius:$button-round); }
+
+ &.disabled, &[disabled] { @include button-style($bg:$primary-color, $disabled:true);
+ &.secondary { @include button-style($bg:$secondary-color, $disabled:true); }
+ &.success { @include button-style($bg:$success-color, $disabled:true); }
+ &.alert { @include button-style($bg:$alert-color, $disabled:true); }
+ }
+ }
+
+ @media #{$medium-up} {
+ button, .button {
+ @include button-base($style:false, $display:inline-block);
+ @include button-size($padding:false, $full-width:false);
+ }
+ }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-clearing-classes: $include-html-classes !default;
+
+// We use these to set the background colors for parts of Clearing.
+$clearing-bg: #333 !default;
+$clearing-caption-bg: $clearing-bg !default;
+$clearing-carousel-bg: rgba(51,51,51,0.8) !default;
+$clearing-img-bg: $clearing-bg !default;
+
+// We use these to style the close button
+$clearing-close-color: #ccc !default;
+$clearing-close-size: 30px !default;
+
+// We use these to style the arrows
+$clearing-arrow-size: 12px !default;
+$clearing-arrow-color: $clearing-close-color !default;
+
+// We use these to style captions
+$clearing-caption-font-color: #ccc !default;
+$clearing-caption-font-size: 0.875em !default;
+$clearing-caption-padding: 10px 30px 20px !default;
+
+// We use these to make the image and carousel height and style
+$clearing-active-img-height: 85% !default;
+$clearing-carousel-height: 120px !default;
+$clearing-carousel-thumb-width: 120px !default;
+$clearing-carousel-thumb-active-border: 1px solid rgb(255,255,255) !default;
+
+@include exports("clearing") {
+ @if $include-html-clearing-classes {
+ // We decided to not create a mixin for Clearing because it relies
+ // on predefined classes and structure to work properly.
+ // The variables above should give enough control.
+
+ /* Clearing Styles */
+ .clearing-thumbs, #{data('clearing')} {
+ @include clearfix;
+ margin-bottom: 0;
+ margin-#{$default-float}: 0;
+ list-style: none;
+
+ li {
+ float: $default-float;
+ margin-#{$opposite-direction}: 10px;
+ }
+
+ &[class*="block-grid-"] li {
+ margin-#{$opposite-direction}: 0;
+ }
+ }
+
+ .clearing-blackout {
+ background: $clearing-bg;
+ position: fixed;
+ width: 100%;
+ height: 100%;
+ top: 0;
+ #{$default-float}: 0;
+ z-index: 998;
+
+ .clearing-close { display: block; }
+ }
+
+ .clearing-container {
+ position: relative;
+ z-index: 998;
+ height: 100%;
+ overflow: hidden;
+ margin: 0;
+ }
+
+ .clearing-touch-label {
+ position: absolute;
+ top: 50%;
+ left: 50%;
+ color: #aaa;
+ font-size: 0.6em;
+ }
+
+ .visible-img {
+ height: 95%;
+ position: relative;
+
+ img {
+ position: absolute;
+ #{$default-float}: 50%;
+ top: 50%;
+ margin-#{$default-float}: -50%;
+ max-height: 100%;
+ max-width: 100%;
+ }
+ }
+
+ .clearing-caption {
+ color: $clearing-caption-font-color;
+ font-size: $clearing-caption-font-size;
+ line-height: 1.3;
+ margin-bottom: 0;
+ text-align: center;
+ bottom: 0;
+ background: $clearing-caption-bg;
+ width: 100%;
+ padding: $clearing-caption-padding;
+ position: absolute;
+ #{$default-float}: 0;
+ }
+
+ .clearing-close {
+ z-index: 999;
+ padding-#{$default-float}: 20px;
+ padding-top: 10px;
+ font-size: $clearing-close-size;
+ line-height: 1;
+ color: $clearing-close-color;
+ display: none;
+
+ &:hover,
+ &:focus { color: #ccc; }
+ }
+
+ .clearing-assembled .clearing-container { height: 100%;
+ .carousel > ul { display: none; }
+ }
+
+ // If you want to show a lightbox, but only have a single image come through as the thumbnail
+ .clearing-feature li {
+ display: none;
+ &.clearing-featured-img {
+ display: block;
+ }
+ }
+
+ // Large screen overrides
+ @media #{$medium-up} {
+ .clearing-main-prev,
+ .clearing-main-next {
+ position: absolute;
+ height: 100%;
+ width: 40px;
+ top: 0;
+ & > span {
+ position: absolute;
+ top: 50%;
+ display: block;
+ width: 0;
+ height: 0;
+ border: solid $clearing-arrow-size;
+ &:hover { opacity: 0.8; }
+ }
+ }
+ .clearing-main-prev {
+ #{$default-float}: 0;
+ & > span {
+ #{$default-float}: 5px;
+ border-color: transparent;
+ border-#{$opposite-direction}-color: $clearing-arrow-color;
+ }
+ }
+ .clearing-main-next {
+ #{$opposite-direction}: 0;
+ & > span {
+ border-color: transparent;
+ border-#{$default-float}-color: $clearing-arrow-color;
+ }
+ }
+
+ .clearing-main-prev.disabled,
+ .clearing-main-next.disabled { opacity: 0.3; }
+
+ .clearing-assembled .clearing-container {
+
+ .carousel {
+ background: $clearing-carousel-bg;
+ height: $clearing-carousel-height;
+ margin-top: 10px;
+ text-align: center;
+
+ & > ul {
+ display: inline-block;
+ z-index: 999;
+ height: 100%;
+ position: relative;
+ float: none;
+
+ li {
+ display: block;
+ width: $clearing-carousel-thumb-width;
+ min-height: inherit;
+ float: $default-float;
+ overflow: hidden;
+ margin-#{$opposite-direction}: 0;
+ padding: 0;
+ position: relative;
+ cursor: $cursor-pointer-value;
+ opacity: 0.4;
+
+ &.fix-height {
+ img {
+ height: 100%;
+ max-width: none;
+ }
+ }
+
+ a.th {
+ border: none;
+ @if $experimental {
+ -webkit-box-shadow: none;
+ }
+ box-shadow: none;
+ display: block;
+ }
+
+ img {
+ cursor: $cursor-pointer-value !important;
+ width: 100% !important;
+ }
+
+ &.visible { opacity: 1; }
+ &:hover { opacity: 0.8; }
+ }
+ }
+ }
+
+ .visible-img {
+ background: $clearing-img-bg;
+ overflow: hidden;
+ height: $clearing-active-img-height;
+ }
+ }
+
+ .clearing-close {
+ position: absolute;
+ top: 10px;
+ #{$opposite-direction}: 20px;
+ padding-#{$default-float}: 0;
+ padding-top: 0;
+ }
+ }
+
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-button-classes: $include-html-classes !default;
+
+// We use these to set the color of the pip in dropdown buttons
+$dropdown-button-pip-color: #fff !default;
+$dropdown-button-pip-color-alt: #333 !default;
+
+$button-pip-tny: rem-calc(6) !default;
+$button-pip-sml: rem-calc(7) !default;
+$button-pip-med: rem-calc(9) !default;
+$button-pip-lrg: rem-calc(11) !default;
+
+// We use these to style tiny dropdown buttons
+$dropdown-button-padding-tny: $button-pip-tny * 7 !default;
+$dropdown-button-pip-size-tny: $button-pip-tny !default;
+$dropdown-button-pip-opposite-tny: $button-pip-tny * 3 !default;
+$dropdown-button-pip-top-tny: -$button-pip-tny / 2 + rem-calc(1) !default;
+
+// We use these to style small dropdown buttons
+$dropdown-button-padding-sml: $button-pip-sml * 7 !default;
+$dropdown-button-pip-size-sml: $button-pip-sml !default;
+$dropdown-button-pip-opposite-sml: $button-pip-sml * 3 !default;
+$dropdown-button-pip-top-sml: -$button-pip-sml / 2 + rem-calc(1) !default;
+
+// We use these to style medium dropdown buttons
+$dropdown-button-padding-med: $button-pip-med * 6 + rem-calc(3) !default;
+$dropdown-button-pip-size-med: $button-pip-med - rem-calc(3) !default;
+$dropdown-button-pip-opposite-med: $button-pip-med * 2.5 !default;
+$dropdown-button-pip-top-med: -$button-pip-med / 2 + rem-calc(2) !default;
+
+// We use these to style large dropdown buttons
+$dropdown-button-padding-lrg: $button-pip-lrg * 5 + rem-calc(3) !default;
+$dropdown-button-pip-size-lrg: $button-pip-lrg - rem-calc(6) !default;
+$dropdown-button-pip-opposite-lrg: $button-pip-lrg * 2.5 !default;
+$dropdown-button-pip-top-lrg: -$button-pip-lrg / 2 + rem-calc(3) !default;
+
+// @mixins
+//
+// Dropdown Button Mixin
+//
+// We use this mixin to build off of the button mixin and add dropdown button styles
+//
+// $padding - Determines the size of button you're working with. Default: medium. Options [tiny, small, medium, large]
+// $pip-color - Color of the little triangle that points to the dropdown. Default: #fff.
+// $base-style - Add in base-styles. This can be set to false. Default:true
+
+@mixin dropdown-button($padding:medium, $pip-color:#fff, $base-style:true) {
+
+ // We add in base styles, but they can be negated by setting to 'false'.
+ @if $base-style {
+ position: relative;
+
+ // This creates the base styles for the triangle pip
+ &:before {
+ position: absolute;
+ content: "";
+ width: 0;
+ height: 0;
+ display: block;
+ border-style: solid;
+ border-color: $dropdown-button-pip-color transparent transparent transparent;
+ top: 50%;
+ }
+ }
+
+ // If we're dealing with tiny buttons, use these styles
+ @if $padding == tiny {
+ padding-#{$opposite-direction}: $dropdown-button-padding-tny;
+ &:before {
+ border-width: $dropdown-button-pip-size-tny;
+ #{$opposite-direction}: $dropdown-button-pip-opposite-tny;
+ margin-top: $dropdown-button-pip-top-tny;
+ }
+ }
+
+ // If we're dealing with small buttons, use these styles
+ @if $padding == small {
+ padding-#{$opposite-direction}: $dropdown-button-padding-sml;
+ &:before {
+ border-width: $dropdown-button-pip-size-sml;
+ #{$opposite-direction}: $dropdown-button-pip-opposite-sml;
+ margin-top: $dropdown-button-pip-top-sml;
+ }
+ }
+
+ // If we're dealing with default (medium) buttons, use these styles
+ @if $padding == medium {
+ padding-#{$opposite-direction}: $dropdown-button-padding-med;
+ &:before {
+ border-width: $dropdown-button-pip-size-med;
+ #{$opposite-direction}: $dropdown-button-pip-opposite-med;
+ margin-top: $dropdown-button-pip-top-med;
+ }
+ }
+
+ // If we're dealing with large buttons, use these styles
+ @if $padding == large {
+ padding-#{$opposite-direction}: $dropdown-button-padding-lrg;
+ &:before {
+ border-width: $dropdown-button-pip-size-lrg;
+ #{$opposite-direction}: $dropdown-button-pip-opposite-lrg;
+ margin-top: $dropdown-button-pip-top-lrg;
+ }
+ }
+
+ // We can control the pip color. We didn't use logic in this case, just set it and forget it.
+ @if $pip-color {
+ &:before { border-color: $pip-color transparent transparent transparent; }
+ }
+}
+
+@include exports("dropdown-button") {
+ @if $include-html-button-classes {
+ .dropdown.button, button.dropdown { @include dropdown-button;
+ &.tiny { @include dropdown-button(tiny,$base-style:false); }
+ &.small { @include dropdown-button(small,$base-style:false); }
+ &.large { @include dropdown-button(large,$base-style:false); }
+ &.secondary:before { border-color: $dropdown-button-pip-color-alt transparent transparent transparent; }
+ }
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-dropdown-classes: $include-html-classes !default;
+
+// We use these to controls height and width styles.
+$f-dropdown-max-width: 200px !default;
+$f-dropdown-height: auto !default;
+$f-dropdown-max-height: none !default;
+$f-dropdown-margin-top: 2px !default;
+
+// We use this to control the background color
+$f-dropdown-bg: #fff !default;
+
+// We use this to set the border styles for dropdowns.
+$f-dropdown-border-style: solid !default;
+$f-dropdown-border-width: 1px !default;
+$f-dropdown-border-color: scale-color(#fff, $lightness: -20%) !default;
+
+// We use these to style the triangle pip.
+$f-dropdown-triangle-size: 6px !default;
+$f-dropdown-triangle-color: #fff !default;
+$f-dropdown-triangle-side-offset: 10px !default;
+
+// We use these to control styles for the list elements.
+$f-dropdown-list-style: none !default;
+$f-dropdown-font-color: #555 !default;
+$f-dropdown-font-size: rem-calc(14) !default;
+$f-dropdown-list-padding: rem-calc(5, 10) !default;
+$f-dropdown-line-height: rem-calc(18) !default;
+$f-dropdown-list-hover-bg: #eeeeee !default;
+$dropdown-mobile-default-float: 0 !default;
+
+// We use this to control the styles for when the dropdown has custom content.
+$f-dropdown-content-padding: rem-calc(20) !default;
+
+//
+// @mixins
+//
+//
+// NOTE: Make default max-width change between list and content types. Can add more width with classes, maybe .small, .medium, .large, etc.;
+// We use this to style the dropdown container element.
+// $content-list - Sets list-style. Default: list. Options: [list, content]
+// $triangle - Sets if dropdown has triangle. Default:true.
+// $max-width - Default: $f-dropdown-max-width || 200px.
+@mixin dropdown-container($content:list, $triangle:true, $max-width:$f-dropdown-max-width) {
+ position: absolute;
+ left: -9999px;
+ list-style: $f-dropdown-list-style;
+ margin-#{$default-float}: 0;
+
+ > *:first-child { margin-top: 0; }
+ > *:last-child { margin-bottom: 0; }
+
+ @if $content == list {
+ width: 100%;
+ max-height: $f-dropdown-max-height;
+ height: $f-dropdown-height;
+ background: $f-dropdown-bg;
+ border: $f-dropdown-border-style $f-dropdown-border-width $f-dropdown-border-color;
+ font-size: $rem-base;
+ z-index: 99;
+ }
+ @else if $content == content {
+ padding: $f-dropdown-content-padding;
+ width: 100%;
+ height: $f-dropdown-height;
+ max-height: $f-dropdown-max-height;
+ background: $f-dropdown-bg;
+ border: $f-dropdown-border-style $f-dropdown-border-width $f-dropdown-border-color;
+ font-size: $rem-base;
+ z-index: 99;
+ }
+
+ @if $triangle {
+ margin-top: $f-dropdown-margin-top;
+
+ &:before {
+ @include css-triangle($f-dropdown-triangle-size, $f-dropdown-triangle-color, bottom);
+ position: absolute;
+ top: -($f-dropdown-triangle-size * 2);
+ #{$default-float}: $f-dropdown-triangle-side-offset;
+ z-index: 99;
+ }
+ &:after {
+ @include css-triangle($f-dropdown-triangle-size + 1, $f-dropdown-border-color, bottom);
+ position: absolute;
+ top: -(($f-dropdown-triangle-size + 1) * 2);
+ #{$default-float}: $f-dropdown-triangle-side-offset - 1;
+ z-index: 98;
+ }
+
+ &.right:before {
+ left: auto;
+ right: $f-dropdown-triangle-side-offset;
+ }
+ &.right:after {
+ left: auto;
+ right: $f-dropdown-triangle-side-offset - 1;
+ }
+ }
+
+ @if $max-width { max-width: $max-width; }
+ @else { max-width: $f-dropdown-max-width; }
+
+}
+
+// @MIXIN
+//
+// We use this to style the list elements or content inside the dropdown.
+
+@mixin dropdown-style {
+ font-size: $f-dropdown-font-size;
+ cursor: $cursor-pointer-value;
+
+ line-height: $f-dropdown-line-height;
+ margin: 0;
+
+ &:hover,
+ &:focus { background: $f-dropdown-list-hover-bg; }
+
+ a {
+ display: block;
+ padding: $f-dropdown-list-padding;
+ color: $f-dropdown-font-color;
+ }
+}
+
+@include exports("dropdown") {
+ @if $include-html-dropdown-classes {
+
+ @media #{$small-only} {
+ .f-dropdown {
+ max-width: 100%;
+ #{$default-float}: $dropdown-mobile-default-float;
+ }
+ }
+
+ /* Foundation Dropdowns */
+ .f-dropdown {
+ @include dropdown-container(list);
+ // max-width: none;
+
+ li { @include dropdown-style; }
+
+ // You can also put custom content in these dropdowns
+ &.content { @include dropdown-container(content, $triangle:false); }
+
+ // Sizes
+ &.tiny { max-width: 200px; }
+ &.small { max-width: 300px; }
+ &.medium { max-width: 500px; }
+ &.large { max-width: 800px; }
+ }
+
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-media-classes: $include-html-classes !default;
+
+// We use these to control video container padding and margins
+$flex-video-padding-top: rem-calc(25) !default;
+$flex-video-padding-bottom: 67.5% !default;
+$flex-video-margin-bottom: rem-calc(16) !default;
+
+// We use this to control widescreen bottom padding
+$flex-video-widescreen-padding-bottom: 56.55% !default;
+
+//
+// @mixins
+//
+
+@mixin flex-video-container {
+ position: relative;
+ padding-top: $flex-video-padding-top;
+ padding-bottom: $flex-video-padding-bottom;
+ height: 0;
+ margin-bottom: $flex-video-margin-bottom;
+ overflow: hidden;
+
+ &.widescreen { padding-bottom: $flex-video-widescreen-padding-bottom; }
+ &.vimeo { padding-top: 0; }
+
+ iframe,
+ object,
+ embed,
+ video {
+ position: absolute;
+ top: 0;
+ #{$default-float}: 0;
+ width: 100%;
+ height: 100%;
+ }
+}
+
+@include exports("flex-video") {
+ @if $include-html-media-classes {
+ .flex-video { @include flex-video-container; }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+@import "buttons";
+
+//
+// @variables
+//
+$include-html-form-classes: $include-html-classes !default;
+
+// We use this to set the base for lots of form spacing and positioning styles
+$form-spacing: rem-calc(16) !default;
+
+// We use these to style the labels in different ways
+$form-label-pointer: pointer !default;
+$form-label-font-size: rem-calc(14) !default;
+$form-label-font-weight: normal !default;
+$form-label-line-height: 1.5 !default;
+$form-label-font-color: scale-color(#000, $lightness: 30%) !default;
+$form-label-bottom-margin: 0 !default;
+$input-font-family: inherit !default;
+$input-font-color: rgba(0,0,0,0.75) !default;
+$input-font-size: rem-calc(14) !default;
+$input-bg-color: #fff !default;
+$input-focus-bg-color: scale-color(#fff, $lightness: -2%) !default;
+$input-border-color: scale-color(#fff, $lightness: -20%) !default;
+$input-focus-border-color: scale-color(#fff, $lightness: -40%) !default;
+$input-border-style: solid !default;
+$input-border-width: 1px !default;
+$input-border-radius: $global-radius !default;
+$input-disabled-bg: #ddd !default;
+$input-box-shadow: inset 0 1px 2px rgba(0,0,0,0.1) !default;
+$input-include-glowing-effect: true !default;
+
+// We use these to style the fieldset border and spacing.
+$fieldset-border-style: solid !default;
+$fieldset-border-width: 1px !default;
+$fieldset-border-color: #ddd !default;
+$fieldset-padding: rem-calc(20) !default;
+$fieldset-margin: rem-calc(18 0) !default;
+
+// We use these to style the legends when you use them
+$legend-bg: #fff !default;
+$legend-font-weight: bold !default;
+$legend-padding: rem-calc(0 3) !default;
+
+// We use these to style the prefix and postfix input elements
+$input-prefix-bg: scale-color(#fff, $lightness: -5%) !default;
+$input-prefix-border-color: scale-color(#fff, $lightness: -20%) !default;
+$input-prefix-border-size: 1px !default;
+$input-prefix-border-type: solid !default;
+$input-prefix-overflow: hidden !default;
+$input-prefix-font-color: #333 !default;
+$input-prefix-font-color-alt: #fff !default;
+
+// We use these to style the error states for inputs and labels
+$input-error-message-padding: rem-calc(6 9 9) !default;
+$input-error-message-top: -1px;
+$input-error-message-font-size: rem-calc(12) !default;
+$input-error-message-font-weight: normal !default;
+$input-error-message-font-style: italic !default;
+$input-error-message-font-color: #fff !default;
+$input-error-message-font-color-alt: #333 !default;
+
+// We use this to style the glowing effect of inputs when focused
+$glowing-effect-fade-time: 0.45s !default;
+$glowing-effect-color: $input-focus-border-color !default;
+
+// Select variables
+$select-bg-color: #fafafa !default;
+
+
+//
+// @MIXINS
+//
+
+// We use this mixin to give us form styles for rows inside of forms
+@mixin form-row-base {
+ .row { margin: 0 ((-$form-spacing) / 2);
+
+ .column,
+ .columns { padding: 0 $form-spacing / 2; }
+
+ // Use this to collapse the margins of a form row
+ &.collapse { margin: 0;
+
+ .column,
+ .columns { padding: 0; }
+ input {
+ -moz-border-radius-bottom#{$opposite-direction}: 0;
+ -moz-border-radius-top#{$opposite-direction}: 0;
+ -webkit-border-bottom-#{$opposite-direction}-radius: 0;
+ -webkit-border-top-#{$opposite-direction}-radius: 0;
+ }
+
+ }
+ }
+ input.column,
+ input.columns,
+ textarea.column,
+ textarea.columns { padding-#{$default-float}: $form-spacing / 2; }
+}
+
+// @MIXIN
+//
+// We use this mixin to give all basic form elements their style
+@mixin form-element {
+ background-color: $input-bg-color;
+ font-family: $input-font-family;
+ border: $input-border-width $input-border-style $input-border-color;
+ @if $experimental {
+ -webkit-box-shadow: $input-box-shadow;
+ }
+ box-shadow: $input-box-shadow;
+ color: $input-font-color;
+ display: block;
+ font-size: $input-font-size;
+ margin: 0 0 $form-spacing 0;
+ padding: $form-spacing / 2;
+ height: ($input-font-size + ($form-spacing * 1.5) - rem-calc(1));
+ width: 100%;
+ @include box-sizing(border-box);
+ @if $input-include-glowing-effect {
+ @include block-glowing-effect(focus, $glowing-effect-fade-time, $glowing-effect-color);
+ }
+ // Basic focus styles
+ &:focus {
+ background: $input-focus-bg-color;
+ border-color: $input-focus-border-color;
+ outline: none;
+ }
+
+ // Disabled background input background color
+ &[disabled] { background-color: $input-disabled-bg; }
+}
+
+// @MIXIN
+//
+// We use this mixin to create form labels
+//
+// $alignment - Alignment options. Default: false. Options: [right, inline, false]
+// $base-style - Control whether or not the base styles come through. Default: true.
+@mixin form-label($alignment:false, $base-style:true) {
+
+ // Control whether or not the base styles come through.
+ @if $base-style {
+ font-size: $form-label-font-size;
+ color: $form-label-font-color;
+ cursor: $form-label-pointer;
+ display: block;
+ font-weight: $form-label-font-weight;
+ line-height: $form-label-line-height;
+ margin-bottom: $form-label-bottom-margin;
+ }
+
+ // Alignment options
+ @if $alignment == right {
+ float: none;
+ text-align: right;
+ }
+ @else if $alignment == inline {
+ margin: 0 0 $form-spacing 0;
+ padding: $form-spacing / 2 + rem-calc($input-border-width * 2) 0;
+ }
+}
+
+// We use this mixin to create postfix/prefix form Labels
+@mixin prefix-postfix-base {
+ display: block;
+ position: relative;
+ z-index: 2;
+ text-align: center;
+ width: 100%;
+ padding-top: 0;
+ padding-bottom: 0;
+ border-style: $input-prefix-border-type;
+ border-width: $input-prefix-border-size;
+ overflow: $input-prefix-overflow;
+ font-size: $form-label-font-size;
+ height: ($form-label-font-size + ($form-spacing * 1.5) - rem-calc(1));
+ line-height: ($form-label-font-size + ($form-spacing * 1.5) - rem-calc(1));
+}
+
+// @MIXIN
+//
+// We use this mixin to create prefix label styles
+// $bg - Default:$input-prefix-bg || scale-color(#fff, $lightness: -5%) !default;
+// $is-button - Toggle position settings if prefix is a button. Default:false
+//
+@mixin prefix($bg:$input-prefix-bg, $border:$input-prefix-border-color, $is-button:false) {
+
+ @if $bg {
+ $bg-lightness: lightness($bg);
+ background: $bg;
+ border-#{$opposite-direction}: none;
+
+ // Control the font color based on background brightness
+ @if $bg-lightness > 70% or $bg == yellow { color: $input-prefix-font-color; }
+ @else { color: $input-prefix-font-color-alt; }
+ }
+
+ @if $border {
+ border-color: $border;
+ }
+
+ @if $is-button {
+ padding-#{$default-float}: 0;
+ padding-#{$opposite-direction}: 0;
+ padding-top: 0;
+ padding-bottom: 0;
+ text-align: center;
+ line-height: rem-calc(34);
+ border: none;
+ }
+
+}
+
+// @MIXIN
+//
+// We use this mixin to create postfix label styles
+// $bg - Default:$input-prefix-bg || scale-color(#fff, $lightness: -5%) !default;
+// $is-button - Toggle position settings if prefix is a button. Default: false
+@mixin postfix($bg:$input-prefix-bg, $border:$input-prefix-border-color, $is-button:false) {
+
+ @if $bg {
+ $bg-lightness: lightness($bg);
+ background: $bg;
+ border-#{$default-float}: none;
+
+ // Control the font color based on background brightness
+ @if $bg-lightness > 70% or $bg == yellow { color: $input-prefix-font-color; }
+ @else { color: $input-prefix-font-color-alt; }
+ }
+
+ @if $border {
+ border-color: $border;
+ }
+
+ @if $is-button {
+ padding-#{$default-float}: 0;
+ padding-#{$opposite-direction}: 0;
+ padding-top: 0;
+ padding-bottom: 0;
+ text-align: center;
+ line-height: rem-calc(34);
+ border: none;
+ }
+
+}
+
+// We use this mixin to style fieldsets
+@mixin fieldset {
+ border: $fieldset-border-style $fieldset-border-width $fieldset-border-color;
+ padding: $fieldset-padding;
+ margin: $fieldset-margin;
+
+ // and legend styles
+ legend {
+ font-weight: $legend-font-weight;
+ background: $legend-bg;
+ padding: $legend-padding;
+ margin: 0;
+ margin-#{$default-float}: rem-calc(-3);
+ }
+}
+
+// @MIXIN
+//
+// We use this mixin to control border and background color of error inputs
+// $color - Default: $alert-color (found in settings file)
+@mixin form-error-color($color:$alert-color) {
+ border-color: $color;
+ background-color: rgba($color, 0.1);
+
+ // Go back to normal on focus
+ &:focus {
+ background: $input-focus-bg-color;
+ border-color: $input-focus-border-color;
+ }
+}
+
+// @MIXIN
+//
+// We use this simple mixin to style labels for error inputs
+// $color - Default:$alert-color. Found in settings file
+@mixin form-label-error-color($color:$alert-color) { color: $color; }
+
+// @MIXIN
+//
+// We use this mixin to create error message styles
+// $bg - Default: $alert-color (Found in settings file)
+@mixin form-error-message($bg:$alert-color) {
+ display: block;
+ padding: $input-error-message-padding;
+ margin-top: $input-error-message-top;
+ margin-bottom: $form-spacing;
+ font-size: $input-error-message-font-size;
+ font-weight: $input-error-message-font-weight;
+ font-style: $input-error-message-font-style;
+
+ // We can control the text color based on the brightness of the background.
+ $bg-lightness: lightness($bg);
+ background: $bg;
+ @if $bg-lightness < 70% or $bg == yellow { color: $input-error-message-font-color; }
+ @else { color: $input-error-message-font-color-alt; }
+}
+
+@include exports("form") {
+ @if $include-html-form-classes {
+ /* Standard Forms */
+ form { margin: 0 0 $form-spacing; }
+
+ /* Using forms within rows, we need to set some defaults */
+ form .row { @include form-row-base; }
+
+ /* Label Styles */
+ label { @include form-label;
+ &.right { @include form-label(right,false); }
+ &.inline { @include form-label(inline,false); }
+ /* Styles for required inputs */
+ small {
+ text-transform: capitalize;
+ color: scale-color($form-label-font-color, $lightness: 15%);
+ }
+ }
+
+ select {
+ -webkit-appearance: none !important;
+ background:
+ $select-bg-color
+ url('data:image/svg+xml;base64, PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZlcnNpb249IjEuMSIgeD0iMHB4IiB5PSIwcHgiIHdpZHRoPSI2cHgiIGhlaWdodD0iM3B4IiB2aWV3Qm94PSIwIDAgNiAzIiBlbmFibGUtYmFja2dyb3VuZD0ibmV3IDAgMCA2IDMiIHhtbDpzcGFjZT0icHJlc2VydmUiPjxwb2x5Z29uIHBvaW50cz0iNS45OTIsMCAyLjk5MiwzIC0wLjAwOCwwICIvPjwvc3ZnPg==') no-repeat;
+ background-position-x: 97%;
+ background-position-y: center;
+ border: $input-border-width $input-border-style $input-border-color;
+ padding: $form-spacing / 2;
+ font-size: $input-font-size;
+ @include radius(0);
+ &.radius { @include radius($global-radius); }
+ &:hover {
+ background:
+ scale-color($select-bg-color, $lightness: -3%)
+ url('data:image/svg+xml;base64, PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZlcnNpb249IjEuMSIgeD0iMHB4IiB5PSIwcHgiIHdpZHRoPSI2cHgiIGhlaWdodD0iM3B4IiB2aWV3Qm94PSIwIDAgNiAzIiBlbmFibGUtYmFja2dyb3VuZD0ibmV3IDAgMCA2IDMiIHhtbDpzcGFjZT0icHJlc2VydmUiPjxwb2x5Z29uIHBvaW50cz0iNS45OTIsMCAyLjk5MiwzIC0wLjAwOCwwICIvPjwvc3ZnPg==') no-repeat;
+ background-position-x: 97%;
+ background-position-y: center;
+ border-color: $input-focus-border-color;
+ }
+ }
+
+ select::-ms-expand {
+ display:none;
+ }
+
+ @-moz-document url-prefix() {
+ select { background: $select-bg-color; }
+ select:hover { background: scale-color($select-bg-color, $lightness: -3%); }
+ }
+ /* Attach elements to the beginning or end of an input */
+ .prefix,
+ .postfix { @include prefix-postfix-base; }
+
+ /* Adjust padding, alignment and radius if pre/post element is a button */
+ .postfix.button { @include button-size(false,false,false); @include postfix(false, false, true); }
+ .prefix.button { @include button-size(false,false,false); @include prefix(false, false, true); }
+
+ .prefix.button.radius { @include radius(0); @include side-radius(left, $button-radius); }
+ .postfix.button.radius { @include radius(0); @include side-radius(right, $button-radius); }
+ .prefix.button.round { @include radius(0); @include side-radius(left, $button-round); }
+ .postfix.button.round { @include radius(0); @include side-radius(right, $button-round); }
+
+ /* Separate prefix and postfix styles when on span or label so buttons keep their own */
+ span.prefix,label.prefix { @include prefix();
+ &.radius { @include radius(0); @include side-radius(left, $global-radius); }
+ }
+ span.postfix,label.postfix { @include postfix();
+ &.radius { @include radius(0); @include side-radius(right, $global-radius); }
+ }
+
+ /* We use this to get basic styling on all basic form elements */
+ input[type="text"],
+ input[type="password"],
+ input[type="date"],
+ input[type="datetime"],
+ input[type="datetime-local"],
+ input[type="month"],
+ input[type="week"],
+ input[type="email"],
+ input[type="number"],
+ input[type="search"],
+ input[type="tel"],
+ input[type="time"],
+ input[type="url"],
+ textarea {
+ -webkit-appearance: none;
+ @include form-element;
+ @if not $input-include-glowing-effect {
+ @include single-transition(all, 0.15s, linear);
+ }
+ &.radius {
+ @include radius($input-border-radius);
+ }
+ }
+
+ /* Add height value for select elements to match text input height */
+ select {
+ height: ($input-font-size + ($form-spacing * 1.5) - rem-calc(1));
+ }
+
+ /* Adjust margin for form elements below */
+ input[type="file"],
+ input[type="checkbox"],
+ input[type="radio"],
+ select {
+ margin: 0 0 $form-spacing 0;
+ }
+
+ input[type="checkbox"] + label,
+ input[type="radio"] + label {
+ display: inline-block;
+ margin-#{$default-float}: $form-spacing * .5;
+ margin-#{$opposite-direction}: $form-spacing;
+ margin-bottom: 0;
+ vertical-align: baseline;
+ }
+
+ /* Normalize file input width */
+ input[type="file"] {
+ width:100%;
+ }
+
+ /* We add basic fieldset styling */
+ fieldset {
+ @include fieldset;
+ }
+
+ /* Error Handling */
+
+ #{data('abide')} {
+ .error small.error, span.error, small.error {
+ @include form-error-message;
+ }
+ span.error, small.error { display: none; }
+ }
+
+ span.error, small.error {
+ @include form-error-message;
+ }
+
+ .error {
+ input,
+ textarea,
+ select {
+ margin-bottom: 0;
+ }
+
+ input[type="checkbox"],
+ input[type="radio"] {
+ margin-bottom: $form-spacing
+ }
+
+ label,
+ label.error {
+ @include form-label-error-color;
+ }
+
+ small.error {
+ @include form-error-message;
+ }
+
+ > label {
+ > small {
+ color: scale-color($form-label-font-color, $lightness: 15%);
+ background: transparent;
+ padding: 0;
+ text-transform: capitalize;
+ font-style: normal;
+ font-size: 60%;
+ margin: 0;
+ display: inline;
+ }
+ }
+
+ span.error-message {
+ display: block;
+ }
+ }
+
+ input.error,
+ textarea.error {
+ margin-bottom: 0;
+ }
+ label.error { @include form-label-error-color; }
+ }
+}
--- /dev/null
+@import "../functions";
+//
+// Foundation Variables
+//
+
+// Data attribute namespace
+// styles get applied to [data-mysite-plugin], etc
+$namespace: false !default;
+
+$experimental: true !default;
+
+// The default font-size is set to 100% of the browser style sheet (usually 16px)
+// for compatibility with browser-based text zoom or user-set defaults.
+
+// Since the typical default browser font-size is 16px, that makes the calculation for grid size.
+// If you want your base font-size to be different and not have it affect the grid breakpoints,
+// set $rem-base to $base-font-size and make sure $base-font-size is a px value.
+$base-font-size: 100% !default;
+
+// $base-line-height is 24px while $base-font-size is 16px
+$base-line-height: 150% !default;
+
+//
+// Global Foundation Mixins
+//
+
+// @mixins
+//
+// We use this to control border radius.
+// $radius - Default: $global-radius || 4px
+@mixin radius($radius:$global-radius) {
+ @if $radius {
+ @if $experimental {
+ -webkit-border-radius: $radius;
+ }
+ border-radius: $radius;
+ }
+}
+
+// @mixins
+//
+// We use this to create equal side border radius on elements.
+// $side - Options: left, right, top, bottom
+@mixin side-radius($side, $radius:$global-radius) {
+ @if $experimental {
+ -moz-border-radius-bottom#{$side}: $radius;
+ -moz-border-radius-top#{$side}: $radius;
+ -webkit-border-bottom-#{$side}-radius: $radius;
+ -webkit-border-top-#{$side}-radius: $radius;
+ }
+ border-bottom-#{$side}-radius: $radius;
+ border-top-#{$side}-radius: $radius;
+}
+
+// @mixins
+//
+// We can control whether or not we have inset shadows edges.
+// $active - Default: true, Options: false
+@mixin inset-shadow($active:true) {
+ @if $experimental {
+ -webkit-box-shadow: $shiny-edge-size $shiny-edge-color inset;
+ }
+ box-shadow: $shiny-edge-size $shiny-edge-color inset;
+
+ @if $active { &:active {
+ @if $experimental {
+ -webkit-box-shadow: $shiny-edge-size $shiny-edge-active-color inset;
+ }
+ box-shadow: $shiny-edge-size $shiny-edge-active-color inset; } }
+}
+
+// @mixins
+//
+// We use this to add transitions to elements
+// $property - Default: all, Options: http://www.w3.org/TR/css3-transitions/#animatable-properties
+// $speed - Default: 300ms
+// $ease - Default:ease-out, Options: http://css-tricks.com/almanac/properties/t/transition-timing-function/
+@mixin single-transition($property:all, $speed:300ms, $ease:ease-out) {
+ @if $experimental {
+ -webkit-transition: $property $speed $ease;
+ -moz-transition: $property $speed $ease;
+ }
+ transition: $property $speed $ease;
+}
+
+// @mixins
+//
+// We use this to add box-sizing across browser prefixes
+@mixin box-sizing($type:border-box) {
+ @if $experimental {
+ -moz-box-sizing: $type;
+ -webkit-box-sizing: $type;
+ }
+ box-sizing: $type;
+}
+
+// @mixins
+//
+// We use this to create equilateral triangles
+// $triangle-size - Used to set border-size. No default, set a px or em size.
+// $triangle-color - Used to set border-color which makes up triangle. No default
+// $triangle-direction - Used to determine which direction triangle points. Options: top, bottom, left, right
+@mixin css-triangle($triangle-size, $triangle-color, $triangle-direction) {
+ content: "";
+ display: block;
+ width: 0;
+ height: 0;
+ border: inset $triangle-size;
+ @if ($triangle-direction == top) {
+ border-color: $triangle-color transparent transparent transparent;
+ border-top-style: solid;
+ }
+ @if ($triangle-direction == bottom) {
+ border-color: transparent transparent $triangle-color transparent;
+ border-bottom-style: solid;
+ }
+ @if ($triangle-direction == left) {
+ border-color: transparent transparent transparent $triangle-color;
+ border-left-style: solid;
+ }
+ @if ($triangle-direction == right) {
+ border-color: transparent $triangle-color transparent transparent;
+ border-right-style: solid;
+ }
+}
+
+// We use this to do clear floats
+@mixin clearfix {
+ *zoom:1;
+ &:before, &:after { content: " "; display: table; }
+ &:after { clear: both; }
+}
+
+// @mixins
+//
+// We use this to add a glowing effect to block elements
+// $selector - Used for selector state. Default: focus, Options: hover, active, visited
+// $fade-time - Default: 300ms
+// $glowing-effect-color - Default: fade-out($primary-color, .25)
+@mixin block-glowing-effect($selector:focus, $fade-time:300ms, $glowing-effect-color:fade-out($primary-color, .25)) {
+ @if $experimental {
+ -webkit-transition: -webkit-box-shadow $fade-time, border-color $fade-time ease-in-out;
+ -moz-transition: -moz-box-shadow $fade-time, border-color $fade-time ease-in-out;
+ }
+ transition: box-shadow $fade-time, border-color $fade-time ease-in-out;
+
+ &:#{$selector} {
+ @if $experimental {
+ -webkit-box-shadow: 0 0 5px $glowing-effect-color;
+ -moz-box-shadow: 0 0 5px $glowing-effect-color;
+ }
+ box-shadow: 0 0 5px $glowing-effect-color;
+ border-color: $glowing-effect-color;
+ }
+}
+
+// @mixins
+//
+// We use this to translate elements in 2D
+// $horizontal: Default: 0
+// $vertical: Default: 0
+@mixin translate2d($horizontal:0, $vertical:0) {
+ @if $experimental {
+ -webkit-transform: translate($horizontal,$vertical);
+ -moz-transform: translate($horizontal,$vertical);
+ -ms-transform: translate($horizontal,$vertical);
+ -o-transform: translate($horizontal,$vertical);
+ }
+ transform: translate($horizontal,$vertical)
+}
+
+// We use these to control various global styles
+$body-bg: #fff !default;
+$body-font-color: #222 !default;
+$body-font-family: "Helvetica Neue", "Helvetica", Helvetica, Arial, sans-serif !default;
+$body-font-weight: normal !default;
+$body-font-style: normal !default;
+
+// We use this to control font-smoothing
+$font-smoothing: antialiased !default;
+
+// We use these to control text direction settings
+$text-direction: ltr !default;
+$default-float: left !default;
+$opposite-direction: right !default;
+@if $text-direction == ltr {
+ $default-float: left;
+ $opposite-direction: right;
+} @else {
+ $default-float: right;
+ $opposite-direction: left;
+}
+// We use these as default colors throughout
+$primary-color: #008CBA !default;
+$secondary-color: #e7e7e7 !default;
+$alert-color: #f04124 !default;
+$success-color: #43AC6A !default;
+$warning-color: #f08a24 !default;
+$info-color: #a0d3e8 !default;
+
+// We use these to make sure border radius matches unless we want it different.
+$global-radius: 3px !default;
+$global-rounded: 1000px !default;
+
+// We use these to control inset shadow shiny edges and depressions.
+$shiny-edge-size: 0 1px 0 !default;
+$shiny-edge-color: rgba(#fff, .5) !default;
+$shiny-edge-active-color: rgba(#000, .2) !default;
+
+// We use this to control whether or not CSS classes come through in the gem files.
+$include-html-classes: true !default;
+$include-print-styles: true !default;
+$include-html-global-classes: $include-html-classes !default;
+
+
+// Media Query Ranges
+$small-range: (0em, 40em) !default;
+$medium-range: (40.063em, 64em) !default;
+$large-range: (64.063em, 90em) !default;
+$xlarge-range: (90.063em, 120em) !default;
+$xxlarge-range: (120.063em, 99999999em) !default;
+
+
+$screen: "only screen" !default;
+
+$landscape: "#{$screen} and (orientation: landscape)" !default;
+$portrait: "#{$screen} and (orientation: portrait)" !default;
+
+$small-up: $screen !default;
+$small-only: "#{$screen} and (max-width: #{upper-bound($small-range)})" !default;
+
+$medium-up: "#{$screen} and (min-width:#{lower-bound($medium-range)})" !default;
+$medium-only: "#{$screen} and (min-width:#{lower-bound($medium-range)}) and (max-width:#{upper-bound($medium-range)})" !default;
+
+$large-up: "#{$screen} and (min-width:#{lower-bound($large-range)})" !default;
+$large-only: "#{$screen} and (min-width:#{lower-bound($large-range)}) and (max-width:#{upper-bound($large-range)})" !default;
+
+$xlarge-up: "#{$screen} and (min-width:#{lower-bound($xlarge-range)})" !default;
+$xlarge-only: "#{$screen} and (min-width:#{lower-bound($xlarge-range)}) and (max-width:#{upper-bound($xlarge-range)})" !default;
+
+$xxlarge-up: "#{$screen} and (min-width:#{lower-bound($xxlarge-range)})" !default;
+$xxlarge-only: "#{$screen} and (min-width:#{lower-bound($xxlarge-range)}) and (max-width:#{upper-bound($xxlarge-range)})" !default;
+
+// Legacy
+$small: $medium-up;
+$medium: $medium-up;
+$large: $large-up;
+
+
+//We use this as cursors values for enabling the option of having custom cursors in the whole site's stylesheet
+$cursor-crosshair-value: crosshair !default;
+$cursor-default-value: default !default;
+$cursor-pointer-value: pointer !default;
+$cursor-help-value: help !default;
+$cursor-text-value: text !default;
+
+
+@include exports("global") {
+ meta.foundation-version {
+ font-family: "/5.1.0/";
+ }
+ // Used to provide media query values for javascript components.
+ // Forward slash placed around everything to convince PhantomJS to read the value.
+ meta.foundation-mq-small {
+ font-family: "/" + unquote($small-only) + "/";
+ width: lower-bound($small-range);
+ }
+
+ meta.foundation-mq-medium {
+ font-family: "/" + unquote($medium-up) + "/";
+ width: lower-bound($medium-range);
+ }
+
+ meta.foundation-mq-large {
+ font-family: "/" + unquote($large-up) + "/";
+ width: lower-bound($large-range);
+ }
+
+ meta.foundation-mq-xlarge {
+ font-family: "/" + unquote($xlarge-up) + "/";
+ width: lower-bound($xlarge-range);
+ }
+
+ meta.foundation-mq-xxlarge {
+ font-family: "/" + unquote($xxlarge-up) + "/";
+ width: lower-bound($xxlarge-range);
+ }
+
+ meta.foundation-data-attribute-namespace {
+ font-family: #{$namespace};
+ }
+
+ // Must be 100% for off canvas to work
+ html, body { height: 100%; }
+
+ @if $include-html-global-classes {
+
+ // Set box-sizing globally to handle padding and border widths
+ *,
+ *:before,
+ *:after {
+ @include box-sizing(border-box);
+ }
+
+ html,
+ body { font-size: $base-font-size; }
+
+ // Default body styles
+ body {
+ background: $body-bg;
+ color: $body-font-color;
+ padding: 0;
+ margin: 0;
+ font-family: $body-font-family;
+ font-weight: $body-font-weight;
+ font-style: $body-font-style;
+ line-height: 1; // Set to $base-line-height to take on browser default of 150%
+ position: relative;
+ cursor: $cursor-default-value;
+ }
+
+ a:hover { cursor: $cursor-pointer-value; }
+
+ // Grid Defaults to get images and embeds to work properly
+ img,
+ object,
+ embed { max-width: 100%; height: auto; }
+
+ object,
+ embed { height: 100%; }
+ img { -ms-interpolation-mode: bicubic; }
+
+ #map_canvas,
+ .map_canvas {
+ img,
+ embed,
+ object { max-width: none !important;
+ }
+ }
+
+ // Miscellaneous useful HTML classes
+ .left { float: left !important; }
+ .right { float: right !important; }
+ .clearfix { @include clearfix; }
+ .hide { display: none; }
+
+ // Font smoothing
+ // Antialiased font smoothing works best for light text on a dark background.
+ // Apply to single elements instead of globally to body.
+ // Note this only applies to webkit-based desktop browsers and Firefox 25 (and later) on the Mac.
+ .antialiased { -webkit-font-smoothing: antialiased; -moz-osx-font-smoothing: grayscale; }
+
+ // Get rid of gap under images by making them display: inline-block; by default
+ img {
+ display: inline-block;
+ vertical-align: middle;
+ }
+
+ //
+ // Global resets for forms
+ //
+
+ // Make sure textarea takes on height automatically
+ textarea { height: auto; min-height: 50px; }
+
+ // Make select elements 100% width by default
+ select { width: 100%; }
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-grid-classes: $include-html-classes !default;
+$include-xl-html-grid-classes: false !default;
+
+$row-width: rem-calc(1000) !default;
+$column-gutter: rem-calc(30) !default;
+$total-columns: 12 !default;
+
+//
+// Grid Functions
+//
+
+// Deprecated: We'll drop support for this in 5.1, use grid-calc()
+@function gridCalc($colNumber, $totalColumns) {
+ @warn "gridCalc() is deprecated, use grid-calc()";
+ @return grid-calc($colNumber, $totalColumns);
+}
+
+// @FUNCTION
+// $colNumber - Found in settings file
+// $totalColumns - Found in settings file
+@function grid-calc($colNumber, $totalColumns) {
+ @return percentage(($colNumber / $totalColumns));
+}
+
+//
+// @mixins
+//
+
+// For creating container, nested, and collapsed rows.
+//
+//
+// $behavior - Any special behavior for this row? Default: false. Options: nest, collapse, nest-collapse, false.
+@mixin grid-row($behavior: false) {
+
+ // use @include grid-row(nest); to include a nested row
+ @if $behavior == nest {
+ width: auto;
+ margin-#{$default-float}: -($column-gutter/2);
+ margin-#{$opposite-direction}: -($column-gutter/2);
+ margin-top: 0;
+ margin-bottom: 0;
+ max-width: none;
+ }
+
+ // use @include grid-row(collapse); to collapsed a container row margins
+ @else if $behavior == collapse {
+ width: 100%;
+ margin: 0;
+ max-width: $row-width;
+ }
+
+ // use @include grid-row(nest-collapse); to collapse outer margins on a nested row
+ @else if $behavior == nest-collapse {
+ width: auto;
+ margin: 0;
+ max-width: none;
+ }
+
+ // use @include grid-row; to use a container row
+ @else {
+ width: 100%;
+ margin-#{$default-float}: auto;
+ margin-#{$opposite-direction}: auto;
+ margin-top: 0;
+ margin-bottom: 0;
+ max-width: $row-width;
+ }
+
+ // Clearfix for all rows
+ @include clearfix();
+}
+
+// Creates a column, should be used inside of a media query to control layouts
+//
+// $columns - The number of columns this should be
+// $last-column - Is this the last column? Default: false.
+// $center - Center these columns? Default: false.
+// $offset - # of columns to offset. Default: false.
+// $push - # of columns to push. Default: false.
+// $pull - # of columns to pull. Default: false.
+// $collapse - Get rid of gutter padding on column? Default: false.
+// $float - Should this float? Default: true. Options: true, false, left, right.
+@mixin grid-column(
+ $columns:false,
+ $last-column:false,
+ $center:false,
+ $offset:false,
+ $push:false,
+ $pull:false,
+ $collapse:false,
+ $float:true,
+ $position:false) {
+
+ // If positioned for default .column, include relative position
+ @if $position {
+ position: relative;
+ }
+
+ // If collapsed, get rid of gutter padding
+ @if $collapse {
+ padding-left: 0;
+ padding-right: 0;
+ }
+
+ // Gutter padding whenever a column isn't set to collapse
+ // (use $collapse:null to do nothing)
+ @else if $collapse == false {
+ padding-left: $column-gutter / 2;
+ padding-right: $column-gutter / 2;
+ }
+
+ // If a column number is given, calculate width
+ @if $columns {
+ width: grid-calc($columns, $total-columns);
+
+ // If last column, float naturally instead of to the right
+ @if $last-column { float: $opposite-direction; }
+ }
+
+ // Source Ordering, adds left/right depending on which you use.
+ @if $push { #{$default-float}: grid-calc($push, $total-columns); #{$opposite-direction}: auto; }
+ @if $pull { #{$opposite-direction}: grid-calc($pull, $total-columns); #{$default-float}: auto; }
+
+ @if $float {
+ @if $float == left or $float == true { float: $default-float; }
+ @else if $float == right { float: $opposite-direction; }
+ @else { float: none; }
+ }
+
+ // If centered, get rid of float and add appropriate margins
+ @if $center {
+ margin-#{$default-float}: auto;
+ margin-#{$opposite-direction}: auto;
+ float: none;
+ }
+
+ // If offset, calculate appropriate margins
+ @if $offset { margin-#{$default-float}: grid-calc($offset, $total-columns) !important; }
+
+}
+
+// Create presentational classes for grid
+//
+// $size - Name of class to use, i.e. "large" will generate .large-1, .large-2, etc.
+@mixin grid-html-classes($size) {
+
+ .column.#{$size}-centered,
+ .columns.#{$size}-centered { @include grid-column($center:true, $collapse:null, $float:false); }
+
+ .column.#{$size}-uncentered,
+ .columns.#{$size}-uncentered {
+ margin-#{$default-float}: 0;
+ margin-#{$opposite-direction}: 0;
+ float: $default-float;
+ }
+
+ .column.#{$size}-uncentered.opposite,
+ .columns.#{$size}-uncentered.opposite {
+ float: $opposite-direction;
+ }
+
+ @for $i from 0 through $total-columns - 1 {
+ .#{$size}-push-#{$i} {
+ @include grid-column($push:$i, $collapse:null, $float:false);
+ }
+ .#{$size}-pull-#{$i} {
+ @include grid-column($pull:$i, $collapse:null, $float:false);
+ }
+ }
+
+ .column,
+ .columns { @include grid-column($columns:false, $position:true); }
+
+
+ @for $i from 1 through $total-columns {
+ .#{$size}-#{$i} { @include grid-column($columns:$i,$collapse:null,$float:false); }
+ }
+
+ [class*="column"] + [class*="column"]:last-child { float: $opposite-direction; }
+ [class*="column"] + [class*="column"].end { float: $default-float; }
+
+
+ @for $i from 0 through $total-columns - 1 {
+ .#{$size}-offset-#{$i} { @include grid-column($offset:$i, $collapse:null,$float:false); }
+ }
+ .#{$size}-reset-order,
+ .#{$size}-reset-order {
+ margin-#{$default-float}: 0;
+ margin-#{$opposite-direction}: 0;
+ left: auto;
+ right: auto;
+ float: $default-float;
+ }
+}
+
+@include exports("grid") {
+ @if $include-html-grid-classes {
+ .row {
+ @include grid-row;
+
+ &.collapse {
+ > .column,
+ > .columns { @include grid-column($collapse:true); }
+
+ .row {margin-left:0; margin-right:0;}
+ }
+
+ .row { @include grid-row($behavior:nest);
+ &.collapse { @include grid-row($behavior:nest-collapse); }
+ }
+ }
+
+ .column,
+ .columns { @include grid-column($columns:$total-columns); }
+
+ @media #{$small-up} {
+ @include grid-html-classes($size:small);
+ }
+
+ @media #{$medium-up} {
+ @include grid-html-classes($size:medium);
+ // Old push and pull classes
+ @for $i from 0 through $total-columns - 1 {
+ .push-#{$i} {
+ @include grid-column($push:$i, $collapse:null, $float:false);
+ }
+ .pull-#{$i} {
+ @include grid-column($pull:$i, $collapse:null, $float:false);
+ }
+ }
+ }
+ @media #{$large-up} {
+ @include grid-html-classes($size:large);
+ @for $i from 0 through $total-columns - 1 {
+ .push-#{$i} {
+ @include grid-column($push:$i, $collapse:null, $float:false);
+ }
+ .pull-#{$i} {
+ @include grid-column($pull:$i, $collapse:null, $float:false);
+ }
+ }
+ }
+ }
+ @if $include-xl-html-grid-classes {
+ @media #{$xlarge-up} {
+ @include grid-html-classes($size:xlarge);
+ }
+ @media #{$xxlarge-up} {
+ @include grid-html-classes($size:xxlarge);
+ }
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-inline-list-classes: $include-html-classes !default;
+
+// We use this to control the margins and padding of the inline list.
+$inline-list-top-margin: 0 !default;
+$inline-list-opposite-margin: 0 !default;
+$inline-list-bottom-margin: rem-calc(17) !default;
+$inline-list-default-float-margin: rem-calc(-22) !default;
+
+$inline-list-padding: 0 !default;
+
+// We use this to control the overflow of the inline list.
+$inline-list-overflow: hidden !default;
+
+// We use this to control the list items
+$inline-list-display: block !default;
+
+// We use this to control any elements within list items
+$inline-list-children-display: block !default;
+
+//
+// @mixins
+//
+// We use this mixin to create inline lists
+@mixin inline-list {
+ margin: $inline-list-top-margin auto $inline-list-bottom-margin auto;
+ margin-#{$default-float}: $inline-list-default-float-margin;
+ margin-#{$opposite-direction}: $inline-list-opposite-margin;
+ padding: $inline-list-padding;
+ list-style: none;
+ overflow: $inline-list-overflow;
+
+ & > li {
+ list-style: none;
+ float: $default-float;
+ margin-#{$default-float}: rem-calc(22);
+ display: $inline-list-display;
+ &>* { display: $inline-list-children-display; }
+ }
+}
+
+@include exports("inline-list") {
+ @if $include-html-inline-list-classes {
+ .inline-list {
+ @include inline-list();
+ }
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-joyride-classes: $include-html-classes !default;
+
+// Controlling default Joyride styles
+$joyride-tip-bg: #333 !default;
+$joyride-tip-default-width: 300px !default;
+$joyride-tip-padding: rem-calc(18 20 24) !default;
+$joyride-tip-border: solid 1px #555 !default;
+$joyride-tip-radius: 4px !default;
+$joyride-tip-position-offset: 22px !default;
+
+// Here, we're setting the tip font styles
+$joyride-tip-font-color: #fff !default;
+$joyride-tip-font-size: rem-calc(14) !default;
+$joyride-tip-header-weight: bold !default;
+
+// This changes the nub size
+$joyride-tip-nub-size: 10px !default;
+
+// This adjusts the styles for the timer when its enabled
+$joyride-tip-timer-width: 50px !default;
+$joyride-tip-timer-height: 3px !default;
+$joyride-tip-timer-color: #666 !default;
+
+// This changes up the styles for the close button
+$joyride-tip-close-color: #777 !default;
+$joyride-tip-close-size: 24px !default;
+$joyride-tip-close-weight: normal !default;
+
+// When Joyride is filling the screen, we use this style for the bg
+$joyride-screenfill: rgba(0,0,0,0.5) !default;
+
+
+// We decided not to make a mixin for this because it relies on
+// predefined classes to work properly.
+@include exports("joyride") {
+ @if $include-html-joyride-classes {
+
+ /* Foundation Joyride */
+ .joyride-list { display: none; }
+
+ /* Default styles for the container */
+ .joyride-tip-guide {
+ display: none;
+ position: absolute;
+ background: $joyride-tip-bg;
+ color: $joyride-tip-font-color;
+ z-index: 101;
+ top: 0;
+ #{$default-float}: 2.5%;
+ font-family: inherit;
+ font-weight: normal;
+ width: 95%;
+ }
+
+ .lt-ie9 .joyride-tip-guide {
+ max-width:800px;
+ #{$default-float}: 50%;
+ margin-#{$default-float}:-400px;
+ }
+
+ .joyride-content-wrapper {
+ width: 100%;
+
+ padding: $joyride-tip-padding;
+
+ .button { margin-bottom: 0 !important; }
+ }
+
+ /* Add a little css triangle pip, older browser just miss out on the fanciness of it */
+ .joyride-tip-guide {
+ .joyride-nub {
+ display: block;
+ position: absolute;
+ #{$default-float}: $joyride-tip-position-offset;
+ width: 0;
+ height: 0;
+ border: $joyride-tip-nub-size solid $joyride-tip-bg;
+
+ &.top {
+ border-top-style: solid;
+ border-color: $joyride-tip-bg;
+ border-top-color: transparent !important;
+ border-#{$default-float}-color: transparent !important;
+ border-#{$opposite-direction}-color: transparent !important;
+ top: -($joyride-tip-nub-size*2);
+ }
+ &.bottom {
+ border-bottom-style: solid;
+ border-color: $joyride-tip-bg !important;
+ border-bottom-color: transparent !important;
+ border-#{$default-float}-color: transparent !important;
+ border-#{$opposite-direction}-color: transparent !important;
+ bottom: -($joyride-tip-nub-size*2);
+ }
+
+ &.right { right: -($joyride-tip-nub-size*2); }
+ &.left { left: -($joyride-tip-nub-size*2); }
+ }
+ }
+
+ /* Typography */
+ .joyride-tip-guide h1,
+ .joyride-tip-guide h2,
+ .joyride-tip-guide h3,
+ .joyride-tip-guide h4,
+ .joyride-tip-guide h5,
+ .joyride-tip-guide h6 {
+ line-height: 1.25;
+ margin: 0;
+ font-weight: $joyride-tip-header-weight;
+ color: $joyride-tip-font-color;
+ }
+ .joyride-tip-guide p {
+ margin: rem-calc(0 0 18 0);
+ font-size: $joyride-tip-font-size;
+ line-height: 1.3;
+ }
+
+ .joyride-timer-indicator-wrap {
+ width: $joyride-tip-timer-width;
+ height: $joyride-tip-timer-height;
+ border: $joyride-tip-border;
+ position: absolute;
+ #{$opposite-direction}: rem-calc(17);
+ bottom: rem-calc(16);
+ }
+ .joyride-timer-indicator {
+ display: block;
+ width: 0;
+ height: inherit;
+ background: $joyride-tip-timer-color;
+ }
+
+ .joyride-close-tip {
+ position: absolute;
+ #{$opposite-direction}: 12px;
+ top: 10px;
+ color: $joyride-tip-close-color !important;
+ text-decoration: none;
+ font-size: $joyride-tip-close-size;
+ font-weight: $joyride-tip-close-weight;
+ line-height: .5 !important;
+
+ &:hover,
+ &:focus { color: #eee !important; }
+ }
+
+ .joyride-modal-bg {
+ position: fixed;
+ height: 100%;
+ width: 100%;
+ background: transparent;
+ background: $joyride-screenfill;
+ z-index: 100;
+ display: none;
+ top: 0;
+ #{$default-float}: 0;
+ cursor: $cursor-pointer-value;
+ }
+
+ .joyride-expose-wrapper {
+ background-color: #ffffff;
+ position: absolute;
+ border-radius: 3px;
+ z-index: 102;
+ @if $experimental {
+ -moz-box-shadow: 0 0 30px #ffffff;
+ -webkit-box-shadow: 0 0 15px #ffffff;
+ }
+ box-shadow: 0 0 15px #ffffff;
+ }
+
+ .joyride-expose-cover {
+ background: transparent;
+ border-radius: 3px;
+ position: absolute;
+ z-index: 9999;
+ top: 0;
+ left: 0;
+ }
+
+
+ /* Styles for screens that are at least 768px; */
+ @media #{$small} {
+ .joyride-tip-guide { width: $joyride-tip-default-width; #{$default-float}: inherit;
+ .joyride-nub {
+ &.bottom {
+ border-color: $joyride-tip-bg !important;
+ border-bottom-color: transparent !important;
+ border-#{$default-float}-color: transparent !important;
+ border-#{$opposite-direction}-color: transparent !important;
+ bottom: -($joyride-tip-nub-size*2);
+ }
+ &.right {
+ border-color: $joyride-tip-bg !important;
+ border-top-color: transparent !important;
+ border-right-color: transparent !important; border-bottom-color: transparent !important;
+ top: $joyride-tip-position-offset;
+ left: auto;
+ right: -($joyride-tip-nub-size*2);
+ }
+ &.left {
+ border-color: $joyride-tip-bg !important;
+ border-top-color: transparent !important;
+ border-left-color: transparent !important;
+ border-bottom-color: transparent !important;
+ top: $joyride-tip-position-offset;
+ left: -($joyride-tip-nub-size*2);
+ right: auto;
+ }
+ }
+ }
+ }
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-type-classes: $include-html-classes !default;
+
+// We use these to control text styles.
+$keystroke-font: "Consolas", "Menlo", "Courier", monospace !default;
+$keystroke-font-size: rem-calc(14) !default;
+$keystroke-font-color: #222 !default;
+$keystroke-font-color-alt: #fff !default;
+$keystroke-function-factor: -7% !default;
+
+// We use this to control keystroke padding.
+$keystroke-padding: rem-calc(2 4 0) !default;
+
+// We use these to control background and border styles.
+$keystroke-bg: scale-color(#fff, $lightness: $keystroke-function-factor) !default;
+$keystroke-border-style: solid !default;
+$keystroke-border-width: 1px !default;
+$keystroke-border-color: scale-color($keystroke-bg, $lightness: $keystroke-function-factor) !default;
+$keystroke-radius: $global-radius !default;
+
+//
+// @mixins
+//
+// We use this mixin to create keystroke styles.
+// $bg - Default: $keystroke-bg || scale-color(#fff, $lightness: $keystroke-function-factor) !default;
+@mixin keystroke($bg:$keystroke-bg) {
+ // This find the lightness percentage of the background color.
+ $bg-lightness: lightness($bg);
+
+ background-color: $bg;
+ border-color: scale-color($bg, $lightness: $keystroke-function-factor);
+
+ // We adjust the font color based on the brightness of the background.
+ @if $bg-lightness > 70% { color: $keystroke-font-color; }
+ @else { color: $keystroke-font-color-alt; }
+
+ border-style: $keystroke-border-style;
+ border-width: $keystroke-border-width;
+ margin: 0;
+ font-family: $keystroke-font;
+ font-size: $keystroke-font-size;
+ padding: $keystroke-padding;
+}
+
+@include exports("keystroke") {
+ @if $include-html-type-classes {
+ .keystroke,
+ kbd {
+ @include keystroke;
+ @include radius($keystroke-radius);
+ }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-label-classes: $include-html-classes !default;
+
+// We use these to style the labels
+$label-padding: rem-calc(4 8 6) !default;
+$label-radius: $global-radius !default;
+
+// We use these to style the label text
+$label-font-sizing: rem-calc(11) !default;
+$label-font-weight: normal !default;
+$label-font-color: #333 !default;
+$label-font-color-alt: #fff !default;
+$label-font-family: $body-font-family !default;
+
+//
+// @mixins
+//
+// We use this mixin to create a default label base.
+@mixin label-base {
+ font-weight: $label-font-weight;
+ font-family: $label-font-family;
+ text-align: center;
+ text-decoration: none;
+ line-height: 1;
+ white-space: nowrap;
+ display: inline-block;
+ position: relative;
+ margin-bottom: inherit;
+}
+
+// @mixins
+//
+// We use this mixin to add label size styles.
+// $padding - Used to determine label padding. Default: $label-padding || rem-calc(3 10 4) !default
+// $text-size - Used to determine label text-size. Default: $text-size found in settings
+@mixin label-size($padding:$label-padding, $text-size:$label-font-sizing) {
+ @if $padding { padding: $padding; }
+ @if $text-size { font-size: $text-size; }
+}
+
+// @mixins
+//
+// We use this mixin to add label styles.
+// $bg - Default: $primary-color (found in settings file)
+// $radius - Default: false, Options: true, sets radius to $global-radius (found in settings file)
+@mixin label-style($bg:$primary-color, $radius:false) {
+
+ // We control which background color comes through
+ @if $bg {
+
+ // This find the lightness percentage of the background color.
+ $bg-lightness: lightness($bg);
+
+ background-color: $bg;
+
+ // We control the text color for you based on the background color.
+ @if $bg-lightness < 70% { color: $label-font-color-alt; }
+ @else { color: $label-font-color; }
+ }
+
+ // We use this to control the radius on labels.
+ @if $radius == true { @include radius($label-radius); }
+ @else if $radius { @include radius($radius); }
+
+}
+
+// @mixins
+//
+// We use this to add close buttons to alerts
+// $padding - Default: $label-padding,
+// $text-size - Default: $label-font-sizing,
+// $bg - Default: $primary-color(found in settings file)
+// $radius - Default: false, Options: true which sets radius to $global-radius (found in settings file)
+@mixin label($padding:$label-padding, $text-size:$label-font-sizing, $bg:$primary-color, $radius:false) {
+
+ @include label-base;
+ @include label-size($padding, $text-size);
+ @include label-style($bg, $radius);
+}
+
+@include exports("label") {
+ @if $include-html-label-classes {
+ .label {
+ @include label-base;
+ @include label-size;
+ @include label-style;
+
+ &.radius { @include label-style(false, true); }
+ &.round { @include label-style(false, $radius:1000px); }
+
+ &.alert { @include label-style($alert-color); }
+ &.success { @include label-style($success-color); }
+ &.secondary { @include label-style($secondary-color); }
+ }
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-magellan-classes: $include-html-classes !default;
+
+$magellan-bg: #fff !default;
+$magellan-padding: 10px !default;
+
+@include exports("magellan") {
+ @if $include-html-magellan-classes {
+
+ #{data('magellan-expedition')} {
+ background: $magellan-bg;
+ z-index: 50;
+ min-width: 100%;
+ padding: $magellan-padding;
+
+ .sub-nav {
+ margin-bottom: 0;
+ dd { margin-bottom: 0; }
+ a {
+ line-height: 1.8em;
+ }
+ }
+ }
+
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+@import "type";
+@import "top-bar";
+
+// Off Canvas Tab Bar Variables
+$include-html-off-canvas-classes: $include-html-classes !default;
+
+$tabbar-bg: #333 !default;
+$tabbar-height: rem-calc(45) !default;
+$tabbar-line-height: $tabbar-height !default;
+$tabbar-color: #FFF !default;
+$tabbar-middle-padding: 0 rem-calc(10) !default;
+
+// Off Canvas Divider Styles
+$tabbar-right-section-border: solid 1px scale-color($tabbar-bg, $lightness: 13%) !default;
+$tabbar-left-section-border: solid 1px scale-color($tabbar-bg, $lightness: -50%) !default;
+
+// Off Canvas Tab Bar Headers
+$tabbar-header-color: #FFF !default;
+$tabbar-header-weight: bold !default;
+$tabbar-header-line-height: $tabbar-height !default;
+$tabbar-header-margin: 0 !default;
+
+// Off Canvas Menu Variables
+$off-canvas-width: 250px !default;
+$off-canvas-bg: #333 !default;
+
+// Off Canvas Menu List Variables
+$off-canvas-label-padding: 0.3rem rem-calc(15) !default;
+$off-canvas-label-color: #999 !default;
+$off-canvas-label-text-transform: uppercase !default;
+$off-canvas-label-font-weight: bold !default;
+$off-canvas-label-bg: #444 !default;
+$off-canvas-label-border-top: 1px solid scale-color(#444, $lightness: 14%) !default;
+$off-canvas-label-border-bottom: none !default;
+$off-canvas-label-margin:0 !default;
+$off-canvas-link-padding: rem-calc(10, 15) !default;
+$off-canvas-link-color: rgba(#FFF, 0.7) !default;
+$off-canvas-link-border-bottom: 1px solid scale-color($off-canvas-bg, $lightness: -25%) !default;
+
+// Off Canvas Menu Icon Variables
+$tabbar-menu-icon-color: #FFF !default;
+$tabbar-menu-icon-hover: scale-color($tabbar-menu-icon-color, $lightness: -30%) !default;
+
+$tabbar-menu-icon-text-indent: rem-calc(35) !default;
+$tabbar-menu-icon-width: $tabbar-height !default;
+$tabbar-menu-icon-height: $tabbar-height !default;
+$tabbar-menu-icon-line-height: rem-calc(33) !default;
+$tabbar-menu-icon-padding: 0 !default;
+
+$tabbar-hamburger-icon-width: rem-calc(16) !default;
+$tabbar-hamburger-icon-left: rem-calc(13) !default;
+$tabbar-hamburger-icon-top: rem-calc(5) !default;
+
+// Off Canvas Back-Link Overlay
+$off-canvas-overlay-transition: background 300ms ease !default;
+$off-canvas-overlay-cursor: pointer !default;
+$off-canvas-overlay-box-shadow: -4px 0 4px rgba(#000, 0.5), 4px 0 4px rgba(#000, 0.5) !default;
+$off-canvas-overlay-background: rgba(#FFF, 0.2) !default;
+$off-canvas-overlay-background-hover: rgba(#FFF, 0.05) !default;
+
+// Transition Variables
+$menu-slide: "transform 500ms ease" !default;
+
+
+// MIXINS
+// Remove transition flicker on phones
+@mixin kill-flicker {
+ // -webkit-transform: translateZ(0x);
+ -webkit-backface-visibility: hidden;
+}
+
+// Basic properties for the content wraps
+@mixin wrap-base {
+ position: relative;
+ width: 100%;
+}
+
+// basic styles for off-canvas menu container
+@mixin off-canvas-menu {
+ width: $off-canvas-width;
+ top:0;
+ bottom:0;
+ position: absolute;
+ overflow-y: auto;
+ background: $off-canvas-bg;
+ z-index: 1001;
+ box-sizing: content-box;
+}
+
+// TRANSLATE 3D
+@mixin translate3d($tx,$ty,$tz) {
+ -webkit-transform: translate3d($tx,$ty,$tz);
+ -moz-transform: translate3d($tx,$ty,$tz);
+ -ms-transform: translate3d($tx,$ty,$tz);
+ -o-transform: translate3d($tx,$ty,$tz);
+ transform: translate3d($tx,$ty,$tz)
+}
+
+// OFF CANVAS WRAP
+// Wrap visible content and prevent scroll bars
+@mixin off-canvas-wrap {
+
+ @include kill-flicker;
+ @include wrap-base;
+ overflow-x: hidden;
+ &.move-right,
+ &.move-left { height: 100%; }
+}
+
+// INNER WRAP
+// Main content area that moves to reveal the off-canvas nav
+@mixin inner-wrap {
+ @include kill-flicker;
+ @include wrap-base;
+ @include clearfix;
+
+ -webkit-transition: -webkit-#{$menu-slide};
+ -moz-transition: -moz-#{$menu-slide};
+ -ms-transition: -ms-#{$menu-slide};
+ -o-transition: -o-#{$menu-slide};
+ transition: #{$menu-slide};
+}
+
+// TAB BAR
+// This is the tab bar base
+@mixin tab-bar-base {
+ @include kill-flicker;
+
+ // base styles
+ background: $tabbar-bg;
+ color: $tabbar-color;
+ height: $tabbar-height;
+ line-height: $tabbar-height;
+
+ // make sure it's below the .exit-offcanvas link
+ position: relative;
+ // z-index: 999;
+
+ // Typography
+ h1,h2,h3,h4,h5,h6 {
+ color: $tabbar-header-color;
+ font-weight: $tabbar-header-weight;
+ line-height: $tabbar-header-line-height;
+ margin: $tabbar-header-margin;
+ }
+ h1,h2,h3,h4 { font-size: $h5-font-size; }
+}
+
+// SMALL SECTIONS
+// These are small sections on the left and right that contain the off-canvas toggle buttons;
+@mixin tabbar-small-section {
+ width: $tabbar-height;
+ height: $tabbar-height;
+ position: absolute;
+ top:0;
+}
+
+@mixin left-small-section {
+ @include tabbar-small-section;
+ border-right: $tabbar-left-section-border;
+ box-shadow: 1px 0 0 scale-color($tabbar-bg, $lightness: 13%);
+ left:0;
+}
+
+@mixin right-small-section {
+ @include tabbar-small-section;
+ border-left: $tabbar-right-section-border;
+ box-shadow: -1px 0 0 scale-color($tabbar-bg, $lightness: -50%);
+ right:0;
+}
+
+@mixin tab-bar-section {
+ padding: $tabbar-middle-padding;
+ position: absolute;
+ text-align: center;
+ height: $tabbar-height;
+ top:0;
+ @media #{$medium-up} {
+ text-align: left;
+ }
+
+ // still need to make these non-presentational
+ &.left {
+ left: 0;
+ right: $tabbar-height;
+ }
+ &.right {
+ left: $tabbar-height;
+ right: 0;
+ }
+ &.middle {
+ left: $tabbar-height;
+ right: $tabbar-height;
+ }
+}
+
+// OFF CANVAS LIST
+// This is the list of links in the off-canvas menu
+@mixin off-canvas-list {
+ list-style-type: none;
+ padding:0;
+ margin:0;
+
+ li {
+ label {
+ padding: $off-canvas-label-padding;
+ color: $off-canvas-label-color;
+ text-transform: $off-canvas-label-text-transform;
+ font-weight: $off-canvas-label-font-weight;
+ background: $off-canvas-label-bg;
+ border-top: $off-canvas-label-border-top;
+ border-bottom: $off-canvas-label-border-bottom;
+ margin: $off-canvas-label-margin;
+ }
+ a {
+ display: block;
+ padding: $off-canvas-link-padding;
+ color: $off-canvas-link-color;
+ border-bottom: $off-canvas-link-border-bottom;
+ }
+ }
+
+}
+
+// BACK LINK
+// This is an overlay that, when clicked, will toggle off the off canvas menu
+@mixin back-link {
+ @include kill-flicker;
+
+ transition: $off-canvas-overlay-transition;
+ cursor: $off-canvas-overlay-cursor;
+ box-shadow: $off-canvas-overlay-box-shadow;
+
+ // fill the screen
+ display: block;
+ position: absolute;
+ background: $off-canvas-overlay-background;
+ top: 0;
+ bottom: 0;
+ left:0;
+ right:0;
+ z-index: 1002;
+ -webkit-tap-highlight-color: rgba(0,0,0,0);
+
+ @media #{$medium-up} {
+ &:hover {
+ background: $off-canvas-overlay-background-hover;
+ }
+ }
+}
+
+// OFF CANVAS MENUS
+// These are the containers that contain the off canvas content
+@mixin left-off-canvas-menu {
+ @include kill-flicker;
+ @include off-canvas-menu;
+ @include translate3d(-100%,0,0);
+ left: 0;
+ * { @include kill-flicker; }
+}
+@mixin right-off-canvas-menu {
+ @include kill-flicker;
+ @include off-canvas-menu;
+ @include translate3d(100%,0,0);
+ right: 0;
+}
+
+
+//
+// DEFAULT CLASSES
+//
+@include exports("offcanvas") {
+ @if $include-html-off-canvas-classes {
+
+ .off-canvas-wrap { @include off-canvas-wrap; }
+ .inner-wrap { @include inner-wrap; }
+
+ nav.tab-bar { @include tab-bar-base; }
+
+ section.left-small { @include left-small-section; }
+ section.right-small { @include right-small-section; }
+
+ section.tab-bar-section { @include tab-bar-section; }
+
+ // MENU BUTTON
+ // This is a little bonus. You don't need it for off canvas to work. Mixins to be written in the future.
+ a.menu-icon {
+ text-indent: $tabbar-menu-icon-text-indent;
+ width: $tabbar-height;
+ height: $tabbar-height;
+ display: block;
+ line-height: $tabbar-menu-icon-line-height;
+ padding: $tabbar-menu-icon-padding;
+ color: $topbar-menu-link-color;
+ position: relative;
+
+ // this is the actual hamburger icon
+ span {
+
+ position: absolute;
+ display: block;
+ width: $tabbar-hamburger-icon-width;
+ height: 0;
+ left: $tabbar-hamburger-icon-left;
+ top: $tabbar-hamburger-icon-top;
+ // margin-top: $tabbar-height / 4;
+
+ @if $experimental {
+ -webkit-box-shadow: 1px 10px 1px 1px $tabbar-menu-icon-color,
+ 1px 16px 1px 1px $tabbar-menu-icon-color,
+ 1px 22px 1px 1px $tabbar-menu-icon-color;
+ }
+ box-shadow: 0 10px 0 1px $tabbar-menu-icon-color,
+ 0 16px 0 1px $tabbar-menu-icon-color,
+ 0 22px 0 1px $tabbar-menu-icon-color;
+ }
+
+ &:hover span {
+ @if $experimental {
+ -webkit-box-shadow: 1px 10px 1px 1px $tabbar-menu-icon-hover,
+ 1px 16px 1px 1px $tabbar-menu-icon-hover,
+ 1px 22px 1px 1px $tabbar-menu-icon-hover;
+ }
+ box-shadow: 0 10px 0 1px $tabbar-menu-icon-hover,
+ 0 16px 0 1px $tabbar-menu-icon-hover,
+ 0 22px 0 1px $tabbar-menu-icon-hover;
+ }
+ }
+
+ .left-off-canvas-menu { @include left-off-canvas-menu; }
+ .right-off-canvas-menu { @include right-off-canvas-menu; }
+
+ ul.off-canvas-list { @include off-canvas-list; }
+
+
+ // ANIMATION CLASSES
+ // These classes are added with JS and trigger the actual animation.
+ .move-right {
+ > .inner-wrap {
+ @include translate3d($off-canvas-width,0,0);
+ }
+ a.exit-off-canvas { @include back-link;}
+ }
+
+ .move-left {
+ > .inner-wrap {
+ @include translate3d(-($off-canvas-width),0,0);
+
+ }
+ a.exit-off-canvas { @include back-link; }
+ }
+
+ // Opera 12.16 and IE9 - don't have 3d transforms
+ .csstransforms.no-csstransforms3d {
+ .left-off-canvas-menu { @include translate2d(-100%, 0); }
+ .right-off-canvas-menu { @include translate2d(100%, 0); }
+
+ .move-left > .inner-wrap { @include translate2d(-($off-canvas-width),0); }
+ .move-right > .inner-wrap { @include translate2d($off-canvas-width,0); }
+ }
+
+ // Older browsers
+ .no-csstransforms {
+ .left-off-canvas-menu { left: -($off-canvas-width); }
+ .right-off-canvas-menu { right: -($off-canvas-width); }
+
+ .move-left > .inner-wrap { right: $off-canvas-width; }
+ .move-right > .inner-wrap { left: $off-canvas-width; }
+ }
+
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+// @variables
+//
+$include-html-orbit-classes: $include-html-classes !default;
+
+// We use these to control the caption styles
+$orbit-container-bg: none !default;
+$orbit-caption-bg: rgba(51,51,51, 0.8) !default;
+$orbit-caption-font-color: #fff !default;
+$orbit-caption-font-size: rem-calc(14) !default;
+$orbit-caption-position: "bottom" !default; // Supported values: "bottom", "under"
+$orbit-caption-padding: rem-calc(10 14) !default;
+$orbit-caption-height: auto !default;
+
+// We use these to control the left/right nav styles
+$orbit-nav-bg: none !default;
+$orbit-nav-bg-hover: rgba(0,0,0,0.3) !default;
+$orbit-nav-arrow-color: #fff !default;
+$orbit-nav-arrow-color-hover: #fff !default;
+
+// We use these to control the timer styles
+$orbit-timer-bg: rgba(255,255,255,0.3) !default;
+$orbit-timer-show-progress-bar: true !default;
+
+// We use these to control the bullet nav styles
+$orbit-bullet-nav-color: #ccc !default;
+$orbit-bullet-nav-color-active: #999 !default;
+$orbit-bullet-radius: rem-calc(9) !default;
+
+// We use these to controls the style of slide numbers
+$orbit-slide-number-bg: rgba(0,0,0,0) !default;
+$orbit-slide-number-font-color: #fff !default;
+$orbit-slide-number-padding: rem-calc(5) !default;
+
+// Graceful Loading Wrapper and preloader
+$wrapper-class: "slideshow-wrapper" !default;
+$preloader-class: "preloader" !default;
+
+@include exports("orbit") {
+ @if $include-html-orbit-classes {
+
+ @if $experimental {
+ @-webkit-keyframes rotate {
+ from { -webkit-transform: rotate(0deg); }
+ to { -webkit-transform: rotate(360deg); }
+ }
+ @-moz-keyframes rotate {
+ from { -moz-transform: rotate(0deg); }
+ to { -moz-transform: rotate(360deg); }
+ }
+ @-o-keyframes rotate {
+ from { -o-transform: rotate(0deg); }
+ to { -o-transform: rotate(360deg); }
+ }
+ }
+ @keyframes rotate {
+ from { transform: rotate(0deg); }
+ to { transform: rotate(360deg); }
+ }
+
+ /* Orbit Graceful Loading */
+ .#{$wrapper-class} {
+ position: relative;
+
+ ul {
+ // Prevent bullets showing before .orbit-container is loaded
+ list-style-type: none;
+ margin: 0;
+
+ // Hide all list items
+ li,
+ li .orbit-caption { display: none; }
+
+ // ...except for the first one
+ li:first-child { display: block; }
+ }
+
+ .orbit-container { background-color: transparent;
+
+ // Show images when .orbit-container is loaded
+ li { display: block;
+
+ .orbit-caption { display: block; }
+ }
+ }
+ }
+
+ // Orbit preloader
+ .#{$preloader-class} {
+ display: block;
+ width: 40px;
+ height: 40px;
+ position: absolute;
+ top: 50%;
+ left: 50%;
+ margin-top: -20px;
+ margin-left: -20px;
+ border: solid 3px;
+ border-color: #555 #fff;
+ @include radius(1000px);
+ @if $experimental {
+ -webkit-animation-name: rotate;
+ -webkit-animation-duration: 1.5s;
+ -webkit-animation-iteration-count: infinite;
+ -webkit-animation-timing-function: linear;
+ -moz-animation-name: rotate;
+ -moz-animation-duration: 1.5s;
+ -moz-animation-iteration-count: infinite;
+ -moz-animation-timing-function: linear;
+ -o-animation-name: rotate;
+ -o-animation-duration: 1.5s;
+ -o-animation-iteration-count: infinite;
+ -o-animation-timing-function: linear;
+ }
+ animation-name: rotate;
+ animation-duration: 1.5s;
+ animation-iteration-count: infinite;
+ animation-timing-function: linear;
+ }
+
+ .orbit-container {
+ overflow: hidden;
+ width: 100%;
+ position: relative;
+ background: $orbit-container-bg;
+
+ .orbit-slides-container {
+ list-style: none;
+ margin: 0;
+ padding: 0;
+ position: relative;
+
+ // Prevents images (and captions) from disappearing after first rotation on Chrome for Android
+ -webkit-transform: translateZ(0);
+
+ img { display: block; max-width: 100%; }
+
+ &>* {
+ position: absolute;
+ top: 0;
+ width: 100%;
+ @if $text-direction == rtl {
+ margin-right: 100%;
+ }
+ @else {
+ margin-left: 100%;
+ }
+
+ &:first-child {
+ @if $text-direction == rtl {
+ margin-right: 0%;
+ }
+ @else {
+ margin-left: 0%;
+ }
+ }
+
+ .orbit-caption {
+ @if $orbit-caption-position == "bottom" {
+ position: absolute;
+ bottom: 0;
+ } @else if $orbit-caption-position == "under" {
+ position: relative;
+ }
+
+ background-color: $orbit-caption-bg;
+ color: $orbit-caption-font-color;
+ width: 100%;
+ padding: $orbit-caption-padding;
+ font-size: $orbit-caption-font-size;
+ }
+ }
+ }
+
+ .orbit-slide-number {
+ position: absolute;
+ top: 10px;
+ #{$default-float}: 10px;
+ font-size: 12px;
+ span { font-weight: 700; padding: $orbit-slide-number-padding;}
+ color: $orbit-slide-number-font-color;
+ background: $orbit-slide-number-bg;
+ z-index: 10;
+ }
+
+ .orbit-timer {
+ position: absolute;
+ top: 12px;
+ #{$opposite-direction}: 10px;
+ height: 6px;
+ width: 100px;
+ z-index: 10;
+ .orbit-progress {
+ @if $orbit-timer-show-progress-bar {
+ height: 3px;
+ background-color: $orbit-timer-bg;
+ display: block;
+ width: 0%;
+ position: relative;
+ right: 20px;
+ top: 5px;
+ }
+ }
+
+ // Play button
+ & > span {
+ display: none;
+ position: absolute;
+ top: 0px;
+ #{$opposite-direction}: 0;
+ width: 11px;
+ height: 14px;
+ border: solid 4px #fff;
+ border-top: none;
+ border-bottom: none;
+ }
+
+ // Pause button
+ &.paused {
+ & > span {
+ #{$opposite-direction}: -4px;
+ top: 0px;
+ width: 11px;
+ height: 14px;
+ border: inset 8px;
+ border-right-style: solid;
+ border-color: transparent transparent transparent #fff;
+ &.dark {
+ border-color: transparent transparent transparent #333;
+ }
+ }
+ }
+ }
+
+
+
+ &:hover .orbit-timer > span { display: block; }
+
+ // Let's get those controls to be right in the center on each side
+ .orbit-prev,
+ .orbit-next {
+ position: absolute;
+ top: 45%;
+ margin-top: -25px;
+ width: 36px;
+ height: 60px;
+ line-height: 50px;
+ color: white;
+ background-color: $orbit-nav-bg;
+ text-indent: -9999px !important;
+ z-index: 10;
+
+ &:hover {
+ background-color: $orbit-nav-bg-hover;
+ }
+
+ & > span {
+ position: absolute;
+ top: 50%;
+ margin-top: -10px;
+ display: block;
+ width: 0;
+ height: 0;
+ border: inset 10px;
+ }
+ }
+ .orbit-prev { #{$default-float}: 0;
+ & > span {
+ border-#{$opposite-direction}-style: solid;
+ border-color: transparent;
+ border-#{$opposite-direction}-color: $orbit-nav-arrow-color;
+ }
+ &:hover > span {
+ border-#{$opposite-direction}-color: $orbit-nav-arrow-color-hover;
+ }
+ }
+ .orbit-next { #{$opposite-direction}: 0;
+ & > span {
+ border-color: transparent;
+ border-#{$default-float}-style: solid;
+ border-#{$default-float}-color: $orbit-nav-arrow-color;
+ #{$default-float}: 50%;
+ margin-#{$default-float}: -4px;
+ }
+ &:hover > span {
+ border-#{$default-float}-color: $orbit-nav-arrow-color-hover;
+ }
+ }
+ }
+
+ .orbit-bullets-container { text-align: center; }
+ .orbit-bullets {
+ margin: 0 auto 30px auto;
+ overflow: hidden;
+ position: relative;
+ top: 10px;
+ float: none;
+ text-align: center;
+ display: block;
+
+ li {
+ display: inline-block;
+ width: $orbit-bullet-radius;
+ height: $orbit-bullet-radius;
+ background: $orbit-bullet-nav-color;
+ // float: $default-float;
+ float: none;
+ margin-#{$opposite-direction}: 6px;
+ @include radius(1000px);
+
+ &.active {
+ background: $orbit-bullet-nav-color-active;
+ }
+
+ &:last-child { margin-#{$opposite-direction}: 0; }
+ }
+ }
+
+ .touch {
+ .orbit-container {
+ .orbit-prev,
+ .orbit-next { display: none; }
+ }
+
+ .orbit-bullets { display: none; }
+ }
+
+
+ @media #{$medium-up} {
+
+ .touch {
+ .orbit-container {
+ .orbit-prev,
+ .orbit-next { display: inherit; }
+ }
+
+ .orbit-bullets { display: block; }
+ }
+
+ }
+
+ @media #{$small-only} {
+ .orbit-stack-on-small {
+ .orbit-slides-container {height: auto !important;}
+ .orbit-slides-container > * {
+ position: relative;
+ margin-left: 0% !important;
+ }
+ .orbit-timer,
+ .orbit-next,
+ .orbit-prev,
+ .orbit-bullets {display: none;}
+ }
+ }
+
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-nav-classes: $include-html-classes !default;
+
+// We use these to control the pagination container
+$pagination-height: rem-calc(24) !default;
+$pagination-margin: rem-calc(-5) !default;
+
+// We use these to set the list-item properties
+$pagination-li-float: $default-float;
+$pagination-li-height: rem-calc(24) !default;
+$pagination-li-font-color: #222 !default;
+$pagination-li-font-size: rem-calc(14) !default;
+$pagination-li-margin: rem-calc(5) !default;
+
+// We use these for the pagination anchor links
+$pagination-link-pad: rem-calc(1 10 1) !default;
+$pagination-link-font-color: #999 !default;
+$pagination-link-active-bg: scale-color(#fff, $lightness: -10%) !default;
+
+// We use these for disabled anchor links
+$pagination-link-unavailable-cursor: default !default;
+$pagination-link-unavailable-font-color: #999 !default;
+$pagination-link-unavailable-bg-active: transparent !default;
+
+// We use these for currently selected anchor links
+$pagination-link-current-background: $primary-color !default;
+$pagination-link-current-font-color: #fff !default;
+$pagination-link-current-font-weight: bold !default;
+$pagination-link-current-cursor: default !default;
+$pagination-link-current-active-bg: $primary-color !default;
+
+// @mixins
+//
+// Style the pagination container. Currently only used when centering elements.
+// $center - Default: false, Options: true
+@mixin pagination-container($center:false) {
+ @if $center { text-align: center; }
+}
+
+// @mixins
+// Style unavailable list items
+@mixin pagination-unavailable-item {
+ a {
+ cursor: $pagination-link-unavailable-cursor;
+ color: $pagination-link-unavailable-font-color;
+ }
+ &:hover a,
+ & a:focus { background: $pagination-link-unavailable-bg-active; }
+}
+// @mixins
+// Style the current list item. Do not assume that the current item has
+// an anchor <a> element.
+// $has-anchor - Default: true, Options: false
+@mixin pagination-current-item($has-anchor: true) {
+ @if $has-anchor {
+ a {
+ background: $pagination-link-current-background;
+ color: $pagination-link-current-font-color;
+ font-weight: $pagination-link-current-font-weight;
+ cursor: $pagination-link-current-cursor;
+
+ &:hover,
+ &:focus { background: $pagination-link-current-active-bg; }
+ }
+ } @else {
+ height: auto;
+ padding: $pagination-link-pad;
+ background: $pagination-link-current-background;
+ color: $pagination-link-current-font-color;
+ font-weight: $pagination-link-current-font-weight;
+ cursor: $pagination-link-current-cursor;
+
+ &:hover,
+ &:focus { background: $pagination-link-current-active-bg; }
+ }
+}
+
+// @mixins
+//
+// We use this mixin to set the properties for the creating Foundation pagination
+// $center - Left or center align the li elements. Default: false
+// $base-style - Sets base styles for pagination. Default: true, Options: false
+// $use-default-classes - Makes unavailable & current classes available for use. Default: true
+@mixin pagination($center:false, $base-style:true, $use-default-classes:true) {
+
+ @if $base-style {
+ display: block;
+ height: $pagination-height;
+ margin-#{$default-float}: $pagination-margin;
+
+ li {
+ height: $pagination-li-height;
+ color: $pagination-li-font-color;
+ font-size: $pagination-li-font-size;
+ margin-#{$default-float}: $pagination-li-margin;
+
+ a {
+ display: block;
+ padding: $pagination-link-pad;
+ color: $pagination-link-font-color;
+ @include radius($global-radius)
+ }
+
+ &:hover a,
+ a:focus { background: $pagination-link-active-bg; }
+
+ @if $use-default-classes {
+ &.unavailable { @include pagination-unavailable-item(); }
+ &.current { @include pagination-current-item(); }
+ }
+ }
+ }
+
+ // Left or center align the li elements
+ li {
+ @if $center {
+ float: none;
+ display: inline-block;
+ } @else {
+ float: $pagination-li-float;
+ display: block;
+ }
+ }
+}
+
+@include exports("pagination") {
+ @if $include-html-nav-classes {
+ ul.pagination {
+ @include pagination;
+ }
+
+ /* Pagination centred wrapper */
+ .pagination-centered {
+ @include pagination-container(true);
+
+ ul.pagination {
+ @include pagination(true, false);
+ }
+ }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-panel-classes: $include-html-classes !default;
+
+// We use these to control the background and border styles
+$panel-bg: scale-color(#fff, $lightness: -5%) !default;
+$panel-border-style: solid !default;
+$panel-border-size: 1px !default;
+
+// We use this % to control how much we darken things on hover
+$panel-function-factor: -11% !default;
+$panel-border-color: scale-color($panel-bg, $lightness: $panel-function-factor) !default;
+
+// We use these to set default inner padding and bottom margin
+$panel-margin-bottom: rem-calc(20) !default;
+$panel-padding: rem-calc(20) !default;
+
+// We use these to set default font colors
+$panel-font-color: #333 !default;
+$panel-font-color-alt: #fff !default;
+
+$panel-header-adjust: true !default;
+$callout-panel-link-color: $primary-color !default;
+//
+// @mixins
+//
+// We use this mixin to create panels.
+// $bg - Sets the panel background color. Default: $panel-pg || scale-color(#fff, $lightness: -5%) !default
+// $padding - Sets the panel padding amount. Default: $panel-padding || rem-calc(20)
+// $adjust - Sets the font color based on the darkness of the bg & resets header line-heights for panels. Default: $panel-header-adjust || true
+@mixin panel($bg:$panel-bg, $padding:$panel-padding, $adjust:$panel-header-adjust) {
+
+ @if $bg {
+ $bg-lightness: lightness($bg);
+
+ border-style: $panel-border-style;
+ border-width: $panel-border-size;
+ border-color: scale-color($bg, $lightness: $panel-function-factor);
+ margin-bottom: $panel-margin-bottom;
+ padding: $padding;
+
+ background: $bg;
+
+ // Respect the padding, fool.
+ &>:first-child { margin-top: 0; }
+ &>:last-child { margin-bottom: 0; }
+
+ @if $adjust {
+ // We set the font color based on the darkness of the bg.
+ @if $bg-lightness >= 50% and $bg == blue { h1,h2,h3,h4,h5,h6,p { color: $panel-font-color-alt; } }
+ @else if $bg-lightness >= 50% { h1,h2,h3,h4,h5,h6,p { color: $panel-font-color; } }
+ @else { h1,h2,h3,h4,h5,h6,p { color: $panel-font-color-alt; } }
+
+ // reset header line-heights for panels
+ h1,h2,h3,h4,h5,h6 {
+ line-height: 1; margin-bottom: rem-calc(20) / 2;
+ &.subheader { line-height: 1.4; }
+ }
+ }
+ }
+}
+
+@include exports("panel") {
+ @if $include-html-panel-classes {
+
+ /* Panels */
+ .panel { @include panel;
+
+ &.callout {
+ @include panel(scale-color($primary-color, $lightness: 94%));
+ a {
+ color: $callout-panel-link-color;
+ }
+ }
+
+ &.radius {
+ @include panel($bg:false);
+ @include radius;
+ }
+
+ }
+
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-pricing-classes: $include-html-classes !default;
+
+// We use this to control the border color
+$price-table-border: solid 1px #ddd !default;
+
+// We use this to control the bottom margin of the pricing table
+$price-table-margin-bottom: rem-calc(20) !default;
+
+// We use these to control the title styles
+$price-title-bg: #333 !default;
+$price-title-padding: rem-calc(15 20) !default;
+$price-title-align: center !default;
+$price-title-color: #eee !default;
+$price-title-weight: normal !default;
+$price-title-size: rem-calc(16) !default;
+$price-title-font-family: $body-font-family !default;
+
+// We use these to control the price styles
+$price-money-bg: #f6f6f6 !default;
+$price-money-padding: rem-calc(15 20) !default;
+$price-money-align: center !default;
+$price-money-color: #333 !default;
+$price-money-weight: normal !default;
+$price-money-size: rem-calc(32) !default;
+$price-money-font-family: $body-font-family !default;
+
+
+// We use these to control the description styles
+$price-bg: #fff !default;
+$price-desc-color: #777 !default;
+$price-desc-padding: rem-calc(15) !default;
+$price-desc-align: center !default;
+$price-desc-font-size: rem-calc(12) !default;
+$price-desc-weight: normal !default;
+$price-desc-line-height: 1.4 !default;
+$price-desc-bottom-border: dotted 1px #ddd !default;
+
+// We use these to control the list item styles
+$price-item-color: #333 !default;
+$price-item-padding: rem-calc(15) !default;
+$price-item-align: center !default;
+$price-item-font-size: rem-calc(14) !default;
+$price-item-weight: normal !default;
+$price-item-bottom-border: dotted 1px #ddd !default;
+
+// We use these to control the CTA area styles
+$price-cta-bg: #fff !default;
+$price-cta-align: center !default;
+$price-cta-padding: rem-calc(20 20 0) !default;
+
+// @mixins
+//
+// We use this to create the container element for the pricing tables
+@mixin pricing-table-container {
+ border: $price-table-border;
+ margin-#{$default-float}: 0;
+ margin-bottom: $price-table-margin-bottom;
+
+ & * {
+ list-style: none;
+ line-height: 1;
+ }
+}
+// @mixins
+//
+// We use this mixin to create the pricing table title styles
+@mixin pricing-table-title {
+ background-color: $price-title-bg;
+ padding: $price-title-padding;
+ text-align: $price-title-align;
+ color: $price-title-color;
+ font-weight: $price-title-weight;
+ font-size: $price-title-size;
+ font-family: $price-title-font-family;
+}
+
+// @mixins
+//
+// We use this mixin to control the pricing table price styles
+@mixin pricing-table-price {
+ background-color: $price-money-bg;
+ padding: $price-money-padding;
+ text-align: $price-money-align;
+ color: $price-money-color;
+ font-weight: $price-money-weight;
+ font-size: $price-money-size;
+ font-family: $price-money-font-family;
+}
+
+// @mixins
+//
+// We use this mixin to create the description styles for the pricing table
+@mixin pricing-table-description {
+ background-color: $price-bg;
+ padding: $price-desc-padding;
+ text-align: $price-desc-align;
+ color: $price-desc-color;
+ font-size: $price-desc-font-size;
+ font-weight: $price-desc-weight;
+ line-height: $price-desc-line-height;
+ border-bottom: $price-desc-bottom-border;
+}
+
+// @mixins
+//
+// We use this mixin to style the bullet items in the pricing table
+@mixin pricing-table-bullet {
+ background-color: $price-bg;
+ padding: $price-item-padding;
+ text-align: $price-item-align;
+ color: $price-item-color;
+ font-size: $price-item-font-size;
+ font-weight: $price-item-weight;
+ border-bottom: $price-item-bottom-border;
+}
+
+// @mixins
+//
+// We use this mixin to style the CTA area of the pricing tables
+@mixin pricing-table-cta {
+ background-color: $price-cta-bg;
+ text-align: $price-cta-align;
+ padding: $price-cta-padding;
+}
+
+@include exports("pricing-table") {
+ @if $include-html-pricing-classes {
+
+ /* Pricing Tables */
+ .pricing-table {
+ @include pricing-table-container;
+
+ .title { @include pricing-table-title; }
+ .price { @include pricing-table-price; }
+ .description { @include pricing-table-description; }
+ .bullet-item { @include pricing-table-bullet; }
+ .cta-button { @include pricing-table-cta; }
+ }
+
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+$include-html-media-classes: $include-html-classes !default;
+
+// We use this to set the progress bar height
+$progress-bar-height: rem-calc(25) !default;
+$progress-bar-color: #f6f6f6 !default;
+
+// We use these to control the border styles
+$progress-bar-border-color: scale-color(#fff, $lightness: 20%) !default;
+$progress-bar-border-size: 1px !default;
+$progress-bar-border-style: solid !default;
+$progress-bar-border-radius: $global-radius !default;
+
+// We use these to control the margin & padding
+$progress-bar-pad: rem-calc(2) !default;
+$progress-bar-margin-bottom: rem-calc(10) !default;
+
+// We use these to set the meter colors
+$progress-meter-color: $primary-color !default;
+$progress-meter-secondary-color: $secondary-color !default;
+$progress-meter-success-color: $success-color !default;
+$progress-meter-alert-color: $alert-color !default;
+
+// @mixins
+//
+// We use this to set up the progress bar container
+@mixin progress-container {
+ background-color: $progress-bar-color;
+ height: $progress-bar-height;
+ border: $progress-bar-border-size $progress-bar-border-style $progress-bar-border-color;
+ padding: $progress-bar-pad;
+ margin-bottom: $progress-bar-margin-bottom;
+}
+
+// @mixins
+//
+// $bg - Default: $progress-meter-color || $primary-color
+@mixin progress-meter($bg:$progress-meter-color) {
+ background: $bg;
+ height: 100%;
+ display: block;
+}
+
+
+@include exports("progress-bar") {
+ @if $include-html-media-classes {
+
+ /* Progress Bar */
+ .progress {
+ @include progress-container;
+
+ // Meter
+ .meter {
+ @include progress-meter;
+ }
+ &.secondary .meter { @include progress-meter($bg:$progress-meter-secondary-color); }
+ &.success .meter { @include progress-meter($bg:$progress-meter-success-color); }
+ &.alert .meter { @include progress-meter($bg:$progress-meter-alert-color); }
+
+ &.radius { @include radius($global-radius);
+ .meter { @include radius($global-radius - 1); }
+ }
+
+ &.round { @include radius(1000px);
+ .meter { @include radius(999px); }
+ }
+
+ }
+
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @name _range-slider.scss
+// @dependencies _global.scss
+//
+
+//
+// @variables
+//
+
+$include-html-range-slider-classes: $include-html-classes !default;
+
+// These variabels define the slider bar styles
+$range-slider-bar-width: 100% !default;
+$range-slider-bar-height: rem-calc(16) !default;
+
+$range-slider-bar-border-width: 1px !default;
+$range-slider-bar-border-style: solid !default;
+$range-slider-bar-border-color: #ddd !default;
+$range-slider-radius: $global-radius !default;
+$range-slider-bar-bg-color: #fafafa !default;
+
+// Vertical bar styles
+$range-slider-vertical-bar-width: rem-calc(16) !default;
+$range-slider-vertical-bar-height: rem-calc(200) !default;
+
+// These variabels define the slider handle styles
+$range-slider-handle-width: rem-calc(32) !default;
+$range-slider-handle-height: $range-slider-handle-width !default;
+$range-slider-handle-margin-top: rem-calc(-10) !default;
+$range-slider-handle-bg-color: $primary-color !default;
+$range-slider-handle-border-width: 1px !default;
+$range-slider-handle-border-style: solid !default;
+$range-slider-handle-border-color: scale-color($range-slider-handle-bg-color, $lightness: -10%) !default;
+$range-slider-handle-radius: $global-radius !default;
+$range-slider-handle-bg-hover-color: scale-color($primary-color, $lightness: -12%) !default;
+$range-slider-handle-cursor: pointer !default;
+
+
+//
+// @mixins
+//
+
+@mixin range-slider-bar-base($vertical: false) {
+ display: block;
+ position: relative;
+ width: $range-slider-bar-width;
+ height: $range-slider-bar-height;
+ border: $range-slider-bar-border-width $range-slider-bar-border-style $range-slider-bar-border-color;
+ margin: rem-calc(20 0);
+ @if $vertical == true {
+ display: inline-block;
+ width: $range-slider-vertical-bar-width;
+ height: $range-slider-vertical-bar-height;
+ }
+}
+@mixin range-slider-bar-style(
+ $bg: true,
+ $radius:false) {
+ @if $bg == true { background: $range-slider-bar-bg-color; }
+ @if $radius == true { @include radius($range-slider-radius); }
+ }
+
+@mixin range-slider-bar(
+ $bg: $range-slider-bar-bg-color,
+ $radius:false) {
+ @include range-slider-bar-base;
+ @include range-slider-bar-style;
+}
+
+@mixin range-slider-handle-base() {
+ display: inline-block;
+ position: relative;
+ margin-top: $range-slider-handle-margin-top;
+ width: $range-slider-handle-width;
+ height: $range-slider-handle-height;
+ border: $range-slider-handle-border-width $range-slider-handle-border-style $range-slider-handle-border-color;
+ cursor: $range-slider-handle-cursor;
+}
+@mixin range-slider-handle-style(
+ $bg: true,
+ $radius: false) {
+ @if $bg == true { background: $range-slider-handle-bg-color; }
+ @if $radius == true { @include radius($range-slider-radius); }
+ &:hover {
+ background: $range-slider-handle-bg-hover-color;
+ }
+}
+@mixin range-slider-handle() {
+ @include range-slider-handle-base;
+ @include range-slider-handle-style;
+}
+
+// CSS Generation
+@include exports("range-slider-bar") {
+ @if $include-html-range-slider-classes {
+ .range-slider {
+ @include range-slider-bar-base;
+ @include range-slider-bar-style($bg:true, $radius:false);
+ &.vertical-range {
+ @include range-slider-bar-base($vertical: true);
+ .range-slider-handle {
+ margin-top: 0;
+ margin-#{$default-float}: -($range-slider-handle-width / 4);
+ position: absolute;
+ bottom: -($range-slider-vertical-bar-height - $range-slider-handle-width);
+ }
+ .range-slider-active-segment {
+ width: $range-slider-bar-height - rem-calc((strip-unit($range-slider-bar-border-width) * 2));
+ height: auto;
+ bottom: 0;
+ }
+ }
+ &.radius {
+ @include range-slider-bar-style($radius:true);
+ .range-slider-handle { @include range-slider-handle-style($radius: true); }
+ }
+ }
+ .range-slider-active-segment {
+ display: inline-block;
+ position: absolute;
+ height: $range-slider-bar-height - rem-calc((strip-unit($range-slider-bar-border-width) * 2));
+ background: scale-color($secondary-color, $lightness: -1%);
+ ~ .range-slider-handle { margin-#{$default-float}: -($range-slider-handle-width / 4); }
+ }
+ .range-slider-handle {
+ @include range-slider-handle-base;
+ @include range-slider-handle-style($bg:true, $radius: false);
+ }
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// @name _reveal.scss
+// @dependencies _global.scss
+//
+
+$include-html-reveal-classes: $include-html-classes !default;
+
+// We use these to control the style of the reveal overlay.
+$reveal-overlay-bg: rgba(#000, .45) !default;
+$reveal-overlay-bg-old: #000 !default;
+
+// We use these to control the style of the modal itself.
+$reveal-modal-bg: #fff !default;
+$reveal-position-top: rem-calc(100) !default;
+$reveal-default-width: 80% !default;
+$reveal-modal-padding: rem-calc(20) !default;
+$reveal-box-shadow: 0 0 10px rgba(#000,.4) !default;
+
+// We use these to style the reveal close button
+$reveal-close-font-size: rem-calc(22) !default;
+$reveal-close-top: rem-calc(8) !default;
+$reveal-close-side: rem-calc(11) !default;
+$reveal-close-color: #aaa !default;
+$reveal-close-weight: bold !default;
+
+// We use these to control the modal border
+$reveal-border-style: solid !default;
+$reveal-border-width: 1px !default;
+$reveal-border-color: #666 !default;
+
+$reveal-modal-class: "reveal-modal" !default;
+$close-reveal-modal-class: "close-reveal-modal" !default;
+
+//
+// @mixins
+//
+
+// We use this to create the reveal background overlay styles
+@mixin reveal-bg {
+ position: fixed;
+ height: 100%;
+ width: 100%;
+ background: $reveal-overlay-bg-old;
+ background: $reveal-overlay-bg;
+ z-index: 98;
+ display: none;
+ top: 0;
+ #{$default-float}: 0;
+}
+
+// We use this mixin to create the structure of a reveal modal
+//
+// $base-style - Provides reveal base styles, can be set to false to override. Default: true, Options: false
+// $width - Sets reveal width Default: $reveal-default-width || 80%
+//
+@mixin reveal-modal-base(
+ $base-style:true,
+ $width:$reveal-default-width) {
+ @if $base-style {
+ visibility: hidden;
+ display: none;
+ position: absolute;
+ #{$default-float}: 50%;
+ z-index: 99;
+ height: auto;
+
+ // Make sure rows don't have a min-width on them
+ .column,
+ .columns { min-width: 0; }
+
+ // Get rid of margin from first and last element inside modal
+ & > :first-child { margin-top: 0; }
+ & > :last-child { margin-bottom: 0; }
+ }
+
+ @if $width {
+ margin-#{$default-float}: -($width / 2);
+ width: $width;
+ }
+}
+
+// We use this to style the reveal modal defaults
+//
+// $bg - Sets background color of reveal modal. Default: $reveal-modal-bg || #fff
+// $padding - Padding to apply to reveal modal. Default: $reveal-modal-padding.
+// $border - Choose whether reveal uses a border. Default: true, Options: false
+// $border-style - Set reveal border style. Default: $reveal-border-style || solid
+// $border-width - Width of border (i.e. 1px). Default: $reveal-border-width.
+// $border-color - Color of border. Default: $reveal-border-color.
+// $box-shadow - Choose whether or not to include the default box-shadow. Default: true, Options: false
+// $top-offset - Default: $reveal-position-top || 50px
+@mixin reveal-modal-style(
+ $bg:$reveal-modal-bg,
+ $padding:$reveal-modal-padding,
+ $border:true,
+ $border-style:$reveal-border-style,
+ $border-width:$reveal-border-width,
+ $border-color:$reveal-border-color,
+ $box-shadow:true,
+ $top-offset:$reveal-position-top) {
+
+ @if $bg { background-color: $bg; }
+ @if $padding { padding: $padding; }
+
+ @if $border { border: $border-style $border-width $border-color; }
+
+ // We can choose whether or not to include the default box-shadow.
+ @if $box-shadow {
+ @if $experimental {
+ -webkit-box-shadow: $reveal-box-shadow;
+ }
+ box-shadow: $reveal-box-shadow;
+ }
+
+ @if $top-offset { top: $top-offset; }
+}
+
+// We use this to create a close button for the reveal modal
+//
+// $color - Default: $reveal-close-color || #aaa
+@mixin reveal-close($color:$reveal-close-color) {
+ font-size: $reveal-close-font-size;
+ line-height: 1;
+ position: absolute;
+ top: $reveal-close-top;
+ #{$opposite-direction}: $reveal-close-side;
+ color: $color;
+ font-weight: $reveal-close-weight;
+ cursor: $cursor-pointer-value;
+}
+
+@include exports("reveal") {
+ @if $include-html-reveal-classes {
+
+ // Reveal Modals
+ .reveal-modal-bg { @include reveal-bg; }
+
+ dialog, .#{$reveal-modal-class} {
+ @include reveal-modal-base;
+ @include reveal-modal-style;
+
+ .#{$close-reveal-modal-class} { @include reveal-close; }
+ }
+
+ dialog[open] {
+ display:block;
+ visibility: visible;
+ }
+
+ @media #{$medium-up} {
+
+ dialog, .#{$reveal-modal-class} {
+ @include reveal-modal-style(false, $reveal-modal-padding * 1.5, false, $box-shadow: false, $top-offset: $reveal-position-top);
+
+ &.tiny { @include reveal-modal-base(false, 30%); }
+ &.small { @include reveal-modal-base(false, 40%); }
+ &.medium { @include reveal-modal-base(false, 60%); }
+ &.large { @include reveal-modal-base(false, 70%); }
+ &.xlarge { @include reveal-modal-base(false, 95%); }
+ }
+ }
+
+ // Reveal Print Styles
+ @media print {
+ dialog, .#{$reveal-modal-class} {background: #fff !important;}
+ }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @variables
+//
+
+$include-html-nav-classes: $include-html-classes !default;
+
+// We use this to control padding.
+$side-nav-padding: rem-calc(14 0) !default;
+
+// We use these to control list styles.
+$side-nav-list-type: none !default;
+$side-nav-list-position: inside !default;
+$side-nav-list-margin: rem-calc(0 0 7 0) !default;
+
+// We use these to control link styles.
+$side-nav-link-color: $primary-color !default;
+$side-nav-link-color-active: scale-color($side-nav-link-color, $lightness: 30%) !default;
+$side-nav-link-color-hover: scale-color($side-nav-link-color, $lightness: 30%) !default;
+$side-nav-font-size: rem-calc(14) !default;
+$side-nav-font-weight: normal !default;
+$side-nav-font-family: $body-font-family !default;
+$side-nav-active-font-family: $side-nav-font-family !default;
+
+
+
+// We use these to control border styles
+$side-nav-divider-size: 1px !default;
+$side-nav-divider-style: solid !default;
+$side-nav-divider-color: scale-color(#fff, $lightness: 10%) !default;
+
+
+//
+// @mixins
+//
+
+
+// We use this to style the side-nav
+//
+// $divider-color - Border color of divider. Default: $side-nav-divider-color.
+// $font-size - Font size of nav items. Default: $side-nav-font-size.
+// $link-color - Color of navigation links. Default: $side-nav-link-color.
+// $link-color-hover - Color of navigation links when hovered. Default: $side-nav-link-color-hover.
+@mixin side-nav(
+ $divider-color:$side-nav-divider-color,
+ $font-size:$side-nav-font-size,
+ $link-color:$side-nav-link-color,
+ $link-color-hover:$side-nav-link-color-hover) {
+ display: block;
+ margin: 0;
+ padding: $side-nav-padding;
+ list-style-type: $side-nav-list-type;
+ list-style-position: $side-nav-list-position;
+ font-family: $side-nav-font-family;
+
+ li {
+ margin: $side-nav-list-margin;
+ font-size: $font-size;
+
+ a:not(.button) {
+ display: block;
+ color: $link-color;
+ &:hover,
+ &:focus { color: $link-color-hover; }
+ }
+
+ &.active > a:first-child:not(.button) {
+ color: $side-nav-link-color-active;
+ font-weight: $side-nav-font-weight;
+ font-family: $side-nav-active-font-family;
+ }
+
+ &.divider {
+ border-top: $side-nav-divider-size $side-nav-divider-style;
+ height: 0;
+ padding: 0;
+ list-style: none;
+ border-top-color: $divider-color;
+ }
+ }
+}
+
+@include exports("side-nav") {
+ @if $include-html-nav-classes {
+ .side-nav { @include side-nav; }
+ }
+}
--- /dev/null
+@import "global";
+@import "buttons";
+@import "dropdown-buttons";
+
+//
+// @name _split-buttons.scss
+// @dependencies _buttons.scss, _global.scss
+//
+
+//
+// @variables
+//
+
+$include-html-button-classes: $include-html-classes !default;
+
+// We use these to control different shared styles for Split Buttons
+$split-button-function-factor: 10% !default;
+$split-button-pip-color: #fff !default;
+$split-button-pip-color-alt: #333 !default;
+$split-button-active-bg-tint: rgba(0,0,0,0.1) !default;
+
+// We use these to control tiny split buttons
+$split-button-padding-tny: $button-pip-tny * 10 !default;
+$split-button-span-width-tny: $button-pip-tny * 6 !default;
+$split-button-pip-size-tny: $button-pip-tny !default;
+$split-button-pip-top-tny: $button-pip-tny * 2 !default;
+$split-button-pip-default-float-tny: rem-calc(-6) !default;
+
+// We use these to control small split buttons
+$split-button-padding-sml: $button-pip-sml * 10 !default;
+$split-button-span-width-sml: $button-pip-sml * 6 !default;
+$split-button-pip-size-sml: $button-pip-sml !default;
+$split-button-pip-top-sml: $button-pip-sml * 1.5 !default;
+$split-button-pip-default-float-sml: rem-calc(-6) !default;
+
+// We use these to control medium split buttons
+$split-button-padding-med: $button-pip-med * 9 !default;
+$split-button-span-width-med: $button-pip-med * 5.5 !default;
+$split-button-pip-size-med: $button-pip-med - rem-calc(3) !default;
+$split-button-pip-top-med: $button-pip-med * 1.5 !default;
+$split-button-pip-default-float-med: rem-calc(-6) !default;
+
+// We use these to control large split buttons
+$split-button-padding-lrg: $button-pip-lrg * 8 !default;
+$split-button-span-width-lrg: $button-pip-lrg * 5 !default;
+$split-button-pip-size-lrg: $button-pip-lrg - rem-calc(6) !default;
+$split-button-pip-top-lrg: $button-pip-lrg + rem-calc(5) !default;
+$split-button-pip-default-float-lrg: rem-calc(-6) !default;
+
+
+//
+// @mixins
+//
+
+// We use this mixin to create split buttons that build upon the button mixins
+//
+// $padding - Type of padding to apply. Default: medium. Options: tiny, small, medium, large.
+// $pip-color - Color of the triangle. Default: $split-button-pip-color.
+// $span-border - Border color of button divider. Default: $primary-color.
+// $base-style - Apply base style to split button. Default: true.
+@mixin split-button(
+ $padding:medium,
+ $pip-color:$split-button-pip-color,
+ $span-border:$primary-color,
+ $base-style:true) {
+
+ // With this, we can control whether or not the base styles come through.
+ @if $base-style {
+ position: relative;
+
+ // Styling for the split arrow clickable area
+ span {
+ display: block;
+ height: 100%;
+ position: absolute;
+ #{$opposite-direction}: 0;
+ top: 0;
+ border-#{$default-float}: solid 1px;
+
+ // Building the triangle pip indicator
+ &:before {
+ position: absolute;
+ content: "";
+ width: 0;
+ height: 0;
+ display: block;
+ border-style: inset;
+ top: 50%;
+
+ #{$default-float}: 50%;
+ }
+
+ &:active { background-color: $split-button-active-bg-tint; }
+ }
+ }
+
+ // Control the border color for the span area of the split button
+ @if $span-border {
+ span {
+ border-#{$default-float}-color: rgba(255,255,255,0.5);
+ }
+ }
+
+ // Style of the button and clickable area for tiny sizes
+ @if $padding == tiny {
+ padding-#{$opposite-direction}: $split-button-padding-tny;
+
+ span { width: $split-button-span-width-tny;
+ &:before {
+ border-top-style: solid;
+ border-width: $split-button-pip-size-tny;
+ top: 48%;
+ margin-#{$default-float}: $split-button-pip-default-float-tny;
+ }
+ }
+ }
+
+ // Style of the button and clickable area for small sizes
+ @else if $padding == small {
+ padding-#{$opposite-direction}: $split-button-padding-sml;
+
+ span { width: $split-button-span-width-sml;
+ &:before {
+ border-top-style: solid;
+ border-width: $split-button-pip-size-sml;
+ top: 48%;
+ margin-#{$default-float}: $split-button-pip-default-float-sml;
+ }
+ }
+ }
+
+ // Style of the button and clickable area for default (medium) sizes
+ @else if $padding == medium {
+ padding-#{$opposite-direction}: $split-button-padding-med;
+
+ span { width: $split-button-span-width-med;
+ &:before {
+ border-top-style: solid;
+ border-width: $split-button-pip-size-med;
+ top: 48%;
+ margin-#{$default-float}: $split-button-pip-default-float-med;
+ }
+ }
+ }
+
+ // Style of the button and clickable area for large sizes
+ @else if $padding == large {
+ padding-#{$opposite-direction}: $split-button-padding-lrg;
+
+ span { width: $split-button-span-width-lrg;
+ &:before {
+ border-top-style: solid;
+ border-width: $split-button-pip-size-lrg;
+ top: 48%;
+ margin-#{$default-float}: $split-button-pip-default-float-lrg;
+ }
+ }
+ }
+
+ // Control the color of the triangle pip
+ @if $pip-color {
+ span:before { border-color: $pip-color transparent transparent transparent; }
+ }
+}
+
+@include exports("split-button") {
+ @if $include-html-button-classes {
+
+ .split.button { @include split-button;
+
+ &.secondary { @include split-button(false, $split-button-pip-color, $secondary-color, false); }
+ &.alert { @include split-button(false, false, $alert-color, false); }
+ &.success { @include split-button(false, false, $success-color, false); }
+
+ &.tiny { @include split-button(tiny, false, false, false); }
+ &.small { @include split-button(small, false, false, false); }
+ &.large { @include split-button(large, false, false, false); }
+ &.expand { padding-left: 2rem; }
+
+ &.secondary { @include split-button(false, $split-button-pip-color-alt, false, false); }
+
+ &.radius span { @include side-radius($opposite-direction, $global-radius); }
+ &.round span { @include side-radius($opposite-direction, 1000px); }
+ }
+
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @name _sub-nav.scss
+// @dependencies _global.scss
+//
+
+//
+// @variables
+//
+
+$include-html-nav-classes: $include-html-classes !default;
+
+// We use these to control margin and padding
+$sub-nav-list-margin: rem-calc(-4 0 18) !default;
+$sub-nav-list-padding-top: rem-calc(4) !default;
+
+// We use this to control the definition
+$sub-nav-font-family: $body-font-family !default;
+$sub-nav-font-size: rem-calc(14) !default;
+$sub-nav-font-color: #999 !default;
+$sub-nav-font-weight: normal !default;
+$sub-nav-text-decoration: none !default;
+$sub-nav-padding: rem-calc(3 16) !default;
+$sub-nav-border-radius: 3px !default;
+$sub-nav-font-color-hover: scale-color($sub-nav-font-color, $lightness: -25%) !default;
+
+
+// We use these to control the active item styles
+
+$sub-nav-active-font-weight: normal !default;
+$sub-nav-active-bg: $primary-color !default;
+$sub-nav-active-bg-hover: scale-color($sub-nav-active-bg, $lightness: -14%) !default;
+$sub-nav-active-color: #fff !default;
+$sub-nav-active-padding: $sub-nav-padding !default;
+$sub-nav-active-cursor: default !default;
+
+$sub-nav-item-divider: "" !default;
+$sub-nav-item-divider-margin: rem-calc(12) !default;
+
+//
+// @mixins
+//
+
+
+// Create a sub-nav item
+//
+// $font-color - Font color. Default: $sub-nav-font-color.
+// $font-size - Font size. Default: $sub-nav-font-size.
+// $active-bg - Background of active nav item. Default: $sub-nav-active-bg.
+// $active-bg-hover - Background of active nav item, when hovered. Default: $sub-nav-active-bg-hover.
+@mixin sub-nav(
+ $font-color: $sub-nav-font-color,
+ $font-size: $sub-nav-font-size,
+ $active-bg: $sub-nav-active-bg,
+ $active-bg-hover: $sub-nav-active-bg-hover) {
+ display: block;
+ width: auto;
+ overflow: hidden;
+ margin: $sub-nav-list-margin;
+ padding-top: $sub-nav-list-padding-top;
+ margin-#{$opposite-direction}: 0;
+ margin-#{$default-float}: rem-calc(-12);
+
+ dt {
+ text-transform: uppercase;
+ }
+
+ dt,
+ dd,
+ li {
+ float: $default-float;
+ display: inline;
+ margin-#{$default-float}: rem-calc(16);
+ margin-bottom: rem-calc(10);
+ font-family: $sub-nav-font-family;
+ font-weight: $sub-nav-font-weight;
+ font-size: $font-size;
+ color: $font-color;
+
+ a {
+ text-decoration: $sub-nav-text-decoration;
+ color: $sub-nav-font-color;
+ padding: $sub-nav-padding;
+ &:hover {
+ color: $sub-nav-font-color-hover;
+ }
+ }
+
+ &.active a {
+ @include radius($global-radius);
+ font-weight: $sub-nav-active-font-weight;
+ background: $active-bg;
+ padding: $sub-nav-active-padding;
+ cursor: $sub-nav-active-cursor;
+ color: $sub-nav-active-color;
+ &:hover {
+ background: $active-bg-hover;
+ }
+ }
+ @if $sub-nav-item-divider != "" {
+ margin-#{$default-float}: 0;
+
+ &:before {
+ content: "#{$sub-nav-item-divider}";
+ margin: 0 $sub-nav-item-divider-margin;
+ }
+
+ &:first-child:before {
+ content: "";
+ margin: 0;
+ }
+ }
+ }
+}
+
+@include exports("sub-nav") {
+ @if $include-html-nav-classes {
+ .sub-nav { @include sub-nav; }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @name
+// @dependencies _global.scss
+//
+
+//
+// @variables
+//
+
+// NOTE: Switches have been deprecated in Foundation 5 and will be removed in the future.
+
+$include-html-form-classes: $include-html-classes !default;
+
+// Controlling border styles and background colors for the switch container
+$switch-border-color: scale-color(#fff, $lightness: -20%) !default;
+$switch-border-style: solid !default;
+$switch-border-width: 1px !default;
+$switch-bg: #fff !default;
+
+// We use these to control the switch heights for our default classes
+$switch-height-tny: 22px !default;
+$switch-height-sml: 28px !default;
+$switch-height-med: 36px !default;
+$switch-height-lrg: 44px !default;
+$switch-bottom-margin: rem-calc(20) !default;
+
+// We use these to control default font sizes for our classes.
+$switch-font-size-tny: 11px !default;
+$switch-font-size-sml: 12px !default;
+$switch-font-size-med: 14px !default;
+$switch-font-size-lrg: 17px !default;
+$switch-label-side-padding: 6px !default;
+
+// We use these to style the switch-paddle
+$switch-paddle-bg: #fff !default;
+$switch-paddle-fade-to-color: scale-color($switch-paddle-bg, $lightness: -10%) !default;
+$switch-paddle-border-color: scale-color($switch-paddle-bg, $lightness: -35%) !default;
+$switch-paddle-border-width: 1px !default;
+$switch-paddle-border-style: solid !default;
+$switch-paddle-transition-speed: .1s !default;
+$switch-paddle-transition-ease: ease-out !default;
+$switch-positive-color: scale-color($success-color, $lightness: 94%) !default;
+$switch-negative-color: #f5f5f5 !default;
+
+// Outline Style for tabbing through switches
+$switch-label-outline: 1px dotted #888 !default;
+
+
+//
+// @mixins
+//
+
+// We use this mixin to create the base styles for our switch element.
+//
+// $transition-speed - Time in ms for switch to toggle. Default: $switch-paddle-transition-speed.
+// $transition-ease - Easing function to use for animation (i.e. ease-out). Default: $switch-paddle-transition-ease.
+@mixin switch-base(
+ $transition-speed:$switch-paddle-transition-speed,
+ $transition-ease:$switch-paddle-transition-ease) {
+
+ // Default position and structure for switch container.
+ position: relative;
+ padding: 0;
+ display: block;
+ overflow: hidden;
+ border-style: $switch-border-style;
+ border-width: $switch-border-width;
+ margin-bottom: $switch-bottom-margin;
+
+ // Default label styles for type and transition
+ label {
+ position: relative;
+ #{$default-float}: 0;
+ z-index: 2;
+ float: $default-float;
+ width: 50%;
+ height: 100%;
+ margin: 0;
+ font-weight: bold;
+ text-align: $default-float;
+
+ // Transition for the switch label to follow paddle
+ @include single-transition(all, $transition-speed, $transition-ease);
+ }
+
+ // So that we don't need to recreate the form with any JS, we use the
+ // existing radio button, but we cleverly position and hide it.
+ input {
+ position: absolute;
+ z-index: 3;
+ opacity: 0;
+ width: 100%;
+ height: 100%;
+ -moz-appearance: none;
+
+ // Hover and focus styles for the paddle
+ &:hover,
+ &:focus {
+ cursor: $cursor-pointer-value;
+ }
+ }
+
+ // The toggle area for radio switches. We call is a paddle.
+ span:last-child {
+ position: absolute;
+ top: -1px;
+ #{$default-float}: -1px;
+ z-index: 1;
+ display: block;
+ padding: 0;
+ border-width: $switch-paddle-border-width;
+ border-style: $switch-paddle-border-style;
+
+ // Transition for the switch paddle
+ @include single-transition(all, $transition-speed, $transition-ease);
+ }
+
+ // When a label isn't :checked, we hide it as it slides away.
+ input:not(:checked) + label { opacity: 0; }
+
+ // Controlling the position of the labels as they are toggled.
+ input:checked { display: none !important; }
+ input { #{$default-float}: 0; display: block !important; }
+
+ // Left Label alignment and position changes, including fixes for while inside a custom form
+ input:first-of-type + label,
+ input:first-of-type + span + label { #{$default-float}: -50%; }
+ input:first-of-type:checked + label,
+ input:first-of-type:checked + span + label { #{$default-float}: 0%; }
+
+ // Right Label alignment and position changes, including fixes for while inside a custom form
+ input:last-of-type + label,
+ input:last-of-type + span + label {#{$opposite-direction}: -50%; #{$default-float}: auto; text-align: $opposite-direction; }
+ input:last-of-type:checked + label,
+ input:last-of-type:checked + span + label { #{$opposite-direction}: 0%; #{$default-float}: auto; }
+
+ // Hiding custom form spans since we auto-create them
+ span.custom { display: none !important; }
+
+ // FIXME We should be able to remove this going forward.
+ // Bugfix for older Webkit, including mobile Webkit. Adapted from:
+ // http://css-tricks.com/webkit-sibling-bug/
+ // @media only screen and (-webkit-min-device-pixel-ratio:0) and (max-device-width:480px) {
+ // @if $experimental { -webkit-animation: webkitSiblingBugfix infinite 1s; }
+ // }
+ // @media only screen and (-webkit-min-device-pixel-ratio:1.5) {
+ // @if $experimental { -webkit-animation: none 0; }
+ // }
+
+ form.custom & .hidden-field {
+ margin-left: auto;
+ position: absolute;
+ visibility: visible;
+ }
+}
+
+// We use this mixin to create the size styles for switches.
+//
+// $height - Height (in px) of the switch. Default: $switch-height-med.
+// $font-size - Font size of text in switch. Default: $switch-font-size-med.
+// $line-height - Line height of switch. Default: 2.3rem.
+@mixin switch-size(
+ $height: $switch-height-med,
+ $font-size: $switch-font-size-med,
+ $line-height: 2.3rem) {
+
+ height: rem-calc($height);
+
+ label {
+ padding: rem-calc(0, $switch-label-side-padding);
+ line-height: $line-height;
+ font-size: rem-calc($font-size);
+ }
+
+ input {
+ // Move the paddle to the right position
+ &:first-of-type:checked ~ span:last-child {
+ #{$default-float}: 100%;
+ margin-#{$default-float}: rem-calc(-$height + 1px);
+ }
+ }
+
+ span:last-child {
+ width: rem-calc($height);
+ height: rem-calc($height);
+ }
+
+}
+
+// We use this mixin to add color and other fanciness to the switches.
+//
+// $paddle-bg - Background of switch paddle. Default: $switch-paddle-bg.
+// $positive-color - Background color of positive side of switch. Default: $switch-positive-color.
+// $negative-color - Background color of negative side of switch. Default: $switch-negative-color.
+// $radius - Radius to apply to switch. Default: false.
+// $base-style - Apply base styles? Default: true.
+@mixin switch-style(
+ $paddle-bg:$switch-paddle-bg,
+ $positive-color:$switch-positive-color,
+ $negative-color:$switch-negative-color,
+ $radius:false,
+ $base-style:true) {
+
+ @if $base-style {
+ background: $switch-bg;
+ border-color: $switch-border-color;
+
+ span:last-child {
+ border-color: scale-color($paddle-bg, $lightness: -30%);
+ background: $paddle-bg;
+ @if $experimental {
+ background: -moz-linear-gradient(top, $paddle-bg 0%, scale-color($paddle-bg, $lightness: -5%) 100%);
+ background: -webkit-linear-gradient(top, $paddle-bg 0%, scale-color($paddle-bg, $lightness: -5%) 100%);
+ }
+ background: linear-gradient(to bottom, $paddle-bg 0%, scale-color($paddle-bg, $lightness: -5%) 100%);
+
+ // Building the alternating colored sides of the switch
+ @if $experimental {
+ -webkit-box-shadow: 2px 0 10px 0 rgba(0,0,0,0.07),
+ 1000px 0 0 1000px $positive-color,
+ -2px 0 10px 0 rgba(0,0,0,0.07),
+ -1000px 0 0 1000px $negative-color;
+ }
+ box-shadow: 2px 0 10px 0 rgba(0,0,0,0.07),
+ 1000px 0 0 980px $positive-color,
+ -2px 0 10px 0 rgba(0,0,0,0.07),
+ -1000px 0 0 1000px $negative-color;
+ }
+
+ &:hover,
+ &:focus {
+ span:last-child {
+ background: $paddle-bg;
+ @if $experimental {
+ background: -moz-linear-gradient(top, $paddle-bg 0%, scale-color($paddle-bg, $lightness: -10%) 100%);
+ background: -webkit-linear-gradient(top, $paddle-bg 0%, scale-color($paddle-bg, $lightness: -10%) 100%);
+ }
+ background: linear-gradient(to bottom, $paddle-bg 0%, scale-color($paddle-bg, $lightness: -10%) 100%);
+ }
+ }
+
+ &:active { background: transparent; }
+ }
+
+ // Setting up the radius for switches
+ @if $radius == true {
+ @include radius(4px);
+ span:last-child { @include radius(3px); }
+ }
+ @else if $radius {
+ @include radius($radius);
+ span:last-child { @include radius($radius - 1px); }
+ }
+
+}
+
+// We use this to quickly create switches with a single mixin
+//
+// $transition-speed - Time in ms for switch to toggle. Default: $switch-paddle-transition-speed.
+// $transition-ease - Easing function to use for animation (i.e. ease-out). Default: $switch-paddle-transition-ease.
+// $height - Height (in px) of the switch. Default: $switch-height-med.
+// $font-size - Font size of text in switch. Default: $switch-font-size-med.
+// $line-height - Line height of switch. Default: 2.3rem.
+// $paddle-bg - Background of switch paddle. Default: $switch-paddle-bg.
+// $positive-color - Background color of positive side of switch. Default: $switch-positive-color.
+// $negative-color - Background color of negative side of switch. Default: $switch-negative-color.
+// $radius - Radius to apply to switch. Default: false.
+// $base-style - Apply base styles? Default: true.
+@mixin switch(
+ $transition-speed: $switch-paddle-transition-speed,
+ $transition-ease: $switch-paddle-transition-ease,
+ $height: $switch-height-med,
+ $font-size: $switch-font-size-med,
+ $line-height: 2.3rem,
+ $paddle-bg: $switch-paddle-bg,
+ $positive-color: $switch-positive-color,
+ $negative-color: $switch-negative-color,
+ $radius:false,
+ $base-style:true) {
+ @include switch-base($transition-speed, $transition-ease);
+ @include switch-size($height, $font-size, $line-height);
+ @include switch-style($paddle-bg, $positive-color, $negative-color, $radius, $base-style);
+}
+
+@include exports("switch") {
+ @if $include-html-form-classes {
+ div.switch {
+ @include switch;
+
+ // Large radio switches
+ &.large { @include switch-size($switch-height-lrg, $switch-font-size-lrg); }
+
+ // Small radio switches
+ &.small { @include switch-size($switch-height-sml, $switch-font-size-sml, 2.1rem); }
+
+ // Tiny radio switches
+ &.tiny { @include switch-size($switch-height-tny, $switch-font-size-tny, 1.9rem); }
+
+ // Add a radius to the switch
+ &.radius { @include radius(4px);
+ span:last-child{ @include radius(3px); }
+ }
+
+ // Make the switch completely round, like a pill
+ &.round { @include radius(1000px);
+ span:last-child { @include radius(999px); }
+ label { padding: rem-calc(0 $switch-label-side-padding + 3); }
+ }
+
+ }
+
+ @if $experimental { @-webkit-keyframes webkitSiblingBugfix { from { position: relative; } to { position: relative; } } }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// @name _tables.scss
+// @dependencies _global.scss
+//
+
+//
+// @variables
+//
+
+$include-html-table-classes: $include-html-classes !default;
+
+// These control the background color for the table and even rows
+$table-bg: #fff !default;
+$table-even-row-bg: #f9f9f9 !default;
+
+// These control the table cell border style
+$table-border-style: solid !default;
+$table-border-size: 1px !default;
+$table-border-color: #ddd !default;
+
+// These control the table head styles
+$table-head-bg: #f5f5f5 !default;
+$table-head-font-size: rem-calc(14) !default;
+$table-head-font-color: #222 !default;
+$table-head-font-weight: bold !default;
+$table-head-padding: rem-calc(8 10 10) !default;
+
+// These control the row padding and font styles
+$table-row-padding: rem-calc(9 10) !default;
+$table-row-font-size: rem-calc(14) !default;
+$table-row-font-color: #222 !default;
+$table-line-height: rem-calc(18) !default;
+
+// These are for controlling the display and margin of tables
+$table-display: table-cell !default;
+$table-margin-bottom: rem-calc(20) !default;
+
+
+//
+// @mixins
+//
+
+@mixin table {
+ background: $table-bg;
+ margin-bottom: $table-margin-bottom;
+ border: $table-border-style $table-border-size $table-border-color;
+
+ thead,
+ tfoot {
+ background: $table-head-bg;
+
+ tr {
+ th,
+ td {
+ padding: $table-head-padding;
+ font-size: $table-head-font-size;
+ font-weight: $table-head-font-weight;
+ color: $table-head-font-color;
+ text-align: $default-float;
+ }
+ }
+ }
+
+ tr {
+ th,
+ td {
+ padding: $table-row-padding;
+ font-size: $table-row-font-size;
+ color: $table-row-font-color;
+ }
+
+ &.even,
+ &.alt,
+ &:nth-of-type(even) { background: $table-even-row-bg; }
+ }
+
+ thead tr th,
+ tfoot tr th,
+ tbody tr td,
+ tr td,
+ tfoot tr td { display: $table-display; line-height: $table-line-height; }
+}
+
+
+@include exports("table") {
+ @if $include-html-table-classes {
+ table {
+ @include table;
+ }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+@import "grid";
+
+//
+// @variables
+//
+
+$include-html-tabs-classes: $include-html-classes !default;
+
+$tabs-navigation-padding: rem-calc(16) !default;
+$tabs-navigation-bg-color: #efefef !default;
+$tabs-navigation-active-bg-color: #fff !default;
+$tabs-navigation-hover-bg-color: scale-color($tabs-navigation-bg-color, $lightness: -6%) !default;
+$tabs-navigation-font-color: #222 !default;
+$tabs-navigation-font-size: rem-calc(16) !default;
+$tabs-navigation-font-family: $body-font-family !default;
+
+$tabs-content-margin-bottom: rem-calc(24) !default;
+$tabs-content-padding: $column-gutter/2 !default;
+
+$tabs-vertical-navigation-margin-bottom: 1.25rem !default;
+
+@include exports("tab") {
+ @if $include-html-tabs-classes {
+ .tabs {
+ @include clearfix;
+ margin-bottom: 0 !important;
+ dd {
+ position: relative;
+ margin-bottom: 0 !important;
+ top: 1px;
+ float: $default-float;
+ > a {
+ display: block;
+ background: $tabs-navigation-bg-color;
+ color: $tabs-navigation-font-color;
+ padding-top: $tabs-navigation-padding;
+ padding-#{$opposite-direction}: $tabs-navigation-padding * 2;
+ padding-bottom: $tabs-navigation-padding + rem-calc(1);
+ padding-#{$default-float}: $tabs-navigation-padding * 2;
+ font-family: $tabs-navigation-font-family;
+ font-size: $tabs-navigation-font-size;
+ &:hover { background: $tabs-navigation-hover-bg-color; }
+ }
+ &.active a { background: $tabs-navigation-active-bg-color; }
+ }
+ &.radius {
+ dd:first-child {
+ a { @include side-radius($default-float, $global-radius); }
+ }
+ dd:last-child {
+ a { @include side-radius($opposite-direction, $global-radius); }
+ }
+ }
+ &.vertical {
+ dd {
+ position: inherit;
+ float: none;
+ display: block;
+ top: auto;
+ }
+ }
+ }
+
+ .tabs-content {
+ @include clearfix;
+ margin-bottom: $tabs-content-margin-bottom;
+ width: 100%;
+ > .content {
+ display: none;
+ float: $default-float;
+ padding: $tabs-content-padding 0;
+ width: 100%;
+ &.active { display: block; }
+ &.contained { padding: $tabs-content-padding; }
+ }
+ &.vertical {
+ display: block;
+ > .content { padding: 0 $tabs-content-padding; }
+ }
+ }
+ @media #{$medium-up} {
+ .tabs {
+ &.vertical {
+ width: 20%;
+ float: $default-float;
+ margin-bottom: $tabs-vertical-navigation-margin-bottom;
+ }
+ }
+ .tabs-content {
+ &.vertical {
+ width: 80%;
+ float: $default-float;
+ margin-#{$default-float}: -1px;
+ }
+ }
+ }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+
+
+//
+// @name _thumbs.scss
+// @dependencies _globals.scss
+//
+
+//
+// @variables
+//
+
+$include-html-media-classes: $include-html-classes !default;
+
+// We use these to control border styles
+$thumb-border-style: solid !default;
+$thumb-border-width: 4px !default;
+$thumb-border-color: #fff !default;
+$thumb-box-shadow: 0 0 0 1px rgba(#000,.2) !default;
+$thumb-box-shadow-hover: 0 0 6px 1px rgba($primary-color,0.5) !default;
+
+// Radius and transition speed for thumbs
+$thumb-radius: $global-radius !default;
+$thumb-transition-speed: 200ms !default;
+
+//
+// @mixins
+//
+
+// We use this to create image thumbnail styles.
+//
+// $border-width - Width of border around thumbnail. Default: $thumb-border-width.
+// $box-shadow - Box shadow to apply to thumbnail. Default: $thumb-box-shadow.
+// $box-shadow-hover - Box shadow to apply on hover. Default: $thumb-box-shadow-hover.
+@mixin thumb(
+ $border-width:$thumb-border-width,
+ $box-shadow:$thumb-box-shadow,
+ $box-shadow-hover:$thumb-box-shadow-hover) {
+ line-height: 0;
+ display: inline-block;
+ border: $thumb-border-style $border-width $thumb-border-color;
+ max-width: 100%;
+ @if $experimental {
+ -webkit-box-shadow: $box-shadow;
+ }
+ box-shadow: $box-shadow;
+
+ &:hover,
+ &:focus {
+ @if $experimental {
+ -webkit-box-shadow: $box-shadow-hover;
+ }
+ box-shadow: $box-shadow-hover;
+ }
+}
+
+
+@include exports("thumb") {
+ @if $include-html-media-classes {
+
+ /* Image Thumbnails */
+ .th {
+ @include thumb;
+ @include single-transition(all,$thumb-transition-speed,ease-out);
+
+ &.radius { @include radius($thumb-radius); }
+ }
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+
+//
+// Tooltip Variables
+//
+$include-html-tooltip-classes: $include-html-classes !default;
+
+$has-tip-border-bottom: dotted 1px #ccc !default;
+$has-tip-font-weight: bold !default;
+$has-tip-font-color: #333 !default;
+$has-tip-border-bottom-hover: dotted 1px scale-color($primary-color, $lightness: -55%) !default;
+$has-tip-font-color-hover: $primary-color !default;
+$has-tip-cursor-type: help !default;
+
+$tooltip-padding: rem-calc(12) !default;
+$tooltip-bg: #333 !default;
+$tooltip-font-size: rem-calc(14) !default;
+$tooltip-font-weight: normal !default;
+$tooltip-font-color: #fff !default;
+$tooltip-line-height: 1.3 !default;
+$tooltip-close-font-size: rem-calc(10) !default;
+$tooltip-close-font-weight: normal !default;
+$tooltip-close-font-color: #777 !default;
+$tooltip-font-size-sml: rem-calc(14) !default;
+$tooltip-radius: $global-radius !default;
+$tooltip-rounded: $global-rounded !default;
+$tooltip-pip-size: 5px !default;
+
+@include exports("tooltip") {
+ @if $include-html-tooltip-classes {
+
+ /* Tooltips */
+ .has-tip {
+ border-bottom: $has-tip-border-bottom;
+ cursor: $has-tip-cursor-type;
+ font-weight: $has-tip-font-weight;
+ color: $has-tip-font-color;
+
+ &:hover,
+ &:focus {
+ border-bottom: $has-tip-border-bottom-hover;
+ color: $has-tip-font-color-hover;
+ }
+
+ &.tip-left,
+ &.tip-right { float: none !important; }
+ }
+
+ .tooltip {
+ display: none;
+ position: absolute;
+ z-index: 999;
+ font-weight: $tooltip-font-weight;
+ font-size: $tooltip-font-size;
+ line-height: $tooltip-line-height;
+ padding: $tooltip-padding;
+ max-width: 85%;
+ #{$default-float}: 50%;
+ width: 100%;
+ color: $tooltip-font-color;
+ background: $tooltip-bg;
+
+ &>.nub {
+ display: block;
+ #{$default-float}: $tooltip-pip-size;
+ position: absolute;
+ width: 0;
+ height: 0;
+ border: solid $tooltip-pip-size;
+ border-color: transparent transparent $tooltip-bg transparent;
+ top: -($tooltip-pip-size * 2);
+ }
+
+ &.radius {
+ @include radius($tooltip-radius);
+ }
+ &.round {
+ @include radius($tooltip-rounded);
+ &>.nub {
+ left: 2rem;
+ }
+ }
+
+ &.opened {
+ color: $has-tip-font-color-hover !important;
+ border-bottom: $has-tip-border-bottom-hover !important;
+ }
+ }
+
+ .tap-to-close {
+ display: block;
+ font-size: $tooltip-close-font-size;
+ color: $tooltip-close-font-color;
+ font-weight: $tooltip-close-font-weight;
+ }
+
+ @media #{$small} {
+ .tooltip {
+ &>.nub {
+ border-color: transparent transparent $tooltip-bg transparent;
+ top: -($tooltip-pip-size * 2);
+ }
+ &.tip-top>.nub {
+ border-color: $tooltip-bg transparent transparent transparent;
+ top: auto;
+ bottom: -($tooltip-pip-size * 2);
+ }
+
+ &.tip-left,
+ &.tip-right { float: none !important; }
+
+ &.tip-left>.nub {
+ border-color: transparent transparent transparent $tooltip-bg;
+ right: -($tooltip-pip-size * 2);
+ left: auto;
+ top: 50%;
+ margin-top: -$tooltip-pip-size;
+ }
+ &.tip-right>.nub {
+ border-color: transparent $tooltip-bg transparent transparent;
+ right: auto;
+ left: -($tooltip-pip-size * 2);
+ top: 50%;
+ margin-top: -$tooltip-pip-size;
+ }
+
+ }
+ }
+
+ }
+}
\ No newline at end of file
--- /dev/null
+@import "global";
+@import "grid";
+
+//
+// Top Bar Variables
+//
+$include-html-top-bar-classes: $include-html-classes !default;
+
+// Background color for the top bar
+$topbar-bg-color: #333 !default;
+$topbar-bg: $topbar-bg-color !default;
+
+// Height and margin
+$topbar-height: 45px !default;
+$topbar-margin-bottom: 0 !default;
+
+// Controlling the styles for the title in the top bar
+$topbar-title-weight: normal !default;
+$topbar-title-font-size: rem-calc(17) !default;
+
+// Style the top bar dropdown elements
+$topbar-dropdown-bg: #333 !default;
+$topbar-dropdown-link-color: #fff !default;
+$topbar-dropdown-link-bg: #333 !default;
+$topbar-dropdown-link-weight: normal !default;
+$topbar-dropdown-toggle-size: 5px !default;
+$topbar-dropdown-toggle-color: #fff !default;
+$topbar-dropdown-toggle-alpha: 0.4 !default;
+
+// Set the link colors and styles for top-level nav
+$topbar-link-color: #fff !default;
+$topbar-link-color-hover: #fff !default;
+$topbar-link-color-active: #fff !default;
+$topbar-link-color-active-hover: #fff !default;
+$topbar-link-weight: normal !default;
+$topbar-link-font-size: rem-calc(13) !default;
+$topbar-link-hover-lightness: -10% !default; // Darken by 10%
+$topbar-link-bg-hover: #272727 !default;
+$topbar-link-bg-active: $primary-color !default;
+$topbar-link-bg-active-hover: scale-color($primary-color, $lightness: -14%) !default;
+$topbar-link-font-family: $body-font-family !default;
+$topbar-link-padding: $topbar-height / 3 !default;
+
+$topbar-button-font-size: 0.75rem;
+$topbar-button-top: 7px !default;
+
+$topbar-dropdown-label-color: #777 !default;
+$topbar-dropdown-label-text-transform: uppercase !default;
+$topbar-dropdown-label-font-weight: bold !default;
+$topbar-dropdown-label-font-size: rem-calc(10) !default;
+$topbar-dropdown-label-bg: #333 !default;
+
+// Top menu icon styles
+$topbar-menu-link-transform: uppercase !default;
+$topbar-menu-link-font-size: rem-calc(13) !default;
+$topbar-menu-link-weight: bold !default;
+$topbar-menu-link-color: #fff !default;
+$topbar-menu-icon-color: #fff !default;
+$topbar-menu-link-color-toggled: #888 !default;
+$topbar-menu-icon-color-toggled: #888 !default;
+
+// Transitions and breakpoint styles
+$topbar-transition-speed: 300ms !default;
+// Using rem-calc for the below breakpoint causes issues with top bar
+$topbar-breakpoint: #{lower-bound($medium-range)} !default; // Change to 9999px for always mobile layout
+$topbar-media-query: $medium-up !default;
+
+// Divider Styles
+$topbar-divider-border-bottom: solid 1px scale-color($topbar-bg-color, $lightness: 13%) !default;
+$topbar-divider-border-top: solid 1px scale-color($topbar-bg-color, $lightness: -50%) !default;
+
+// Sticky Class
+$topbar-sticky-class: ".sticky" !default;
+$topbar-arrows: true !default; //Set false to remove the triangle icon from the menu item
+
+@include exports("top-bar") {
+ // Used to provide media query values for javascript components.
+ // This class is generated despite the value of $include-html-top-bar-classes
+ // to ensure width calculations work correctly.
+ meta.foundation-mq-topbar {
+ font-family: "/" + unquote($topbar-media-query) + "/";
+ width: $topbar-breakpoint;
+ }
+
+ @if $include-html-top-bar-classes {
+
+ /* Wrapped around .top-bar to contain to grid width */
+ .contain-to-grid {
+ width: 100%;
+ background: $topbar-bg;
+
+ .top-bar { margin-bottom: $topbar-margin-bottom; }
+ }
+
+ // Wrapped around .top-bar to make it stick to the top
+ .fixed {
+ width: 100%;
+ #{$default-float}: 0;
+ position: fixed;
+ top: 0;
+ z-index: 99;
+
+ &.expanded:not(.top-bar) {
+ overflow-y: auto;
+ height: auto;
+ width: 100%;
+ max-height: 100%;
+
+ .title-area {
+ position: fixed;
+ width: 100%;
+ z-index: 99;
+ }
+ // Ensure you can scroll the menu on small screens
+ .top-bar-section {
+ z-index: 98;
+ margin-top: $topbar-height;
+ }
+ }
+ }
+
+ .top-bar {
+ overflow: hidden;
+ height: $topbar-height;
+ line-height: $topbar-height;
+ position: relative;
+ background: $topbar-bg;
+ margin-bottom: $topbar-margin-bottom;
+
+ // Topbar Global list Styles
+ ul {
+ margin-bottom: 0;
+ list-style: none;
+ }
+
+ .row { max-width: none; }
+
+ form,
+ input { margin-bottom: 0; }
+
+ input { height: auto; padding-top: .35rem; padding-bottom: .35rem; font-size: $topbar-button-font-size; }
+
+ .button {
+ padding-top: .45rem;
+ padding-bottom: .35rem;
+ margin-bottom: 0;
+ font-size: $topbar-button-font-size;
+ // position: relative;
+ // top: -1px;
+
+ }
+
+ // Title Area
+ .title-area {
+ position: relative;
+ margin: 0;
+ }
+
+ .name {
+ height: $topbar-height;
+ margin: 0;
+ font-size: $rem-base;
+
+ h1 {
+ line-height: $topbar-height;
+ font-size: $topbar-title-font-size;
+ margin: 0;
+ a {
+ font-weight: $topbar-title-weight;
+ color: $topbar-link-color;
+ width: 50%;
+ display: block;
+ padding: 0 $topbar-link-padding;
+ }
+ }
+ }
+
+ // Menu toggle button on small devices
+ .toggle-topbar {
+ position: absolute;
+ #{$opposite-direction}: 0;
+ top: 0;
+
+ a {
+ color: $topbar-link-color;
+ text-transform: $topbar-menu-link-transform;
+ font-size: $topbar-menu-link-font-size;
+ font-weight: $topbar-menu-link-weight;
+ position: relative;
+ display: block;
+ padding: 0 $topbar-link-padding;
+ height: $topbar-height;
+ line-height: $topbar-height;
+ }
+
+ // Adding the class "menu-icon" will add the 3-line icon people love and adore.
+ &.menu-icon {
+ #{$opposite-direction}: $topbar-link-padding;
+ top: 50%;
+ margin-top: -16px;
+ padding-#{$default-float}: 40px;
+
+ a {
+ @if $text-direction == rtl {
+ text-indent: -58px;
+ }
+ height: 34px;
+ line-height: 33px;
+ padding: 0;
+ padding-right: 25px;
+ color: $topbar-menu-link-color;
+ position: relative;
+
+ &::after {
+ content:"";
+ position: absolute;
+ #{$opposite-direction}: 0;
+ display: block;
+ width: 16px;
+ top:0;
+ height: 0;
+ // Shh, don't tell, but box-shadows create the menu icon :)
+ @if $experimental {
+ -webkit-box-shadow: 0 10px 0 1px $topbar-menu-icon-color,
+ 0 16px 0 1px $topbar-menu-icon-color,
+ 0 22px 0 1px $topbar-menu-icon-color;
+ }
+ box-shadow: 0 10px 0 1px $topbar-menu-icon-color,
+ 0 16px 0 1px $topbar-menu-icon-color,
+ 0 22px 0 1px $topbar-menu-icon-color;
+ }
+ }
+ }
+ }
+
+ // Change things up when the top-bar is expanded
+ &.expanded {
+ height: auto;
+ background: transparent;
+
+ .title-area { background: $topbar-bg; }
+
+ .toggle-topbar {
+ a { color: $topbar-menu-link-color-toggled;
+ span {
+ // Shh, don't tell, but box-shadows create the menu icon :)
+ @if $experimental {
+ -webkit-box-shadow: 0 10px 0 1px $topbar-menu-icon-color-toggled,
+ 0 16px 0 1px $topbar-menu-icon-color-toggled,
+ 0 22px 0 1px $topbar-menu-icon-color-toggled;
+ }
+ box-shadow: 0 10px 0 1px $topbar-menu-icon-color-toggled,
+ 0 16px 0 1px $topbar-menu-icon-color-toggled,
+ 0 22px 0 1px $topbar-menu-icon-color-toggled;
+ }
+ }
+ }
+ }
+
+
+
+ }
+
+ // Right and Left Navigation that stacked by default
+ .top-bar-section {
+ #{$default-float}: 0;
+ position: relative;
+ width: auto;
+ @include single-transition($default-float, $topbar-transition-speed);
+
+ ul {
+ width: 100%;
+ height: auto;
+ display: block;
+ background: $topbar-dropdown-bg;
+ font-size: $rem-base;
+ margin: 0;
+ }
+
+ .divider,
+ [role="separator"] {
+ border-top: $topbar-divider-border-top;
+ clear: both;
+ height: 1px;
+ width: 100%;
+ }
+
+ ul li {
+ & > a {
+ display: block;
+ width: 100%;
+ color: $topbar-link-color;
+ padding: 12px 0 12px 0;
+ padding-#{$default-float}: $topbar-link-padding;
+ font-family: $topbar-link-font-family;
+ font-size: $topbar-link-font-size;
+ font-weight: $topbar-link-weight;
+ background: $topbar-dropdown-bg;
+
+ &.button {
+ background: $primary-color;
+ font-size: $topbar-link-font-size;
+ padding-#{$opposite-direction}: $topbar-link-padding;
+ padding-#{$default-float}: $topbar-link-padding;
+ &:hover {
+ background: scale-color($primary-color, $lightness: -27%);
+ }
+ }
+ &.button.secondary {
+ background: $secondary-color;
+ &:hover {
+ background: scale-color($secondary-color, $lightness: -11%);
+ }
+ }
+ &.button.success {
+ background: $success-color;
+ &:hover {
+ background: scale-color($success-color, $lightness: -21%);
+ }
+ }
+ &.button.alert {
+ background: $alert-color;
+ &:hover {
+ background: scale-color($alert-color, $lightness: -18%);
+ }
+ }
+
+ }
+
+ // Apply the hover link color when it has that class
+ &:hover > a {
+ background: $topbar-link-bg-hover;
+ color: $topbar-link-color-hover;
+
+ }
+
+ // Apply the active link color when it has that class
+ &.active > a {
+ background: $topbar-link-bg-active;
+ color: $topbar-link-color-active;
+ &:hover {
+ background: $topbar-link-bg-active-hover;
+ color: $topbar-link-color-active-hover;
+ }
+ }
+ }
+
+ // Add some extra padding for list items contains buttons
+ .has-form { padding: $topbar-link-padding; }
+
+ // Styling for list items that have a dropdown within them.
+ .has-dropdown {
+ position: relative;
+
+ & > a {
+ &:after {
+ @if ($topbar-arrows){
+ @include css-triangle($topbar-dropdown-toggle-size, rgba($topbar-dropdown-toggle-color, $topbar-dropdown-toggle-alpha), $default-float);
+ }
+ margin-#{$opposite-direction}: $topbar-link-padding;
+ margin-top: -($topbar-dropdown-toggle-size / 2) - 2;
+ position: absolute;
+ top: 50%;
+ #{$opposite-direction}: 0;
+ }
+ }
+
+ &.moved { position: static;
+ & > .dropdown {
+ display: block;
+ }
+ }
+ }
+
+ // Styling elements inside of dropdowns
+ .dropdown {
+ position: absolute;
+ #{$default-float}: 100%;
+ top: 0;
+ display: none;
+ z-index: 99;
+
+ li {
+ width: 100%;
+ height: auto;
+
+ a {
+ font-weight: $topbar-dropdown-link-weight;
+ padding: 8px $topbar-link-padding;
+ &.parent-link {
+ font-weight: $topbar-link-weight;
+ }
+ }
+
+ &.title h5 { margin-bottom: 0;
+ a {
+ color: $topbar-link-color;
+ line-height: $topbar-height / 2;
+ display: block;
+ }
+ }
+ &.has-form { padding: 8px $topbar-link-padding; }
+ .button { top: auto; }
+ }
+
+ label {
+ padding: 8px $topbar-link-padding 2px;
+ margin-bottom: 0;
+ text-transform: $topbar-dropdown-label-text-transform;
+ color: $topbar-dropdown-label-color;
+ font-weight: $topbar-dropdown-label-font-weight;
+ font-size: $topbar-dropdown-label-font-size;
+ }
+ }
+ }
+
+ .js-generated { display: block; }
+
+
+ // Top Bar styles intended for screen sizes above the breakpoint.
+ @media #{$topbar-media-query} {
+ .top-bar {
+ background: $topbar-bg;
+ @include clearfix;
+ overflow: visible;
+
+ .toggle-topbar { display: none; }
+
+ .title-area { float: $default-float; }
+ .name h1 a { width: auto; }
+
+ input,
+ .button {
+ font-size: rem-calc(14);
+ position: relative;
+ top: $topbar-button-top;
+ }
+
+ &.expanded { background: $topbar-bg; }
+ }
+
+ .contain-to-grid .top-bar {
+ max-width: $row-width;
+ margin: 0 auto;
+ margin-bottom: $topbar-margin-bottom;
+ }
+
+ .top-bar-section {
+ @include single-transition(none,0,0);
+ #{$default-float}: 0 !important;
+
+ ul {
+ width: auto;
+ height: auto !important;
+ display: inline;
+
+ li {
+ float: $default-float;
+ .js-generated { display: none; }
+ }
+ }
+
+ li {
+ &.hover {
+ > a:not(.button) {
+ background: $topbar-link-bg-hover;
+ color: $topbar-link-color-hover;
+ }
+ }
+ &:not(.has-form) {
+ a:not(.button) {
+ padding: 0 $topbar-link-padding;
+ line-height: $topbar-height;
+ background: $topbar-bg;
+ &:hover { background: $topbar-link-bg-hover; }
+ }
+ }
+ &.active:not(.has-form) {
+ a:not(.button) {
+ padding: 0 $topbar-height / 3;
+ line-height: $topbar-height;
+ color: $topbar-link-color-active;
+ background: $topbar-link-bg-active;
+ &:hover { background: $topbar-link-bg-active-hover; }
+ }
+ }
+ }
+
+ .has-dropdown {
+
+ @if($topbar-arrows){
+
+ & > a {
+ padding-#{$opposite-direction}: $topbar-link-padding + 20 !important;
+ &:after {
+ @include css-triangle($topbar-dropdown-toggle-size, rgba($topbar-dropdown-toggle-color, $topbar-dropdown-toggle-alpha), top);
+ margin-top: -($topbar-dropdown-toggle-size / 2);
+ top: $topbar-height / 2;
+ }
+ }
+
+ }
+
+ &.moved { position: relative;
+ & > .dropdown { display: none; }
+ }
+
+ &.hover, &.not-click:hover {
+ & > .dropdown {
+ display: block;
+ }
+ }
+
+ .dropdown li.has-dropdown {
+ & > a {
+ &:after {
+ border: none;
+ content: "\00bb";
+ top: 1rem;
+ margin-top: -2px;
+ #{$opposite-direction}: 5px;
+ line-height: 1.2;
+ }
+ }
+ }
+
+ }
+
+ .dropdown {
+ #{$default-float}: 0;
+ top: auto;
+ background: transparent;
+ min-width: 100%;
+
+ li {
+ a {
+ color: $topbar-dropdown-link-color;
+ line-height: 1;
+ white-space: nowrap;
+ padding: 12px $topbar-link-padding;
+ background: $topbar-dropdown-link-bg;
+ }
+
+ label {
+ white-space: nowrap;
+ background: $topbar-dropdown-label-bg;
+ }
+
+ // Second Level Dropdowns
+ .dropdown {
+ #{$default-float}: 100%;
+ top: 0;
+ }
+ }
+ }
+
+ & > ul > .divider,
+ & > ul > [role="separator"] {
+ border-bottom: none;
+ border-top: none;
+ border-#{$opposite-direction}: $topbar-divider-border-bottom;
+ clear: none;
+ height: $topbar-height;
+ width: 0;
+ }
+
+ .has-form {
+ background: $topbar-bg;
+ padding: 0 $topbar-link-padding;
+ height: $topbar-height;
+ }
+
+ // Position overrides for ul.right and ul.left
+ .right {
+ li .dropdown {
+ #{$default-float}: auto;
+ #{$opposite-direction}: 0;
+
+ li .dropdown { #{$opposite-direction}: 100%; }
+ }
+ }
+ .left {
+ li .dropdown {
+ #{$opposite-direction}: auto;
+ #{$default-float}: 0;
+
+ li .dropdown { #{$default-float}: 100%; }
+ }
+ }
+ }
+
+ // Degrade gracefully when Javascript is disabled. Displays dropdown and changes
+ // background & text color on hover.
+ .no-js .top-bar-section {
+ ul li {
+ // Apply the hover link color when it has that class
+ &:hover > a {
+ background: $topbar-link-bg-hover;
+ color: $topbar-link-color-hover;
+ }
+
+ // Apply the active link color when it has that class
+ &:active > a {
+ background: $topbar-link-bg-active;
+ color: $topbar-link-color-active;
+ }
+ }
+
+ .has-dropdown {
+ &:hover {
+ & > .dropdown {
+ display: block;
+ }
+ }
+ }
+ }
+ }
+ }
+}
--- /dev/null
+@import "global";
+
+$include-html-type-classes: $include-html-classes !default;
+
+// We use these to control header font styles
+$header-font-family: $body-font-family !default;
+$header-font-weight: normal !default;
+$header-font-style: normal !default;
+$header-font-color: #222 !default;
+$header-line-height: 1.4 !default;
+$header-top-margin: .2rem !default;
+$header-bottom-margin: .5rem !default;
+$header-text-rendering: optimizeLegibility !default;
+
+// We use these to control header font sizes
+$h1-font-size: rem-calc(44) !default;
+$h2-font-size: rem-calc(37) !default;
+$h3-font-size: rem-calc(27) !default;
+$h4-font-size: rem-calc(23) !default;
+$h5-font-size: rem-calc(18) !default;
+$h6-font-size: 1rem !default;
+
+// These control how subheaders are styled.
+$subheader-line-height: 1.4 !default;
+$subheader-font-color: scale-color($header-font-color, $lightness: 35%) !default;
+$subheader-font-weight: normal !default;
+$subheader-top-margin: .2rem !default;
+$subheader-bottom-margin: .5rem !default;
+
+// A general <small> styling
+$small-font-size: 60% !default;
+$small-font-color: scale-color($header-font-color, $lightness: 35%) !default;
+
+// We use these to style paragraphs
+$paragraph-font-family: inherit !default;
+$paragraph-font-weight: normal !default;
+$paragraph-font-size: 1rem !default;
+$paragraph-line-height: 1.6 !default;
+$paragraph-margin-bottom: rem-calc(20) !default;
+$paragraph-aside-font-size: rem-calc(14) !default;
+$paragraph-aside-line-height: 1.35 !default;
+$paragraph-aside-font-style: italic !default;
+$paragraph-text-rendering: optimizeLegibility !default;
+
+// We use these to style <code> tags
+$code-color: scale-color($alert-color, $lightness: -27%) !default;
+$code-font-family: Consolas, 'Liberation Mono', Courier, monospace !default;
+$code-font-weight: bold !default;
+
+// We use these to style anchors
+$anchor-text-decoration: none !default;
+$anchor-font-color: $primary-color !default;
+$anchor-font-color-hover: scale-color($primary-color, $lightness: -14%) !default;
+
+// We use these to style the <hr> element
+$hr-border-width: 1px !default;
+$hr-border-style: solid !default;
+$hr-border-color: #ddd !default;
+$hr-margin: rem-calc(20) !default;
+
+// We use these to style lists
+$list-style-position: outside !default;
+$list-side-margin: 1.1rem !default;
+$list-ordered-side-margin: 1.4rem !default;
+$list-side-margin-no-bullet: 0 !default;
+$list-nested-margin: rem-calc(20) !default;
+$definition-list-header-weight: bold !default;
+$definition-list-header-margin-bottom: .3rem !default;
+$definition-list-margin-bottom: rem-calc(12) !default;
+
+// We use these to style blockquotes
+$blockquote-font-color: scale-color($header-font-color, $lightness: 35%) !default;
+$blockquote-padding: rem-calc(9 20 0 19) !default;
+$blockquote-border: 1px solid #ddd !default;
+$blockquote-cite-font-size: rem-calc(13) !default;
+$blockquote-cite-font-color: scale-color($header-font-color, $lightness: 23%) !default;
+$blockquote-cite-link-color: $blockquote-cite-font-color !default;
+
+// Acronym styles
+$acronym-underline: 1px dotted #ddd !default;
+
+// We use these to control padding and margin
+$microformat-padding: rem-calc(10 12) !default;
+$microformat-margin: rem-calc(0 0 20 0) !default;
+
+// We use these to control the border styles
+$microformat-border-width: 1px !default;
+$microformat-border-style: solid !default;
+$microformat-border-color: #ddd !default;
+
+// We use these to control full name font styles
+$microformat-fullname-font-weight: bold !default;
+$microformat-fullname-font-size: rem-calc(15) !default;
+
+// We use this to control the summary font styles
+$microformat-summary-font-weight: bold !default;
+
+// We use this to control abbr padding
+$microformat-abbr-padding: rem-calc(0 1) !default;
+
+// We use this to control abbr font styles
+$microformat-abbr-font-weight: bold !default;
+$microformat-abbr-font-decoration: none !default;
+
+//
+// Responsive Text alignment
+//
+
+// Global Text Styles
+.text-left { text-align: left !important; }
+.text-right { text-align: right !important; }
+.text-center { text-align: center !important; }
+.text-justify { text-align: justify !important; }
+
+@media #{$small-only} {
+ .small-only-text-left { text-align: left !important; }
+ .small-only-text-right { text-align: right !important; }
+ .small-only-text-center { text-align: center !important; }
+ .small-only-text-justify { text-align: justify !important; }
+}
+
+@media #{$small-up} {
+ .small-text-left { text-align: left !important; }
+ .small-text-right { text-align: right !important; }
+ .small-text-center { text-align: center !important; }
+ .small-text-justify { text-align: justify !important; }
+}
+
+@media #{$medium-only} {
+ .medium-only-text-left { text-align: left !important; }
+ .medium-only-text-right { text-align: right !important; }
+ .medium-only-text-center { text-align: center !important; }
+ .medium-only-text-justify { text-align: justify !important; }
+}
+
+@media #{$medium-up} {
+ .medium-text-left { text-align: left !important; }
+ .medium-text-right { text-align: right !important; }
+ .medium-text-center { text-align: center !important; }
+ .medium-text-justify { text-align: justify !important; }
+}
+
+@media #{$large-only} {
+ .large-only-text-left { text-align: left !important; }
+ .large-only-text-right { text-align: right !important; }
+ .large-only-text-center { text-align: center !important; }
+ .large-only-text-justify { text-align: justify !important; }
+}
+
+@media #{$large-up} {
+ .large-text-left { text-align: left !important; }
+ .large-text-right { text-align: right !important; }
+ .large-text-center { text-align: center !important; }
+ .large-text-justify { text-align: justify !important; }
+}
+
+@media #{$xlarge-only} {
+ .xlarge-only-text-left { text-align: left !important; }
+ .xlarge-only-text-right { text-align: right !important; }
+ .xlarge-only-text-center { text-align: center !important; }
+ .xlarge-only-text-justify { text-align: justify !important; }
+}
+
+@media #{$xlarge-up} {
+ .xlarge-text-left { text-align: left !important; }
+ .xlarge-text-right { text-align: right !important; }
+ .xlarge-text-center { text-align: center !important; }
+ .xlarge-text-justify { text-align: justify !important; }
+}
+
+@media #{$xxlarge-only} {
+ .xxlarge-only-text-left { text-align: left !important; }
+ .xxlarge-only-text-right { text-align: right !important; }
+ .xxlarge-only-text-center { text-align: center !important; }
+ .xxlarge-only-text-justify { text-align: justify !important; }
+}
+
+@media #{$xxlarge-up} {
+ .xxlarge-text-left { text-align: left !important; }
+ .xxlarge-text-right { text-align: right !important; }
+ .xxlarge-text-center { text-align: center !important; }
+ .xxlarge-text-justify { text-align: justify !important; }
+}
+
+//
+// Typography Placeholders
+//
+
+// These will throw a deprecation warning if used within a media query.
+@mixin lead {
+ font-size: $paragraph-font-size + rem-calc(3.5);
+ line-height: 1.6;
+}
+
+@mixin subheader {
+ line-height: $subheader-line-height;
+ color: $subheader-font-color;
+ font-weight: $subheader-font-weight;
+ margin-top: $subheader-top-margin;
+ margin-bottom: $subheader-bottom-margin;
+}
+@include exports("type") {
+ @if $include-html-type-classes {
+
+ /* Typography resets */
+ div,
+ dl,
+ dt,
+ dd,
+ ul,
+ ol,
+ li,
+ h1,
+ h2,
+ h3,
+ h4,
+ h5,
+ h6,
+ pre,
+ form,
+ p,
+ blockquote,
+ th,
+ td {
+ margin:0;
+ padding:0;
+ }
+
+ /* Default Link Styles */
+ a {
+ color: $anchor-font-color;
+ text-decoration: $anchor-text-decoration;
+ line-height: inherit;
+
+ &:hover,
+ &:focus { color: $anchor-font-color-hover; }
+
+ img { border:none; }
+ }
+
+ /* Default paragraph styles */
+ p {
+ font-family: $paragraph-font-family;
+ font-weight: $paragraph-font-weight;
+ font-size: $paragraph-font-size;
+ line-height: $paragraph-line-height;
+ margin-bottom: $paragraph-margin-bottom;
+ text-rendering: $paragraph-text-rendering;
+
+ &.lead { @include lead; }
+
+ & aside {
+ font-size: $paragraph-aside-font-size;
+ line-height: $paragraph-aside-line-height;
+ font-style: $paragraph-aside-font-style;
+ }
+ }
+
+ /* Default header styles */
+ h1, h2, h3, h4, h5, h6 {
+ font-family: $header-font-family;
+ font-weight: $header-font-weight;
+ font-style: $header-font-style;
+ color: $header-font-color;
+ text-rendering: $header-text-rendering;
+ margin-top: $header-top-margin;
+ margin-bottom: $header-bottom-margin;
+ line-height: $header-line-height;
+
+ small {
+ font-size: $small-font-size;
+ color: $small-font-color;
+ line-height: 0;
+ }
+ }
+
+ h1 { font-size: $h1-font-size - rem-calc(10); }
+ h2 { font-size: $h2-font-size - rem-calc(10); }
+ h3 { font-size: $h3-font-size - rem-calc(5); }
+ h4 { font-size: $h4-font-size - rem-calc(5); }
+ h5 { font-size: $h5-font-size; }
+ h6 { font-size: $h6-font-size; }
+
+ .subheader { @include subheader; }
+
+ hr {
+ border: $hr-border-style $hr-border-color;
+ border-width: $hr-border-width 0 0;
+ clear: both;
+ margin: $hr-margin 0 ($hr-margin - rem-calc(1));
+ height: 0;
+ }
+
+ /* Helpful Typography Defaults */
+ em,
+ i {
+ font-style: italic;
+ line-height: inherit;
+ }
+
+ strong,
+ b {
+ font-weight: bold;
+ line-height: inherit;
+ }
+
+ small {
+ font-size: $small-font-size;
+ line-height: inherit;
+ }
+
+ code {
+ font-family: $code-font-family;
+ font-weight: $code-font-weight;
+ color: $code-color;
+ }
+
+ /* Lists */
+ ul,
+ ol,
+ dl {
+ font-size: $paragraph-font-size;
+ line-height: $paragraph-line-height;
+ margin-bottom: $paragraph-margin-bottom;
+ list-style-position: $list-style-position;
+ font-family: $paragraph-font-family;
+ }
+
+ ul {
+ margin-#{$default-float}: $list-side-margin;
+ &.no-bullet {
+ margin-#{$default-float}: $list-side-margin-no-bullet;
+ li {
+ ul,
+ ol {
+ margin-#{$default-float}: $list-nested-margin;
+ margin-bottom: 0;
+ list-style: none;
+ }
+ }
+ }
+ }
+
+ /* Unordered Lists */
+ ul {
+ li {
+ ul,
+ ol {
+ margin-#{$default-float}: $list-nested-margin;
+ margin-bottom: 0;
+ }
+ }
+ &.square,
+ &.circle,
+ &.disc {
+ li ul { list-style: inherit; }
+ }
+
+ &.square { list-style-type: square; margin-#{$default-float}: $list-side-margin;}
+ &.circle { list-style-type: circle; margin-#{$default-float}: $list-side-margin;}
+ &.disc { list-style-type: disc; margin-#{$default-float}: $list-side-margin;}
+ &.no-bullet { list-style: none; }
+ }
+
+ /* Ordered Lists */
+ ol {
+ margin-#{$default-float}: $list-ordered-side-margin;
+ li {
+ ul,
+ ol {
+ margin-#{$default-float}: $list-nested-margin;
+ margin-bottom: 0;
+ }
+ }
+ }
+
+ /* Definition Lists */
+ dl {
+ dt {
+ margin-bottom: $definition-list-header-margin-bottom;
+ font-weight: $definition-list-header-weight;
+ }
+ dd { margin-bottom: $definition-list-margin-bottom; }
+ }
+
+ /* Abbreviations */
+ abbr,
+ acronym {
+ text-transform: uppercase;
+ font-size: 90%;
+ color: $body-font-color;
+ border-bottom: $acronym-underline;
+ cursor: $cursor-help-value;
+ }
+ abbr {
+ text-transform: none;
+ }
+
+ /* Blockquotes */
+ blockquote {
+ margin: 0 0 $paragraph-margin-bottom;
+ padding: $blockquote-padding;
+ border-#{$default-float}: $blockquote-border;
+
+ cite {
+ display: block;
+ font-size: $blockquote-cite-font-size;
+ color: $blockquote-cite-font-color;
+ &:before {
+ content: "\2014 \0020";
+ }
+
+ a,
+ a:visited {
+ color: $blockquote-cite-link-color;
+ }
+ }
+ }
+ blockquote,
+ blockquote p {
+ line-height: $paragraph-line-height;
+ color: $blockquote-font-color;
+ }
+
+ /* Microformats */
+ .vcard {
+ display: inline-block;
+ margin: $microformat-margin;
+ border: $microformat-border-width $microformat-border-style $microformat-border-color;
+ padding: $microformat-padding;
+
+ li {
+ margin: 0;
+ display: block;
+ }
+ .fn {
+ font-weight: $microformat-fullname-font-weight;
+ font-size: $microformat-fullname-font-size;
+ }
+ }
+
+ .vevent {
+ .summary { font-weight: $microformat-summary-font-weight; }
+
+ abbr {
+ cursor: $cursor-default-value;
+ text-decoration: $microformat-abbr-font-decoration;
+ font-weight: $microformat-abbr-font-weight;
+ border: none;
+ padding: $microformat-abbr-padding;
+ }
+ }
+
+
+ @media #{$medium-up} {
+ h1,h2,h3,h4,h5,h6 { line-height: $header-line-height; }
+ h1 { font-size: $h1-font-size; }
+ h2 { font-size: $h2-font-size; }
+ h3 { font-size: $h3-font-size; }
+ h4 { font-size: $h4-font-size; }
+ }
+
+ // Only include these styles if you want them.
+ @if $include-print-styles {
+ /*
+ * Print styles.
+ *
+ * Inlined to avoid required HTTP connection: www.phpied.com/delay-loading-your-print-css/
+ * Credit to Paul Irish and HTML5 Boilerplate (html5boilerplate.com)
+ */
+ .print-only { display: none !important; }
+ @media print {
+ * {
+ background: transparent !important;
+ color: #000 !important; /* Black prints faster: h5bp.com/s */
+ box-shadow: none !important;
+ text-shadow: none !important;
+ }
+
+ a,
+ a:visited { text-decoration: underline;}
+ a[href]:after { content: " (" attr(href) ")"; }
+
+ abbr[title]:after { content: " (" attr(title) ")"; }
+
+ // Don't show links for images, or javascript/internal links
+ .ir a:after,
+ a[href^="javascript:"]:after,
+ a[href^="#"]:after { content: ""; }
+
+ pre,
+ blockquote {
+ border: 1px solid #999;
+ page-break-inside: avoid;
+ }
+
+ thead { display: table-header-group; /* h5bp.com/t */ }
+
+ tr,
+ img { page-break-inside: avoid; }
+
+ img { max-width: 100% !important; }
+
+ @page { margin: 0.5cm; }
+
+ p,
+ h2,
+ h3 {
+ orphans: 3;
+ widows: 3;
+ }
+
+ h2,
+ h3 { page-break-after: avoid; }
+
+ .hide-on-print { display: none !important; }
+ .print-only { display: block !important; }
+ .hide-for-print { display: none !important; }
+ .show-for-print { display: inherit !important; }
+ }
+ }
+
+ }
+}
--- /dev/null
+@import "global";
+
+//
+// Foundation Visibility Classes
+//
+$include-html-visibility-classes: $include-html-classes !default;
+
+@if $include-html-visibility-classes != false {
+
+//
+// Media Class Names
+//
+
+ /* Foundation Visibility HTML Classes */
+ .show-for-small,
+ .show-for-small-only,
+ .show-for-medium-down,
+ .show-for-large-down,
+ .hide-for-medium,
+ .hide-for-medium-up,
+ .hide-for-medium-only,
+ .hide-for-large,
+ .hide-for-large-up,
+ .hide-for-large-only,
+ .hide-for-xlarge,
+ .hide-for-xlarge-up,
+ .hide-for-xlarge-only,
+ .hide-for-xxlarge-up,
+ .hide-for-xxlarge-only { display: inherit !important; }
+
+ .hide-for-small,
+ .hide-for-small-only,
+ .hide-for-medium-down,
+ .show-for-medium,
+ .show-for-medium-up,
+ .show-for-medium-only,
+ .hide-for-large-down,
+ .show-for-large,
+ .show-for-large-up,
+ .show-for-large-only,
+ .show-for-xlarge,
+ .show-for-xlarge-up,
+ .show-for-xlarge-only,
+ .show-for-xxlarge-up,
+ .show-for-xxlarge-only { display: none !important; }
+
+ /* Specific visibility for tables */
+ table {
+ &.show-for-small,
+ &.show-for-small-only,
+ &.show-for-medium-down,
+ &.show-for-large-down,
+ &.hide-for-medium,
+ &.hide-for-medium-up,
+ &.hide-for-medium-only,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table; }
+ }
+ thead {
+ &.show-for-small,
+ &.show-for-small-only,
+ &.show-for-medium-down,
+ &.show-for-large-down,
+ &.hide-for-medium,
+ &.hide-for-medium-up,
+ &.hide-for-medium-only,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-header-group !important; }
+ }
+ tbody {
+ &.show-for-small,
+ &.show-for-small-only,
+ &.show-for-medium-down,
+ &.show-for-large-down,
+ &.hide-for-medium,
+ &.hide-for-medium-up,
+ &.hide-for-medium-only,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-row-group !important; }
+ }
+ tr {
+ &.show-for-small,
+ &.show-for-small-only,
+ &.show-for-medium-down,
+ &.show-for-large-down,
+ &.hide-for-medium,
+ &.hide-for-medium-up,
+ &.hide-for-medium-only,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-row !important; }
+ }
+ td,
+ th {
+ &.show-for-small,
+ &.show-for-small-only,
+ &.show-for-medium-down,
+ &.show-for-large-down,
+ &.hide-for-medium,
+ &.hide-for-medium-up,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xxlarge-up { display: table-cell !important; }
+ }
+
+ /* Medium Displays: 641px and up */
+ @media #{$medium-up} {
+ .hide-for-small,
+ .hide-for-small-only,
+ .show-for-medium,
+ .show-for-medium-down,
+ .show-for-medium-up,
+ .show-for-medium-only,
+ .hide-for-large,
+ .hide-for-large-up,
+ .hide-for-large-only,
+ .hide-for-xlarge,
+ .hide-for-xlarge-up,
+ .hide-for-xlarge-only,
+ .hide-for-xxlarge-up,
+ .hide-for-xxlarge-only { display: inherit !important; }
+
+ .show-for-small,
+ .show-for-small-only,
+ .hide-for-medium,
+ .hide-for-medium-down,
+ .hide-for-medium-up,
+ .hide-for-medium-only,
+ .hide-for-large-down,
+ .show-for-large,
+ .show-for-large-up,
+ .show-for-large-only,
+ .show-for-xlarge,
+ .show-for-xlarge-up,
+ .show-for-xlarge-only,
+ .show-for-xxlarge-up,
+ .show-for-xxlarge-only { display: none !important; }
+
+ /* Specific visibility for tables */
+ table {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.show-for-medium,
+ &.show-for-medium-down,
+ &.show-for-medium-up,
+ &.show-for-medium-only,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table; }
+ }
+ thead {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.show-for-medium,
+ &.show-for-medium-down,
+ &.show-for-medium-up,
+ &.show-for-medium-only,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-header-group !important; }
+ }
+ tbody {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.show-for-medium,
+ &.show-for-medium-down,
+ &.show-for-medium-up,
+ &.show-for-medium-only,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-row-group !important; }
+ }
+ tr {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.show-for-medium,
+ &.show-for-medium-down,
+ &.show-for-medium-up,
+ &.show-for-medium-only,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-row !important; }
+ }
+ td,
+ th {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.show-for-medium,
+ &.show-for-medium-down,
+ &.show-for-medium-up,
+ &.show-for-medium-only,
+ &.hide-for-large,
+ &.hide-for-large-up,
+ &.hide-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-cell !important; }
+ }
+ }
+
+ /* Large Displays: 1024px and up */
+ @media #{$large-up} {
+ .hide-for-small,
+ .hide-for-small-only,
+ .hide-for-medium,
+ .hide-for-medium-down,
+ .hide-for-medium-only,
+ .show-for-medium-up,
+ .show-for-large,
+ .show-for-large-up,
+ .show-for-large-only,
+ .hide-for-xlarge,
+ .hide-for-xlarge-up,
+ .hide-for-xlarge-only,
+ .hide-for-xxlarge-up,
+ .hide-for-xxlarge-only { display: inherit !important; }
+
+ .show-for-small-only,
+ .show-for-medium,
+ .show-for-medium-down,
+ .show-for-medium-only,
+ .hide-for-large,
+ .hide-for-large-up,
+ .hide-for-large-only,
+ .show-for-xlarge,
+ .show-for-xlarge-up,
+ .show-for-xlarge-only,
+ .show-for-xxlarge-up,
+ .show-for-xxlarge-only { display: none !important; }
+
+ /* Specific visibility for tables */
+ table {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large,
+ &.show-for-large-up,
+ &.show-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table; }
+ }
+ thead {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large,
+ &.show-for-large-up,
+ &.show-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-header-group !important; }
+ }
+ tbody {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large,
+ &.show-for-large-up,
+ &.show-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-row-group !important; }
+ }
+ tr {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large,
+ &.show-for-large-up,
+ &.show-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-row !important; }
+ }
+ td,
+ th {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large,
+ &.show-for-large-up,
+ &.show-for-large-only,
+ &.hide-for-xlarge,
+ &.hide-for-xlarge-up,
+ &.hide-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-cell !important; }
+ }
+ }
+
+ /* X-Large Displays: 1441 and up */
+ @media #{$xlarge-up} {
+ .hide-for-small,
+ .hide-for-small-only,
+ .hide-for-medium,
+ .hide-for-medium-down,
+ .hide-for-medium-only,
+ .show-for-medium-up,
+ .show-for-large-up,
+ .hide-for-large-only,
+ .show-for-xlarge,
+ .show-for-xlarge-up,
+ .show-for-xlarge-only,
+ .hide-for-xxlarge-up,
+ .hide-for-xxlarge-only { display: inherit !important; }
+
+ .show-for-small-only,
+ .show-for-medium,
+ .show-for-medium-down,
+ .show-for-medium-only,
+ .show-for-large,
+ .show-for-large-only,
+ .show-for-large-down,
+ .hide-for-xlarge,
+ .hide-for-xlarge-up,
+ .hide-for-xlarge-only,
+ .show-for-xxlarge-up,
+ .show-for-xxlarge-only { display: none !important; }
+
+ /* Specific visibility for tables */
+ table {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-large-only,
+ &.show-for-xlarge,
+ &.show-for-xlarge-up,
+ &.show-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table; }
+ }
+ thead {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-large-only,
+ &.show-for-xlarge,
+ &.show-for-xlarge-up,
+ &.show-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-header-group !important; }
+ }
+ tbody {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-large-only,
+ &.show-for-xlarge,
+ &.show-for-xlarge-up,
+ &.show-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-row-group !important; }
+ }
+ tr {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-large-only,
+ &.show-for-xlarge,
+ &.show-for-xlarge-up,
+ &.show-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-row !important; }
+ }
+ td,
+ th {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-large-only,
+ &.show-for-xlarge,
+ &.show-for-xlarge-up,
+ &.show-for-xlarge-only,
+ &.hide-for-xxlarge-up,
+ &.hide-for-xxlarge-only { display: table-cell !important; }
+ }
+ }
+
+ /* XX-Large Displays: 1920 and up */
+ @media #{$xxlarge-up} {
+ .hide-for-small,
+ .hide-for-small-only,
+ .hide-for-medium,
+ .hide-for-medium-down,
+ .hide-for-medium-only,
+ .show-for-medium-up,
+ .show-for-large-up,
+ .hide-for-large-only,
+ .hide-for-xlarge-only,
+ .show-for-xlarge-up,
+ .show-for-xxlarge-up,
+ .show-for-xxlarge-only { display: inherit !important; }
+
+ .show-for-small-only,
+ .show-for-medium,
+ .show-for-medium-down,
+ .show-for-medium-only,
+ .show-for-large,
+ .show-for-large-only,
+ .show-for-large-down,
+ .hide-for-xlarge,
+ .show-for-xlarge-only,
+ .hide-for-xxlarge-up,
+ .hide-for-xxlarge-only { display: none !important; }
+
+ /* Specific visibility for tables */
+ table {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-xlarge-only,
+ &.show-for-xlarge-up,
+ &.show-for-xxlarge-up,
+ &.show-for-xxlarge-only { display: table; }
+ }
+ thead {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-xlarge-only,
+ &.show-for-xlarge-up,
+ &.show-for-xxlarge-up,
+ &.show-for-xxlarge-only { display: table-header-group !important; }
+ }
+ tbody {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-xlarge-only,
+ &.show-for-xlarge-up,
+ &.show-for-xxlarge-up,
+ &.show-for-xxlarge-only { display: table-row-group !important; }
+ }
+ tr {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-xlarge-only,
+ &.show-for-xlarge-up,
+ &.show-for-xxlarge-up,
+ &.show-for-xxlarge-only { display: table-row !important; }
+ }
+ td,
+ th {
+ &.hide-for-small,
+ &.hide-for-small-only,
+ &.hide-for-medium,
+ &.hide-for-medium-down,
+ &.hide-for-medium-only,
+ &.show-for-medium-up,
+ &.show-for-large-up,
+ &.hide-for-xlarge-only,
+ &.show-for-xlarge-up,
+ &.show-for-xxlarge-up,
+ &.show-for-xxlarge-only { display: table-cell !important; }
+ }
+ }
+
+
+ /* Orientation targeting */
+ .show-for-landscape,
+ .hide-for-portrait { display: inherit !important; }
+ .hide-for-landscape,
+ .show-for-portrait { display: none !important; }
+
+ /* Specific visibility for tables */
+ table {
+ &.hide-for-landscape,
+ &.show-for-portrait { display: table; }
+ }
+ thead {
+ &.hide-for-landscape,
+ &.show-for-portrait { display: table-header-group !important; }
+ }
+ tbody {
+ &.hide-for-landscape,
+ &.show-for-portrait { display: table-row-group !important; }
+ }
+ tr {
+ &.hide-for-landscape,
+ &.show-for-portrait { display: table-row !important; }
+ }
+ td,
+ th {
+ &.hide-for-landscape,
+ &.show-for-portrait { display: table-cell !important; }
+ }
+
+ @media #{$landscape} {
+ .show-for-landscape,
+ .hide-for-portrait { display: inherit !important; }
+ .hide-for-landscape,
+ .show-for-portrait { display: none !important; }
+
+ /* Specific visibility for tables */
+ table {
+ &.show-for-landscape,
+ &.hide-for-portrait { display: table; }
+ }
+ thead {
+ &.show-for-landscape,
+ &.hide-for-portrait { display: table-header-group !important; }
+ }
+ tbody {
+ &.show-for-landscape,
+ &.hide-for-portrait { display: table-row-group !important; }
+ }
+ tr {
+ &.show-for-landscape,
+ &.hide-for-portrait { display: table-row !important; }
+ }
+ td,
+ th {
+ &.show-for-landscape,
+ &.hide-for-portrait { display: table-cell !important; }
+ }
+ }
+
+ @media #{$portrait} {
+ .show-for-portrait,
+ .hide-for-landscape { display: inherit !important; }
+ .hide-for-portrait,
+ .show-for-landscape { display: none !important; }
+
+ /* Specific visibility for tables */
+ table {
+ &.show-for-portrait,
+ &.hide-for-landscape { display: table; }
+ }
+ thead {
+ &.show-for-portrait,
+ &.hide-for-landscape { display: table-header-group !important; }
+ }
+ tbody {
+ &.show-for-portrait,
+ &.hide-for-landscape { display: table-row-group !important; }
+ }
+ tr {
+ &.show-for-portrait,
+ &.hide-for-landscape { display: table-row !important; }
+ }
+ td,
+ th {
+ &.show-for-portrait,
+ &.hide-for-landscape { display: table-cell !important; }
+ }
+ }
+
+ /* Touch-enabled device targeting */
+ .show-for-touch { display: none !important; }
+ .hide-for-touch { display: inherit !important; }
+ .touch .show-for-touch { display: inherit !important; }
+ .touch .hide-for-touch { display: none !important; }
+
+ /* Specific visibility for tables */
+ table.hide-for-touch { display: table; }
+ .touch table.show-for-touch { display: table; }
+ thead.hide-for-touch { display: table-header-group !important; }
+ .touch thead.show-for-touch { display: table-header-group !important; }
+ tbody.hide-for-touch { display: table-row-group !important; }
+ .touch tbody.show-for-touch { display: table-row-group !important; }
+ tr.hide-for-touch { display: table-row !important; }
+ .touch tr.show-for-touch { display: table-row !important; }
+ td.hide-for-touch { display: table-cell !important; }
+ .touch td.show-for-touch { display: table-cell !important; }
+ th.hide-for-touch { display: table-cell !important; }
+ .touch th.show-for-touch { display: table-cell !important; }
+
+}
--- /dev/null
+/*! normalize.css v2.1.2 | MIT License | git.io/normalize */
+
+/* ==========================================================================
+ HTML5 display definitions
+ ========================================================================== */
+
+/**
+ * Correct `block` display not defined in IE 8/9.
+ */
+
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+main,
+nav,
+section,
+summary {
+ display: block;
+}
+
+/**
+ * Correct `inline-block` display not defined in IE 8/9.
+ */
+
+audio,
+canvas,
+video {
+ display: inline-block;
+}
+
+/**
+ * Prevent modern browsers from displaying `audio` without controls.
+ * Remove excess height in iOS 5 devices.
+ */
+
+audio:not([controls]) {
+ display: none;
+ height: 0;
+}
+
+/**
+ * Address `[hidden]` styling not present in IE 8/9.
+ * Hide the `template` element in IE, Safari, and Firefox < 22.
+ */
+
+[hidden],
+template {
+ display: none;
+}
+
+script {
+ display: none !important;
+}
+
+/* ==========================================================================
+ Base
+ ========================================================================== */
+
+/**
+ * 1. Set default font family to sans-serif.
+ * 2. Prevent iOS text size adjust after orientation change, without disabling
+ * user zoom.
+ */
+
+html {
+ font-family: sans-serif; /* 1 */
+ -ms-text-size-adjust: 100%; /* 2 */
+ -webkit-text-size-adjust: 100%; /* 2 */
+}
+
+/**
+ * Remove default margin.
+ */
+
+body {
+ margin: 0;
+}
+
+/* ==========================================================================
+ Links
+ ========================================================================== */
+
+/**
+ * Remove the gray background color from active links in IE 10.
+ */
+
+a {
+ background: transparent;
+}
+
+/**
+ * Address `outline` inconsistency between Chrome and other browsers.
+ */
+
+a:focus {
+ outline: thin dotted;
+}
+
+/**
+ * Improve readability when focused and also mouse hovered in all browsers.
+ */
+
+a:active,
+a:hover {
+ outline: 0;
+}
+
+/* ==========================================================================
+ Typography
+ ========================================================================== */
+
+/**
+ * Address variable `h1` font-size and margin within `section` and `article`
+ * contexts in Firefox 4+, Safari 5, and Chrome.
+ */
+
+h1 {
+ font-size: 2em;
+ margin: 0.67em 0;
+}
+
+/**
+ * Address styling not present in IE 8/9, Safari 5, and Chrome.
+ */
+
+abbr[title] {
+ border-bottom: 1px dotted;
+}
+
+/**
+ * Address style set to `bolder` in Firefox 4+, Safari 5, and Chrome.
+ */
+
+b,
+strong {
+ font-weight: bold;
+}
+
+/**
+ * Address styling not present in Safari 5 and Chrome.
+ */
+
+dfn {
+ font-style: italic;
+}
+
+/**
+ * Address differences between Firefox and other browsers.
+ */
+
+hr {
+ -moz-box-sizing: content-box;
+ box-sizing: content-box;
+ height: 0;
+}
+
+/**
+ * Address styling not present in IE 8/9.
+ */
+
+mark {
+ background: #ff0;
+ color: #000;
+}
+
+/**
+ * Correct font family set oddly in Safari 5 and Chrome.
+ */
+
+code,
+kbd,
+pre,
+samp {
+ font-family: monospace, serif;
+ font-size: 1em;
+}
+
+/**
+ * Improve readability of pre-formatted text in all browsers.
+ */
+
+pre {
+ white-space: pre-wrap;
+}
+
+/**
+ * Set consistent quote types.
+ */
+
+q {
+ quotes: "\201C" "\201D" "\2018" "\2019";
+}
+
+/**
+ * Address inconsistent and variable font size in all browsers.
+ */
+
+small {
+ font-size: 80%;
+}
+
+/**
+ * Prevent `sub` and `sup` affecting `line-height` in all browsers.
+ */
+
+sub,
+sup {
+ font-size: 75%;
+ line-height: 0;
+ position: relative;
+ vertical-align: baseline;
+}
+
+sup {
+ top: -0.5em;
+}
+
+sub {
+ bottom: -0.25em;
+}
+
+/* ==========================================================================
+ Embedded content
+ ========================================================================== */
+
+/**
+ * Remove border when inside `a` element in IE 8/9.
+ */
+
+img {
+ border: 0;
+}
+
+/**
+ * Correct overflow displayed oddly in IE 9.
+ */
+
+svg:not(:root) {
+ overflow: hidden;
+}
+
+/* ==========================================================================
+ Figures
+ ========================================================================== */
+
+/**
+ * Address margin not present in IE 8/9 and Safari 5.
+ */
+
+figure {
+ margin: 0;
+}
+
+/* ==========================================================================
+ Forms
+ ========================================================================== */
+
+/**
+ * Define consistent border, margin, and padding.
+ */
+
+fieldset {
+ border: 1px solid #c0c0c0;
+ margin: 0 2px;
+ padding: 0.35em 0.625em 0.75em;
+}
+
+/**
+ * 1. Correct `color` not being inherited in IE 8/9.
+ * 2. Remove padding so people aren't caught out if they zero out fieldsets.
+ */
+
+legend {
+ border: 0; /* 1 */
+ padding: 0; /* 2 */
+}
+
+/**
+ * 1. Correct font family not being inherited in all browsers.
+ * 2. Correct font size not being inherited in all browsers.
+ * 3. Address margins set differently in Firefox 4+, Safari 5, and Chrome.
+ */
+
+button,
+input,
+select,
+textarea {
+ font-family: inherit; /* 1 */
+ font-size: 100%; /* 2 */
+ margin: 0; /* 3 */
+}
+
+/**
+ * Address Firefox 4+ setting `line-height` on `input` using `!important` in
+ * the UA stylesheet.
+ */
+
+button,
+input {
+ line-height: normal;
+}
+
+/**
+ * Address inconsistent `text-transform` inheritance for `button` and `select`.
+ * All other form control elements do not inherit `text-transform` values.
+ * Correct `button` style inheritance in Chrome, Safari 5+, and IE 8+.
+ * Correct `select` style inheritance in Firefox 4+ and Opera.
+ */
+
+button,
+select {
+ text-transform: none;
+}
+
+/**
+ * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio`
+ * and `video` controls.
+ * 2. Correct inability to style clickable `input` types in iOS.
+ * 3. Improve usability and consistency of cursor style between image-type
+ * `input` and others.
+ */
+
+button,
+html input[type="button"], /* 1 */
+input[type="reset"],
+input[type="submit"] {
+ -webkit-appearance: button; /* 2 */
+ cursor: pointer; /* 3 */
+}
+
+/**
+ * Re-set default cursor for disabled elements.
+ */
+
+button[disabled],
+html input[disabled] {
+ cursor: default;
+}
+
+/**
+ * 1. Address box sizing set to `content-box` in IE 8/9.
+ * 2. Remove excess padding in IE 8/9.
+ */
+
+input[type="checkbox"],
+input[type="radio"] {
+ box-sizing: border-box; /* 1 */
+ padding: 0; /* 2 */
+}
+
+/**
+ * 1. Address `appearance` set to `searchfield` in Safari 5 and Chrome.
+ * 2. Address `box-sizing` set to `border-box` in Safari 5 and Chrome
+ * (include `-moz` to future-proof).
+ */
+
+input[type="search"] {
+ -webkit-appearance: textfield; /* 1 */
+ -moz-box-sizing: content-box;
+ -webkit-box-sizing: content-box; /* 2 */
+ box-sizing: content-box;
+}
+
+/**
+ * Remove inner padding and search cancel button in Safari 5 and Chrome
+ * on OS X.
+ */
+
+input[type="search"]::-webkit-search-cancel-button,
+input[type="search"]::-webkit-search-decoration {
+ -webkit-appearance: none;
+}
+
+/**
+ * Remove inner padding and border in Firefox 4+.
+ */
+
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+ border: 0;
+ padding: 0;
+}
+
+/**
+ * 1. Remove default vertical scrollbar in IE 8/9.
+ * 2. Improve readability and alignment in all browsers.
+ */
+
+textarea {
+ overflow: auto; /* 1 */
+ vertical-align: top; /* 2 */
+}
+
+/* ==========================================================================
+ Tables
+ ========================================================================== */
+
+/**
+ * Remove most spacing between table cells.
+ */
+
+table {
+ border-collapse: collapse;
+ border-spacing: 0;
+}
--- /dev/null
+ <div id="column" class="medium-2 columns sidebar">
+ <div id="nav">
+ <?php wp_nav_menu(array('ParrotsLanding' => 'header-menu'));?>
+ </div>
+ <div id="address" class="vcard">
+ <h2 class="fn org"><?php bloginfo('name');?></h2>
+ <div class="adr">
+ <div>
+ <p class="street-address">8110 W. Hazel Rd</p>
+ <p>
+ <span flexy:if="city" class="locality">Mears,</span>
+ <abbr class="region" title="Michigan">MI</abbr>
+ <span class="postal-code">49436</span>
+ </p>
+ <p class="tel">
+ <span class="type">Phone</span>:
+ <span class="value">231-873-8400</span>
+ </p>
+ </div>
+ <!--
+ <div>
+ <p class="post-office-box">Street Address 2</p>
+ <p>
+ <span class="locality">City 2,</span>
+ <abbr class="region" title="State">State Abbr</abbr>
+ <span class="postal-code">Zip</span>
+ </p>
+ </div>
+ -->
+
+
+ </div>
+ </div><!-- /#address -->
+ </div><!-- /#column -->
--- /dev/null
+/*
+Theme Name: parrotslanding
+Theme URI: www.gaslightmedia.com
+Author: Gaslight Media
+Author URI: www.gaslightmedia.com
+Description: Theme for www.parrotslanding.com.
+Version: 1.0
+License:
+License URI:
+Tags:
+Text Domain: parrotslanding
+
+*/
+
+/*body { text-align: center;
+ background: red;}
+#wrapper { display: block; border: 1px #a2a2a2 solid; width:90%; margin:0px auto; }
+#header { border: 2px #a2a2a2 solid; }
+#content { width: 75%; border: 2px #a2a2a2 solid; float: left; }
+#sidebar { width: 23%; border: 2px #a2a2a2 solid; float: right; }
+#delimiter { clear: both; }
+#footer { border: 2px #a2a2a2 solid; }
+.title { font-size: 11pt; font-family: verdana; font-weight: bold; }*/
+
+html, body, div, span, applet, object, iframe,
+h1, h2, h3, h4, h5, h6, p, blockquote, pre,
+a, abbr, acronym, address, big, cite, code,
+del, dfn, em, img, ins, kbd, q, s, samp,
+small, strike, strong, sub, sup, tt, var,
+b, u, i, center,
+dl, dt, dd, ol, ul, li,
+fieldset, form, label, legend,
+table, caption, tbody, tfoot, thead, tr, th, td,
+article, aside, canvas, details, embed,
+figure, figcaption, footer, header, hgroup,
+menu, nav, output, ruby, section, summary,
+time, mark, audio, video {
+/* margin: 0;*/
+ padding: 0;
+ border: 0;
+ font-style: inherit;
+ font-size: 100%;
+/* vertical-align: baseline;*/
+}
+
+a {
+ text-decoration: underline;
+}
+
+html {
+ margin-top: 0px !important;
+}
+
+p {
+ padding: 2px;
+ margin-bottom: 4px;
+}
+.row,
+.row .row {
+ max-width: 100%;
+}
+
+body {
+ margin: 0;
+ padding: 0;
+ text-align: center;
+ font-family: arial, sans-serif;
+ font-size: 13px;
+ line-height: 18px;
+ background: url(assets/bg.jpg) repeat-x #2f446b;
+}
+a:link {color: #51760c;}
+a:visited {color: #052c79;}
+a:hover {color: #000;}
+a:active {color: #51760c;}
+img {
+ border: 0;
+ display: block;
+ }
+/* Wrappers */
+#wrapper {
+ background-color: #f7941d;
+ max-width: 990px;
+ margin: 0px auto;
+ text-align: left;
+/* background-color: #f7941d;*/
+ }
+#wrapperInner {
+ margin: 0 auto;
+ height: 1%;
+ overflow: hidden;
+ padding-right: 20px;
+ width: 100%;
+/* background: url(assets/bg_wrapper.gif) repeat-y;*/
+ }
+ .imgGallery > div {
+ padding: 20px 0 0 0.9375rem;
+ }
+.imgRowWrap {
+ margin-left: 0px !important;
+ }
+.imgWrap {
+ padding: 0px 0px 20px 0px;
+ max-width: 100%;
+ }
+.imgWrap > img {
+ margin-left: auto;
+ margin-right: auto;
+ }
+/* Header Area */
+#top {
+ /*background:#000 url(assets/bg-top.gif) no-repeat right top;*/
+/* height: auto;*/
+ height: 176px;
+ width:100%;
+ position: relative;
+ display: block;
+ float: left;
+ }
+#logo {
+ position: absolute;
+ top:0px;
+ left: 0px;
+ }
+
+
+ #wpadminbar {
+ display:none;
+ }
+
+@media (max-width:640px) {
+ html {
+ margin: 0 !important;
+ }
+ #top {
+ padding: 0;
+/* background-image: url(assets/logo-small.gif);
+ background-size: cover;
+ overflow-y: hidden ! important;
+ overflow-x: hidden ! important;
+ background-color: #f8f8f8;
+ background-size: cover;
+ background-size: contain;
+ background-repeat: no-repeat;
+ background-position: right;
+ height:auto;*/
+ }
+ #logo {
+ float: none;
+ max-height: 100%;
+ max-width: 100%;
+ position: relative;
+ }
+
+ }
+ @media (min-width: 641px) {
+ .tab-bar{
+ display: none;
+ }
+ }
+/* Main Contant Area */
+#main {
+ max-width: 720px;
+ float: right;
+ position: relative;
+ /* background: url(assets/bgInner.jpg) no-repeat 0 bottom; */
+ padding: 0px 10px;
+ background: url(assets/bg_main.gif) no-repeat #fff;
+ margin-right: 3.3%;
+ margin-left: 3.3%;
+ }
+/* Column */
+#column {
+ max-width: 200px;
+ float: left;
+ position: static !important;
+ }
+
+.vcard {
+ padding: 0px;
+ border: none;
+ }
+/* Toolbox */
+#toolbox {
+ margin: 20px 15px;
+ }
+h1, h2 {
+ font-size: 18px;
+ margin: 10px 0 3px 0;
+ color: #052c79;
+ font-weight: bold;
+ }
+.imageright, .imageleft {
+ position: relative;
+ }
+.imageright {
+ float: right;
+ margin: 0 0 10px 10px;
+ }
+.imageleft {
+ float: left;
+ margin: 0 10px 10px 0;
+ }
+.imageright img, .imageleft img {
+ border-bottom: 1px solid #e66b23;
+ }
+.imagecaption {
+ }
+.listing {
+ clear: both;
+ }
+/* Main Nav */
+#nav {
+ margin: 5px 5px 30px 10px;
+ }
+/*#nav h2 {
+ background: url(assets/subnav-h-bg.gif) repeat-x left bottom;
+ padding: 5px 5px 10px 5px;
+ color: #fff;
+ margin: 0;
+ border-bottom: 1px solid white;
+ }*/
+#nav ul {
+ margin: 0;
+ padding: 0 3px 0 3px;
+ list-style-type: none;
+/* padding-left: 3px;*/
+ }
+#nav ul li {
+ margin: 0;
+ padding: 0;
+ /*border-left: 8px solid #b25a00;*/
+ background: #00b8ff;
+ max-width: 184px;
+ zoom: 1;
+ }
+#nav ul li a {
+ display: block;
+ padding: 3px 1px 3px 6px;
+ font-weight: bold;
+ text-decoration: none;
+ max-width: 177px;
+/*border-left: 1px solid yellow;
+ border-bottom: 1px solid #fe0001;
+ border-top: 1px solid #b25a00;*/
+
+ zoom: 1;
+ }
+
+#column h2 {
+ font-size: 14px;
+ margin: 0 0 0px 0;
+ color: #032c7e;
+}
+#column p {
+ margin: 0 0 0 0;
+ color: #032c7e;
+ font-weight: normal;
+}
+#address {
+ margin-left: 5px;
+ margin-right: 5px;
+/* text-align: center;*/
+}
+#address p {
+ line-height: 100%;
+}
+/* Hamburger/Mobile nav */
+nav.tab-bar {
+ background-color: rgba(90, 237, 86, 0.9); /* light green */
+}
+.left-off-canvas-toggle {
+ background-color: #00b8ff;
+/* border-radius: 10px;*/
+}
+.left-off-canvas-menu {
+/* background-color: #5aed56;*/
+/* background-color: rgba(0, 122, 174, 1.0);*/ /* */
+/* opacity: 0.4;*/
+}
+#menu-general {
+ width: 90%;
+}
+.menu-item {
+ background-color: #007aae;
+/* background-color: rgba(90, 237, 86, 0.9);
+ color: black !important;
+ border-radius: 4px;
+ padding: 4px;
+ margin: 3px;
+ width: 100%;
+ */
+/* opacity: 1.0;*/
+
+}
+ul.off-canvas-list li a {
+ color: black;
+}
+aside.left-off-canvas-menu {
+ background: transparent;
+/* background-color: rgba(255, 255, 255, 0.8);*/
+}
+aside.left-off-canvas-menu ul.off-canvas-list li {
+ display: block;
+ overflow: hidden;
+ position: relative;
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a {
+ font-family: "Arial";
+ font-size: 18px;
+ line-height: 20px;
+ color: black;
+ border-bottom: 1px solid #b1b3b6;
+ background-repeat: no-repeat;
+ background-position: 3px 50%;
+ padding-left: 55px;
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a:hover {
+ background-color: transparent;
+ color: rgba(90, 237, 86, 0.9);
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a.activities {
+ background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAC4AAAAbCAYAAAADDr0pAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNS1jMDIxIDc5LjE1NTc3MiwgMjAxNC8wMS8xMy0xOTo0NDowMCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCkiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6MDlDNkM4NzkxODIwMTFFNDgwMzVFRThCQ0UxMTZEODEiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6MDlDNkM4N0ExODIwMTFFNDgwMzVFRThCQ0UxMTZEODEiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDowOUM2Qzg3NzE4MjAxMUU0ODAzNUVFOEJDRTExNkQ4MSIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDowOUM2Qzg3ODE4MjAxMUU0ODAzNUVFOEJDRTExNkQ4MSIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/Pku/e/gAAAT3SURBVHjatJgJbBZVEMf5yllEPFrkilqlVhMlikK80BitTdFqqyEeERKSEgMeAYyJKMUWL+IJqAmHoKgxGol4I40tGjxAY6SKRi1KgEglHEFrKwKC/v7mv8m67rZfF76X/DO775iZN2/ezOxmuuWonbK6ZRpkJsjrYNomcN6Gi4f82VX+PbJUog+kT8JwG4L/iunvDjIJa/p5/OS0hslkobQ2tx0ckzBlJoo/0MXTqIHcD+5h7ew0imdj8QMgHxwEe8ARYBuQwG/AZynknmT6ZVqL53U2AYv8DRloVxkCdoEjwcuMrQLtKeT+Ynptzlwl5phXQy4CO8HWlHIHg+PAflDM5rfk5HKGlC6CjPZroXEoraf8HEzKqcVRXH49HTSBs8ACrDU5ZbjsZx8vSmP1vC4I6gWptouU2tfH05/W6gNA35DVD9/lRKkB4Fi/jrWwZ7GOlH7MEebOFNa+BPIFGOquavqKPdYdDHbuyN5VWFAGuQWUOQx2s5UP+ELpWDf6qDc52hTRtzNLpeXPT/p+1Zj3QvCxp5zv5KT2I1gGnojyzwsx7A80qR5UWun9VrjQIVGhcQLzMjBq4/mhbK2uRAae5nE+2AuugYfWrwL7fOlHW+mgBNAp3K2ozNrr/6c4nflWeKyTzIPgVNDbWBaar/pjnt/nOxnd1pGvM6asuxLcCjaDC1D6TfqViD4CvUIJaRBj+fb/MUDh92jwCvPHRy3+qIodx+VzWFgDmp18AgYSWGFr3A6TGxjXJh/uyOrMOw3yObjMSo5i3Xr6JftVKQo+AF+DEaDAiW8P0GZ1H+rM7hnWlfyruC/FJB9fBZO/i8ge56JoIWPvSmn3P8LanvbPWKvzrg2v9ZEvUTSCxw4P3wRGgo2gCtzlO3dvNHODWQoKPv37AotX268Uk5tijDbZvr7EjBZD1oHjwZURq7+Fsq+BO4BO4B2XB9OYNxHsC/ENks50+lttXdU917H2zBg9tLF2jxfmOXqoLY05Zl2W4fJxGG8PDS02LTd9PxQRVH88bvf7HVzB2rkRvv3tmq3abGiozlafFVMzKaq84fEyhaQS++1XCdZWU8SpC/WfYFrq/lK/q7x9Hcx1PTMFgfUxfIt92k2M7w0ptxJ+snoldATv6yLr1trFhvWw/7b4IkZboFCFEW3DQK2fd8s/xQehsliD3SnpQyLID9FW6whUbpcMt92mBVL8N8Vp3XKEHoxMrHJYjLYSx1dFgjlgKjjDltygyOR5uxIUDy5oQYxL1KPL5Y5E0RbM3yHFvwfnKkxFPwpgsgayJsb3p/ixkTlLedeGn5cwntc7kbTZbeLaFiedUczvHXYXy21IWHeh6Q/ys/ci/txZBtSaiX5dYUEvOEz1tW+3gKvo35bwcdLu2K35N2YpVzX81UDftw1SYpEv5zhHkc5a4BbNTteBMrUuDZQNT+T9w074BJFmNnIHZSH3KddFL8H714x3o2gww5elkoFPE3Zd7Y1qw+UJEaMrVWIj5FJHNOWErQkf6/Nc+Cm8Dmfe5kxocLmO10XVc47rzU5OI71wjPnNcIF0qP9eVLh94ujU6lNY7vLiKEc1/Z853UmwCrkr/lPW+kNhjn096ctIWXIqixcdxh9HcpMXQ6E3rv2sqhS5jR3V42dDbnYcHeoT+Am8rTqaxS05+vOl057gyDHQJ/CtK1PVSX+E5/8jwACLDdQh7t/iTwAAAABJRU5ErkJggg==');
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a.attractions {
+ background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAC4AAAAcCAYAAAAeC42RAAAACXBIWXMAAAsTAAALEwEAmpwYAAA5omlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS41LWMwMjEgNzkuMTU1NzcyLCAyMDE0LzAxLzEzLTE5OjQ0OjAwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnhtcE1NPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvbW0vIgogICAgICAgICAgICB4bWxuczpzdFJlZj0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL3NUeXBlL1Jlc291cmNlUmVmIyIKICAgICAgICAgICAgeG1sbnM6c3RFdnQ9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZUV2ZW50IyIKICAgICAgICAgICAgeG1sbnM6ZGM9Imh0dHA6Ly9wdXJsLm9yZy9kYy9lbGVtZW50cy8xLjEvIgogICAgICAgICAgICB4bWxuczpwaG90b3Nob3A9Imh0dHA6Ly9ucy5hZG9iZS5jb20vcGhvdG9zaG9wLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnRpZmY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vdGlmZi8xLjAvIgogICAgICAgICAgICB4bWxuczpleGlmPSJodHRwOi8vbnMuYWRvYmUuY29tL2V4aWYvMS4wLyI+CiAgICAgICAgIDx4bXA6Q3JlYXRvclRvb2w+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3htcDpDcmVhdG9yVG9vbD4KICAgICAgICAgPHhtcDpDcmVhdGVEYXRlPjIwMTQtMDgtMDlUMTU6MzE6MzUtMDQ6MDA8L3htcDpDcmVhdGVEYXRlPgogICAgICAgICA8eG1wOk1vZGlmeURhdGU+MjAxNC0wOC0xMFQyMzowODowMS0wNDowMDwveG1wOk1vZGlmeURhdGU+CiAgICAgICAgIDx4bXA6TWV0YWRhdGFEYXRlPjIwMTQtMDgtMTBUMjM6MDg6MDEtMDQ6MDA8L3htcDpNZXRhZGF0YURhdGU+CiAgICAgICAgIDx4bXBNTTpJbnN0YW5jZUlEPnhtcC5paWQ6NDE5NmE4NmQtNDE5Ni00MWEyLWFmODYtMGQ4MzQyOTA3ZjcxPC94bXBNTTpJbnN0YW5jZUlEPgogICAgICAgICA8eG1wTU06RG9jdW1lbnRJRD54bXAuZGlkOjA5QzZDODdFMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC94bXBNTTpEb2N1bWVudElEPgogICAgICAgICA8eG1wTU06RGVyaXZlZEZyb20gcmRmOnBhcnNlVHlwZT0iUmVzb3VyY2UiPgogICAgICAgICAgICA8c3RSZWY6aW5zdGFuY2VJRD54bXAuaWlkOjA5QzZDODdCMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjppbnN0YW5jZUlEPgogICAgICAgICAgICA8c3RSZWY6ZG9jdW1lbnRJRD54bXAuZGlkOjA5QzZDODdDMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjpkb2N1bWVudElEPgogICAgICAgICA8L3htcE1NOkRlcml2ZWRGcm9tPgogICAgICAgICA8eG1wTU06T3JpZ2luYWxEb2N1bWVudElEPnhtcC5kaWQ6MDlDNkM4N0UxODIwMTFFNDgwMzVFRThCQ0UxMTZEODE8L3htcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkhpc3Rvcnk+CiAgICAgICAgICAgIDxyZGY6U2VxPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjQxOTZhODZkLTQxOTYtNDFhMi1hZjg2LTBkODM0MjkwN2Y3MTwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNC0wOC0xMFQyMzowODowMS0wNDowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+NzIwMDAwLzEwMDAwPC90aWZmOlhSZXNvbHV0aW9uPgogICAgICAgICA8dGlmZjpZUmVzb2x1dGlvbj43MjAwMDAvMTAwMDA8L3RpZmY6WVJlc29sdXRpb24+CiAgICAgICAgIDx0aWZmOlJlc29sdXRpb25Vbml0PjI8L3RpZmY6UmVzb2x1dGlvblVuaXQ+CiAgICAgICAgIDxleGlmOkNvbG9yU3BhY2U+NjU1MzU8L2V4aWY6Q29sb3JTcGFjZT4KICAgICAgICAgPGV4aWY6UGl4ZWxYRGltZW5zaW9uPjQ2PC9leGlmOlBpeGVsWERpbWVuc2lvbj4KICAgICAgICAgPGV4aWY6UGl4ZWxZRGltZW5zaW9uPjI4PC9leGlmOlBpeGVsWURpbWVuc2lvbj4KICAgICAgPC9yZGY6RGVzY3JpcHRpb24+CiAgIDwvcmRmOlJERj4KPC94OnhtcG1ldGE+CiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgCjw/eHBhY2tldCBlbmQ9InciPz79zI+PAAAAIGNIUk0AAHolAACAgwAA+f8AAIDpAAB1MAAA6mAAADqYAAAXb5JfxUYAAALoSURBVHjazJhdSFRBFIC/LQnNsB/6wQmFlDEoNaSMXhyjsr8H6yGQoD8qqOhXpIcKoay3iChfKggEKYigHhIUIasRIvohwujBieyPaakXMTEscnsZ4bbotvfu7rUDywx7zzn3u3PPnDnnRmKxGKMSiURIl0htpwGzE6jEgKhRYjgZf15OgEgmwKW2O4ErQPY/VH8CzcBxo0TMD/gk0ixS22LgWhLQAFOABuCY3/ukHRzY5YD8SL3UNjLR4MsD2BQAJX4M/orxku4vB4B1ydgB08e5tgzIDQD/Cugf51pLb1V+i/ePrDiFhcCmNK7+A+AW8BjoA4ZcpikFaoAdgHC6SxL4eRhGqAA8BSqNEquMElcBC0igEphslOgySpwAFgBHgUG/N8jKAHSzyxRIbQ8Bu4GKuMzzDrgBXDBKXJbatgPtQPFEbc5LRokjLuR63ENUjKFXBDQCb6W2640SBqgGPgbdnPOBOSmA9wCLgW4gL0mbEWCLUeKu1HauJ+a9Eu2tyo8mCpVsYGUA4DdGiU6pbQ5wxwf06FtvldqWGSX6XKlQG6fzBEgIXgZcDABe58aDfuLUI7nAWWAb8A04F5dSzzj4tMb4MNDm5vtT8FMntZ1plPgOdIaxOXuMEkNSWxlwtb1vf7UnNDIO/sGTKVKVojifGQX/4capafCV7Qm/jIOPps9oGnx9deOsMMAXeXL4cIq+nruxNAzwAqntQqPEINCRgp/3wAs3XxPWkb/Hk29jAX2cNkrEpLZL3XkSCvg+qe08o8RL4HwA+w6g1c2bwiyy8lxzDHASuO7D9hFQZ5QYkdpuBTaGXR1ulto2GSV+GyX2uibhcwL9AeAUUGOUGJDarvDzwOmuxxultjOABqNEq9T2tut0aoBC10R/ctVjm1Gi39XntcBNIGciG4nDQLXUtt4o0QXcc7+xPmUUuoJq+//QAQGUA/eltq9dmfvMrfQv13OWAxuAtUEZMgWO5yApzYTjPwMAdYPVJOKDHZgAAAAASUVORK5CYII=');
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a.lodging {
+ background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAC4AAAAaCAYAAADIUm6MAAAACXBIWXMAAAsTAAALEwEAmpwYAAA5omlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS41LWMwMjEgNzkuMTU1NzcyLCAyMDE0LzAxLzEzLTE5OjQ0OjAwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnhtcE1NPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvbW0vIgogICAgICAgICAgICB4bWxuczpzdFJlZj0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL3NUeXBlL1Jlc291cmNlUmVmIyIKICAgICAgICAgICAgeG1sbnM6c3RFdnQ9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZUV2ZW50IyIKICAgICAgICAgICAgeG1sbnM6ZGM9Imh0dHA6Ly9wdXJsLm9yZy9kYy9lbGVtZW50cy8xLjEvIgogICAgICAgICAgICB4bWxuczpwaG90b3Nob3A9Imh0dHA6Ly9ucy5hZG9iZS5jb20vcGhvdG9zaG9wLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnRpZmY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vdGlmZi8xLjAvIgogICAgICAgICAgICB4bWxuczpleGlmPSJodHRwOi8vbnMuYWRvYmUuY29tL2V4aWYvMS4wLyI+CiAgICAgICAgIDx4bXA6Q3JlYXRvclRvb2w+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3htcDpDcmVhdG9yVG9vbD4KICAgICAgICAgPHhtcDpDcmVhdGVEYXRlPjIwMTQtMDgtMDlUMTU6MzQ6MDUtMDQ6MDA8L3htcDpDcmVhdGVEYXRlPgogICAgICAgICA8eG1wOk1vZGlmeURhdGU+MjAxNC0wOC0xMFQyMzowOToxMS0wNDowMDwveG1wOk1vZGlmeURhdGU+CiAgICAgICAgIDx4bXA6TWV0YWRhdGFEYXRlPjIwMTQtMDgtMTBUMjM6MDk6MTEtMDQ6MDA8L3htcDpNZXRhZGF0YURhdGU+CiAgICAgICAgIDx4bXBNTTpJbnN0YW5jZUlEPnhtcC5paWQ6ZTEyYmFiMWUtNDU3ZC00NTU4LTkxZjgtMzk4OTM3Nzc5MzA2PC94bXBNTTpJbnN0YW5jZUlEPgogICAgICAgICA8eG1wTU06RG9jdW1lbnRJRD54bXAuZGlkOjc2RTNENEI0MTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC94bXBNTTpEb2N1bWVudElEPgogICAgICAgICA8eG1wTU06RGVyaXZlZEZyb20gcmRmOnBhcnNlVHlwZT0iUmVzb3VyY2UiPgogICAgICAgICAgICA8c3RSZWY6aW5zdGFuY2VJRD54bXAuaWlkOjM5NTI4NzFBMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjppbnN0YW5jZUlEPgogICAgICAgICAgICA8c3RSZWY6ZG9jdW1lbnRJRD54bXAuZGlkOjc2RTNENEIyMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjpkb2N1bWVudElEPgogICAgICAgICA8L3htcE1NOkRlcml2ZWRGcm9tPgogICAgICAgICA8eG1wTU06T3JpZ2luYWxEb2N1bWVudElEPnhtcC5kaWQ6NzZFM0Q0QjQxODIwMTFFNDgwMzVFRThCQ0UxMTZEODE8L3htcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkhpc3Rvcnk+CiAgICAgICAgICAgIDxyZGY6U2VxPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOmUxMmJhYjFlLTQ1N2QtNDU1OC05MWY4LTM5ODkzNzc3OTMwNjwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNC0wOC0xMFQyMzowOToxMS0wNDowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+NzIwMDAwLzEwMDAwPC90aWZmOlhSZXNvbHV0aW9uPgogICAgICAgICA8dGlmZjpZUmVzb2x1dGlvbj43MjAwMDAvMTAwMDA8L3RpZmY6WVJlc29sdXRpb24+CiAgICAgICAgIDx0aWZmOlJlc29sdXRpb25Vbml0PjI8L3RpZmY6UmVzb2x1dGlvblVuaXQ+CiAgICAgICAgIDxleGlmOkNvbG9yU3BhY2U+NjU1MzU8L2V4aWY6Q29sb3JTcGFjZT4KICAgICAgICAgPGV4aWY6UGl4ZWxYRGltZW5zaW9uPjQ2PC9leGlmOlBpeGVsWERpbWVuc2lvbj4KICAgICAgICAgPGV4aWY6UGl4ZWxZRGltZW5zaW9uPjI2PC9leGlmOlBpeGVsWURpbWVuc2lvbj4KICAgICAgPC9yZGY6RGVzY3JpcHRpb24+CiAgIDwvcmRmOlJERj4KPC94OnhtcG1ldGE+CiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgCjw/eHBhY2tldCBlbmQ9InciPz6lLmGsAAAAIGNIUk0AAHolAACAgwAA+f8AAIDpAAB1MAAA6mAAADqYAAAXb5JfxUYAAAGLSURBVHja7NjPi05RHAfg52pCEgss3rPVfVmQku0cLFgoM/+ALFjZK7LzH8iCUhaysbOywO5OSkpJMtNcFqT7bqTxIzK9vBauent7mfvW8TaL+9nc2znnnvPc09l8TzYYDPwrWZaZJHlR7UQHm7GCt2UM3yeZYy0TZKngeVGdwgXsG+n6hge4VMbwcl3B86I6g5v4iLtYrsG7cAjH8BkHyxhep4DPSJOLeIcDZQwfxvzYcdzHOZxPsWDjHc+LahsOY8eYYdfwon7+LdexiKsj7T/xBo/KGPpJj0peVPO4he3+X5ZwsozhVRJ4d6HXxXNsGmr+gtn6PeBeQ1wPJ+r3PbgzBr9/ebbTT3HGz46g4UcZw7P6CK1MsKurQ9+N69+Lo3i41kQbGiy223STNxnUBD4zZfjGVPB1mRbewlt4C2/hLbyFt/A6X6ds+pQK/njK8CdJas7uQm8rnqI71Nwfqnq21FV8k/y5qlCXgUdG+m+XMZxOWXN2cAVzfl/0pM573MDlMobVJvBfAwC69YZPSvw2MgAAAABJRU5ErkJggg==');
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a.restaurants {
+ background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAC4AAAAcCAYAAAAeC42RAAAACXBIWXMAAAsTAAALEwEAmpwYAAA7XmlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS41LWMwMjEgNzkuMTU1NzcyLCAyMDE0LzAxLzEzLTE5OjQ0OjAwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnhtcE1NPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvbW0vIgogICAgICAgICAgICB4bWxuczpzdFJlZj0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL3NUeXBlL1Jlc291cmNlUmVmIyIKICAgICAgICAgICAgeG1sbnM6c3RFdnQ9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZUV2ZW50IyIKICAgICAgICAgICAgeG1sbnM6ZGM9Imh0dHA6Ly9wdXJsLm9yZy9kYy9lbGVtZW50cy8xLjEvIgogICAgICAgICAgICB4bWxuczpwaG90b3Nob3A9Imh0dHA6Ly9ucy5hZG9iZS5jb20vcGhvdG9zaG9wLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnRpZmY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vdGlmZi8xLjAvIgogICAgICAgICAgICB4bWxuczpleGlmPSJodHRwOi8vbnMuYWRvYmUuY29tL2V4aWYvMS4wLyI+CiAgICAgICAgIDx4bXA6Q3JlYXRvclRvb2w+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3htcDpDcmVhdG9yVG9vbD4KICAgICAgICAgPHhtcDpDcmVhdGVEYXRlPjIwMTQtMDgtMDlUMTU6MzI6MjEtMDQ6MDA8L3htcDpDcmVhdGVEYXRlPgogICAgICAgICA8eG1wOk1vZGlmeURhdGU+MjAxNC0wOC0xMFQyMzowNzo1MC0wNDowMDwveG1wOk1vZGlmeURhdGU+CiAgICAgICAgIDx4bXA6TWV0YWRhdGFEYXRlPjIwMTQtMDgtMTBUMjM6MDc6NTAtMDQ6MDA8L3htcDpNZXRhZGF0YURhdGU+CiAgICAgICAgIDx4bXBNTTpJbnN0YW5jZUlEPnhtcC5paWQ6OWEyNTg3NGEtOTNkYS00YzRhLWE5ZDYtNTc2NzdhYzExOTJjPC94bXBNTTpJbnN0YW5jZUlEPgogICAgICAgICA8eG1wTU06RG9jdW1lbnRJRD54bXAuZGlkOjM5NTI4NzExMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC94bXBNTTpEb2N1bWVudElEPgogICAgICAgICA8eG1wTU06RGVyaXZlZEZyb20gcmRmOnBhcnNlVHlwZT0iUmVzb3VyY2UiPgogICAgICAgICAgICA8c3RSZWY6aW5zdGFuY2VJRD54bXAuaWlkOjA5QzZDODdGMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjppbnN0YW5jZUlEPgogICAgICAgICAgICA8c3RSZWY6ZG9jdW1lbnRJRD54bXAuZGlkOjA5QzZDODgwMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjpkb2N1bWVudElEPgogICAgICAgICA8L3htcE1NOkRlcml2ZWRGcm9tPgogICAgICAgICA8eG1wTU06T3JpZ2luYWxEb2N1bWVudElEPnhtcC5kaWQ6Mzk1Mjg3MTExODIwMTFFNDgwMzVFRThCQ0UxMTZEODE8L3htcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkhpc3Rvcnk+CiAgICAgICAgICAgIDxyZGY6U2VxPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjdlMTRhNWQ2LTMzMjQtNDgwMS1iMDhiLTQ3NjY5NTkzMTg3OTwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNC0wOC0xMFQyMzowNTo1MS0wNDowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjlhMjU4NzRhLTkzZGEtNGM0YS1hOWQ2LTU3Njc3YWMxMTkyYzwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNC0wOC0xMFQyMzowNzo1MC0wNDowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+NzIwMDAwLzEwMDAwPC90aWZmOlhSZXNvbHV0aW9uPgogICAgICAgICA8dGlmZjpZUmVzb2x1dGlvbj43MjAwMDAvMTAwMDA8L3RpZmY6WVJlc29sdXRpb24+CiAgICAgICAgIDx0aWZmOlJlc29sdXRpb25Vbml0PjI8L3RpZmY6UmVzb2x1dGlvblVuaXQ+CiAgICAgICAgIDxleGlmOkNvbG9yU3BhY2U+NjU1MzU8L2V4aWY6Q29sb3JTcGFjZT4KICAgICAgICAgPGV4aWY6UGl4ZWxYRGltZW5zaW9uPjQ2PC9leGlmOlBpeGVsWERpbWVuc2lvbj4KICAgICAgICAgPGV4aWY6UGl4ZWxZRGltZW5zaW9uPjI4PC9leGlmOlBpeGVsWURpbWVuc2lvbj4KICAgICAgPC9yZGY6RGVzY3JpcHRpb24+CiAgIDwvcmRmOlJERj4KPC94OnhtcG1ldGE+CiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgCjw/eHBhY2tldCBlbmQ9InciPz5O6iGGAAAAIGNIUk0AAHolAACAgwAA+f8AAIDpAAB1MAAA6mAAADqYAAAXb5JfxUYAAAFpSURBVHja7Jc/S8QwGMZ/PY4DQT+AAXWQ6uIiTgpmFScR/ADOCoII7iJ4i4Oci6BfwEEHOVBcxJ6jIodj0EWs4p9FuinUpYVQatXeaSrkgUDzPO9LfkOSEicMQ36qgcZ9P/AMBMCQkqLpen4fECgpXvRa1/NngBrQCVSVFNU4y7N2rFLOvh1gFhgFziNvA5hPQE8Cu0A30AWsuZ6/TBuUF9yJRjkasVfSoCvAVsoaq67n95oC/46mgTTACjBXZPCpnNmvgztfzAezzrfr+U4r4OUWeheBx2g/HwESuNTyIKP3TUkRYuBWAegBRqLvCaAjkZ9k9B4WeY+vA1cp/hOwZAr84hM/vtNRUgTAGLCv5XVgWElxYwp8BThLeJtKirpuRPANzdpTUtwZ+wEpKV6VFOOadaqkWOAPVeKfyoJbcAtuwS24BbfgFtyCFxD8PX5DZr0vU+qNg9eAB2A7o+YAuAWugeN2gX8MAPm8V3R7JlSjAAAAAElFTkSuQmCC');
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a.shopping {
+ background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAC4AAAAcCAYAAAAeC42RAAAACXBIWXMAAAsTAAALEwEAmpwYAAA5omlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS41LWMwMjEgNzkuMTU1NzcyLCAyMDE0LzAxLzEzLTE5OjQ0OjAwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnhtcE1NPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvbW0vIgogICAgICAgICAgICB4bWxuczpzdFJlZj0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL3NUeXBlL1Jlc291cmNlUmVmIyIKICAgICAgICAgICAgeG1sbnM6c3RFdnQ9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZUV2ZW50IyIKICAgICAgICAgICAgeG1sbnM6ZGM9Imh0dHA6Ly9wdXJsLm9yZy9kYy9lbGVtZW50cy8xLjEvIgogICAgICAgICAgICB4bWxuczpwaG90b3Nob3A9Imh0dHA6Ly9ucy5hZG9iZS5jb20vcGhvdG9zaG9wLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnRpZmY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vdGlmZi8xLjAvIgogICAgICAgICAgICB4bWxuczpleGlmPSJodHRwOi8vbnMuYWRvYmUuY29tL2V4aWYvMS4wLyI+CiAgICAgICAgIDx4bXA6Q3JlYXRvclRvb2w+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3htcDpDcmVhdG9yVG9vbD4KICAgICAgICAgPHhtcDpDcmVhdGVEYXRlPjIwMTQtMDgtMDlUMTU6MzI6NTEtMDQ6MDA8L3htcDpDcmVhdGVEYXRlPgogICAgICAgICA8eG1wOk1vZGlmeURhdGU+MjAxNC0wOC0xMFQyMzowODoxNy0wNDowMDwveG1wOk1vZGlmeURhdGU+CiAgICAgICAgIDx4bXA6TWV0YWRhdGFEYXRlPjIwMTQtMDgtMTBUMjM6MDg6MTctMDQ6MDA8L3htcDpNZXRhZGF0YURhdGU+CiAgICAgICAgIDx4bXBNTTpJbnN0YW5jZUlEPnhtcC5paWQ6NjE0M2RkYjgtNTE3My00M2VhLWE1MzItZGUxOTIwNjg3MmU2PC94bXBNTTpJbnN0YW5jZUlEPgogICAgICAgICA8eG1wTU06RG9jdW1lbnRJRD54bXAuZGlkOjM5NTI4NzE1MTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC94bXBNTTpEb2N1bWVudElEPgogICAgICAgICA8eG1wTU06RGVyaXZlZEZyb20gcmRmOnBhcnNlVHlwZT0iUmVzb3VyY2UiPgogICAgICAgICAgICA8c3RSZWY6aW5zdGFuY2VJRD54bXAuaWlkOjM5NTI4NzEyMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjppbnN0YW5jZUlEPgogICAgICAgICAgICA8c3RSZWY6ZG9jdW1lbnRJRD54bXAuZGlkOjM5NTI4NzEzMTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjpkb2N1bWVudElEPgogICAgICAgICA8L3htcE1NOkRlcml2ZWRGcm9tPgogICAgICAgICA8eG1wTU06T3JpZ2luYWxEb2N1bWVudElEPnhtcC5kaWQ6Mzk1Mjg3MTUxODIwMTFFNDgwMzVFRThCQ0UxMTZEODE8L3htcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkhpc3Rvcnk+CiAgICAgICAgICAgIDxyZGY6U2VxPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOjYxNDNkZGI4LTUxNzMtNDNlYS1hNTMyLWRlMTkyMDY4NzJlNjwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNC0wOC0xMFQyMzowODoxNy0wNDowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+NzIwMDAwLzEwMDAwPC90aWZmOlhSZXNvbHV0aW9uPgogICAgICAgICA8dGlmZjpZUmVzb2x1dGlvbj43MjAwMDAvMTAwMDA8L3RpZmY6WVJlc29sdXRpb24+CiAgICAgICAgIDx0aWZmOlJlc29sdXRpb25Vbml0PjI8L3RpZmY6UmVzb2x1dGlvblVuaXQ+CiAgICAgICAgIDxleGlmOkNvbG9yU3BhY2U+NjU1MzU8L2V4aWY6Q29sb3JTcGFjZT4KICAgICAgICAgPGV4aWY6UGl4ZWxYRGltZW5zaW9uPjQ2PC9leGlmOlBpeGVsWERpbWVuc2lvbj4KICAgICAgICAgPGV4aWY6UGl4ZWxZRGltZW5zaW9uPjI4PC9leGlmOlBpeGVsWURpbWVuc2lvbj4KICAgICAgPC9yZGY6RGVzY3JpcHRpb24+CiAgIDwvcmRmOlJERj4KPC94OnhtcG1ldGE+CiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgCjw/eHBhY2tldCBlbmQ9InciPz4cNqK6AAAAIGNIUk0AAHolAACAgwAA+f8AAIDpAAB1MAAA6mAAADqYAAAXb5JfxUYAAAIPSURBVHja7JbPS1RRFMc/T0dJMpRM1Fu08hrWQqVVi7lEm0I3guBODMKVC7FNGxGj/oog2ljUOil3xpVq0w9BUJm7KALvUBn5I4iIYdocYRDf+Gac8QW+7+bw3jnv3g9fzj33Bfl8nqgKgiA0p61PAc3OqA3KVCksNVRA2voRIAt819Yva+svUWUFh3VcWz8MPJPHDeAMsA70OKN+SE09MAqcA+adUW//B8enJI4B7cAccBa4K9B1wEvgATANvNHWzxx200qAt0ucc0blgHEgB9zS1p8GJoBrwGfgPvAbmNbWd8YNPi/xoba+wRn1BXgOnACGgEnJjwIzQAYIgNa4we9IT/cDr7X1F4HHkrsHKOAj8B54AvQADngXK7gzKgukgTWgD1gCrku6TeI3AR+WAzzkjPp7pFNFW99dAFSoRnG4t8gSv4Db4vherWbSHV+rAt61mG2VeV1bhdH8IZPuuBy1OFXi4icFehtYKFJ3XtpmV6+ArZDaOjkfLaWApMp055MzarDITXoTeFTwatIZtRRS2wz8jGOqxKJyHW/Q1vce0CqFuqCtD6s9dZTgXTKbo+pp3I5ngRfADaDGGRVE7PG+/XpcW39VDvk2MFu1HndG/XFGDQA7FTZwwRk1dSwOZwKegCfgCXgCfjx/snav7M2QVP2e50Vtfa6S+5f74QpwBWiKWN94QH65VIB/AwCbvJllu+glOgAAAABJRU5ErkJggg==');
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a.calendar {
+ background-image: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAC4AAAAbCAYAAAADDr0pAAAACXBIWXMAAAsTAAALEwEAmpwYAAA5omlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS41LWMwMjEgNzkuMTU1NzcyLCAyMDE0LzAxLzEzLTE5OjQ0OjAwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnhtcE1NPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvbW0vIgogICAgICAgICAgICB4bWxuczpzdFJlZj0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL3NUeXBlL1Jlc291cmNlUmVmIyIKICAgICAgICAgICAgeG1sbnM6c3RFdnQ9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZUV2ZW50IyIKICAgICAgICAgICAgeG1sbnM6ZGM9Imh0dHA6Ly9wdXJsLm9yZy9kYy9lbGVtZW50cy8xLjEvIgogICAgICAgICAgICB4bWxuczpwaG90b3Nob3A9Imh0dHA6Ly9ucy5hZG9iZS5jb20vcGhvdG9zaG9wLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnRpZmY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vdGlmZi8xLjAvIgogICAgICAgICAgICB4bWxuczpleGlmPSJodHRwOi8vbnMuYWRvYmUuY29tL2V4aWYvMS4wLyI+CiAgICAgICAgIDx4bXA6Q3JlYXRvclRvb2w+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3htcDpDcmVhdG9yVG9vbD4KICAgICAgICAgPHhtcDpDcmVhdGVEYXRlPjIwMTQtMDgtMDlUMTU6MzM6MjMtMDQ6MDA8L3htcDpDcmVhdGVEYXRlPgogICAgICAgICA8eG1wOk1vZGlmeURhdGU+MjAxNC0wOC0xMFQyMzowODo1NC0wNDowMDwveG1wOk1vZGlmeURhdGU+CiAgICAgICAgIDx4bXA6TWV0YWRhdGFEYXRlPjIwMTQtMDgtMTBUMjM6MDg6NTQtMDQ6MDA8L3htcDpNZXRhZGF0YURhdGU+CiAgICAgICAgIDx4bXBNTTpJbnN0YW5jZUlEPnhtcC5paWQ6ZDA3YWNmZjQtOGUxMy00NGE2LTkyZGItZGIzOTc1OTkyZDZiPC94bXBNTTpJbnN0YW5jZUlEPgogICAgICAgICA8eG1wTU06RG9jdW1lbnRJRD54bXAuZGlkOjM5NTI4NzE5MTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC94bXBNTTpEb2N1bWVudElEPgogICAgICAgICA8eG1wTU06RGVyaXZlZEZyb20gcmRmOnBhcnNlVHlwZT0iUmVzb3VyY2UiPgogICAgICAgICAgICA8c3RSZWY6aW5zdGFuY2VJRD54bXAuaWlkOjM5NTI4NzE2MTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjppbnN0YW5jZUlEPgogICAgICAgICAgICA8c3RSZWY6ZG9jdW1lbnRJRD54bXAuZGlkOjM5NTI4NzE3MTgyMDExRTQ4MDM1RUU4QkNFMTE2RDgxPC9zdFJlZjpkb2N1bWVudElEPgogICAgICAgICA8L3htcE1NOkRlcml2ZWRGcm9tPgogICAgICAgICA8eG1wTU06T3JpZ2luYWxEb2N1bWVudElEPnhtcC5kaWQ6Mzk1Mjg3MTkxODIwMTFFNDgwMzVFRThCQ0UxMTZEODE8L3htcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkhpc3Rvcnk+CiAgICAgICAgICAgIDxyZGY6U2VxPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOmQwN2FjZmY0LThlMTMtNDRhNi05MmRiLWRiMzk3NTk5MmQ2Yjwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNC0wOC0xMFQyMzowODo1NC0wNDowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHRpZmY6T3JpZW50YXRpb24+MTwvdGlmZjpPcmllbnRhdGlvbj4KICAgICAgICAgPHRpZmY6WFJlc29sdXRpb24+NzIwMDAwLzEwMDAwPC90aWZmOlhSZXNvbHV0aW9uPgogICAgICAgICA8dGlmZjpZUmVzb2x1dGlvbj43MjAwMDAvMTAwMDA8L3RpZmY6WVJlc29sdXRpb24+CiAgICAgICAgIDx0aWZmOlJlc29sdXRpb25Vbml0PjI8L3RpZmY6UmVzb2x1dGlvblVuaXQ+CiAgICAgICAgIDxleGlmOkNvbG9yU3BhY2U+NjU1MzU8L2V4aWY6Q29sb3JTcGFjZT4KICAgICAgICAgPGV4aWY6UGl4ZWxYRGltZW5zaW9uPjQ2PC9leGlmOlBpeGVsWERpbWVuc2lvbj4KICAgICAgICAgPGV4aWY6UGl4ZWxZRGltZW5zaW9uPjI3PC9leGlmOlBpeGVsWURpbWVuc2lvbj4KICAgICAgPC9yZGY6RGVzY3JpcHRpb24+CiAgIDwvcmRmOlJERj4KPC94OnhtcG1ldGE+CiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgCjw/eHBhY2tldCBlbmQ9InciPz5TPuc5AAAAIGNIUk0AAHolAACAgwAA+f8AAIDpAAB1MAAA6mAAADqYAAAXb5JfxUYAAAKASURBVHja7Jc/aBRBFMZ/a+KR42JIISE3gpjgRMHCYCEK3pgoWkQUBTFWVknpnzIWtoJYRdEqlY2KgghiZ+FEO0EFkeRGSQwyHsYikVPEU5NmFoZwt7smuxEhr5l333sz9/Hmm5m3wcLCAnEWBEHDmNS2FbgMTBglbkbktQBXgPdGiWuN8pLwAVjHyu0YcBa4IbUtROQdBc4Bo1LbjpX+afPfJEttNwOngE1AuA3GS+mT2h5qMP2D5/dLbfc6vwZMAreNEt9SJy61HQDuA/kloRHP3wWcb7DEJc/fUSfvotS2H5hJjbjUNg/cqkMaoA14DkwAhyOWKQDjwDSwp068GxgFTiThFCQ5DD3jnw4ATyJSxoFOQMYs9QzYCGxvEK+VS8VcmlJpi4mXEq6zLya+Pql007hV/on9t8SblzFn2mn6T0oc8sARd3gzI/4b2G2UmE2zelLbQeBOlsSrRolZqe0GV3UAa5QYkNoK4HEENmmUGJTabgPuOuyFUWLIPUCZSwWgCdjp/HY35mIwXxohNrd2OBPaV6DL+b/c+DEG++nGtx72Y7WJNwG9zv/uCOZisHnAOqmE2BegsprEC8ADr+vbAnTEYK8d4S4Pewr0rWk8gdWAh87/7MkjCpvyJBNib5ZLPGl3eNxt77xRoj3t6klte4GXAOVSMcis4u4785H7WTFKnJbadnqvXz3snVFiSGq7FRhz2CujxIXVlEozsH/JJ1lLDBbuVKuHrXWHUc0VQE5qGwBVoH/JI1KJwaqhZDxszrteMzmcPV4jdNVrnNIq3ghwEJgql4rdqREPggCp7T3gZMYKGC6XimNpa/wMcN3dw2nbDDBslBhLOmFxAKXKx9ASM3P1AAAAAElFTkSuQmCC');
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a.home {
+ padding-left: 10px;
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a.toggle {
+ background: url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACgAAABUCAYAAADwHnXXAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNS1jMDIxIDc5LjE1NTc3MiwgMjAxNC8wMS8xMy0xOTo0NDowMCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCkiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6NEIxREJCRjkxOTc3MTFFNEExMUU4NDJENjA5NTYyNEEiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6NEIxREJCRkExOTc3MTFFNEExMUU4NDJENjA5NTYyNEEiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDo0QjFEQkJGNzE5NzcxMUU0QTExRTg0MkQ2MDk1NjI0QSIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDo0QjFEQkJGODE5NzcxMUU0QTExRTg0MkQ2MDk1NjI0QSIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PmLH3EUAAAKASURBVHja7FpNKERRFH7jJ7KQkiKllGRBSRY2ViR2io2yUpSUhiLJb4QQg7KwsLJQNnZKysJWslB+RokSJdEkURjfae5imsa8d9+777lyTn3d3pt77/veOe+cc++54wuHw4bOkmRoLkyQCTLBv04wxekExQd3jsZfVOf9Aw1CSzto6iXmDQGfJn32gSZVJu4BaiX6Z5r8/gGMKnMSfCdnaFYVWm4NOFHtxWPAowJyNMeI8jADLT7JTJxAhmVeNMkt0/wgx2IOdwI1tPghHMaO0MKz24J3O4uDILmHZtsGwU3gwKtU1w+8S/R/BQY8y8XQYhDNssSQGeDG68XCJHBvod8VMOf5agZaDImQYSa9wNtvLbfWgaMEv+/adCg1BKHFLzT+BPnWr8OClULHVpz7lLtPdVlR98V8Zw9WVyteEbyO8dRB4Fm3PckscAscCufRY08SJS8iW1wCXzoSJNlQvSfxcXWLCTJBJsgEmSATZIJMkAkyQSb4i8InTbqZuApo1crEMS+7ApDNtsVGXisNtgGVQL4RqWFrZeIsYCrqmqpdBToRpFJbTtR1OjCvC8ESoCvO/WagWgeCS0BqnPs+IOD0GY4GI0g3oqlL0KVCOI/3BEGOvrMFC10nDPMDblc0SJ5aaKFfLjBk9yG26oPQHoUQquBnWBxC53plQNCrXDwtQY4kzYjUsN03MbRHoaPFxrPIoWpcJQhyyUbklNNnU/MB2fwvq8EOoNyBY5UC7a44CbSXjeYcyHYY2OkPFUWGOOhR6SQTCsgZYo5xpSaG9kqFeVVJp8jhyhas9MYhkz7JEhmDcvci0OBKoOZNk0oNcmWBCTJBJsgEmaDe8i3AAABaiPID+002AAAAAElFTkSuQmCC');
+ background-repeat: no-repeat;
+ background-position: 50% 3px;
+ width: 40px;
+ height: 100%;
+ position: absolute;
+ right: 0;
+ top: 0;
+ transition: none;
+}
+aside.left-off-canvas-menu ul.off-canvas-list li a.toggle.open {
+ background-position: 50% -40px;
+}
+aside.left-off-canvas-menu ul.off-canvas-list li > ul {
+ display: none;
+}
+aside.left-off-canvas-menu ul.off-canvas-list li > ul li > a {
+ padding-left: 10px;
+ margin-left: 25px;
+ font-size: 16px;
+ line-height: 18px;
+}
+aside.left-off-canvas-menu ul.off-canvas-list li > ul.open {
+ display: block;
+}
+
+/* Navigation link colors and backgrounds */
+#nav ul a:link {color: #032c7e;
+}
+#nav ul a:visited {color: #032c7e;}
+#nav ul a:hover {color: #032c7e; background: #fffb00;}
+#nav ul a:active {color: #032c7e;}
+a#current {
+ color: #E8D092 !important;
+ }
+ul ul a#current {
+ color: #BF7723 !important;
+ }
+.current-menu-item > a,
+.current-menu-ancestor > a,
+.current_page_item > a,
+.current_page_ancestor > a {
+ color: #E8D092 !important;
+ font-weight: bold;
+}
+#toolbox li {
+ padding-left: 10px;
+ list-style-position: inside;
+}
+#toolbox ul {
+/* padding-left: 20px;*/
+ }
+/* End of each page */
+#wildbillfooter {
+ text-align: center;
+ font-size: 16px;
+ line-height: 18px;
+ margin: 13px 0 18px 0;
+}
+/* Copyright */
+#copyright {
+ clear: both;
+ padding: 10px;
+ text-align: center;
+ background: #007aae;
+ position: relative;
+ font-size: 11px;
+ /*border-left: 20px solid #007aae;*/
+ }
+/* Image Upload Icons */
+.file-download, .download {
+ background-repeat: no-repeat;
+ background-position: left;
+ padding: 1px 2px;
+ padding-left: 18px;
+ position: relative;
+ margin-right: 10px;
+ margin-bottom: 5px;
+ display: block;
+ float: left;
+ clear: left;
+}
+.avi { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/avi.gif);}
+.doc { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/doc.gif);}
+.gif { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/gif.gif);}
+.html { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/html.gif);}
+.jpg { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/jpg.gif);}
+.mov { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/mov.gif);}
+.mp3 { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/mp3.gif);}
+.pdf { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/pdf.png);}
+.ppt { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/ppt.gif);}
+.txt { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/txt.png);}
+.wmv { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/wmv.gif);}
+.xls { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/xls.gif);}
+.zip { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/zip.png);}
+.download {
+ background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/download.gif);
+ clear: none;
+ background-repeat: no-repeat;
+}
+/*.wpcf7 .wpcf7-form-control { max-width: 100%; }*/
+.wpcf7-form {
+ margin-top: 40px;
+}
+
+.wpcf7-form div {
+ padding-left: 10px;
+ padding-right: 10px;
+}
+.wpcf7-textarea {
+ min-height: 100px;
+}
+#column {
+ background-color: #5aed56;
+ margin-left: 5px;
+ padding-left: 0px;
+ padding-right: 0px;
+}
+
+#nav {
+ margin-left: 0px;
+ margin-right: 0px;
+}
+
+#wrapper {
+ margin-bottom: 30px;
+}
+
+#wrapperInner {
+ background-color: #007aae;
+ padding: 0px;
+}
+
+html, body {
+/* font-size: 13px;*/
+}
+
+@media (max-width: 640px) {
+ #column {
+ display: none;
+ width: 0;
+ }
+ #main {
+ margin: 0px;
+ }
+}
+@media (max-width: 480px) {
+ #top {
+ height: 140px;
+ }
+}
+@media (max-width: 360px) {
+ #top {
+ height: 100px;
+ }
+}
+
+.glmform-half {
+ max-width: 45% !important;
+}
+
+.breadcrumbs {
+ margin-bottom: 20px;
+}
+
+/* Yahoo + Yelp map */
+.yuiMap {
+/* width: 100%;*/
+ min-height: 475px;
+ height: auto;
+}
+
+#myc-map {
+ width: 100%;
+}
\ No newline at end of file
--- /dev/null
+body {
+ margin: 0;
+ padding: 0;
+ text-align: center;
+ font-family: arial, sans-serif;
+ font-size: 13px;
+ line-height: 18px;
+ background: url(assets/bg.jpg) repeat-x #2f446b;
+}
+a:link {color: #51760c;}
+a:visited {color: #052c79;}
+a:hover {color: #000;}
+a:active {color: #51760c;}
+img {
+ border: 0;
+ display: block;
+ }
+/* Wrappers */
+#wrapper {
+ width: 990px;
+ margin: 0px auto;
+ text-align: left;
+ background-color: #f7941d;
+ }
+#wrapperInner {
+ margin: 0 auto;
+ height: 1%;
+ overflow: hidden;
+ padding-right: 20px;
+ background: url(assets/bg_wrapper.gif) repeat-y;
+ }
+/* Header Area */
+#top {
+ /*background:#000 url(assets/bg-top.gif) no-repeat right top;*/
+ height: 175px;
+ position: relative;
+ }
+#logo {
+ position: absolute;
+ top:0px;
+ left: 0px;
+ }
+/* Main Contant Area */
+#main {
+ width: 720px;
+ float: right;
+ position: relative;
+ /* background: url(assets/bgInner.jpg) no-repeat 0 bottom; */
+ padding: 0px 10px;
+ background: url(assets/bg_main.gif) no-repeat #fff;
+ }
+/* Column */
+#column {
+ width: 200px;
+ float: left;
+ position: relative;
+ }
+/* Toolbox */
+#toolbox {
+ margin: 20px 15px;
+ }
+h1, h2 {
+ font-size: 18px;
+ margin: 0 0 3px 0;
+ color: #052c79;
+ }
+.imageright, .imageleft {
+ position: relative;
+ }
+.imageright {
+ float: right;
+ margin: 0 0 10px 10px;
+ }
+.imageleft {
+ float: left;
+ margin: 0 10px 10px 0;
+ }
+.imageright img, .imageleft img {
+ border-bottom: 1px solid #e66b23;
+ }
+.imagecaption {
+ }
+.listing {
+ clear: both;
+ }
+/* Main Nav */
+#nav {
+ margin: 5px 5px 30px 10px;
+ }
+/*#nav h2 {
+ background: url(assets/subnav-h-bg.gif) repeat-x left bottom;
+ padding: 5px 5px 10px 5px;
+ color: #fff;
+ margin: 0;
+ border-bottom: 1px solid white;
+ }*/
+#nav ul {
+ margin: 0;
+ padding: 0;
+ list-style-type: none;
+ padding-left: 3px;
+ }
+#nav ul li {
+ margin: 0;
+ padding: 0;
+ /*border-left: 8px solid #b25a00;*/
+ background: #00b8ff;
+ width: 184px;
+ zoom: 1;
+ }
+#nav ul li a {
+ display: block;
+ padding: 3px 1px 3px 6px;
+ font-weight: bold;
+ text-decoration: none;
+ width: 177px;
+/*border-left: 1px solid yellow;
+ border-bottom: 1px solid #fe0001;
+ border-top: 1px solid #b25a00;*/
+
+ zoom: 1;
+ }
+
+#column h2 {font-size: 14px; margin: 5px 0 0px 15px; color: #032c7e;}
+#column p {margin: 0 0 0 15px; color: #032c7e; font-weight: normal;}
+/* Navigation link colors and backgrounds */
+#nav ul a:link {color: #032c7e;
+}
+#nav ul a:visited {color: #032c7e;}
+#nav ul a:hover {color: #032c7e; background: #fffb00;}
+#nav ul a:active {color: #032c7e;}
+a#current {
+ color: #E8D092 !important;
+ }
+ul ul a#current {
+ color: #BF7723 !important;
+ }
+/* Copyright */
+#copyright {
+ clear: both;
+ padding: 10px;
+ text-align: center;
+ background: #007aae;
+ position: relative;
+ font-size: 11px;
+ /*border-left: 20px solid #007aae;*/
+ }
+/* Image Upload Icons */
+.file-download, .download {
+ background-repeat: no-repeat;
+ background-position: left;
+ padding: 1px 2px;
+ padding-left: 18px;
+ position: relative;
+ margin-right: 10px;
+ margin-bottom: 5px;
+ display: block;
+ float: left;
+ clear: left;
+}
+.avi { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/avi.gif);}
+.doc { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/doc.gif);}
+.gif { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/gif.gif);}
+.html { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/html.gif);}
+.jpg { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/jpg.gif);}
+.mov { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/mov.gif);}
+.mp3 { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/mp3.gif);}
+.pdf { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/pdf.png);}
+.ppt { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/ppt.gif);}
+.txt { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/txt.png);}
+.wmv { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/wmv.gif);}
+.xls { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/xls.gif);}
+.zip { background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/zip.png);}
+.download {
+ background-image: url(http://app.gaslightmedia.com/QuickSite/images/file-ext/download.gif);
+ clear: none;
+ background-repeat: no-repeat;
+}
--- /dev/null
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01//EN"
+"http://www.w3.org/TR/html4/strict.dtd">
+<html>
+<head>
+<title>{title:h}</title>
+<meta http-equiv="content-type" content="text/html;charset=utf-8">
+<meta name="description" content="{metaTags:h}">
+<meta http-equiv="imagetoolbar" content="no">
+<meta http-equiv="imagetoolbar" content="false">
+{styles:h}
+{topScripts:h}
+{if:googleAnalyticsCode}
+{googleAnalyticsCode:h}
+{end:}
+</head>
+<body>
+<div id="wrapper">
+ <div id="wrapperInner">
+ <div id="top">
+ <a href="baseurl/index.php">
+ <img id="logo" src="{logoImage:h}">
+ </a>
+ </div><!-- /#top -->
+ <div id="column">
+ <div id="nav">
+ {sideNav:h}
+ </div>
+ {socialMedia:h}
+ <div id="address" class="vcard">
+ <h2 flexy:if="businessName" class="fn org">{businessName:h}</h2>
+ <div class="adr">
+ <div>
+ <p flexy:if="streetAddress" class="street-address">{streetAddress:h}</p>
+ <p>
+ <span flexy:if="city" class="locality">{city:h},</span>
+ <abbr class="region" title="{state:h}">{stateAbbr:h}</abbr>
+ <span class="postal-code">{zipCode:h}</span>
+ </p>
+ </div>
+ <div flexy:if="streetAddress2">
+ <p flexy:if="streetAddress2" class="post-office-box">{streetAddress2:h}</p>
+ <p flexy:if="streetAddress2">
+ <span flexy:if="city2" class="locality">{city2:h},</span>
+ <abbr class="region" title="{state2:h}">{state2Abbr:h}</abbr>
+ <span class="postal-code">{zip2Code:h}</span>
+ </p>
+ </div>
+ <p flexy:if="phone" class="tel">
+ <span class="type">Phone</span>:
+ <span class="value">{phone:h}</span>
+ </p>
+ <p flexy:if="fax" class="tel">
+ <span class="type">Fax</span>:
+ <span class="value">{fax:h}</span>
+ </p>
+<div style="margin-left:10px;" flexy:if="MOBILE_SITE">
+<a href="{MOBILE_SITE_URL:h}">View Mobile Site</a>
+</div>
+
+ </div>
+ </div><!-- /#address -->
+ </div><!-- /#column -->
+ <div id="main">
+ <div id="toolbox">
+ {toolboxContent:h}
+ </div><!-- /#toolbox -->
+ </div><!-- /#main -->
+ <div id="copyright">
+ Copyright©<?php echo date('Y');?> {siteName:h} - Produced by <a href="http://www.gaslightmedia.com">Gaslight Media</a>, All Rights Reserved.
+ </div><!-- /#copyright -->
+ </div><!-- /#wrapperInner" -->
+</div><!-- /#wrapper -->
+{bottomScripts:h}
+</body>
+</html>
projects / WP-Themes / ParrotsLanding.git / commitdiff
